A simple but powerful molecule viewer for generating 3D models from simplified molecular-input line-entry system (SMILES) files. Implementation includes the ChEmbl API and Speck.
Create a plain text file containing a single line of SMILES, for example, for ciprofloxacin:
OC(=O)C1=CN(C2CC2)C2=CC(N3CCNCC3)=C(F)C=C2C1=O
Drop it onto the green dropzone on the page, and let MoleculeViewer do the rest of the work.
- MoleculeViewer only accepts plain text files, or files with the valid MIME type of
chemical/x-daylight-smiles. If in doubt, a plain text file generated from a typical text editor will work.