From 0d254488ba4bcb9daf2af26b8c0cdc929af7ba4f Mon Sep 17 00:00:00 2001 From: Vedant Singhania Date: Tue, 2 Jul 2024 12:46:00 -0700 Subject: [PATCH] upgrade to next --- .gitignore => old/.gitignore | 0 LICENSE.md => old/LICENSE.md | 0 README.md => old/README.md | 0 {client => old/client}/package-lock.json | 0 {client => old/client}/package.json | 0 .../public/Tunestats_Privacy_Policy.pdf | Bin {client => old/client}/public/favicon.ico | Bin .../public/google5c484243c5870197.html | 0 {client => old/client}/public/index.html | 0 {client => old/client}/public/logo192.png | Bin {client => old/client}/public/logo512.png | Bin {client => old/client}/public/manifest.json | 0 {client => old/client}/public/robots.txt | 0 {client => old/client}/public/sitemap.xml | 0 .../client}/public/spotify_logo.png | Bin {client => old/client}/src/App.js | 0 {client => old/client}/src/assets/demo.png | Bin {client => old/client}/src/assets/style.css | 0 .../client}/src/components/ArtistDisplay.js | 0 .../client}/src/components/Footer.js | 0 .../client}/src/components/Login.js | 0 .../client}/src/components/NavBar.js | 0 .../client}/src/components/SmallButton.js | 0 .../src/components/SmallButtonGroup.js | 0 .../client}/src/components/SongDisplay.js | 0 .../client}/src/components/Titles.js | 0 {client => old/client}/src/index.js | 0 deploy.sh => old/deploy.sh | 0 push.sh => old/push.sh | 0 {server => old/server}/index.js | 0 {server => old/server}/package-lock.json | 0 {server => old/server}/package.json | 0 .../workflows/codeql-analysis.yml | 0 tunestats/.eslintrc.json | 3 + tunestats/.gitignore | 36 + tunestats/README.md | 36 + tunestats/app/api/.env | 3 + tunestats/app/api/index.js | 152 + tunestats/app/api/node_modules/.bin/mime | 1 + tunestats/app/api/node_modules/.bin/nodemon | 1 + tunestats/app/api/node_modules/.bin/nodetouch | 1 + tunestats/app/api/node_modules/.bin/semver | 1 + .../app/api/node_modules/.bin/sshpk-conv | 1 + .../app/api/node_modules/.bin/sshpk-sign | 1 + .../app/api/node_modules/.bin/sshpk-verify | 1 + tunestats/app/api/node_modules/.bin/uuid | 1 + .../app/api/node_modules/.package-lock.json | 1433 +++ .../app/api/node_modules/accepts/HISTORY.md | 243 + .../app/api/node_modules/accepts/LICENSE | 23 + .../app/api/node_modules/accepts/README.md | 140 + .../app/api/node_modules/accepts/index.js | 238 + .../app/api/node_modules/accepts/package.json | 47 + .../api/node_modules/ajv/.tonic_example.js | 20 + tunestats/app/api/node_modules/ajv/LICENSE | 22 + tunestats/app/api/node_modules/ajv/README.md | 1497 +++ .../api/node_modules/ajv/dist/ajv.bundle.js | 7189 +++++++++++ .../app/api/node_modules/ajv/dist/ajv.min.js | 3 + .../api/node_modules/ajv/dist/ajv.min.js.map | 1 + .../app/api/node_modules/ajv/lib/ajv.d.ts | 397 + tunestats/app/api/node_modules/ajv/lib/ajv.js | 506 + .../app/api/node_modules/ajv/lib/cache.js | 26 + .../api/node_modules/ajv/lib/compile/async.js | 90 + .../api/node_modules/ajv/lib/compile/equal.js | 5 + .../ajv/lib/compile/error_classes.js | 34 + .../node_modules/ajv/lib/compile/formats.js | 142 + .../api/node_modules/ajv/lib/compile/index.js | 387 + .../node_modules/ajv/lib/compile/resolve.js | 270 + .../api/node_modules/ajv/lib/compile/rules.js | 66 + .../ajv/lib/compile/schema_obj.js | 9 + .../ajv/lib/compile/ucs2length.js | 20 + .../api/node_modules/ajv/lib/compile/util.js | 239 + .../app/api/node_modules/ajv/lib/data.js | 49 + .../node_modules/ajv/lib/definition_schema.js | 37 + .../api/node_modules/ajv/lib/dot/_limit.jst | 113 + .../node_modules/ajv/lib/dot/_limitItems.jst | 12 + .../node_modules/ajv/lib/dot/_limitLength.jst | 12 + .../ajv/lib/dot/_limitProperties.jst | 12 + .../api/node_modules/ajv/lib/dot/allOf.jst | 32 + .../api/node_modules/ajv/lib/dot/anyOf.jst | 46 + .../api/node_modules/ajv/lib/dot/coerce.def | 51 + .../api/node_modules/ajv/lib/dot/comment.jst | 9 + .../api/node_modules/ajv/lib/dot/const.jst | 11 + .../api/node_modules/ajv/lib/dot/contains.jst | 55 + .../api/node_modules/ajv/lib/dot/custom.jst | 191 + .../api/node_modules/ajv/lib/dot/defaults.def | 47 + .../node_modules/ajv/lib/dot/definitions.def | 203 + .../node_modules/ajv/lib/dot/dependencies.jst | 79 + .../app/api/node_modules/ajv/lib/dot/enum.jst | 30 + .../api/node_modules/ajv/lib/dot/errors.def | 194 + .../api/node_modules/ajv/lib/dot/format.jst | 106 + .../app/api/node_modules/ajv/lib/dot/if.jst | 73 + .../api/node_modules/ajv/lib/dot/items.jst | 98 + .../api/node_modules/ajv/lib/dot/missing.def | 39 + .../node_modules/ajv/lib/dot/multipleOf.jst | 22 + .../app/api/node_modules/ajv/lib/dot/not.jst | 43 + .../api/node_modules/ajv/lib/dot/oneOf.jst | 54 + .../api/node_modules/ajv/lib/dot/pattern.jst | 14 + .../node_modules/ajv/lib/dot/properties.jst | 245 + .../ajv/lib/dot/propertyNames.jst | 52 + .../app/api/node_modules/ajv/lib/dot/ref.jst | 85 + .../api/node_modules/ajv/lib/dot/required.jst | 108 + .../node_modules/ajv/lib/dot/uniqueItems.jst | 62 + .../api/node_modules/ajv/lib/dot/validate.jst | 276 + .../api/node_modules/ajv/lib/dotjs/README.md | 3 + .../api/node_modules/ajv/lib/dotjs/_limit.js | 163 + .../node_modules/ajv/lib/dotjs/_limitItems.js | 80 + .../ajv/lib/dotjs/_limitLength.js | 85 + .../ajv/lib/dotjs/_limitProperties.js | 80 + .../api/node_modules/ajv/lib/dotjs/allOf.js | 42 + .../api/node_modules/ajv/lib/dotjs/anyOf.js | 73 + .../api/node_modules/ajv/lib/dotjs/comment.js | 14 + .../api/node_modules/ajv/lib/dotjs/const.js | 56 + .../node_modules/ajv/lib/dotjs/contains.js | 81 + .../api/node_modules/ajv/lib/dotjs/custom.js | 228 + .../ajv/lib/dotjs/dependencies.js | 168 + .../api/node_modules/ajv/lib/dotjs/enum.js | 66 + .../api/node_modules/ajv/lib/dotjs/format.js | 150 + .../app/api/node_modules/ajv/lib/dotjs/if.js | 103 + .../api/node_modules/ajv/lib/dotjs/index.js | 33 + .../api/node_modules/ajv/lib/dotjs/items.js | 140 + .../node_modules/ajv/lib/dotjs/multipleOf.js | 80 + .../app/api/node_modules/ajv/lib/dotjs/not.js | 84 + .../api/node_modules/ajv/lib/dotjs/oneOf.js | 73 + .../api/node_modules/ajv/lib/dotjs/pattern.js | 75 + .../node_modules/ajv/lib/dotjs/properties.js | 335 + .../ajv/lib/dotjs/propertyNames.js | 81 + .../app/api/node_modules/ajv/lib/dotjs/ref.js | 124 + .../node_modules/ajv/lib/dotjs/required.js | 270 + .../node_modules/ajv/lib/dotjs/uniqueItems.js | 86 + .../node_modules/ajv/lib/dotjs/validate.js | 482 + .../app/api/node_modules/ajv/lib/keyword.js | 146 + .../api/node_modules/ajv/lib/refs/data.json | 17 + .../ajv/lib/refs/json-schema-draft-04.json | 149 + .../ajv/lib/refs/json-schema-draft-06.json | 154 + .../ajv/lib/refs/json-schema-draft-07.json | 168 + .../ajv/lib/refs/json-schema-secure.json | 94 + .../app/api/node_modules/ajv/package.json | 106 + .../node_modules/ajv/scripts/.eslintrc.yml | 3 + .../api/node_modules/ajv/scripts/bundle.js | 61 + .../node_modules/ajv/scripts/compile-dots.js | 73 + .../app/api/node_modules/ajv/scripts/info | 10 + .../node_modules/ajv/scripts/prepare-tests | 12 + .../ajv/scripts/publish-built-version | 32 + .../node_modules/ajv/scripts/travis-gh-pages | 23 + .../app/api/node_modules/anymatch/LICENSE | 15 + .../app/api/node_modules/anymatch/README.md | 87 + .../app/api/node_modules/anymatch/index.d.ts | 20 + .../app/api/node_modules/anymatch/index.js | 104 + .../api/node_modules/anymatch/package.json | 48 + .../api/node_modules/array-flatten/LICENSE | 21 + .../api/node_modules/array-flatten/README.md | 43 + .../array-flatten/array-flatten.js | 64 + .../node_modules/array-flatten/package.json | 39 + .../app/api/node_modules/asn1/Jenkinsfile | 65 + tunestats/app/api/node_modules/asn1/LICENSE | 19 + tunestats/app/api/node_modules/asn1/README.md | 50 + .../api/node_modules/asn1/lib/ber/errors.js | 13 + .../api/node_modules/asn1/lib/ber/index.js | 27 + .../api/node_modules/asn1/lib/ber/reader.js | 262 + .../api/node_modules/asn1/lib/ber/types.js | 36 + .../api/node_modules/asn1/lib/ber/writer.js | 317 + .../app/api/node_modules/asn1/lib/index.js | 20 + .../app/api/node_modules/asn1/package.json | 31 + .../app/api/node_modules/assert-plus/AUTHORS | 6 + .../api/node_modules/assert-plus/CHANGES.md | 14 + .../api/node_modules/assert-plus/README.md | 162 + .../api/node_modules/assert-plus/assert.js | 211 + .../api/node_modules/assert-plus/package.json | 23 + .../app/api/node_modules/asynckit/LICENSE | 21 + .../app/api/node_modules/asynckit/README.md | 233 + .../app/api/node_modules/asynckit/bench.js | 76 + .../app/api/node_modules/asynckit/index.js | 6 + .../api/node_modules/asynckit/lib/abort.js | 29 + .../api/node_modules/asynckit/lib/async.js | 34 + .../api/node_modules/asynckit/lib/defer.js | 26 + .../api/node_modules/asynckit/lib/iterate.js | 75 + .../asynckit/lib/readable_asynckit.js | 91 + .../asynckit/lib/readable_parallel.js | 25 + .../asynckit/lib/readable_serial.js | 25 + .../asynckit/lib/readable_serial_ordered.js | 29 + .../api/node_modules/asynckit/lib/state.js | 37 + .../node_modules/asynckit/lib/streamify.js | 141 + .../node_modules/asynckit/lib/terminator.js | 29 + .../api/node_modules/asynckit/package.json | 63 + .../app/api/node_modules/asynckit/parallel.js | 43 + .../app/api/node_modules/asynckit/serial.js | 17 + .../node_modules/asynckit/serialOrdered.js | 75 + .../app/api/node_modules/asynckit/stream.js | 21 + .../app/api/node_modules/aws-sign2/LICENSE | 55 + .../app/api/node_modules/aws-sign2/README.md | 4 + .../app/api/node_modules/aws-sign2/index.js | 212 + .../api/node_modules/aws-sign2/package.json | 17 + tunestats/app/api/node_modules/aws4/LICENSE | 19 + tunestats/app/api/node_modules/aws4/README.md | 213 + tunestats/app/api/node_modules/aws4/aws4.js | 381 + tunestats/app/api/node_modules/aws4/lru.js | 96 + .../app/api/node_modules/aws4/package.json | 21 + .../balanced-match/.github/FUNDING.yml | 2 + .../node_modules/balanced-match/LICENSE.md | 21 + .../api/node_modules/balanced-match/README.md | 97 + .../api/node_modules/balanced-match/index.js | 62 + .../node_modules/balanced-match/package.json | 48 + .../node_modules/bcrypt-pbkdf/CONTRIBUTING.md | 13 + .../app/api/node_modules/bcrypt-pbkdf/LICENSE | 66 + .../api/node_modules/bcrypt-pbkdf/README.md | 45 + .../api/node_modules/bcrypt-pbkdf/index.js | 556 + .../node_modules/bcrypt-pbkdf/package.json | 15 + .../binary-extensions/binary-extensions.json | 263 + .../binary-extensions.json.d.ts | 3 + .../node_modules/binary-extensions/index.d.ts | 14 + .../node_modules/binary-extensions/index.js | 1 + .../node_modules/binary-extensions/license | 10 + .../binary-extensions/package.json | 40 + .../node_modules/binary-extensions/readme.md | 25 + .../api/node_modules/body-parser/HISTORY.md | 665 + .../app/api/node_modules/body-parser/LICENSE | 23 + .../api/node_modules/body-parser/README.md | 465 + .../api/node_modules/body-parser/SECURITY.md | 25 + .../app/api/node_modules/body-parser/index.js | 156 + .../api/node_modules/body-parser/lib/read.js | 205 + .../body-parser/lib/types/json.js | 247 + .../node_modules/body-parser/lib/types/raw.js | 101 + .../body-parser/lib/types/text.js | 121 + .../body-parser/lib/types/urlencoded.js | 284 + .../api/node_modules/body-parser/package.json | 56 + .../api/node_modules/brace-expansion/LICENSE | 21 + .../node_modules/brace-expansion/README.md | 129 + .../api/node_modules/brace-expansion/index.js | 201 + .../node_modules/brace-expansion/package.json | 47 + tunestats/app/api/node_modules/braces/LICENSE | 21 + .../app/api/node_modules/braces/README.md | 586 + .../app/api/node_modules/braces/index.js | 170 + .../api/node_modules/braces/lib/compile.js | 60 + .../api/node_modules/braces/lib/constants.js | 57 + .../app/api/node_modules/braces/lib/expand.js | 113 + .../app/api/node_modules/braces/lib/parse.js | 331 + .../api/node_modules/braces/lib/stringify.js | 32 + .../app/api/node_modules/braces/lib/utils.js | 122 + .../app/api/node_modules/braces/package.json | 77 + .../app/api/node_modules/bytes/History.md | 97 + tunestats/app/api/node_modules/bytes/LICENSE | 23 + .../app/api/node_modules/bytes/Readme.md | 152 + tunestats/app/api/node_modules/bytes/index.js | 170 + .../app/api/node_modules/bytes/package.json | 42 + .../api/node_modules/call-bind/.eslintignore | 1 + .../app/api/node_modules/call-bind/.eslintrc | 16 + .../call-bind/.github/FUNDING.yml | 12 + .../app/api/node_modules/call-bind/.nycrc | 9 + .../api/node_modules/call-bind/CHANGELOG.md | 93 + .../app/api/node_modules/call-bind/LICENSE | 21 + .../app/api/node_modules/call-bind/README.md | 64 + .../api/node_modules/call-bind/callBound.js | 15 + .../app/api/node_modules/call-bind/index.js | 35 + .../api/node_modules/call-bind/package.json | 95 + .../node_modules/call-bind/test/callBound.js | 54 + .../api/node_modules/call-bind/test/index.js | 80 + .../app/api/node_modules/caseless/LICENSE | 28 + .../app/api/node_modules/caseless/README.md | 45 + .../app/api/node_modules/caseless/index.js | 67 + .../api/node_modules/caseless/package.json | 27 + .../app/api/node_modules/caseless/test.js | 67 + .../app/api/node_modules/chokidar/LICENSE | 21 + .../app/api/node_modules/chokidar/README.md | 308 + .../app/api/node_modules/chokidar/index.js | 973 ++ .../node_modules/chokidar/lib/constants.js | 66 + .../chokidar/lib/fsevents-handler.js | 526 + .../chokidar/lib/nodefs-handler.js | 654 + .../api/node_modules/chokidar/package.json | 70 + .../node_modules/chokidar/types/index.d.ts | 192 + .../api/node_modules/combined-stream/License | 19 + .../node_modules/combined-stream/Readme.md | 138 + .../combined-stream/lib/combined_stream.js | 208 + .../node_modules/combined-stream/package.json | 25 + .../node_modules/combined-stream/yarn.lock | 17 + .../api/node_modules/concat-map/.travis.yml | 4 + .../app/api/node_modules/concat-map/LICENSE | 18 + .../node_modules/concat-map/README.markdown | 62 + .../node_modules/concat-map/example/map.js | 6 + .../app/api/node_modules/concat-map/index.js | 13 + .../api/node_modules/concat-map/package.json | 43 + .../api/node_modules/concat-map/test/map.js | 39 + .../content-disposition/HISTORY.md | 60 + .../node_modules/content-disposition/LICENSE | 22 + .../content-disposition/README.md | 142 + .../node_modules/content-disposition/index.js | 458 + .../content-disposition/package.json | 44 + .../api/node_modules/content-type/HISTORY.md | 29 + .../app/api/node_modules/content-type/LICENSE | 22 + .../api/node_modules/content-type/README.md | 94 + .../api/node_modules/content-type/index.js | 225 + .../node_modules/content-type/package.json | 42 + .../api/node_modules/cookie-parser/HISTORY.md | 100 + .../api/node_modules/cookie-parser/LICENSE | 23 + .../api/node_modules/cookie-parser/README.md | 119 + .../api/node_modules/cookie-parser/index.js | 182 + .../node_modules/cookie-parser/package.json | 45 + .../node_modules/cookie-signature/.npmignore | 4 + .../node_modules/cookie-signature/History.md | 38 + .../node_modules/cookie-signature/Readme.md | 42 + .../node_modules/cookie-signature/index.js | 51 + .../cookie-signature/package.json | 18 + .../app/api/node_modules/cookie/HISTORY.md | 128 + tunestats/app/api/node_modules/cookie/LICENSE | 24 + .../app/api/node_modules/cookie/README.md | 257 + .../app/api/node_modules/cookie/index.js | 202 + .../app/api/node_modules/cookie/package.json | 40 + .../app/api/node_modules/core-util-is/LICENSE | 19 + .../api/node_modules/core-util-is/README.md | 3 + .../api/node_modules/core-util-is/float.patch | 604 + .../api/node_modules/core-util-is/lib/util.js | 107 + .../node_modules/core-util-is/package.json | 32 + .../app/api/node_modules/core-util-is/test.js | 68 + .../app/api/node_modules/cors/CONTRIBUTING.md | 33 + .../app/api/node_modules/cors/HISTORY.md | 58 + tunestats/app/api/node_modules/cors/LICENSE | 22 + tunestats/app/api/node_modules/cors/README.md | 243 + .../app/api/node_modules/cors/lib/index.js | 238 + .../app/api/node_modules/cors/package.json | 41 + .../app/api/node_modules/dashdash/CHANGES.md | 364 + .../app/api/node_modules/dashdash/LICENSE.txt | 24 + .../app/api/node_modules/dashdash/README.md | 574 + .../dashdash/etc/dashdash.bash_completion.in | 389 + .../api/node_modules/dashdash/lib/dashdash.js | 1055 ++ .../api/node_modules/dashdash/package.json | 26 + .../app/api/node_modules/debug/.coveralls.yml | 1 + .../app/api/node_modules/debug/.eslintrc | 11 + .../app/api/node_modules/debug/.npmignore | 9 + .../app/api/node_modules/debug/.travis.yml | 14 + .../app/api/node_modules/debug/CHANGELOG.md | 362 + tunestats/app/api/node_modules/debug/LICENSE | 19 + tunestats/app/api/node_modules/debug/Makefile | 50 + .../app/api/node_modules/debug/README.md | 312 + .../app/api/node_modules/debug/component.json | 19 + .../app/api/node_modules/debug/karma.conf.js | 70 + tunestats/app/api/node_modules/debug/node.js | 1 + .../app/api/node_modules/debug/package.json | 49 + .../app/api/node_modules/debug/src/browser.js | 185 + .../app/api/node_modules/debug/src/debug.js | 202 + .../app/api/node_modules/debug/src/index.js | 10 + .../node_modules/debug/src/inspector-log.js | 15 + .../app/api/node_modules/debug/src/node.js | 248 + .../define-data-property/.eslintrc | 24 + .../define-data-property/.github/FUNDING.yml | 12 + .../node_modules/define-data-property/.nycrc | 13 + .../define-data-property/CHANGELOG.md | 70 + .../node_modules/define-data-property/LICENSE | 21 + .../define-data-property/README.md | 67 + .../define-data-property/index.d.ts | 12 + .../define-data-property/index.js | 56 + .../define-data-property/package.json | 106 + .../define-data-property/test/index.js | 392 + .../define-data-property/tsconfig.json | 59 + .../node_modules/delayed-stream/.npmignore | 1 + .../api/node_modules/delayed-stream/License | 19 + .../api/node_modules/delayed-stream/Makefile | 7 + .../api/node_modules/delayed-stream/Readme.md | 141 + .../delayed-stream/lib/delayed_stream.js | 107 + .../node_modules/delayed-stream/package.json | 27 + .../app/api/node_modules/depd/History.md | 103 + tunestats/app/api/node_modules/depd/LICENSE | 22 + tunestats/app/api/node_modules/depd/Readme.md | 280 + tunestats/app/api/node_modules/depd/index.js | 538 + .../node_modules/depd/lib/browser/index.js | 77 + .../app/api/node_modules/depd/package.json | 45 + .../app/api/node_modules/destroy/LICENSE | 23 + .../app/api/node_modules/destroy/README.md | 63 + .../app/api/node_modules/destroy/index.js | 209 + .../app/api/node_modules/destroy/package.json | 48 + .../app/api/node_modules/dotenv/CHANGELOG.md | 475 + tunestats/app/api/node_modules/dotenv/LICENSE | 23 + .../app/api/node_modules/dotenv/README-es.md | 448 + .../app/api/node_modules/dotenv/README.md | 728 ++ .../app/api/node_modules/dotenv/config.d.ts | 1 + .../app/api/node_modules/dotenv/config.js | 9 + .../node_modules/dotenv/lib/cli-options.js | 11 + .../node_modules/dotenv/lib/env-options.js | 24 + .../app/api/node_modules/dotenv/lib/main.d.ts | 153 + .../app/api/node_modules/dotenv/lib/main.js | 361 + .../app/api/node_modules/dotenv/package.json | 65 + .../app/api/node_modules/ecc-jsbn/LICENSE | 21 + .../app/api/node_modules/ecc-jsbn/README.md | 8 + .../app/api/node_modules/ecc-jsbn/index.js | 58 + .../node_modules/ecc-jsbn/lib/LICENSE-jsbn | 40 + .../app/api/node_modules/ecc-jsbn/lib/ec.js | 561 + .../app/api/node_modules/ecc-jsbn/lib/sec.js | 170 + .../api/node_modules/ecc-jsbn/package.json | 40 + .../app/api/node_modules/ecc-jsbn/test.js | 14 + .../app/api/node_modules/ee-first/LICENSE | 22 + .../app/api/node_modules/ee-first/README.md | 80 + .../app/api/node_modules/ee-first/index.js | 95 + .../api/node_modules/ee-first/package.json | 29 + .../app/api/node_modules/encodeurl/HISTORY.md | 14 + .../app/api/node_modules/encodeurl/LICENSE | 22 + .../app/api/node_modules/encodeurl/README.md | 128 + .../app/api/node_modules/encodeurl/index.js | 60 + .../api/node_modules/encodeurl/package.json | 40 + .../node_modules/es-define-property/.eslintrc | 13 + .../es-define-property/.github/FUNDING.yml | 12 + .../node_modules/es-define-property/.nycrc | 9 + .../es-define-property/CHANGELOG.md | 15 + .../node_modules/es-define-property/LICENSE | 21 + .../node_modules/es-define-property/README.md | 49 + .../es-define-property/index.d.ts | 3 + .../node_modules/es-define-property/index.js | 16 + .../es-define-property/package.json | 81 + .../es-define-property/test/index.js | 55 + .../es-define-property/tsconfig.json | 50 + .../app/api/node_modules/es-errors/.eslintrc | 5 + .../es-errors/.github/FUNDING.yml | 12 + .../api/node_modules/es-errors/CHANGELOG.md | 40 + .../app/api/node_modules/es-errors/LICENSE | 21 + .../app/api/node_modules/es-errors/README.md | 55 + .../app/api/node_modules/es-errors/eval.d.ts | 3 + .../app/api/node_modules/es-errors/eval.js | 4 + .../app/api/node_modules/es-errors/index.d.ts | 3 + .../app/api/node_modules/es-errors/index.js | 4 + .../api/node_modules/es-errors/package.json | 80 + .../app/api/node_modules/es-errors/range.d.ts | 3 + .../app/api/node_modules/es-errors/range.js | 4 + .../app/api/node_modules/es-errors/ref.d.ts | 3 + .../app/api/node_modules/es-errors/ref.js | 4 + .../api/node_modules/es-errors/syntax.d.ts | 3 + .../app/api/node_modules/es-errors/syntax.js | 4 + .../api/node_modules/es-errors/test/index.js | 19 + .../api/node_modules/es-errors/tsconfig.json | 49 + .../app/api/node_modules/es-errors/type.d.ts | 3 + .../app/api/node_modules/es-errors/type.js | 4 + .../app/api/node_modules/es-errors/uri.d.ts | 3 + .../app/api/node_modules/es-errors/uri.js | 4 + .../app/api/node_modules/escape-html/LICENSE | 24 + .../api/node_modules/escape-html/Readme.md | 43 + .../app/api/node_modules/escape-html/index.js | 78 + .../api/node_modules/escape-html/package.json | 24 + .../app/api/node_modules/etag/HISTORY.md | 83 + tunestats/app/api/node_modules/etag/LICENSE | 22 + tunestats/app/api/node_modules/etag/README.md | 159 + tunestats/app/api/node_modules/etag/index.js | 131 + .../app/api/node_modules/etag/package.json | 47 + .../app/api/node_modules/express/History.md | 3615 ++++++ .../app/api/node_modules/express/LICENSE | 24 + .../app/api/node_modules/express/Readme.md | 166 + .../app/api/node_modules/express/index.js | 11 + .../node_modules/express/lib/application.js | 661 + .../api/node_modules/express/lib/express.js | 116 + .../express/lib/middleware/init.js | 43 + .../express/lib/middleware/query.js | 47 + .../api/node_modules/express/lib/request.js | 525 + .../api/node_modules/express/lib/response.js | 1178 ++ .../node_modules/express/lib/router/index.js | 673 + .../node_modules/express/lib/router/layer.js | 181 + .../node_modules/express/lib/router/route.js | 230 + .../app/api/node_modules/express/lib/utils.js | 303 + .../app/api/node_modules/express/lib/view.js | 182 + .../express/node_modules/cookie/HISTORY.md | 147 + .../express/node_modules/cookie/LICENSE | 24 + .../express/node_modules/cookie/README.md | 317 + .../express/node_modules/cookie/SECURITY.md | 25 + .../express/node_modules/cookie/index.js | 274 + .../express/node_modules/cookie/package.json | 44 + .../app/api/node_modules/express/package.json | 98 + .../app/api/node_modules/extend/.editorconfig | 20 + .../app/api/node_modules/extend/.eslintrc | 17 + .../app/api/node_modules/extend/.jscs.json | 175 + .../app/api/node_modules/extend/.travis.yml | 230 + .../app/api/node_modules/extend/CHANGELOG.md | 83 + tunestats/app/api/node_modules/extend/LICENSE | 23 + .../app/api/node_modules/extend/README.md | 81 + .../api/node_modules/extend/component.json | 32 + .../app/api/node_modules/extend/index.js | 117 + .../app/api/node_modules/extend/package.json | 42 + .../api/node_modules/extsprintf/.gitmodules | 0 .../api/node_modules/extsprintf/.npmignore | 2 + .../app/api/node_modules/extsprintf/LICENSE | 19 + .../app/api/node_modules/extsprintf/Makefile | 24 + .../api/node_modules/extsprintf/Makefile.targ | 285 + .../app/api/node_modules/extsprintf/README.md | 46 + .../api/node_modules/extsprintf/jsl.node.conf | 137 + .../node_modules/extsprintf/lib/extsprintf.js | 183 + .../api/node_modules/extsprintf/package.json | 14 + .../api/node_modules/fast-deep-equal/LICENSE | 21 + .../node_modules/fast-deep-equal/README.md | 96 + .../fast-deep-equal/es6/index.d.ts | 2 + .../node_modules/fast-deep-equal/es6/index.js | 72 + .../fast-deep-equal/es6/react.d.ts | 2 + .../node_modules/fast-deep-equal/es6/react.js | 79 + .../node_modules/fast-deep-equal/index.d.ts | 4 + .../api/node_modules/fast-deep-equal/index.js | 46 + .../node_modules/fast-deep-equal/package.json | 61 + .../node_modules/fast-deep-equal/react.d.ts | 2 + .../api/node_modules/fast-deep-equal/react.js | 53 + .../fast-json-stable-stringify/.eslintrc.yml | 26 + .../.github/FUNDING.yml | 1 + .../fast-json-stable-stringify/.travis.yml | 8 + .../fast-json-stable-stringify/LICENSE | 21 + .../fast-json-stable-stringify/README.md | 131 + .../benchmark/index.js | 31 + .../benchmark/test.json | 137 + .../example/key_cmp.js | 7 + .../example/nested.js | 3 + .../fast-json-stable-stringify/example/str.js | 3 + .../example/value_cmp.js | 7 + .../fast-json-stable-stringify/index.d.ts | 4 + .../fast-json-stable-stringify/index.js | 59 + .../fast-json-stable-stringify/package.json | 52 + .../fast-json-stable-stringify/test/cmp.js | 13 + .../fast-json-stable-stringify/test/nested.js | 44 + .../fast-json-stable-stringify/test/str.js | 46 + .../test/to-json.js | 22 + .../app/api/node_modules/fill-range/LICENSE | 21 + .../app/api/node_modules/fill-range/README.md | 237 + .../app/api/node_modules/fill-range/index.js | 248 + .../api/node_modules/fill-range/package.json | 74 + .../api/node_modules/finalhandler/HISTORY.md | 195 + .../app/api/node_modules/finalhandler/LICENSE | 22 + .../api/node_modules/finalhandler/README.md | 147 + .../api/node_modules/finalhandler/SECURITY.md | 25 + .../api/node_modules/finalhandler/index.js | 336 + .../node_modules/finalhandler/package.json | 46 + .../api/node_modules/forever-agent/LICENSE | 55 + .../api/node_modules/forever-agent/README.md | 4 + .../api/node_modules/forever-agent/index.js | 138 + .../node_modules/forever-agent/package.json | 17 + .../app/api/node_modules/form-data/License | 19 + .../app/api/node_modules/form-data/README.md | 234 + .../api/node_modules/form-data/README.md.bak | 234 + .../api/node_modules/form-data/lib/browser.js | 2 + .../node_modules/form-data/lib/form_data.js | 457 + .../node_modules/form-data/lib/populate.js | 10 + .../api/node_modules/form-data/package.json | 65 + .../app/api/node_modules/form-data/yarn.lock | 2662 ++++ .../app/api/node_modules/forwarded/HISTORY.md | 21 + .../app/api/node_modules/forwarded/LICENSE | 22 + .../app/api/node_modules/forwarded/README.md | 57 + .../app/api/node_modules/forwarded/index.js | 90 + .../api/node_modules/forwarded/package.json | 45 + .../app/api/node_modules/fresh/HISTORY.md | 70 + tunestats/app/api/node_modules/fresh/LICENSE | 23 + .../app/api/node_modules/fresh/README.md | 119 + tunestats/app/api/node_modules/fresh/index.js | 137 + .../app/api/node_modules/fresh/package.json | 46 + .../api/node_modules/function-bind/.eslintrc | 21 + .../function-bind/.github/FUNDING.yml | 12 + .../function-bind/.github/SECURITY.md | 3 + .../app/api/node_modules/function-bind/.nycrc | 13 + .../node_modules/function-bind/CHANGELOG.md | 136 + .../api/node_modules/function-bind/LICENSE | 20 + .../api/node_modules/function-bind/README.md | 46 + .../function-bind/implementation.js | 84 + .../api/node_modules/function-bind/index.js | 5 + .../node_modules/function-bind/package.json | 87 + .../node_modules/function-bind/test/.eslintrc | 9 + .../node_modules/function-bind/test/index.js | 252 + .../api/node_modules/get-intrinsic/.eslintrc | 38 + .../get-intrinsic/.github/FUNDING.yml | 12 + .../app/api/node_modules/get-intrinsic/.nycrc | 9 + .../node_modules/get-intrinsic/CHANGELOG.md | 143 + .../api/node_modules/get-intrinsic/LICENSE | 21 + .../api/node_modules/get-intrinsic/README.md | 71 + .../api/node_modules/get-intrinsic/index.js | 359 + .../node_modules/get-intrinsic/package.json | 93 + .../get-intrinsic/test/GetIntrinsic.js | 274 + .../app/api/node_modules/getpass/.npmignore | 8 + .../app/api/node_modules/getpass/.travis.yml | 9 + .../app/api/node_modules/getpass/LICENSE | 18 + .../app/api/node_modules/getpass/README.md | 32 + .../app/api/node_modules/getpass/lib/index.js | 123 + .../app/api/node_modules/getpass/package.json | 18 + .../api/node_modules/glob-parent/CHANGELOG.md | 110 + .../app/api/node_modules/glob-parent/LICENSE | 15 + .../api/node_modules/glob-parent/README.md | 137 + .../app/api/node_modules/glob-parent/index.js | 42 + .../api/node_modules/glob-parent/package.json | 48 + tunestats/app/api/node_modules/gopd/.eslintrc | 16 + .../api/node_modules/gopd/.github/FUNDING.yml | 12 + .../app/api/node_modules/gopd/CHANGELOG.md | 25 + tunestats/app/api/node_modules/gopd/LICENSE | 21 + tunestats/app/api/node_modules/gopd/README.md | 40 + tunestats/app/api/node_modules/gopd/index.js | 16 + .../app/api/node_modules/gopd/package.json | 71 + .../app/api/node_modules/gopd/test/index.js | 35 + .../app/api/node_modules/har-schema/LICENSE | 13 + .../app/api/node_modules/har-schema/README.md | 49 + .../har-schema/lib/afterRequest.json | 30 + .../har-schema/lib/beforeRequest.json | 30 + .../node_modules/har-schema/lib/browser.json | 20 + .../node_modules/har-schema/lib/cache.json | 21 + .../node_modules/har-schema/lib/content.json | 29 + .../node_modules/har-schema/lib/cookie.json | 36 + .../node_modules/har-schema/lib/creator.json | 20 + .../node_modules/har-schema/lib/entry.json | 53 + .../api/node_modules/har-schema/lib/har.json | 13 + .../node_modules/har-schema/lib/header.json | 20 + .../api/node_modules/har-schema/lib/index.js | 22 + .../api/node_modules/har-schema/lib/log.json | 36 + .../api/node_modules/har-schema/lib/page.json | 32 + .../har-schema/lib/pageTimings.json | 18 + .../node_modules/har-schema/lib/postData.json | 43 + .../node_modules/har-schema/lib/query.json | 20 + .../node_modules/har-schema/lib/request.json | 57 + .../node_modules/har-schema/lib/response.json | 54 + .../node_modules/har-schema/lib/timings.json | 42 + .../api/node_modules/har-schema/package.json | 54 + .../api/node_modules/har-validator/LICENSE | 9 + .../api/node_modules/har-validator/README.md | 43 + .../node_modules/har-validator/lib/async.js | 105 + .../node_modules/har-validator/lib/error.js | 17 + .../node_modules/har-validator/lib/promise.js | 102 + .../node_modules/har-validator/package.json | 43 + .../app/api/node_modules/has-flag/index.js | 8 + .../app/api/node_modules/has-flag/license | 9 + .../api/node_modules/has-flag/package.json | 44 + .../app/api/node_modules/has-flag/readme.md | 70 + .../has-property-descriptors/.eslintrc | 13 + .../.github/FUNDING.yml | 12 + .../has-property-descriptors/.nycrc | 9 + .../has-property-descriptors/CHANGELOG.md | 35 + .../has-property-descriptors/LICENSE | 21 + .../has-property-descriptors/README.md | 43 + .../has-property-descriptors/index.js | 22 + .../has-property-descriptors/package.json | 77 + .../has-property-descriptors/test/index.js | 57 + .../app/api/node_modules/has-proto/.eslintrc | 5 + .../has-proto/.github/FUNDING.yml | 12 + .../api/node_modules/has-proto/CHANGELOG.md | 38 + .../app/api/node_modules/has-proto/LICENSE | 21 + .../app/api/node_modules/has-proto/README.md | 38 + .../app/api/node_modules/has-proto/index.d.ts | 3 + .../app/api/node_modules/has-proto/index.js | 15 + .../api/node_modules/has-proto/package.json | 78 + .../api/node_modules/has-proto/test/index.js | 19 + .../api/node_modules/has-proto/tsconfig.json | 49 + .../api/node_modules/has-symbols/.eslintrc | 11 + .../has-symbols/.github/FUNDING.yml | 12 + .../app/api/node_modules/has-symbols/.nycrc | 9 + .../api/node_modules/has-symbols/CHANGELOG.md | 75 + .../app/api/node_modules/has-symbols/LICENSE | 21 + .../api/node_modules/has-symbols/README.md | 46 + .../app/api/node_modules/has-symbols/index.js | 13 + .../api/node_modules/has-symbols/package.json | 101 + .../app/api/node_modules/has-symbols/shams.js | 42 + .../node_modules/has-symbols/test/index.js | 22 + .../has-symbols/test/shams/core-js.js | 28 + .../test/shams/get-own-property-symbols.js | 28 + .../node_modules/has-symbols/test/tests.js | 56 + .../app/api/node_modules/hasown/.eslintrc | 5 + .../node_modules/hasown/.github/FUNDING.yml | 12 + tunestats/app/api/node_modules/hasown/.nycrc | 13 + .../app/api/node_modules/hasown/CHANGELOG.md | 40 + tunestats/app/api/node_modules/hasown/LICENSE | 21 + .../app/api/node_modules/hasown/README.md | 40 + .../app/api/node_modules/hasown/index.d.ts | 3 + .../app/api/node_modules/hasown/index.js | 8 + .../app/api/node_modules/hasown/package.json | 92 + .../app/api/node_modules/hasown/tsconfig.json | 6 + .../api/node_modules/http-errors/HISTORY.md | 180 + .../app/api/node_modules/http-errors/LICENSE | 23 + .../api/node_modules/http-errors/README.md | 169 + .../app/api/node_modules/http-errors/index.js | 289 + .../api/node_modules/http-errors/package.json | 50 + .../http-signature/.dir-locals.el | 6 + .../node_modules/http-signature/.npmignore | 7 + .../node_modules/http-signature/CHANGES.md | 46 + .../api/node_modules/http-signature/LICENSE | 18 + .../api/node_modules/http-signature/README.md | 79 + .../http-signature/http_signing.md | 363 + .../node_modules/http-signature/lib/index.js | 29 + .../node_modules/http-signature/lib/parser.js | 315 + .../node_modules/http-signature/lib/signer.js | 401 + .../node_modules/http-signature/lib/utils.js | 112 + .../node_modules/http-signature/lib/verify.js | 88 + .../node_modules/http-signature/package.json | 39 + .../api/node_modules/iconv-lite/Changelog.md | 162 + .../app/api/node_modules/iconv-lite/LICENSE | 21 + .../app/api/node_modules/iconv-lite/README.md | 156 + .../iconv-lite/encodings/dbcs-codec.js | 555 + .../iconv-lite/encodings/dbcs-data.js | 176 + .../iconv-lite/encodings/index.js | 22 + .../iconv-lite/encodings/internal.js | 188 + .../iconv-lite/encodings/sbcs-codec.js | 72 + .../encodings/sbcs-data-generated.js | 451 + .../iconv-lite/encodings/sbcs-data.js | 174 + .../encodings/tables/big5-added.json | 122 + .../iconv-lite/encodings/tables/cp936.json | 264 + .../iconv-lite/encodings/tables/cp949.json | 273 + .../iconv-lite/encodings/tables/cp950.json | 177 + .../iconv-lite/encodings/tables/eucjp.json | 182 + .../encodings/tables/gb18030-ranges.json | 1 + .../encodings/tables/gbk-added.json | 55 + .../iconv-lite/encodings/tables/shiftjis.json | 125 + .../iconv-lite/encodings/utf16.js | 177 + .../node_modules/iconv-lite/encodings/utf7.js | 290 + .../iconv-lite/lib/bom-handling.js | 52 + .../iconv-lite/lib/extend-node.js | 217 + .../node_modules/iconv-lite/lib/index.d.ts | 24 + .../api/node_modules/iconv-lite/lib/index.js | 153 + .../node_modules/iconv-lite/lib/streams.js | 121 + .../api/node_modules/iconv-lite/package.json | 46 + .../node_modules/ignore-by-default/LICENSE | 14 + .../node_modules/ignore-by-default/README.md | 26 + .../node_modules/ignore-by-default/index.js | 12 + .../ignore-by-default/package.json | 34 + .../app/api/node_modules/inherits/LICENSE | 16 + .../app/api/node_modules/inherits/README.md | 42 + .../app/api/node_modules/inherits/inherits.js | 9 + .../node_modules/inherits/inherits_browser.js | 27 + .../api/node_modules/inherits/package.json | 29 + .../app/api/node_modules/ipaddr.js/LICENSE | 19 + .../app/api/node_modules/ipaddr.js/README.md | 233 + .../api/node_modules/ipaddr.js/ipaddr.min.js | 1 + .../api/node_modules/ipaddr.js/lib/ipaddr.js | 673 + .../node_modules/ipaddr.js/lib/ipaddr.js.d.ts | 68 + .../api/node_modules/ipaddr.js/package.json | 35 + .../node_modules/is-binary-path/index.d.ts | 17 + .../api/node_modules/is-binary-path/index.js | 7 + .../api/node_modules/is-binary-path/license | 9 + .../node_modules/is-binary-path/package.json | 40 + .../api/node_modules/is-binary-path/readme.md | 34 + .../app/api/node_modules/is-extglob/LICENSE | 21 + .../app/api/node_modules/is-extglob/README.md | 107 + .../app/api/node_modules/is-extglob/index.js | 20 + .../api/node_modules/is-extglob/package.json | 69 + .../app/api/node_modules/is-glob/LICENSE | 21 + .../app/api/node_modules/is-glob/README.md | 206 + .../app/api/node_modules/is-glob/index.js | 150 + .../app/api/node_modules/is-glob/package.json | 81 + .../app/api/node_modules/is-number/LICENSE | 21 + .../app/api/node_modules/is-number/README.md | 187 + .../app/api/node_modules/is-number/index.js | 18 + .../api/node_modules/is-number/package.json | 82 + .../api/node_modules/is-typedarray/LICENSE.md | 18 + .../api/node_modules/is-typedarray/README.md | 16 + .../api/node_modules/is-typedarray/index.js | 41 + .../node_modules/is-typedarray/package.json | 30 + .../api/node_modules/is-typedarray/test.js | 34 + .../app/api/node_modules/isstream/.jshintrc | 59 + .../app/api/node_modules/isstream/.npmignore | 1 + .../app/api/node_modules/isstream/.travis.yml | 12 + .../app/api/node_modules/isstream/LICENSE.md | 11 + .../app/api/node_modules/isstream/README.md | 66 + .../app/api/node_modules/isstream/isstream.js | 27 + .../api/node_modules/isstream/package.json | 33 + .../app/api/node_modules/isstream/test.js | 168 + .../app/api/node_modules/jsbn/.npmignore | 2 + tunestats/app/api/node_modules/jsbn/LICENSE | 40 + tunestats/app/api/node_modules/jsbn/README.md | 175 + .../app/api/node_modules/jsbn/example.html | 12 + .../app/api/node_modules/jsbn/example.js | 3 + tunestats/app/api/node_modules/jsbn/index.js | 1357 ++ .../app/api/node_modules/jsbn/package.json | 21 + .../json-schema-traverse/.eslintrc.yml | 27 + .../json-schema-traverse/.travis.yml | 8 + .../node_modules/json-schema-traverse/LICENSE | 21 + .../json-schema-traverse/README.md | 83 + .../json-schema-traverse/index.js | 89 + .../json-schema-traverse/package.json | 43 + .../json-schema-traverse/spec/.eslintrc.yml | 6 + .../spec/fixtures/schema.js | 125 + .../json-schema-traverse/spec/index.spec.js | 171 + .../app/api/node_modules/json-schema/LICENSE | 195 + .../api/node_modules/json-schema/README.md | 3 + .../api/node_modules/json-schema/lib/links.js | 65 + .../node_modules/json-schema/lib/validate.js | 271 + .../api/node_modules/json-schema/package.json | 24 + .../json-stringify-safe/.npmignore | 1 + .../json-stringify-safe/CHANGELOG.md | 14 + .../node_modules/json-stringify-safe/LICENSE | 15 + .../node_modules/json-stringify-safe/Makefile | 35 + .../json-stringify-safe/README.md | 52 + .../json-stringify-safe/package.json | 31 + .../json-stringify-safe/stringify.js | 27 + .../json-stringify-safe/test/mocha.opts | 2 + .../test/stringify_test.js | 246 + .../app/api/node_modules/jsprim/CHANGES.md | 53 + .../api/node_modules/jsprim/CONTRIBUTING.md | 19 + tunestats/app/api/node_modules/jsprim/LICENSE | 19 + .../app/api/node_modules/jsprim/README.md | 287 + .../app/api/node_modules/jsprim/lib/jsprim.js | 735 ++ .../app/api/node_modules/jsprim/package.json | 20 + .../api/node_modules/media-typer/HISTORY.md | 22 + .../app/api/node_modules/media-typer/LICENSE | 22 + .../api/node_modules/media-typer/README.md | 81 + .../app/api/node_modules/media-typer/index.js | 270 + .../api/node_modules/media-typer/package.json | 26 + .../node_modules/merge-descriptors/HISTORY.md | 21 + .../node_modules/merge-descriptors/LICENSE | 23 + .../node_modules/merge-descriptors/README.md | 48 + .../node_modules/merge-descriptors/index.js | 60 + .../merge-descriptors/package.json | 32 + .../app/api/node_modules/methods/HISTORY.md | 29 + .../app/api/node_modules/methods/LICENSE | 24 + .../app/api/node_modules/methods/README.md | 51 + .../app/api/node_modules/methods/index.js | 69 + .../app/api/node_modules/methods/package.json | 36 + .../app/api/node_modules/mime-db/HISTORY.md | 507 + .../app/api/node_modules/mime-db/LICENSE | 23 + .../app/api/node_modules/mime-db/README.md | 100 + .../app/api/node_modules/mime-db/db.json | 8519 +++++++++++++ .../app/api/node_modules/mime-db/index.js | 12 + .../app/api/node_modules/mime-db/package.json | 60 + .../api/node_modules/mime-types/HISTORY.md | 397 + .../app/api/node_modules/mime-types/LICENSE | 23 + .../app/api/node_modules/mime-types/README.md | 113 + .../app/api/node_modules/mime-types/index.js | 188 + .../api/node_modules/mime-types/package.json | 44 + .../app/api/node_modules/mime/.npmignore | 0 .../app/api/node_modules/mime/CHANGELOG.md | 164 + tunestats/app/api/node_modules/mime/LICENSE | 21 + tunestats/app/api/node_modules/mime/README.md | 90 + tunestats/app/api/node_modules/mime/cli.js | 8 + tunestats/app/api/node_modules/mime/mime.js | 108 + .../app/api/node_modules/mime/package.json | 44 + .../app/api/node_modules/mime/src/build.js | 53 + .../app/api/node_modules/mime/src/test.js | 60 + .../app/api/node_modules/mime/types.json | 1 + .../app/api/node_modules/minimatch/LICENSE | 15 + .../app/api/node_modules/minimatch/README.md | 230 + .../api/node_modules/minimatch/minimatch.js | 947 ++ .../api/node_modules/minimatch/package.json | 33 + tunestats/app/api/node_modules/ms/index.js | 152 + tunestats/app/api/node_modules/ms/license.md | 21 + .../app/api/node_modules/ms/package.json | 37 + tunestats/app/api/node_modules/ms/readme.md | 51 + .../api/node_modules/negotiator/HISTORY.md | 108 + .../app/api/node_modules/negotiator/LICENSE | 24 + .../app/api/node_modules/negotiator/README.md | 203 + .../app/api/node_modules/negotiator/index.js | 82 + .../node_modules/negotiator/lib/charset.js | 169 + .../node_modules/negotiator/lib/encoding.js | 184 + .../node_modules/negotiator/lib/language.js | 179 + .../node_modules/negotiator/lib/mediaType.js | 294 + .../api/node_modules/negotiator/package.json | 42 + .../api/node_modules/nodemon/.prettierrc.json | 3 + .../app/api/node_modules/nodemon/LICENSE | 21 + .../app/api/node_modules/nodemon/README.md | 452 + .../api/node_modules/nodemon/bin/nodemon.js | 16 + .../node_modules/nodemon/bin/windows-kill.exe | Bin 0 -> 80384 bytes .../node_modules/nodemon/doc/cli/authors.txt | 8 + .../node_modules/nodemon/doc/cli/config.txt | 44 + .../api/node_modules/nodemon/doc/cli/help.txt | 29 + .../api/node_modules/nodemon/doc/cli/logo.txt | 20 + .../node_modules/nodemon/doc/cli/options.txt | 36 + .../node_modules/nodemon/doc/cli/topics.txt | 8 + .../node_modules/nodemon/doc/cli/usage.txt | 3 + .../node_modules/nodemon/doc/cli/whoami.txt | 9 + .../app/api/node_modules/nodemon/index.d.ts | 141 + .../api/node_modules/nodemon/jsconfig.json | 7 + .../api/node_modules/nodemon/lib/cli/index.js | 49 + .../api/node_modules/nodemon/lib/cli/parse.js | 230 + .../nodemon/lib/config/command.js | 43 + .../nodemon/lib/config/defaults.js | 34 + .../node_modules/nodemon/lib/config/exec.js | 234 + .../node_modules/nodemon/lib/config/index.js | 93 + .../node_modules/nodemon/lib/config/load.js | 223 + .../node_modules/nodemon/lib/help/index.js | 27 + .../app/api/node_modules/nodemon/lib/index.js | 1 + .../node_modules/nodemon/lib/monitor/index.js | 4 + .../node_modules/nodemon/lib/monitor/match.js | 276 + .../node_modules/nodemon/lib/monitor/run.js | 555 + .../nodemon/lib/monitor/signals.js | 34 + .../node_modules/nodemon/lib/monitor/watch.js | 244 + .../api/node_modules/nodemon/lib/nodemon.js | 315 + .../api/node_modules/nodemon/lib/rules/add.js | 89 + .../node_modules/nodemon/lib/rules/index.js | 53 + .../node_modules/nodemon/lib/rules/parse.js | 43 + .../app/api/node_modules/nodemon/lib/spawn.js | 74 + .../api/node_modules/nodemon/lib/utils/bus.js | 44 + .../node_modules/nodemon/lib/utils/clone.js | 40 + .../node_modules/nodemon/lib/utils/colour.js | 26 + .../node_modules/nodemon/lib/utils/index.js | 103 + .../api/node_modules/nodemon/lib/utils/log.js | 82 + .../node_modules/nodemon/lib/utils/merge.js | 47 + .../api/node_modules/nodemon/lib/version.js | 100 + .../nodemon/node_modules/debug/LICENSE | 20 + .../nodemon/node_modules/debug/README.md | 481 + .../nodemon/node_modules/debug/package.json | 60 + .../nodemon/node_modules/debug/src/browser.js | 269 + .../nodemon/node_modules/debug/src/common.js | 274 + .../nodemon/node_modules/debug/src/index.js | 10 + .../nodemon/node_modules/debug/src/node.js | 263 + .../nodemon/node_modules/ms/index.js | 162 + .../nodemon/node_modules/ms/license.md | 21 + .../nodemon/node_modules/ms/package.json | 37 + .../nodemon/node_modules/ms/readme.md | 60 + .../app/api/node_modules/nodemon/package.json | 75 + .../api/node_modules/normalize-path/LICENSE | 21 + .../api/node_modules/normalize-path/README.md | 127 + .../api/node_modules/normalize-path/index.js | 35 + .../node_modules/normalize-path/package.json | 77 + .../app/api/node_modules/oauth-sign/LICENSE | 55 + .../app/api/node_modules/oauth-sign/README.md | 11 + .../app/api/node_modules/oauth-sign/index.js | 146 + .../api/node_modules/oauth-sign/package.json | 23 + .../api/node_modules/object-assign/index.js | 90 + .../api/node_modules/object-assign/license | 21 + .../node_modules/object-assign/package.json | 42 + .../api/node_modules/object-assign/readme.md | 61 + .../api/node_modules/object-inspect/.eslintrc | 53 + .../object-inspect/.github/FUNDING.yml | 12 + .../api/node_modules/object-inspect/.nycrc | 13 + .../node_modules/object-inspect/CHANGELOG.md | 404 + .../api/node_modules/object-inspect/LICENSE | 21 + .../object-inspect/example/all.js | 23 + .../object-inspect/example/circular.js | 6 + .../node_modules/object-inspect/example/fn.js | 5 + .../object-inspect/example/inspect.js | 10 + .../api/node_modules/object-inspect/index.js | 527 + .../object-inspect/package-support.json | 20 + .../node_modules/object-inspect/package.json | 104 + .../object-inspect/readme.markdown | 84 + .../object-inspect/test-core-js.js | 26 + .../object-inspect/test/bigint.js | 58 + .../object-inspect/test/browser/dom.js | 15 + .../object-inspect/test/circular.js | 16 + .../node_modules/object-inspect/test/deep.js | 12 + .../object-inspect/test/element.js | 53 + .../node_modules/object-inspect/test/err.js | 48 + .../node_modules/object-inspect/test/fakes.js | 29 + .../node_modules/object-inspect/test/fn.js | 76 + .../object-inspect/test/global.js | 17 + .../node_modules/object-inspect/test/has.js | 15 + .../node_modules/object-inspect/test/holes.js | 15 + .../object-inspect/test/indent-option.js | 271 + .../object-inspect/test/inspect.js | 139 + .../object-inspect/test/lowbyte.js | 12 + .../object-inspect/test/number.js | 58 + .../object-inspect/test/quoteStyle.js | 17 + .../object-inspect/test/toStringTag.js | 40 + .../node_modules/object-inspect/test/undef.js | 12 + .../object-inspect/test/values.js | 211 + .../object-inspect/util.inspect.js | 1 + .../api/node_modules/on-finished/HISTORY.md | 98 + .../app/api/node_modules/on-finished/LICENSE | 23 + .../api/node_modules/on-finished/README.md | 162 + .../app/api/node_modules/on-finished/index.js | 234 + .../api/node_modules/on-finished/package.json | 39 + .../app/api/node_modules/parseurl/HISTORY.md | 58 + .../app/api/node_modules/parseurl/LICENSE | 24 + .../app/api/node_modules/parseurl/README.md | 133 + .../app/api/node_modules/parseurl/index.js | 158 + .../api/node_modules/parseurl/package.json | 40 + .../node_modules/path-to-regexp/History.md | 36 + .../api/node_modules/path-to-regexp/LICENSE | 21 + .../api/node_modules/path-to-regexp/Readme.md | 35 + .../api/node_modules/path-to-regexp/index.js | 129 + .../node_modules/path-to-regexp/package.json | 30 + .../node_modules/performance-now/.npmignore | 1 + .../performance-now/.tm_properties | 7 + .../node_modules/performance-now/.travis.yml | 6 + .../node_modules/performance-now/README.md | 30 + .../performance-now/lib/performance-now.js | 36 + .../lib/performance-now.js.map | 10 + .../node_modules/performance-now/license.txt | 7 + .../node_modules/performance-now/package.json | 35 + .../performance-now/src/index.d.ts | 8 + .../src/performance-now.coffee | 17 + .../performance-now/test/mocha.opts | 3 + .../test/performance-now.coffee | 43 + .../performance-now/test/scripts.coffee | 27 + .../test/scripts/delayed-call.coffee | 11 + .../test/scripts/delayed-require.coffee | 12 + .../test/scripts/difference.coffee | 6 + .../test/scripts/initial-value.coffee | 10 + .../api/node_modules/picomatch/CHANGELOG.md | 136 + .../app/api/node_modules/picomatch/LICENSE | 21 + .../app/api/node_modules/picomatch/README.md | 708 ++ .../app/api/node_modules/picomatch/index.js | 3 + .../node_modules/picomatch/lib/constants.js | 179 + .../api/node_modules/picomatch/lib/parse.js | 1091 ++ .../node_modules/picomatch/lib/picomatch.js | 342 + .../api/node_modules/picomatch/lib/scan.js | 391 + .../api/node_modules/picomatch/lib/utils.js | 64 + .../api/node_modules/picomatch/package.json | 81 + .../api/node_modules/proxy-addr/HISTORY.md | 161 + .../app/api/node_modules/proxy-addr/LICENSE | 22 + .../app/api/node_modules/proxy-addr/README.md | 139 + .../app/api/node_modules/proxy-addr/index.js | 327 + .../api/node_modules/proxy-addr/package.json | 47 + tunestats/app/api/node_modules/psl/.env | 0 tunestats/app/api/node_modules/psl/LICENSE | 9 + tunestats/app/api/node_modules/psl/README.md | 211 + .../node_modules/psl/browserstack-logo.svg | 90 + .../app/api/node_modules/psl/data/rules.json | 9376 ++++++++++++++ .../app/api/node_modules/psl/dist/psl.js | 10187 ++++++++++++++++ .../app/api/node_modules/psl/dist/psl.min.js | 1 + tunestats/app/api/node_modules/psl/index.js | 269 + .../app/api/node_modules/psl/package.json | 43 + .../api/node_modules/pstree.remy/.travis.yml | 8 + .../app/api/node_modules/pstree.remy/LICENSE | 7 + .../api/node_modules/pstree.remy/README.md | 26 + .../api/node_modules/pstree.remy/lib/index.js | 37 + .../api/node_modules/pstree.remy/lib/tree.js | 37 + .../api/node_modules/pstree.remy/lib/utils.js | 53 + .../api/node_modules/pstree.remy/package.json | 33 + .../pstree.remy/tests/fixtures/index.js | 13 + .../pstree.remy/tests/fixtures/out1 | 10 + .../pstree.remy/tests/fixtures/out2 | 29 + .../pstree.remy/tests/index.test.js | 51 + .../api/node_modules/punycode/LICENSE-MIT.txt | 20 + .../app/api/node_modules/punycode/README.md | 148 + .../api/node_modules/punycode/package.json | 58 + .../api/node_modules/punycode/punycode.es6.js | 444 + .../app/api/node_modules/punycode/punycode.js | 443 + .../app/api/node_modules/qs/.editorconfig | 43 + tunestats/app/api/node_modules/qs/.eslintrc | 38 + .../api/node_modules/qs/.github/FUNDING.yml | 12 + tunestats/app/api/node_modules/qs/.nycrc | 13 + .../app/api/node_modules/qs/CHANGELOG.md | 546 + tunestats/app/api/node_modules/qs/LICENSE.md | 29 + tunestats/app/api/node_modules/qs/README.md | 625 + tunestats/app/api/node_modules/qs/dist/qs.js | 2054 ++++ .../app/api/node_modules/qs/lib/formats.js | 23 + .../app/api/node_modules/qs/lib/index.js | 11 + .../app/api/node_modules/qs/lib/parse.js | 263 + .../app/api/node_modules/qs/lib/stringify.js | 326 + .../app/api/node_modules/qs/lib/utils.js | 252 + .../app/api/node_modules/qs/package.json | 77 + .../app/api/node_modules/qs/test/parse.js | 855 ++ .../app/api/node_modules/qs/test/stringify.js | 909 ++ .../app/api/node_modules/qs/test/utils.js | 136 + .../api/node_modules/querystring/CHANGELOG.md | 42 + .../app/api/node_modules/querystring/LICENSE | 7 + .../api/node_modules/querystring/README.md | 22 + .../api/node_modules/querystring/decode.d.ts | 20 + .../api/node_modules/querystring/decode.js | 80 + .../api/node_modules/querystring/encode.d.ts | 18 + .../api/node_modules/querystring/encode.js | 64 + .../api/node_modules/querystring/index.d.ts | 8 + .../app/api/node_modules/querystring/index.js | 4 + .../api/node_modules/querystring/package.json | 35 + .../api/node_modules/range-parser/HISTORY.md | 56 + .../app/api/node_modules/range-parser/LICENSE | 23 + .../api/node_modules/range-parser/README.md | 84 + .../api/node_modules/range-parser/index.js | 162 + .../node_modules/range-parser/package.json | 44 + .../app/api/node_modules/raw-body/HISTORY.md | 308 + .../app/api/node_modules/raw-body/LICENSE | 22 + .../app/api/node_modules/raw-body/README.md | 223 + .../app/api/node_modules/raw-body/SECURITY.md | 24 + .../app/api/node_modules/raw-body/index.d.ts | 87 + .../app/api/node_modules/raw-body/index.js | 336 + .../api/node_modules/raw-body/package.json | 49 + .../app/api/node_modules/readdirp/LICENSE | 21 + .../app/api/node_modules/readdirp/README.md | 122 + .../app/api/node_modules/readdirp/index.d.ts | 43 + .../app/api/node_modules/readdirp/index.js | 287 + .../api/node_modules/readdirp/package.json | 122 + .../app/api/node_modules/request/CHANGELOG.md | 717 ++ .../app/api/node_modules/request/LICENSE | 55 + .../app/api/node_modules/request/README.md | 1133 ++ .../app/api/node_modules/request/index.js | 155 + .../app/api/node_modules/request/lib/auth.js | 167 + .../api/node_modules/request/lib/cookies.js | 38 + .../request/lib/getProxyFromURI.js | 79 + .../app/api/node_modules/request/lib/har.js | 205 + .../app/api/node_modules/request/lib/hawk.js | 89 + .../api/node_modules/request/lib/helpers.js | 66 + .../api/node_modules/request/lib/multipart.js | 112 + .../app/api/node_modules/request/lib/oauth.js | 148 + .../node_modules/request/lib/querystring.js | 50 + .../api/node_modules/request/lib/redirect.js | 154 + .../api/node_modules/request/lib/tunnel.js | 175 + .../request/node_modules/qs/.editorconfig | 43 + .../request/node_modules/qs/.eslintrc | 37 + .../node_modules/qs/.github/FUNDING.yml | 12 + .../request/node_modules/qs/.nycrc | 13 + .../request/node_modules/qs/CHANGELOG.md | 250 + .../request/node_modules/qs/LICENSE.md | 29 + .../request/node_modules/qs/README.md | 510 + .../request/node_modules/qs/bower.json | 21 + .../request/node_modules/qs/component.json | 15 + .../request/node_modules/qs/dist/qs.js | 648 + .../request/node_modules/qs/lib/formats.js | 18 + .../request/node_modules/qs/lib/index.js | 11 + .../request/node_modules/qs/lib/parse.js | 175 + .../request/node_modules/qs/lib/stringify.js | 217 + .../request/node_modules/qs/lib/utils.js | 215 + .../request/node_modules/qs/package.json | 54 + .../request/node_modules/qs/test/index.js | 7 + .../request/node_modules/qs/test/parse.js | 649 + .../request/node_modules/qs/test/stringify.js | 642 + .../request/node_modules/qs/test/utils.js | 65 + .../app/api/node_modules/request/package.json | 86 + .../app/api/node_modules/request/request.js | 1553 +++ .../app/api/node_modules/safe-buffer/LICENSE | 21 + .../api/node_modules/safe-buffer/README.md | 584 + .../api/node_modules/safe-buffer/index.d.ts | 187 + .../app/api/node_modules/safe-buffer/index.js | 65 + .../api/node_modules/safe-buffer/package.json | 51 + .../app/api/node_modules/safer-buffer/LICENSE | 21 + .../safer-buffer/Porting-Buffer.md | 268 + .../api/node_modules/safer-buffer/Readme.md | 156 + .../node_modules/safer-buffer/dangerous.js | 58 + .../node_modules/safer-buffer/package.json | 34 + .../api/node_modules/safer-buffer/safer.js | 77 + .../api/node_modules/safer-buffer/tests.js | 406 + tunestats/app/api/node_modules/semver/LICENSE | 15 + .../app/api/node_modules/semver/README.md | 654 + .../app/api/node_modules/semver/bin/semver.js | 188 + .../node_modules/semver/classes/comparator.js | 141 + .../api/node_modules/semver/classes/index.js | 5 + .../api/node_modules/semver/classes/range.js | 540 + .../api/node_modules/semver/classes/semver.js | 302 + .../node_modules/semver/functions/clean.js | 6 + .../api/node_modules/semver/functions/cmp.js | 52 + .../node_modules/semver/functions/coerce.js | 60 + .../semver/functions/compare-build.js | 7 + .../semver/functions/compare-loose.js | 3 + .../node_modules/semver/functions/compare.js | 5 + .../api/node_modules/semver/functions/diff.js | 65 + .../api/node_modules/semver/functions/eq.js | 3 + .../api/node_modules/semver/functions/gt.js | 3 + .../api/node_modules/semver/functions/gte.js | 3 + .../api/node_modules/semver/functions/inc.js | 19 + .../api/node_modules/semver/functions/lt.js | 3 + .../api/node_modules/semver/functions/lte.js | 3 + .../node_modules/semver/functions/major.js | 3 + .../node_modules/semver/functions/minor.js | 3 + .../api/node_modules/semver/functions/neq.js | 3 + .../node_modules/semver/functions/parse.js | 16 + .../node_modules/semver/functions/patch.js | 3 + .../semver/functions/prerelease.js | 6 + .../node_modules/semver/functions/rcompare.js | 3 + .../node_modules/semver/functions/rsort.js | 3 + .../semver/functions/satisfies.js | 10 + .../api/node_modules/semver/functions/sort.js | 3 + .../node_modules/semver/functions/valid.js | 6 + .../app/api/node_modules/semver/index.js | 89 + .../node_modules/semver/internal/constants.js | 35 + .../api/node_modules/semver/internal/debug.js | 9 + .../semver/internal/identifiers.js | 23 + .../node_modules/semver/internal/lrucache.js | 40 + .../semver/internal/parse-options.js | 15 + .../api/node_modules/semver/internal/re.js | 217 + .../app/api/node_modules/semver/package.json | 77 + .../app/api/node_modules/semver/preload.js | 2 + .../app/api/node_modules/semver/range.bnf | 16 + .../app/api/node_modules/semver/ranges/gtr.js | 4 + .../node_modules/semver/ranges/intersects.js | 7 + .../app/api/node_modules/semver/ranges/ltr.js | 4 + .../semver/ranges/max-satisfying.js | 25 + .../semver/ranges/min-satisfying.js | 24 + .../node_modules/semver/ranges/min-version.js | 61 + .../api/node_modules/semver/ranges/outside.js | 80 + .../node_modules/semver/ranges/simplify.js | 47 + .../api/node_modules/semver/ranges/subset.js | 247 + .../semver/ranges/to-comparators.js | 8 + .../api/node_modules/semver/ranges/valid.js | 11 + .../app/api/node_modules/send/HISTORY.md | 521 + tunestats/app/api/node_modules/send/LICENSE | 23 + tunestats/app/api/node_modules/send/README.md | 327 + .../app/api/node_modules/send/SECURITY.md | 24 + tunestats/app/api/node_modules/send/index.js | 1143 ++ .../send/node_modules/ms/index.js | 162 + .../send/node_modules/ms/license.md | 21 + .../send/node_modules/ms/package.json | 38 + .../send/node_modules/ms/readme.md | 59 + .../app/api/node_modules/send/package.json | 62 + .../api/node_modules/serve-static/HISTORY.md | 471 + .../app/api/node_modules/serve-static/LICENSE | 25 + .../api/node_modules/serve-static/README.md | 257 + .../api/node_modules/serve-static/index.js | 210 + .../node_modules/serve-static/package.json | 42 + .../set-function-length/.eslintrc | 27 + .../set-function-length/.github/FUNDING.yml | 12 + .../node_modules/set-function-length/.nycrc | 13 + .../set-function-length/CHANGELOG.md | 70 + .../node_modules/set-function-length/LICENSE | 21 + .../set-function-length/README.md | 56 + .../node_modules/set-function-length/env.d.ts | 9 + .../node_modules/set-function-length/env.js | 25 + .../set-function-length/index.d.ts | 7 + .../node_modules/set-function-length/index.js | 42 + .../set-function-length/package.json | 102 + .../set-function-length/tsconfig.json | 9 + .../api/node_modules/setprototypeof/LICENSE | 13 + .../api/node_modules/setprototypeof/README.md | 31 + .../node_modules/setprototypeof/index.d.ts | 2 + .../api/node_modules/setprototypeof/index.js | 17 + .../node_modules/setprototypeof/package.json | 38 + .../node_modules/setprototypeof/test/index.js | 24 + .../node_modules/side-channel/.editorconfig | 9 + .../api/node_modules/side-channel/.eslintrc | 11 + .../side-channel/.github/FUNDING.yml | 12 + .../app/api/node_modules/side-channel/.nycrc | 13 + .../node_modules/side-channel/CHANGELOG.md | 95 + .../app/api/node_modules/side-channel/LICENSE | 21 + .../api/node_modules/side-channel/README.md | 2 + .../api/node_modules/side-channel/index.d.ts | 27 + .../api/node_modules/side-channel/index.js | 129 + .../node_modules/side-channel/package.json | 84 + .../node_modules/side-channel/test/index.js | 83 + .../node_modules/side-channel/tsconfig.json | 50 + .../simple-update-notifier/LICENSE | 21 + .../simple-update-notifier/README.md | 82 + .../simple-update-notifier/build/index.d.ts | 13 + .../simple-update-notifier/build/index.js | 210 + .../simple-update-notifier/package.json | 100 + .../src/borderedText.ts | 12 + .../simple-update-notifier/src/cache.spec.ts | 17 + .../simple-update-notifier/src/cache.ts | 44 + .../src/getDistVersion.spec.ts | 35 + .../src/getDistVersion.ts | 29 + .../src/hasNewVersion.spec.ts | 82 + .../src/hasNewVersion.ts | 40 + .../simple-update-notifier/src/index.spec.ts | 27 + .../simple-update-notifier/src/index.ts | 34 + .../simple-update-notifier/src/isNpmOrYarn.ts | 12 + .../simple-update-notifier/src/types.ts | 8 + .../app/api/node_modules/sshpk/.travis.yml | 11 + .../app/api/node_modules/sshpk/Jenkinsfile | 86 + tunestats/app/api/node_modules/sshpk/LICENSE | 18 + .../app/api/node_modules/sshpk/README.md | 804 ++ .../app/api/node_modules/sshpk/bin/sshpk-conv | 243 + .../app/api/node_modules/sshpk/bin/sshpk-sign | 191 + .../api/node_modules/sshpk/bin/sshpk-verify | 167 + .../app/api/node_modules/sshpk/lib/algs.js | 168 + .../api/node_modules/sshpk/lib/certificate.js | 410 + .../app/api/node_modules/sshpk/lib/dhe.js | 397 + .../api/node_modules/sshpk/lib/ed-compat.js | 92 + .../app/api/node_modules/sshpk/lib/errors.js | 84 + .../api/node_modules/sshpk/lib/fingerprint.js | 220 + .../node_modules/sshpk/lib/formats/auto.js | 124 + .../node_modules/sshpk/lib/formats/dnssec.js | 287 + .../sshpk/lib/formats/openssh-cert.js | 352 + .../api/node_modules/sshpk/lib/formats/pem.js | 290 + .../node_modules/sshpk/lib/formats/pkcs1.js | 373 + .../node_modules/sshpk/lib/formats/pkcs8.js | 643 + .../node_modules/sshpk/lib/formats/putty.js | 194 + .../node_modules/sshpk/lib/formats/rfc4253.js | 166 + .../sshpk/lib/formats/ssh-private.js | 262 + .../api/node_modules/sshpk/lib/formats/ssh.js | 115 + .../sshpk/lib/formats/x509-pem.js | 88 + .../node_modules/sshpk/lib/formats/x509.js | 752 ++ .../api/node_modules/sshpk/lib/identity.js | 373 + .../app/api/node_modules/sshpk/lib/index.js | 40 + .../app/api/node_modules/sshpk/lib/key.js | 294 + .../api/node_modules/sshpk/lib/private-key.js | 247 + .../api/node_modules/sshpk/lib/signature.js | 314 + .../api/node_modules/sshpk/lib/ssh-buffer.js | 149 + .../app/api/node_modules/sshpk/lib/utils.js | 404 + .../node_modules/sshpk/man/man1/sshpk-conv.1 | 135 + .../node_modules/sshpk/man/man1/sshpk-sign.1 | 81 + .../sshpk/man/man1/sshpk-verify.1 | 68 + .../app/api/node_modules/sshpk/package.json | 59 + .../app/api/node_modules/statuses/HISTORY.md | 82 + .../app/api/node_modules/statuses/LICENSE | 23 + .../app/api/node_modules/statuses/README.md | 136 + .../app/api/node_modules/statuses/codes.json | 65 + .../app/api/node_modules/statuses/index.js | 146 + .../api/node_modules/statuses/package.json | 49 + .../node_modules/supports-color/browser.js | 5 + .../api/node_modules/supports-color/index.js | 131 + .../api/node_modules/supports-color/license | 9 + .../node_modules/supports-color/package.json | 53 + .../api/node_modules/supports-color/readme.md | 66 + .../api/node_modules/to-regex-range/LICENSE | 21 + .../api/node_modules/to-regex-range/README.md | 305 + .../api/node_modules/to-regex-range/index.js | 288 + .../node_modules/to-regex-range/package.json | 88 + .../api/node_modules/toidentifier/HISTORY.md | 9 + .../app/api/node_modules/toidentifier/LICENSE | 21 + .../api/node_modules/toidentifier/README.md | 61 + .../api/node_modules/toidentifier/index.js | 32 + .../node_modules/toidentifier/package.json | 38 + tunestats/app/api/node_modules/touch/LICENSE | 15 + .../app/api/node_modules/touch/README.md | 52 + .../api/node_modules/touch/bin/nodetouch.js | 112 + tunestats/app/api/node_modules/touch/index.js | 224 + .../app/api/node_modules/touch/package.json | 25 + .../app/api/node_modules/tough-cookie/LICENSE | 12 + .../api/node_modules/tough-cookie/README.md | 527 + .../node_modules/tough-cookie/lib/cookie.js | 1482 +++ .../node_modules/tough-cookie/lib/memstore.js | 181 + .../tough-cookie/lib/pathMatch.js | 61 + .../tough-cookie/lib/permuteDomain.js | 56 + .../tough-cookie/lib/pubsuffix-psl.js | 38 + .../node_modules/tough-cookie/lib/store.js | 75 + .../node_modules/tough-cookie/lib/version.js | 2 + .../node_modules/tough-cookie/package.json | 78 + .../app/api/node_modules/tunnel-agent/LICENSE | 55 + .../api/node_modules/tunnel-agent/README.md | 4 + .../api/node_modules/tunnel-agent/index.js | 244 + .../node_modules/tunnel-agent/package.json | 22 + .../app/api/node_modules/tweetnacl/.npmignore | 4 + .../app/api/node_modules/tweetnacl/AUTHORS.md | 28 + .../api/node_modules/tweetnacl/CHANGELOG.md | 221 + .../app/api/node_modules/tweetnacl/LICENSE | 24 + .../tweetnacl/PULL_REQUEST_TEMPLATE.md | 20 + .../app/api/node_modules/tweetnacl/README.md | 459 + .../api/node_modules/tweetnacl/nacl-fast.js | 2388 ++++ .../node_modules/tweetnacl/nacl-fast.min.js | 2 + .../app/api/node_modules/tweetnacl/nacl.d.ts | 98 + .../app/api/node_modules/tweetnacl/nacl.js | 1175 ++ .../api/node_modules/tweetnacl/nacl.min.js | 1 + .../api/node_modules/tweetnacl/package.json | 58 + .../app/api/node_modules/type-is/HISTORY.md | 259 + .../app/api/node_modules/type-is/LICENSE | 23 + .../app/api/node_modules/type-is/README.md | 170 + .../app/api/node_modules/type-is/index.js | 266 + .../app/api/node_modules/type-is/package.json | 45 + .../undefsafe/.github/workflows/release.yml | 25 + .../app/api/node_modules/undefsafe/.jscsrc | 13 + .../app/api/node_modules/undefsafe/.jshintrc | 16 + .../api/node_modules/undefsafe/.travis.yml | 18 + .../app/api/node_modules/undefsafe/LICENSE | 22 + .../app/api/node_modules/undefsafe/README.md | 63 + .../app/api/node_modules/undefsafe/example.js | 14 + .../node_modules/undefsafe/lib/undefsafe.js | 125 + .../api/node_modules/undefsafe/package.json | 34 + .../app/api/node_modules/unpipe/HISTORY.md | 4 + tunestats/app/api/node_modules/unpipe/LICENSE | 22 + .../app/api/node_modules/unpipe/README.md | 43 + .../app/api/node_modules/unpipe/index.js | 69 + .../app/api/node_modules/unpipe/package.json | 27 + tunestats/app/api/node_modules/uri-js/LICENSE | 11 + .../app/api/node_modules/uri-js/README.md | 203 + .../node_modules/uri-js/dist/es5/uri.all.d.ts | 59 + .../node_modules/uri-js/dist/es5/uri.all.js | 1443 +++ .../uri-js/dist/es5/uri.all.js.map | 1 + .../uri-js/dist/es5/uri.all.min.d.ts | 59 + .../uri-js/dist/es5/uri.all.min.js | 3 + .../uri-js/dist/es5/uri.all.min.js.map | 1 + .../uri-js/dist/esnext/index.d.ts | 1 + .../node_modules/uri-js/dist/esnext/index.js | 17 + .../uri-js/dist/esnext/index.js.map | 1 + .../uri-js/dist/esnext/regexps-iri.d.ts | 3 + .../uri-js/dist/esnext/regexps-iri.js | 3 + .../uri-js/dist/esnext/regexps-iri.js.map | 1 + .../uri-js/dist/esnext/regexps-uri.d.ts | 4 + .../uri-js/dist/esnext/regexps-uri.js | 42 + .../uri-js/dist/esnext/regexps-uri.js.map | 1 + .../uri-js/dist/esnext/schemes/http.d.ts | 3 + .../uri-js/dist/esnext/schemes/http.js | 28 + .../uri-js/dist/esnext/schemes/http.js.map | 1 + .../uri-js/dist/esnext/schemes/https.d.ts | 3 + .../uri-js/dist/esnext/schemes/https.js | 9 + .../uri-js/dist/esnext/schemes/https.js.map | 1 + .../uri-js/dist/esnext/schemes/mailto.d.ts | 12 + .../uri-js/dist/esnext/schemes/mailto.js | 148 + .../uri-js/dist/esnext/schemes/mailto.js.map | 1 + .../uri-js/dist/esnext/schemes/urn-uuid.d.ts | 7 + .../uri-js/dist/esnext/schemes/urn-uuid.js | 23 + .../dist/esnext/schemes/urn-uuid.js.map | 1 + .../uri-js/dist/esnext/schemes/urn.d.ts | 10 + .../uri-js/dist/esnext/schemes/urn.js | 49 + .../uri-js/dist/esnext/schemes/urn.js.map | 1 + .../uri-js/dist/esnext/schemes/ws.d.ts | 7 + .../uri-js/dist/esnext/schemes/ws.js | 41 + .../uri-js/dist/esnext/schemes/ws.js.map | 1 + .../uri-js/dist/esnext/schemes/wss.d.ts | 3 + .../uri-js/dist/esnext/schemes/wss.js | 9 + .../uri-js/dist/esnext/schemes/wss.js.map | 1 + .../node_modules/uri-js/dist/esnext/uri.d.ts | 59 + .../node_modules/uri-js/dist/esnext/uri.js | 480 + .../uri-js/dist/esnext/uri.js.map | 1 + .../node_modules/uri-js/dist/esnext/util.d.ts | 6 + .../node_modules/uri-js/dist/esnext/util.js | 36 + .../uri-js/dist/esnext/util.js.map | 1 + .../app/api/node_modules/uri-js/package.json | 77 + .../app/api/node_modules/uri-js/yarn.lock | 2558 ++++ .../api/node_modules/utils-merge/.npmignore | 9 + .../app/api/node_modules/utils-merge/LICENSE | 20 + .../api/node_modules/utils-merge/README.md | 34 + .../app/api/node_modules/utils-merge/index.js | 23 + .../api/node_modules/utils-merge/package.json | 40 + tunestats/app/api/node_modules/uuid/AUTHORS | 5 + .../app/api/node_modules/uuid/CHANGELOG.md | 119 + .../app/api/node_modules/uuid/LICENSE.md | 21 + tunestats/app/api/node_modules/uuid/README.md | 276 + tunestats/app/api/node_modules/uuid/bin/uuid | 65 + tunestats/app/api/node_modules/uuid/index.js | 8 + .../api/node_modules/uuid/lib/bytesToUuid.js | 26 + .../api/node_modules/uuid/lib/md5-browser.js | 216 + .../app/api/node_modules/uuid/lib/md5.js | 25 + .../api/node_modules/uuid/lib/rng-browser.js | 34 + .../app/api/node_modules/uuid/lib/rng.js | 8 + .../api/node_modules/uuid/lib/sha1-browser.js | 89 + .../app/api/node_modules/uuid/lib/sha1.js | 25 + .../app/api/node_modules/uuid/lib/v35.js | 57 + .../app/api/node_modules/uuid/package.json | 49 + tunestats/app/api/node_modules/uuid/v1.js | 109 + tunestats/app/api/node_modules/uuid/v3.js | 4 + tunestats/app/api/node_modules/uuid/v4.js | 29 + tunestats/app/api/node_modules/uuid/v5.js | 3 + .../app/api/node_modules/vary/HISTORY.md | 39 + tunestats/app/api/node_modules/vary/LICENSE | 22 + tunestats/app/api/node_modules/vary/README.md | 101 + tunestats/app/api/node_modules/vary/index.js | 149 + .../app/api/node_modules/vary/package.json | 43 + .../app/api/node_modules/verror/.npmignore | 9 + .../app/api/node_modules/verror/CHANGES.md | 28 + .../api/node_modules/verror/CONTRIBUTING.md | 19 + tunestats/app/api/node_modules/verror/LICENSE | 19 + .../app/api/node_modules/verror/README.md | 528 + .../app/api/node_modules/verror/lib/verror.js | 451 + .../app/api/node_modules/verror/package.json | 22 + tunestats/app/api/package-lock.json | 1459 +++ tunestats/app/api/package.json | 18 + tunestats/app/components/footer.tsx | 51 + tunestats/app/dashboard/page.tsx | 39 + tunestats/app/favicon.ico | Bin 0 -> 25931 bytes tunestats/app/globals.css | 33 + tunestats/app/layout.tsx | 32 + tunestats/app/page.tsx | 20 + tunestats/next.config.mjs | 4 + tunestats/package-lock.json | 5321 ++++++++ tunestats/package.json | 31 + tunestats/postcss.config.mjs | 8 + tunestats/public/next.svg | 1 + tunestats/public/vercel.svg | 1 + tunestats/tailwind.config.ts | 22 + tunestats/tsconfig.json | 26 + 1412 files changed, 197004 insertions(+) rename .gitignore => old/.gitignore (100%) rename LICENSE.md => old/LICENSE.md (100%) rename README.md => old/README.md (100%) rename {client => old/client}/package-lock.json (100%) rename {client => old/client}/package.json (100%) rename {client => old/client}/public/Tunestats_Privacy_Policy.pdf (100%) rename {client => old/client}/public/favicon.ico (100%) rename {client => old/client}/public/google5c484243c5870197.html (100%) rename {client => old/client}/public/index.html (100%) rename {client => old/client}/public/logo192.png (100%) rename {client => old/client}/public/logo512.png (100%) rename {client => old/client}/public/manifest.json (100%) rename {client => old/client}/public/robots.txt (100%) rename {client => old/client}/public/sitemap.xml (100%) rename {client => old/client}/public/spotify_logo.png (100%) rename {client => old/client}/src/App.js (100%) rename {client => old/client}/src/assets/demo.png (100%) rename {client => old/client}/src/assets/style.css (100%) rename {client => old/client}/src/components/ArtistDisplay.js (100%) rename {client => old/client}/src/components/Footer.js (100%) rename {client => old/client}/src/components/Login.js (100%) rename {client => old/client}/src/components/NavBar.js (100%) rename {client => old/client}/src/components/SmallButton.js (100%) rename {client => old/client}/src/components/SmallButtonGroup.js (100%) rename {client => old/client}/src/components/SongDisplay.js (100%) rename {client => old/client}/src/components/Titles.js (100%) rename {client => old/client}/src/index.js (100%) rename deploy.sh => old/deploy.sh (100%) rename push.sh => old/push.sh (100%) rename {server => old/server}/index.js (100%) rename {server => old/server}/package-lock.json (100%) rename {server => old/server}/package.json (100%) rename {.github => old}/workflows/codeql-analysis.yml (100%) create mode 100644 tunestats/.eslintrc.json create mode 100644 tunestats/.gitignore create mode 100644 tunestats/README.md create mode 100644 tunestats/app/api/.env create mode 100644 tunestats/app/api/index.js create mode 120000 tunestats/app/api/node_modules/.bin/mime create mode 120000 tunestats/app/api/node_modules/.bin/nodemon create mode 120000 tunestats/app/api/node_modules/.bin/nodetouch create mode 120000 tunestats/app/api/node_modules/.bin/semver create mode 120000 tunestats/app/api/node_modules/.bin/sshpk-conv create mode 120000 tunestats/app/api/node_modules/.bin/sshpk-sign create mode 120000 tunestats/app/api/node_modules/.bin/sshpk-verify create mode 120000 tunestats/app/api/node_modules/.bin/uuid create mode 100644 tunestats/app/api/node_modules/.package-lock.json create mode 100644 tunestats/app/api/node_modules/accepts/HISTORY.md create mode 100644 tunestats/app/api/node_modules/accepts/LICENSE create mode 100644 tunestats/app/api/node_modules/accepts/README.md create mode 100644 tunestats/app/api/node_modules/accepts/index.js create mode 100644 tunestats/app/api/node_modules/accepts/package.json create mode 100644 tunestats/app/api/node_modules/ajv/.tonic_example.js create mode 100644 tunestats/app/api/node_modules/ajv/LICENSE create mode 100644 tunestats/app/api/node_modules/ajv/README.md create mode 100644 tunestats/app/api/node_modules/ajv/dist/ajv.bundle.js create mode 100644 tunestats/app/api/node_modules/ajv/dist/ajv.min.js create mode 100644 tunestats/app/api/node_modules/ajv/dist/ajv.min.js.map create mode 100644 tunestats/app/api/node_modules/ajv/lib/ajv.d.ts create mode 100644 tunestats/app/api/node_modules/ajv/lib/ajv.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/cache.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/async.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/equal.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/error_classes.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/formats.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/index.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/resolve.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/rules.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/schema_obj.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/ucs2length.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/compile/util.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/data.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/definition_schema.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/_limit.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/_limitItems.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/_limitLength.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/_limitProperties.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/allOf.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/anyOf.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/coerce.def create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/comment.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/const.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/contains.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/custom.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/defaults.def create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/definitions.def create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/dependencies.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/enum.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/errors.def create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/format.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/if.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/items.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/missing.def create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/multipleOf.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/not.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/oneOf.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/pattern.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/properties.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/propertyNames.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/ref.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/required.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/uniqueItems.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dot/validate.jst create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/README.md create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/_limit.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/_limitItems.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/_limitLength.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/_limitProperties.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/allOf.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/anyOf.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/comment.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/const.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/contains.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/custom.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/dependencies.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/enum.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/format.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/if.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/index.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/items.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/multipleOf.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/not.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/oneOf.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/pattern.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/properties.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/propertyNames.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/ref.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/required.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/uniqueItems.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/dotjs/validate.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/keyword.js create mode 100644 tunestats/app/api/node_modules/ajv/lib/refs/data.json create mode 100644 tunestats/app/api/node_modules/ajv/lib/refs/json-schema-draft-04.json create mode 100644 tunestats/app/api/node_modules/ajv/lib/refs/json-schema-draft-06.json create mode 100644 tunestats/app/api/node_modules/ajv/lib/refs/json-schema-draft-07.json create mode 100644 tunestats/app/api/node_modules/ajv/lib/refs/json-schema-secure.json create mode 100644 tunestats/app/api/node_modules/ajv/package.json create mode 100644 tunestats/app/api/node_modules/ajv/scripts/.eslintrc.yml create mode 100644 tunestats/app/api/node_modules/ajv/scripts/bundle.js create mode 100644 tunestats/app/api/node_modules/ajv/scripts/compile-dots.js create mode 100644 tunestats/app/api/node_modules/ajv/scripts/info create mode 100644 tunestats/app/api/node_modules/ajv/scripts/prepare-tests create mode 100644 tunestats/app/api/node_modules/ajv/scripts/publish-built-version create mode 100644 tunestats/app/api/node_modules/ajv/scripts/travis-gh-pages create mode 100644 tunestats/app/api/node_modules/anymatch/LICENSE create mode 100644 tunestats/app/api/node_modules/anymatch/README.md create mode 100644 tunestats/app/api/node_modules/anymatch/index.d.ts create mode 100644 tunestats/app/api/node_modules/anymatch/index.js create mode 100644 tunestats/app/api/node_modules/anymatch/package.json create mode 100644 tunestats/app/api/node_modules/array-flatten/LICENSE create mode 100644 tunestats/app/api/node_modules/array-flatten/README.md create mode 100644 tunestats/app/api/node_modules/array-flatten/array-flatten.js create mode 100644 tunestats/app/api/node_modules/array-flatten/package.json create mode 100644 tunestats/app/api/node_modules/asn1/Jenkinsfile create mode 100644 tunestats/app/api/node_modules/asn1/LICENSE create mode 100644 tunestats/app/api/node_modules/asn1/README.md create mode 100644 tunestats/app/api/node_modules/asn1/lib/ber/errors.js create mode 100644 tunestats/app/api/node_modules/asn1/lib/ber/index.js create mode 100644 tunestats/app/api/node_modules/asn1/lib/ber/reader.js create mode 100644 tunestats/app/api/node_modules/asn1/lib/ber/types.js create mode 100644 tunestats/app/api/node_modules/asn1/lib/ber/writer.js create mode 100644 tunestats/app/api/node_modules/asn1/lib/index.js create mode 100644 tunestats/app/api/node_modules/asn1/package.json create mode 100644 tunestats/app/api/node_modules/assert-plus/AUTHORS create mode 100644 tunestats/app/api/node_modules/assert-plus/CHANGES.md create mode 100644 tunestats/app/api/node_modules/assert-plus/README.md create mode 100644 tunestats/app/api/node_modules/assert-plus/assert.js create mode 100644 tunestats/app/api/node_modules/assert-plus/package.json create mode 100644 tunestats/app/api/node_modules/asynckit/LICENSE create mode 100644 tunestats/app/api/node_modules/asynckit/README.md create mode 100644 tunestats/app/api/node_modules/asynckit/bench.js create mode 100644 tunestats/app/api/node_modules/asynckit/index.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/abort.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/async.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/defer.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/iterate.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/readable_asynckit.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/readable_parallel.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/readable_serial.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/readable_serial_ordered.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/state.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/streamify.js create mode 100644 tunestats/app/api/node_modules/asynckit/lib/terminator.js create mode 100644 tunestats/app/api/node_modules/asynckit/package.json create mode 100644 tunestats/app/api/node_modules/asynckit/parallel.js create mode 100644 tunestats/app/api/node_modules/asynckit/serial.js create mode 100644 tunestats/app/api/node_modules/asynckit/serialOrdered.js create mode 100644 tunestats/app/api/node_modules/asynckit/stream.js create mode 100644 tunestats/app/api/node_modules/aws-sign2/LICENSE create mode 100644 tunestats/app/api/node_modules/aws-sign2/README.md create mode 100644 tunestats/app/api/node_modules/aws-sign2/index.js create mode 100644 tunestats/app/api/node_modules/aws-sign2/package.json create mode 100644 tunestats/app/api/node_modules/aws4/LICENSE create mode 100644 tunestats/app/api/node_modules/aws4/README.md create mode 100644 tunestats/app/api/node_modules/aws4/aws4.js create mode 100644 tunestats/app/api/node_modules/aws4/lru.js create mode 100644 tunestats/app/api/node_modules/aws4/package.json create mode 100644 tunestats/app/api/node_modules/balanced-match/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/balanced-match/LICENSE.md create mode 100644 tunestats/app/api/node_modules/balanced-match/README.md create mode 100644 tunestats/app/api/node_modules/balanced-match/index.js create mode 100644 tunestats/app/api/node_modules/balanced-match/package.json create mode 100644 tunestats/app/api/node_modules/bcrypt-pbkdf/CONTRIBUTING.md create mode 100644 tunestats/app/api/node_modules/bcrypt-pbkdf/LICENSE create mode 100644 tunestats/app/api/node_modules/bcrypt-pbkdf/README.md create mode 100644 tunestats/app/api/node_modules/bcrypt-pbkdf/index.js create mode 100644 tunestats/app/api/node_modules/bcrypt-pbkdf/package.json create mode 100644 tunestats/app/api/node_modules/binary-extensions/binary-extensions.json create mode 100644 tunestats/app/api/node_modules/binary-extensions/binary-extensions.json.d.ts create mode 100644 tunestats/app/api/node_modules/binary-extensions/index.d.ts create mode 100644 tunestats/app/api/node_modules/binary-extensions/index.js create mode 100644 tunestats/app/api/node_modules/binary-extensions/license create mode 100644 tunestats/app/api/node_modules/binary-extensions/package.json create mode 100644 tunestats/app/api/node_modules/binary-extensions/readme.md create mode 100644 tunestats/app/api/node_modules/body-parser/HISTORY.md create mode 100644 tunestats/app/api/node_modules/body-parser/LICENSE create mode 100644 tunestats/app/api/node_modules/body-parser/README.md create mode 100644 tunestats/app/api/node_modules/body-parser/SECURITY.md create mode 100644 tunestats/app/api/node_modules/body-parser/index.js create mode 100644 tunestats/app/api/node_modules/body-parser/lib/read.js create mode 100644 tunestats/app/api/node_modules/body-parser/lib/types/json.js create mode 100644 tunestats/app/api/node_modules/body-parser/lib/types/raw.js create mode 100644 tunestats/app/api/node_modules/body-parser/lib/types/text.js create mode 100644 tunestats/app/api/node_modules/body-parser/lib/types/urlencoded.js create mode 100644 tunestats/app/api/node_modules/body-parser/package.json create mode 100644 tunestats/app/api/node_modules/brace-expansion/LICENSE create mode 100644 tunestats/app/api/node_modules/brace-expansion/README.md create mode 100644 tunestats/app/api/node_modules/brace-expansion/index.js create mode 100644 tunestats/app/api/node_modules/brace-expansion/package.json create mode 100644 tunestats/app/api/node_modules/braces/LICENSE create mode 100644 tunestats/app/api/node_modules/braces/README.md create mode 100644 tunestats/app/api/node_modules/braces/index.js create mode 100644 tunestats/app/api/node_modules/braces/lib/compile.js create mode 100644 tunestats/app/api/node_modules/braces/lib/constants.js create mode 100644 tunestats/app/api/node_modules/braces/lib/expand.js create mode 100644 tunestats/app/api/node_modules/braces/lib/parse.js create mode 100644 tunestats/app/api/node_modules/braces/lib/stringify.js create mode 100644 tunestats/app/api/node_modules/braces/lib/utils.js create mode 100644 tunestats/app/api/node_modules/braces/package.json create mode 100644 tunestats/app/api/node_modules/bytes/History.md create mode 100644 tunestats/app/api/node_modules/bytes/LICENSE create mode 100644 tunestats/app/api/node_modules/bytes/Readme.md create mode 100644 tunestats/app/api/node_modules/bytes/index.js create mode 100644 tunestats/app/api/node_modules/bytes/package.json create mode 100644 tunestats/app/api/node_modules/call-bind/.eslintignore create mode 100644 tunestats/app/api/node_modules/call-bind/.eslintrc create mode 100644 tunestats/app/api/node_modules/call-bind/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/call-bind/.nycrc create mode 100644 tunestats/app/api/node_modules/call-bind/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/call-bind/LICENSE create mode 100644 tunestats/app/api/node_modules/call-bind/README.md create mode 100644 tunestats/app/api/node_modules/call-bind/callBound.js create mode 100644 tunestats/app/api/node_modules/call-bind/index.js create mode 100644 tunestats/app/api/node_modules/call-bind/package.json create mode 100644 tunestats/app/api/node_modules/call-bind/test/callBound.js create mode 100644 tunestats/app/api/node_modules/call-bind/test/index.js create mode 100644 tunestats/app/api/node_modules/caseless/LICENSE create mode 100644 tunestats/app/api/node_modules/caseless/README.md create mode 100644 tunestats/app/api/node_modules/caseless/index.js create mode 100644 tunestats/app/api/node_modules/caseless/package.json create mode 100644 tunestats/app/api/node_modules/caseless/test.js create mode 100644 tunestats/app/api/node_modules/chokidar/LICENSE create mode 100644 tunestats/app/api/node_modules/chokidar/README.md create mode 100644 tunestats/app/api/node_modules/chokidar/index.js create mode 100644 tunestats/app/api/node_modules/chokidar/lib/constants.js create mode 100644 tunestats/app/api/node_modules/chokidar/lib/fsevents-handler.js create mode 100644 tunestats/app/api/node_modules/chokidar/lib/nodefs-handler.js create mode 100644 tunestats/app/api/node_modules/chokidar/package.json create mode 100644 tunestats/app/api/node_modules/chokidar/types/index.d.ts create mode 100644 tunestats/app/api/node_modules/combined-stream/License create mode 100644 tunestats/app/api/node_modules/combined-stream/Readme.md create mode 100644 tunestats/app/api/node_modules/combined-stream/lib/combined_stream.js create mode 100644 tunestats/app/api/node_modules/combined-stream/package.json create mode 100644 tunestats/app/api/node_modules/combined-stream/yarn.lock create mode 100644 tunestats/app/api/node_modules/concat-map/.travis.yml create mode 100644 tunestats/app/api/node_modules/concat-map/LICENSE create mode 100644 tunestats/app/api/node_modules/concat-map/README.markdown create mode 100644 tunestats/app/api/node_modules/concat-map/example/map.js create mode 100644 tunestats/app/api/node_modules/concat-map/index.js create mode 100644 tunestats/app/api/node_modules/concat-map/package.json create mode 100644 tunestats/app/api/node_modules/concat-map/test/map.js create mode 100644 tunestats/app/api/node_modules/content-disposition/HISTORY.md create mode 100644 tunestats/app/api/node_modules/content-disposition/LICENSE create mode 100644 tunestats/app/api/node_modules/content-disposition/README.md create mode 100644 tunestats/app/api/node_modules/content-disposition/index.js create mode 100644 tunestats/app/api/node_modules/content-disposition/package.json create mode 100644 tunestats/app/api/node_modules/content-type/HISTORY.md create mode 100644 tunestats/app/api/node_modules/content-type/LICENSE create mode 100644 tunestats/app/api/node_modules/content-type/README.md create mode 100644 tunestats/app/api/node_modules/content-type/index.js create mode 100644 tunestats/app/api/node_modules/content-type/package.json create mode 100644 tunestats/app/api/node_modules/cookie-parser/HISTORY.md create mode 100644 tunestats/app/api/node_modules/cookie-parser/LICENSE create mode 100644 tunestats/app/api/node_modules/cookie-parser/README.md create mode 100644 tunestats/app/api/node_modules/cookie-parser/index.js create mode 100644 tunestats/app/api/node_modules/cookie-parser/package.json create mode 100644 tunestats/app/api/node_modules/cookie-signature/.npmignore create mode 100644 tunestats/app/api/node_modules/cookie-signature/History.md create mode 100644 tunestats/app/api/node_modules/cookie-signature/Readme.md create mode 100644 tunestats/app/api/node_modules/cookie-signature/index.js create mode 100644 tunestats/app/api/node_modules/cookie-signature/package.json create mode 100644 tunestats/app/api/node_modules/cookie/HISTORY.md create mode 100644 tunestats/app/api/node_modules/cookie/LICENSE create mode 100644 tunestats/app/api/node_modules/cookie/README.md create mode 100644 tunestats/app/api/node_modules/cookie/index.js create mode 100644 tunestats/app/api/node_modules/cookie/package.json create mode 100644 tunestats/app/api/node_modules/core-util-is/LICENSE create mode 100644 tunestats/app/api/node_modules/core-util-is/README.md create mode 100644 tunestats/app/api/node_modules/core-util-is/float.patch create mode 100644 tunestats/app/api/node_modules/core-util-is/lib/util.js create mode 100644 tunestats/app/api/node_modules/core-util-is/package.json create mode 100644 tunestats/app/api/node_modules/core-util-is/test.js create mode 100644 tunestats/app/api/node_modules/cors/CONTRIBUTING.md create mode 100644 tunestats/app/api/node_modules/cors/HISTORY.md create mode 100644 tunestats/app/api/node_modules/cors/LICENSE create mode 100644 tunestats/app/api/node_modules/cors/README.md create mode 100644 tunestats/app/api/node_modules/cors/lib/index.js create mode 100644 tunestats/app/api/node_modules/cors/package.json create mode 100644 tunestats/app/api/node_modules/dashdash/CHANGES.md create mode 100644 tunestats/app/api/node_modules/dashdash/LICENSE.txt create mode 100644 tunestats/app/api/node_modules/dashdash/README.md create mode 100644 tunestats/app/api/node_modules/dashdash/etc/dashdash.bash_completion.in create mode 100644 tunestats/app/api/node_modules/dashdash/lib/dashdash.js create mode 100644 tunestats/app/api/node_modules/dashdash/package.json create mode 100644 tunestats/app/api/node_modules/debug/.coveralls.yml create mode 100644 tunestats/app/api/node_modules/debug/.eslintrc create mode 100644 tunestats/app/api/node_modules/debug/.npmignore create mode 100644 tunestats/app/api/node_modules/debug/.travis.yml create mode 100644 tunestats/app/api/node_modules/debug/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/debug/LICENSE create mode 100644 tunestats/app/api/node_modules/debug/Makefile create mode 100644 tunestats/app/api/node_modules/debug/README.md create mode 100644 tunestats/app/api/node_modules/debug/component.json create mode 100644 tunestats/app/api/node_modules/debug/karma.conf.js create mode 100644 tunestats/app/api/node_modules/debug/node.js create mode 100644 tunestats/app/api/node_modules/debug/package.json create mode 100644 tunestats/app/api/node_modules/debug/src/browser.js create mode 100644 tunestats/app/api/node_modules/debug/src/debug.js create mode 100644 tunestats/app/api/node_modules/debug/src/index.js create mode 100644 tunestats/app/api/node_modules/debug/src/inspector-log.js create mode 100644 tunestats/app/api/node_modules/debug/src/node.js create mode 100644 tunestats/app/api/node_modules/define-data-property/.eslintrc create mode 100644 tunestats/app/api/node_modules/define-data-property/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/define-data-property/.nycrc create mode 100644 tunestats/app/api/node_modules/define-data-property/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/define-data-property/LICENSE create mode 100644 tunestats/app/api/node_modules/define-data-property/README.md create mode 100644 tunestats/app/api/node_modules/define-data-property/index.d.ts create mode 100644 tunestats/app/api/node_modules/define-data-property/index.js create mode 100644 tunestats/app/api/node_modules/define-data-property/package.json create mode 100644 tunestats/app/api/node_modules/define-data-property/test/index.js create mode 100644 tunestats/app/api/node_modules/define-data-property/tsconfig.json create mode 100644 tunestats/app/api/node_modules/delayed-stream/.npmignore create mode 100644 tunestats/app/api/node_modules/delayed-stream/License create mode 100644 tunestats/app/api/node_modules/delayed-stream/Makefile create mode 100644 tunestats/app/api/node_modules/delayed-stream/Readme.md create mode 100644 tunestats/app/api/node_modules/delayed-stream/lib/delayed_stream.js create mode 100644 tunestats/app/api/node_modules/delayed-stream/package.json create mode 100644 tunestats/app/api/node_modules/depd/History.md create mode 100644 tunestats/app/api/node_modules/depd/LICENSE create mode 100644 tunestats/app/api/node_modules/depd/Readme.md create mode 100644 tunestats/app/api/node_modules/depd/index.js create mode 100644 tunestats/app/api/node_modules/depd/lib/browser/index.js create mode 100644 tunestats/app/api/node_modules/depd/package.json create mode 100644 tunestats/app/api/node_modules/destroy/LICENSE create mode 100644 tunestats/app/api/node_modules/destroy/README.md create mode 100644 tunestats/app/api/node_modules/destroy/index.js create mode 100644 tunestats/app/api/node_modules/destroy/package.json create mode 100644 tunestats/app/api/node_modules/dotenv/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/dotenv/LICENSE create mode 100644 tunestats/app/api/node_modules/dotenv/README-es.md create mode 100644 tunestats/app/api/node_modules/dotenv/README.md create mode 100644 tunestats/app/api/node_modules/dotenv/config.d.ts create mode 100644 tunestats/app/api/node_modules/dotenv/config.js create mode 100644 tunestats/app/api/node_modules/dotenv/lib/cli-options.js create mode 100644 tunestats/app/api/node_modules/dotenv/lib/env-options.js create mode 100644 tunestats/app/api/node_modules/dotenv/lib/main.d.ts create mode 100644 tunestats/app/api/node_modules/dotenv/lib/main.js create mode 100644 tunestats/app/api/node_modules/dotenv/package.json create mode 100755 tunestats/app/api/node_modules/ecc-jsbn/LICENSE create mode 100755 tunestats/app/api/node_modules/ecc-jsbn/README.md create mode 100755 tunestats/app/api/node_modules/ecc-jsbn/index.js create mode 100755 tunestats/app/api/node_modules/ecc-jsbn/lib/LICENSE-jsbn create mode 100755 tunestats/app/api/node_modules/ecc-jsbn/lib/ec.js create mode 100755 tunestats/app/api/node_modules/ecc-jsbn/lib/sec.js create mode 100755 tunestats/app/api/node_modules/ecc-jsbn/package.json create mode 100755 tunestats/app/api/node_modules/ecc-jsbn/test.js create mode 100644 tunestats/app/api/node_modules/ee-first/LICENSE create mode 100644 tunestats/app/api/node_modules/ee-first/README.md create mode 100644 tunestats/app/api/node_modules/ee-first/index.js create mode 100644 tunestats/app/api/node_modules/ee-first/package.json create mode 100644 tunestats/app/api/node_modules/encodeurl/HISTORY.md create mode 100644 tunestats/app/api/node_modules/encodeurl/LICENSE create mode 100644 tunestats/app/api/node_modules/encodeurl/README.md create mode 100644 tunestats/app/api/node_modules/encodeurl/index.js create mode 100644 tunestats/app/api/node_modules/encodeurl/package.json create mode 100644 tunestats/app/api/node_modules/es-define-property/.eslintrc create mode 100644 tunestats/app/api/node_modules/es-define-property/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/es-define-property/.nycrc create mode 100644 tunestats/app/api/node_modules/es-define-property/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/es-define-property/LICENSE create mode 100644 tunestats/app/api/node_modules/es-define-property/README.md create mode 100644 tunestats/app/api/node_modules/es-define-property/index.d.ts create mode 100644 tunestats/app/api/node_modules/es-define-property/index.js create mode 100644 tunestats/app/api/node_modules/es-define-property/package.json create mode 100644 tunestats/app/api/node_modules/es-define-property/test/index.js create mode 100644 tunestats/app/api/node_modules/es-define-property/tsconfig.json create mode 100644 tunestats/app/api/node_modules/es-errors/.eslintrc create mode 100644 tunestats/app/api/node_modules/es-errors/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/es-errors/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/es-errors/LICENSE create mode 100644 tunestats/app/api/node_modules/es-errors/README.md create mode 100644 tunestats/app/api/node_modules/es-errors/eval.d.ts create mode 100644 tunestats/app/api/node_modules/es-errors/eval.js create mode 100644 tunestats/app/api/node_modules/es-errors/index.d.ts create mode 100644 tunestats/app/api/node_modules/es-errors/index.js create mode 100644 tunestats/app/api/node_modules/es-errors/package.json create mode 100644 tunestats/app/api/node_modules/es-errors/range.d.ts create mode 100644 tunestats/app/api/node_modules/es-errors/range.js create mode 100644 tunestats/app/api/node_modules/es-errors/ref.d.ts create mode 100644 tunestats/app/api/node_modules/es-errors/ref.js create mode 100644 tunestats/app/api/node_modules/es-errors/syntax.d.ts create mode 100644 tunestats/app/api/node_modules/es-errors/syntax.js create mode 100644 tunestats/app/api/node_modules/es-errors/test/index.js create mode 100644 tunestats/app/api/node_modules/es-errors/tsconfig.json create mode 100644 tunestats/app/api/node_modules/es-errors/type.d.ts create mode 100644 tunestats/app/api/node_modules/es-errors/type.js create mode 100644 tunestats/app/api/node_modules/es-errors/uri.d.ts create mode 100644 tunestats/app/api/node_modules/es-errors/uri.js create mode 100644 tunestats/app/api/node_modules/escape-html/LICENSE create mode 100644 tunestats/app/api/node_modules/escape-html/Readme.md create mode 100644 tunestats/app/api/node_modules/escape-html/index.js create mode 100644 tunestats/app/api/node_modules/escape-html/package.json create mode 100644 tunestats/app/api/node_modules/etag/HISTORY.md create mode 100644 tunestats/app/api/node_modules/etag/LICENSE create mode 100644 tunestats/app/api/node_modules/etag/README.md create mode 100644 tunestats/app/api/node_modules/etag/index.js create mode 100644 tunestats/app/api/node_modules/etag/package.json create mode 100644 tunestats/app/api/node_modules/express/History.md create mode 100644 tunestats/app/api/node_modules/express/LICENSE create mode 100644 tunestats/app/api/node_modules/express/Readme.md create mode 100644 tunestats/app/api/node_modules/express/index.js create mode 100644 tunestats/app/api/node_modules/express/lib/application.js create mode 100644 tunestats/app/api/node_modules/express/lib/express.js create mode 100644 tunestats/app/api/node_modules/express/lib/middleware/init.js create mode 100644 tunestats/app/api/node_modules/express/lib/middleware/query.js create mode 100644 tunestats/app/api/node_modules/express/lib/request.js create mode 100644 tunestats/app/api/node_modules/express/lib/response.js create mode 100644 tunestats/app/api/node_modules/express/lib/router/index.js create mode 100644 tunestats/app/api/node_modules/express/lib/router/layer.js create mode 100644 tunestats/app/api/node_modules/express/lib/router/route.js create mode 100644 tunestats/app/api/node_modules/express/lib/utils.js create mode 100644 tunestats/app/api/node_modules/express/lib/view.js create mode 100644 tunestats/app/api/node_modules/express/node_modules/cookie/HISTORY.md create mode 100644 tunestats/app/api/node_modules/express/node_modules/cookie/LICENSE create mode 100644 tunestats/app/api/node_modules/express/node_modules/cookie/README.md create mode 100644 tunestats/app/api/node_modules/express/node_modules/cookie/SECURITY.md create mode 100644 tunestats/app/api/node_modules/express/node_modules/cookie/index.js create mode 100644 tunestats/app/api/node_modules/express/node_modules/cookie/package.json create mode 100644 tunestats/app/api/node_modules/express/package.json create mode 100644 tunestats/app/api/node_modules/extend/.editorconfig create mode 100644 tunestats/app/api/node_modules/extend/.eslintrc create mode 100644 tunestats/app/api/node_modules/extend/.jscs.json create mode 100644 tunestats/app/api/node_modules/extend/.travis.yml create mode 100644 tunestats/app/api/node_modules/extend/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/extend/LICENSE create mode 100644 tunestats/app/api/node_modules/extend/README.md create mode 100644 tunestats/app/api/node_modules/extend/component.json create mode 100644 tunestats/app/api/node_modules/extend/index.js create mode 100644 tunestats/app/api/node_modules/extend/package.json create mode 100644 tunestats/app/api/node_modules/extsprintf/.gitmodules create mode 100644 tunestats/app/api/node_modules/extsprintf/.npmignore create mode 100644 tunestats/app/api/node_modules/extsprintf/LICENSE create mode 100644 tunestats/app/api/node_modules/extsprintf/Makefile create mode 100644 tunestats/app/api/node_modules/extsprintf/Makefile.targ create mode 100644 tunestats/app/api/node_modules/extsprintf/README.md create mode 100644 tunestats/app/api/node_modules/extsprintf/jsl.node.conf create mode 100644 tunestats/app/api/node_modules/extsprintf/lib/extsprintf.js create mode 100644 tunestats/app/api/node_modules/extsprintf/package.json create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/LICENSE create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/README.md create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/es6/index.d.ts create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/es6/index.js create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/es6/react.d.ts create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/es6/react.js create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/index.d.ts create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/index.js create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/package.json create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/react.d.ts create mode 100644 tunestats/app/api/node_modules/fast-deep-equal/react.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/.eslintrc.yml create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/.travis.yml create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/LICENSE create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/README.md create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/benchmark/index.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/benchmark/test.json create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/example/key_cmp.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/example/nested.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/example/str.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/example/value_cmp.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/index.d.ts create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/index.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/package.json create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/test/cmp.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/test/nested.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/test/str.js create mode 100644 tunestats/app/api/node_modules/fast-json-stable-stringify/test/to-json.js create mode 100644 tunestats/app/api/node_modules/fill-range/LICENSE create mode 100644 tunestats/app/api/node_modules/fill-range/README.md create mode 100644 tunestats/app/api/node_modules/fill-range/index.js create mode 100644 tunestats/app/api/node_modules/fill-range/package.json create mode 100644 tunestats/app/api/node_modules/finalhandler/HISTORY.md create mode 100644 tunestats/app/api/node_modules/finalhandler/LICENSE create mode 100644 tunestats/app/api/node_modules/finalhandler/README.md create mode 100644 tunestats/app/api/node_modules/finalhandler/SECURITY.md create mode 100644 tunestats/app/api/node_modules/finalhandler/index.js create mode 100644 tunestats/app/api/node_modules/finalhandler/package.json create mode 100644 tunestats/app/api/node_modules/forever-agent/LICENSE create mode 100644 tunestats/app/api/node_modules/forever-agent/README.md create mode 100644 tunestats/app/api/node_modules/forever-agent/index.js create mode 100644 tunestats/app/api/node_modules/forever-agent/package.json create mode 100644 tunestats/app/api/node_modules/form-data/License create mode 100644 tunestats/app/api/node_modules/form-data/README.md create mode 100644 tunestats/app/api/node_modules/form-data/README.md.bak create mode 100644 tunestats/app/api/node_modules/form-data/lib/browser.js create mode 100644 tunestats/app/api/node_modules/form-data/lib/form_data.js create mode 100644 tunestats/app/api/node_modules/form-data/lib/populate.js create mode 100644 tunestats/app/api/node_modules/form-data/package.json create mode 100644 tunestats/app/api/node_modules/form-data/yarn.lock create mode 100644 tunestats/app/api/node_modules/forwarded/HISTORY.md create mode 100644 tunestats/app/api/node_modules/forwarded/LICENSE create mode 100644 tunestats/app/api/node_modules/forwarded/README.md create mode 100644 tunestats/app/api/node_modules/forwarded/index.js create mode 100644 tunestats/app/api/node_modules/forwarded/package.json create mode 100644 tunestats/app/api/node_modules/fresh/HISTORY.md create mode 100644 tunestats/app/api/node_modules/fresh/LICENSE create mode 100644 tunestats/app/api/node_modules/fresh/README.md create mode 100644 tunestats/app/api/node_modules/fresh/index.js create mode 100644 tunestats/app/api/node_modules/fresh/package.json create mode 100644 tunestats/app/api/node_modules/function-bind/.eslintrc create mode 100644 tunestats/app/api/node_modules/function-bind/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/function-bind/.github/SECURITY.md create mode 100644 tunestats/app/api/node_modules/function-bind/.nycrc create mode 100644 tunestats/app/api/node_modules/function-bind/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/function-bind/LICENSE create mode 100644 tunestats/app/api/node_modules/function-bind/README.md create mode 100644 tunestats/app/api/node_modules/function-bind/implementation.js create mode 100644 tunestats/app/api/node_modules/function-bind/index.js create mode 100644 tunestats/app/api/node_modules/function-bind/package.json create mode 100644 tunestats/app/api/node_modules/function-bind/test/.eslintrc create mode 100644 tunestats/app/api/node_modules/function-bind/test/index.js create mode 100644 tunestats/app/api/node_modules/get-intrinsic/.eslintrc create mode 100644 tunestats/app/api/node_modules/get-intrinsic/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/get-intrinsic/.nycrc create mode 100644 tunestats/app/api/node_modules/get-intrinsic/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/get-intrinsic/LICENSE create mode 100644 tunestats/app/api/node_modules/get-intrinsic/README.md create mode 100644 tunestats/app/api/node_modules/get-intrinsic/index.js create mode 100644 tunestats/app/api/node_modules/get-intrinsic/package.json create mode 100644 tunestats/app/api/node_modules/get-intrinsic/test/GetIntrinsic.js create mode 100644 tunestats/app/api/node_modules/getpass/.npmignore create mode 100644 tunestats/app/api/node_modules/getpass/.travis.yml create mode 100644 tunestats/app/api/node_modules/getpass/LICENSE create mode 100644 tunestats/app/api/node_modules/getpass/README.md create mode 100644 tunestats/app/api/node_modules/getpass/lib/index.js create mode 100644 tunestats/app/api/node_modules/getpass/package.json create mode 100644 tunestats/app/api/node_modules/glob-parent/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/glob-parent/LICENSE create mode 100644 tunestats/app/api/node_modules/glob-parent/README.md create mode 100644 tunestats/app/api/node_modules/glob-parent/index.js create mode 100644 tunestats/app/api/node_modules/glob-parent/package.json create mode 100644 tunestats/app/api/node_modules/gopd/.eslintrc create mode 100644 tunestats/app/api/node_modules/gopd/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/gopd/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/gopd/LICENSE create mode 100644 tunestats/app/api/node_modules/gopd/README.md create mode 100644 tunestats/app/api/node_modules/gopd/index.js create mode 100644 tunestats/app/api/node_modules/gopd/package.json create mode 100644 tunestats/app/api/node_modules/gopd/test/index.js create mode 100644 tunestats/app/api/node_modules/har-schema/LICENSE create mode 100644 tunestats/app/api/node_modules/har-schema/README.md create mode 100644 tunestats/app/api/node_modules/har-schema/lib/afterRequest.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/beforeRequest.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/browser.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/cache.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/content.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/cookie.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/creator.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/entry.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/har.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/header.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/index.js create mode 100644 tunestats/app/api/node_modules/har-schema/lib/log.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/page.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/pageTimings.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/postData.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/query.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/request.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/response.json create mode 100644 tunestats/app/api/node_modules/har-schema/lib/timings.json create mode 100644 tunestats/app/api/node_modules/har-schema/package.json create mode 100644 tunestats/app/api/node_modules/har-validator/LICENSE create mode 100644 tunestats/app/api/node_modules/har-validator/README.md create mode 100644 tunestats/app/api/node_modules/har-validator/lib/async.js create mode 100644 tunestats/app/api/node_modules/har-validator/lib/error.js create mode 100644 tunestats/app/api/node_modules/har-validator/lib/promise.js create mode 100644 tunestats/app/api/node_modules/har-validator/package.json create mode 100644 tunestats/app/api/node_modules/has-flag/index.js create mode 100644 tunestats/app/api/node_modules/has-flag/license create mode 100644 tunestats/app/api/node_modules/has-flag/package.json create mode 100644 tunestats/app/api/node_modules/has-flag/readme.md create mode 100644 tunestats/app/api/node_modules/has-property-descriptors/.eslintrc create mode 100644 tunestats/app/api/node_modules/has-property-descriptors/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/has-property-descriptors/.nycrc create mode 100644 tunestats/app/api/node_modules/has-property-descriptors/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/has-property-descriptors/LICENSE create mode 100644 tunestats/app/api/node_modules/has-property-descriptors/README.md create mode 100644 tunestats/app/api/node_modules/has-property-descriptors/index.js create mode 100644 tunestats/app/api/node_modules/has-property-descriptors/package.json create mode 100644 tunestats/app/api/node_modules/has-property-descriptors/test/index.js create mode 100644 tunestats/app/api/node_modules/has-proto/.eslintrc create mode 100644 tunestats/app/api/node_modules/has-proto/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/has-proto/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/has-proto/LICENSE create mode 100644 tunestats/app/api/node_modules/has-proto/README.md create mode 100644 tunestats/app/api/node_modules/has-proto/index.d.ts create mode 100644 tunestats/app/api/node_modules/has-proto/index.js create mode 100644 tunestats/app/api/node_modules/has-proto/package.json create mode 100644 tunestats/app/api/node_modules/has-proto/test/index.js create mode 100644 tunestats/app/api/node_modules/has-proto/tsconfig.json create mode 100644 tunestats/app/api/node_modules/has-symbols/.eslintrc create mode 100644 tunestats/app/api/node_modules/has-symbols/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/has-symbols/.nycrc create mode 100644 tunestats/app/api/node_modules/has-symbols/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/has-symbols/LICENSE create mode 100644 tunestats/app/api/node_modules/has-symbols/README.md create mode 100644 tunestats/app/api/node_modules/has-symbols/index.js create mode 100644 tunestats/app/api/node_modules/has-symbols/package.json create mode 100644 tunestats/app/api/node_modules/has-symbols/shams.js create mode 100644 tunestats/app/api/node_modules/has-symbols/test/index.js create mode 100644 tunestats/app/api/node_modules/has-symbols/test/shams/core-js.js create mode 100644 tunestats/app/api/node_modules/has-symbols/test/shams/get-own-property-symbols.js create mode 100644 tunestats/app/api/node_modules/has-symbols/test/tests.js create mode 100644 tunestats/app/api/node_modules/hasown/.eslintrc create mode 100644 tunestats/app/api/node_modules/hasown/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/hasown/.nycrc create mode 100644 tunestats/app/api/node_modules/hasown/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/hasown/LICENSE create mode 100644 tunestats/app/api/node_modules/hasown/README.md create mode 100644 tunestats/app/api/node_modules/hasown/index.d.ts create mode 100644 tunestats/app/api/node_modules/hasown/index.js create mode 100644 tunestats/app/api/node_modules/hasown/package.json create mode 100644 tunestats/app/api/node_modules/hasown/tsconfig.json create mode 100644 tunestats/app/api/node_modules/http-errors/HISTORY.md create mode 100644 tunestats/app/api/node_modules/http-errors/LICENSE create mode 100644 tunestats/app/api/node_modules/http-errors/README.md create mode 100644 tunestats/app/api/node_modules/http-errors/index.js create mode 100644 tunestats/app/api/node_modules/http-errors/package.json create mode 100644 tunestats/app/api/node_modules/http-signature/.dir-locals.el create mode 100644 tunestats/app/api/node_modules/http-signature/.npmignore create mode 100644 tunestats/app/api/node_modules/http-signature/CHANGES.md create mode 100644 tunestats/app/api/node_modules/http-signature/LICENSE create mode 100644 tunestats/app/api/node_modules/http-signature/README.md create mode 100644 tunestats/app/api/node_modules/http-signature/http_signing.md create mode 100644 tunestats/app/api/node_modules/http-signature/lib/index.js create mode 100644 tunestats/app/api/node_modules/http-signature/lib/parser.js create mode 100644 tunestats/app/api/node_modules/http-signature/lib/signer.js create mode 100644 tunestats/app/api/node_modules/http-signature/lib/utils.js create mode 100644 tunestats/app/api/node_modules/http-signature/lib/verify.js create mode 100644 tunestats/app/api/node_modules/http-signature/package.json create mode 100644 tunestats/app/api/node_modules/iconv-lite/Changelog.md create mode 100644 tunestats/app/api/node_modules/iconv-lite/LICENSE create mode 100644 tunestats/app/api/node_modules/iconv-lite/README.md create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/dbcs-codec.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/dbcs-data.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/index.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/internal.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/sbcs-codec.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/sbcs-data-generated.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/sbcs-data.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/tables/big5-added.json create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/tables/cp936.json create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/tables/cp949.json create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/tables/cp950.json create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/tables/eucjp.json create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/tables/gb18030-ranges.json create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/tables/gbk-added.json create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/tables/shiftjis.json create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/utf16.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/encodings/utf7.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/lib/bom-handling.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/lib/extend-node.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/lib/index.d.ts create mode 100644 tunestats/app/api/node_modules/iconv-lite/lib/index.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/lib/streams.js create mode 100644 tunestats/app/api/node_modules/iconv-lite/package.json create mode 100644 tunestats/app/api/node_modules/ignore-by-default/LICENSE create mode 100644 tunestats/app/api/node_modules/ignore-by-default/README.md create mode 100644 tunestats/app/api/node_modules/ignore-by-default/index.js create mode 100644 tunestats/app/api/node_modules/ignore-by-default/package.json create mode 100644 tunestats/app/api/node_modules/inherits/LICENSE create mode 100644 tunestats/app/api/node_modules/inherits/README.md create mode 100644 tunestats/app/api/node_modules/inherits/inherits.js create mode 100644 tunestats/app/api/node_modules/inherits/inherits_browser.js create mode 100644 tunestats/app/api/node_modules/inherits/package.json create mode 100644 tunestats/app/api/node_modules/ipaddr.js/LICENSE create mode 100644 tunestats/app/api/node_modules/ipaddr.js/README.md create mode 100644 tunestats/app/api/node_modules/ipaddr.js/ipaddr.min.js create mode 100644 tunestats/app/api/node_modules/ipaddr.js/lib/ipaddr.js create mode 100644 tunestats/app/api/node_modules/ipaddr.js/lib/ipaddr.js.d.ts create mode 100644 tunestats/app/api/node_modules/ipaddr.js/package.json create mode 100644 tunestats/app/api/node_modules/is-binary-path/index.d.ts create mode 100644 tunestats/app/api/node_modules/is-binary-path/index.js create mode 100644 tunestats/app/api/node_modules/is-binary-path/license create mode 100644 tunestats/app/api/node_modules/is-binary-path/package.json create mode 100644 tunestats/app/api/node_modules/is-binary-path/readme.md create mode 100644 tunestats/app/api/node_modules/is-extglob/LICENSE create mode 100644 tunestats/app/api/node_modules/is-extglob/README.md create mode 100644 tunestats/app/api/node_modules/is-extglob/index.js create mode 100644 tunestats/app/api/node_modules/is-extglob/package.json create mode 100644 tunestats/app/api/node_modules/is-glob/LICENSE create mode 100644 tunestats/app/api/node_modules/is-glob/README.md create mode 100644 tunestats/app/api/node_modules/is-glob/index.js create mode 100644 tunestats/app/api/node_modules/is-glob/package.json create mode 100644 tunestats/app/api/node_modules/is-number/LICENSE create mode 100644 tunestats/app/api/node_modules/is-number/README.md create mode 100644 tunestats/app/api/node_modules/is-number/index.js create mode 100644 tunestats/app/api/node_modules/is-number/package.json create mode 100644 tunestats/app/api/node_modules/is-typedarray/LICENSE.md create mode 100644 tunestats/app/api/node_modules/is-typedarray/README.md create mode 100644 tunestats/app/api/node_modules/is-typedarray/index.js create mode 100644 tunestats/app/api/node_modules/is-typedarray/package.json create mode 100644 tunestats/app/api/node_modules/is-typedarray/test.js create mode 100644 tunestats/app/api/node_modules/isstream/.jshintrc create mode 100644 tunestats/app/api/node_modules/isstream/.npmignore create mode 100644 tunestats/app/api/node_modules/isstream/.travis.yml create mode 100644 tunestats/app/api/node_modules/isstream/LICENSE.md create mode 100644 tunestats/app/api/node_modules/isstream/README.md create mode 100644 tunestats/app/api/node_modules/isstream/isstream.js create mode 100644 tunestats/app/api/node_modules/isstream/package.json create mode 100644 tunestats/app/api/node_modules/isstream/test.js create mode 100644 tunestats/app/api/node_modules/jsbn/.npmignore create mode 100644 tunestats/app/api/node_modules/jsbn/LICENSE create mode 100644 tunestats/app/api/node_modules/jsbn/README.md create mode 100644 tunestats/app/api/node_modules/jsbn/example.html create mode 100644 tunestats/app/api/node_modules/jsbn/example.js create mode 100644 tunestats/app/api/node_modules/jsbn/index.js create mode 100644 tunestats/app/api/node_modules/jsbn/package.json create mode 100644 tunestats/app/api/node_modules/json-schema-traverse/.eslintrc.yml create mode 100644 tunestats/app/api/node_modules/json-schema-traverse/.travis.yml create mode 100644 tunestats/app/api/node_modules/json-schema-traverse/LICENSE create mode 100644 tunestats/app/api/node_modules/json-schema-traverse/README.md create mode 100644 tunestats/app/api/node_modules/json-schema-traverse/index.js create mode 100644 tunestats/app/api/node_modules/json-schema-traverse/package.json create mode 100644 tunestats/app/api/node_modules/json-schema-traverse/spec/.eslintrc.yml create mode 100644 tunestats/app/api/node_modules/json-schema-traverse/spec/fixtures/schema.js create mode 100644 tunestats/app/api/node_modules/json-schema-traverse/spec/index.spec.js create mode 100644 tunestats/app/api/node_modules/json-schema/LICENSE create mode 100644 tunestats/app/api/node_modules/json-schema/README.md create mode 100644 tunestats/app/api/node_modules/json-schema/lib/links.js create mode 100644 tunestats/app/api/node_modules/json-schema/lib/validate.js create mode 100644 tunestats/app/api/node_modules/json-schema/package.json create mode 100644 tunestats/app/api/node_modules/json-stringify-safe/.npmignore create mode 100644 tunestats/app/api/node_modules/json-stringify-safe/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/json-stringify-safe/LICENSE create mode 100644 tunestats/app/api/node_modules/json-stringify-safe/Makefile create mode 100644 tunestats/app/api/node_modules/json-stringify-safe/README.md create mode 100644 tunestats/app/api/node_modules/json-stringify-safe/package.json create mode 100644 tunestats/app/api/node_modules/json-stringify-safe/stringify.js create mode 100644 tunestats/app/api/node_modules/json-stringify-safe/test/mocha.opts create mode 100644 tunestats/app/api/node_modules/json-stringify-safe/test/stringify_test.js create mode 100644 tunestats/app/api/node_modules/jsprim/CHANGES.md create mode 100644 tunestats/app/api/node_modules/jsprim/CONTRIBUTING.md create mode 100644 tunestats/app/api/node_modules/jsprim/LICENSE create mode 100644 tunestats/app/api/node_modules/jsprim/README.md create mode 100644 tunestats/app/api/node_modules/jsprim/lib/jsprim.js create mode 100644 tunestats/app/api/node_modules/jsprim/package.json create mode 100644 tunestats/app/api/node_modules/media-typer/HISTORY.md create mode 100644 tunestats/app/api/node_modules/media-typer/LICENSE create mode 100644 tunestats/app/api/node_modules/media-typer/README.md create mode 100644 tunestats/app/api/node_modules/media-typer/index.js create mode 100644 tunestats/app/api/node_modules/media-typer/package.json create mode 100644 tunestats/app/api/node_modules/merge-descriptors/HISTORY.md create mode 100644 tunestats/app/api/node_modules/merge-descriptors/LICENSE create mode 100644 tunestats/app/api/node_modules/merge-descriptors/README.md create mode 100644 tunestats/app/api/node_modules/merge-descriptors/index.js create mode 100644 tunestats/app/api/node_modules/merge-descriptors/package.json create mode 100644 tunestats/app/api/node_modules/methods/HISTORY.md create mode 100644 tunestats/app/api/node_modules/methods/LICENSE create mode 100644 tunestats/app/api/node_modules/methods/README.md create mode 100644 tunestats/app/api/node_modules/methods/index.js create mode 100644 tunestats/app/api/node_modules/methods/package.json create mode 100644 tunestats/app/api/node_modules/mime-db/HISTORY.md create mode 100644 tunestats/app/api/node_modules/mime-db/LICENSE create mode 100644 tunestats/app/api/node_modules/mime-db/README.md create mode 100644 tunestats/app/api/node_modules/mime-db/db.json create mode 100644 tunestats/app/api/node_modules/mime-db/index.js create mode 100644 tunestats/app/api/node_modules/mime-db/package.json create mode 100644 tunestats/app/api/node_modules/mime-types/HISTORY.md create mode 100644 tunestats/app/api/node_modules/mime-types/LICENSE create mode 100644 tunestats/app/api/node_modules/mime-types/README.md create mode 100644 tunestats/app/api/node_modules/mime-types/index.js create mode 100644 tunestats/app/api/node_modules/mime-types/package.json create mode 100644 tunestats/app/api/node_modules/mime/.npmignore create mode 100644 tunestats/app/api/node_modules/mime/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/mime/LICENSE create mode 100644 tunestats/app/api/node_modules/mime/README.md create mode 100755 tunestats/app/api/node_modules/mime/cli.js create mode 100644 tunestats/app/api/node_modules/mime/mime.js create mode 100644 tunestats/app/api/node_modules/mime/package.json create mode 100755 tunestats/app/api/node_modules/mime/src/build.js create mode 100644 tunestats/app/api/node_modules/mime/src/test.js create mode 100644 tunestats/app/api/node_modules/mime/types.json create mode 100644 tunestats/app/api/node_modules/minimatch/LICENSE create mode 100644 tunestats/app/api/node_modules/minimatch/README.md create mode 100644 tunestats/app/api/node_modules/minimatch/minimatch.js create mode 100644 tunestats/app/api/node_modules/minimatch/package.json create mode 100644 tunestats/app/api/node_modules/ms/index.js create mode 100644 tunestats/app/api/node_modules/ms/license.md create mode 100644 tunestats/app/api/node_modules/ms/package.json create mode 100644 tunestats/app/api/node_modules/ms/readme.md create mode 100644 tunestats/app/api/node_modules/negotiator/HISTORY.md create mode 100644 tunestats/app/api/node_modules/negotiator/LICENSE create mode 100644 tunestats/app/api/node_modules/negotiator/README.md create mode 100644 tunestats/app/api/node_modules/negotiator/index.js create mode 100644 tunestats/app/api/node_modules/negotiator/lib/charset.js create mode 100644 tunestats/app/api/node_modules/negotiator/lib/encoding.js create mode 100644 tunestats/app/api/node_modules/negotiator/lib/language.js create mode 100644 tunestats/app/api/node_modules/negotiator/lib/mediaType.js create mode 100644 tunestats/app/api/node_modules/negotiator/package.json create mode 100644 tunestats/app/api/node_modules/nodemon/.prettierrc.json create mode 100644 tunestats/app/api/node_modules/nodemon/LICENSE create mode 100644 tunestats/app/api/node_modules/nodemon/README.md create mode 100755 tunestats/app/api/node_modules/nodemon/bin/nodemon.js create mode 100644 tunestats/app/api/node_modules/nodemon/bin/windows-kill.exe create mode 100644 tunestats/app/api/node_modules/nodemon/doc/cli/authors.txt create mode 100644 tunestats/app/api/node_modules/nodemon/doc/cli/config.txt create mode 100644 tunestats/app/api/node_modules/nodemon/doc/cli/help.txt create mode 100644 tunestats/app/api/node_modules/nodemon/doc/cli/logo.txt create mode 100644 tunestats/app/api/node_modules/nodemon/doc/cli/options.txt create mode 100644 tunestats/app/api/node_modules/nodemon/doc/cli/topics.txt create mode 100644 tunestats/app/api/node_modules/nodemon/doc/cli/usage.txt create mode 100644 tunestats/app/api/node_modules/nodemon/doc/cli/whoami.txt create mode 100644 tunestats/app/api/node_modules/nodemon/index.d.ts create mode 100644 tunestats/app/api/node_modules/nodemon/jsconfig.json create mode 100644 tunestats/app/api/node_modules/nodemon/lib/cli/index.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/cli/parse.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/config/command.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/config/defaults.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/config/exec.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/config/index.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/config/load.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/help/index.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/index.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/monitor/index.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/monitor/match.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/monitor/run.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/monitor/signals.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/monitor/watch.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/nodemon.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/rules/add.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/rules/index.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/rules/parse.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/spawn.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/utils/bus.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/utils/clone.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/utils/colour.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/utils/index.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/utils/log.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/utils/merge.js create mode 100644 tunestats/app/api/node_modules/nodemon/lib/version.js create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/debug/LICENSE create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/debug/README.md create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/debug/package.json create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/debug/src/browser.js create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/debug/src/common.js create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/debug/src/index.js create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/debug/src/node.js create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/ms/index.js create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/ms/license.md create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/ms/package.json create mode 100644 tunestats/app/api/node_modules/nodemon/node_modules/ms/readme.md create mode 100644 tunestats/app/api/node_modules/nodemon/package.json create mode 100644 tunestats/app/api/node_modules/normalize-path/LICENSE create mode 100644 tunestats/app/api/node_modules/normalize-path/README.md create mode 100644 tunestats/app/api/node_modules/normalize-path/index.js create mode 100644 tunestats/app/api/node_modules/normalize-path/package.json create mode 100644 tunestats/app/api/node_modules/oauth-sign/LICENSE create mode 100644 tunestats/app/api/node_modules/oauth-sign/README.md create mode 100644 tunestats/app/api/node_modules/oauth-sign/index.js create mode 100644 tunestats/app/api/node_modules/oauth-sign/package.json create mode 100644 tunestats/app/api/node_modules/object-assign/index.js create mode 100644 tunestats/app/api/node_modules/object-assign/license create mode 100644 tunestats/app/api/node_modules/object-assign/package.json create mode 100644 tunestats/app/api/node_modules/object-assign/readme.md create mode 100644 tunestats/app/api/node_modules/object-inspect/.eslintrc create mode 100644 tunestats/app/api/node_modules/object-inspect/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/object-inspect/.nycrc create mode 100644 tunestats/app/api/node_modules/object-inspect/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/object-inspect/LICENSE create mode 100644 tunestats/app/api/node_modules/object-inspect/example/all.js create mode 100644 tunestats/app/api/node_modules/object-inspect/example/circular.js create mode 100644 tunestats/app/api/node_modules/object-inspect/example/fn.js create mode 100644 tunestats/app/api/node_modules/object-inspect/example/inspect.js create mode 100644 tunestats/app/api/node_modules/object-inspect/index.js create mode 100644 tunestats/app/api/node_modules/object-inspect/package-support.json create mode 100644 tunestats/app/api/node_modules/object-inspect/package.json create mode 100644 tunestats/app/api/node_modules/object-inspect/readme.markdown create mode 100644 tunestats/app/api/node_modules/object-inspect/test-core-js.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/bigint.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/browser/dom.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/circular.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/deep.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/element.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/err.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/fakes.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/fn.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/global.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/has.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/holes.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/indent-option.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/inspect.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/lowbyte.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/number.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/quoteStyle.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/toStringTag.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/undef.js create mode 100644 tunestats/app/api/node_modules/object-inspect/test/values.js create mode 100644 tunestats/app/api/node_modules/object-inspect/util.inspect.js create mode 100644 tunestats/app/api/node_modules/on-finished/HISTORY.md create mode 100644 tunestats/app/api/node_modules/on-finished/LICENSE create mode 100644 tunestats/app/api/node_modules/on-finished/README.md create mode 100644 tunestats/app/api/node_modules/on-finished/index.js create mode 100644 tunestats/app/api/node_modules/on-finished/package.json create mode 100644 tunestats/app/api/node_modules/parseurl/HISTORY.md create mode 100644 tunestats/app/api/node_modules/parseurl/LICENSE create mode 100644 tunestats/app/api/node_modules/parseurl/README.md create mode 100644 tunestats/app/api/node_modules/parseurl/index.js create mode 100644 tunestats/app/api/node_modules/parseurl/package.json create mode 100644 tunestats/app/api/node_modules/path-to-regexp/History.md create mode 100644 tunestats/app/api/node_modules/path-to-regexp/LICENSE create mode 100644 tunestats/app/api/node_modules/path-to-regexp/Readme.md create mode 100644 tunestats/app/api/node_modules/path-to-regexp/index.js create mode 100644 tunestats/app/api/node_modules/path-to-regexp/package.json create mode 100644 tunestats/app/api/node_modules/performance-now/.npmignore create mode 100644 tunestats/app/api/node_modules/performance-now/.tm_properties create mode 100644 tunestats/app/api/node_modules/performance-now/.travis.yml create mode 100644 tunestats/app/api/node_modules/performance-now/README.md create mode 100644 tunestats/app/api/node_modules/performance-now/lib/performance-now.js create mode 100644 tunestats/app/api/node_modules/performance-now/lib/performance-now.js.map create mode 100644 tunestats/app/api/node_modules/performance-now/license.txt create mode 100644 tunestats/app/api/node_modules/performance-now/package.json create mode 100644 tunestats/app/api/node_modules/performance-now/src/index.d.ts create mode 100644 tunestats/app/api/node_modules/performance-now/src/performance-now.coffee create mode 100644 tunestats/app/api/node_modules/performance-now/test/mocha.opts create mode 100644 tunestats/app/api/node_modules/performance-now/test/performance-now.coffee create mode 100644 tunestats/app/api/node_modules/performance-now/test/scripts.coffee create mode 100755 tunestats/app/api/node_modules/performance-now/test/scripts/delayed-call.coffee create mode 100755 tunestats/app/api/node_modules/performance-now/test/scripts/delayed-require.coffee create mode 100755 tunestats/app/api/node_modules/performance-now/test/scripts/difference.coffee create mode 100755 tunestats/app/api/node_modules/performance-now/test/scripts/initial-value.coffee create mode 100644 tunestats/app/api/node_modules/picomatch/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/picomatch/LICENSE create mode 100644 tunestats/app/api/node_modules/picomatch/README.md create mode 100644 tunestats/app/api/node_modules/picomatch/index.js create mode 100644 tunestats/app/api/node_modules/picomatch/lib/constants.js create mode 100644 tunestats/app/api/node_modules/picomatch/lib/parse.js create mode 100644 tunestats/app/api/node_modules/picomatch/lib/picomatch.js create mode 100644 tunestats/app/api/node_modules/picomatch/lib/scan.js create mode 100644 tunestats/app/api/node_modules/picomatch/lib/utils.js create mode 100644 tunestats/app/api/node_modules/picomatch/package.json create mode 100644 tunestats/app/api/node_modules/proxy-addr/HISTORY.md create mode 100644 tunestats/app/api/node_modules/proxy-addr/LICENSE create mode 100644 tunestats/app/api/node_modules/proxy-addr/README.md create mode 100644 tunestats/app/api/node_modules/proxy-addr/index.js create mode 100644 tunestats/app/api/node_modules/proxy-addr/package.json create mode 100644 tunestats/app/api/node_modules/psl/.env create mode 100644 tunestats/app/api/node_modules/psl/LICENSE create mode 100644 tunestats/app/api/node_modules/psl/README.md create mode 100644 tunestats/app/api/node_modules/psl/browserstack-logo.svg create mode 100644 tunestats/app/api/node_modules/psl/data/rules.json create mode 100644 tunestats/app/api/node_modules/psl/dist/psl.js create mode 100644 tunestats/app/api/node_modules/psl/dist/psl.min.js create mode 100644 tunestats/app/api/node_modules/psl/index.js create mode 100644 tunestats/app/api/node_modules/psl/package.json create mode 100644 tunestats/app/api/node_modules/pstree.remy/.travis.yml create mode 100644 tunestats/app/api/node_modules/pstree.remy/LICENSE create mode 100644 tunestats/app/api/node_modules/pstree.remy/README.md create mode 100644 tunestats/app/api/node_modules/pstree.remy/lib/index.js create mode 100644 tunestats/app/api/node_modules/pstree.remy/lib/tree.js create mode 100644 tunestats/app/api/node_modules/pstree.remy/lib/utils.js create mode 100644 tunestats/app/api/node_modules/pstree.remy/package.json create mode 100644 tunestats/app/api/node_modules/pstree.remy/tests/fixtures/index.js create mode 100644 tunestats/app/api/node_modules/pstree.remy/tests/fixtures/out1 create mode 100644 tunestats/app/api/node_modules/pstree.remy/tests/fixtures/out2 create mode 100644 tunestats/app/api/node_modules/pstree.remy/tests/index.test.js create mode 100644 tunestats/app/api/node_modules/punycode/LICENSE-MIT.txt create mode 100644 tunestats/app/api/node_modules/punycode/README.md create mode 100644 tunestats/app/api/node_modules/punycode/package.json create mode 100644 tunestats/app/api/node_modules/punycode/punycode.es6.js create mode 100644 tunestats/app/api/node_modules/punycode/punycode.js create mode 100644 tunestats/app/api/node_modules/qs/.editorconfig create mode 100644 tunestats/app/api/node_modules/qs/.eslintrc create mode 100644 tunestats/app/api/node_modules/qs/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/qs/.nycrc create mode 100644 tunestats/app/api/node_modules/qs/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/qs/LICENSE.md create mode 100644 tunestats/app/api/node_modules/qs/README.md create mode 100644 tunestats/app/api/node_modules/qs/dist/qs.js create mode 100644 tunestats/app/api/node_modules/qs/lib/formats.js create mode 100644 tunestats/app/api/node_modules/qs/lib/index.js create mode 100644 tunestats/app/api/node_modules/qs/lib/parse.js create mode 100644 tunestats/app/api/node_modules/qs/lib/stringify.js create mode 100644 tunestats/app/api/node_modules/qs/lib/utils.js create mode 100644 tunestats/app/api/node_modules/qs/package.json create mode 100644 tunestats/app/api/node_modules/qs/test/parse.js create mode 100644 tunestats/app/api/node_modules/qs/test/stringify.js create mode 100644 tunestats/app/api/node_modules/qs/test/utils.js create mode 100644 tunestats/app/api/node_modules/querystring/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/querystring/LICENSE create mode 100644 tunestats/app/api/node_modules/querystring/README.md create mode 100644 tunestats/app/api/node_modules/querystring/decode.d.ts create mode 100644 tunestats/app/api/node_modules/querystring/decode.js create mode 100644 tunestats/app/api/node_modules/querystring/encode.d.ts create mode 100644 tunestats/app/api/node_modules/querystring/encode.js create mode 100644 tunestats/app/api/node_modules/querystring/index.d.ts create mode 100644 tunestats/app/api/node_modules/querystring/index.js create mode 100644 tunestats/app/api/node_modules/querystring/package.json create mode 100644 tunestats/app/api/node_modules/range-parser/HISTORY.md create mode 100644 tunestats/app/api/node_modules/range-parser/LICENSE create mode 100644 tunestats/app/api/node_modules/range-parser/README.md create mode 100644 tunestats/app/api/node_modules/range-parser/index.js create mode 100644 tunestats/app/api/node_modules/range-parser/package.json create mode 100644 tunestats/app/api/node_modules/raw-body/HISTORY.md create mode 100644 tunestats/app/api/node_modules/raw-body/LICENSE create mode 100644 tunestats/app/api/node_modules/raw-body/README.md create mode 100644 tunestats/app/api/node_modules/raw-body/SECURITY.md create mode 100644 tunestats/app/api/node_modules/raw-body/index.d.ts create mode 100644 tunestats/app/api/node_modules/raw-body/index.js create mode 100644 tunestats/app/api/node_modules/raw-body/package.json create mode 100644 tunestats/app/api/node_modules/readdirp/LICENSE create mode 100644 tunestats/app/api/node_modules/readdirp/README.md create mode 100644 tunestats/app/api/node_modules/readdirp/index.d.ts create mode 100644 tunestats/app/api/node_modules/readdirp/index.js create mode 100644 tunestats/app/api/node_modules/readdirp/package.json create mode 100644 tunestats/app/api/node_modules/request/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/request/LICENSE create mode 100644 tunestats/app/api/node_modules/request/README.md create mode 100755 tunestats/app/api/node_modules/request/index.js create mode 100644 tunestats/app/api/node_modules/request/lib/auth.js create mode 100644 tunestats/app/api/node_modules/request/lib/cookies.js create mode 100644 tunestats/app/api/node_modules/request/lib/getProxyFromURI.js create mode 100644 tunestats/app/api/node_modules/request/lib/har.js create mode 100644 tunestats/app/api/node_modules/request/lib/hawk.js create mode 100644 tunestats/app/api/node_modules/request/lib/helpers.js create mode 100644 tunestats/app/api/node_modules/request/lib/multipart.js create mode 100644 tunestats/app/api/node_modules/request/lib/oauth.js create mode 100644 tunestats/app/api/node_modules/request/lib/querystring.js create mode 100644 tunestats/app/api/node_modules/request/lib/redirect.js create mode 100644 tunestats/app/api/node_modules/request/lib/tunnel.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/.editorconfig create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/.eslintrc create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/.nycrc create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/LICENSE.md create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/README.md create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/bower.json create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/component.json create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/dist/qs.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/lib/formats.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/lib/index.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/lib/parse.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/lib/stringify.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/lib/utils.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/package.json create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/test/index.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/test/parse.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/test/stringify.js create mode 100644 tunestats/app/api/node_modules/request/node_modules/qs/test/utils.js create mode 100644 tunestats/app/api/node_modules/request/package.json create mode 100644 tunestats/app/api/node_modules/request/request.js create mode 100644 tunestats/app/api/node_modules/safe-buffer/LICENSE create mode 100644 tunestats/app/api/node_modules/safe-buffer/README.md create mode 100644 tunestats/app/api/node_modules/safe-buffer/index.d.ts create mode 100644 tunestats/app/api/node_modules/safe-buffer/index.js create mode 100644 tunestats/app/api/node_modules/safe-buffer/package.json create mode 100644 tunestats/app/api/node_modules/safer-buffer/LICENSE create mode 100644 tunestats/app/api/node_modules/safer-buffer/Porting-Buffer.md create mode 100644 tunestats/app/api/node_modules/safer-buffer/Readme.md create mode 100644 tunestats/app/api/node_modules/safer-buffer/dangerous.js create mode 100644 tunestats/app/api/node_modules/safer-buffer/package.json create mode 100644 tunestats/app/api/node_modules/safer-buffer/safer.js create mode 100644 tunestats/app/api/node_modules/safer-buffer/tests.js create mode 100644 tunestats/app/api/node_modules/semver/LICENSE create mode 100644 tunestats/app/api/node_modules/semver/README.md create mode 100755 tunestats/app/api/node_modules/semver/bin/semver.js create mode 100644 tunestats/app/api/node_modules/semver/classes/comparator.js create mode 100644 tunestats/app/api/node_modules/semver/classes/index.js create mode 100644 tunestats/app/api/node_modules/semver/classes/range.js create mode 100644 tunestats/app/api/node_modules/semver/classes/semver.js create mode 100644 tunestats/app/api/node_modules/semver/functions/clean.js create mode 100644 tunestats/app/api/node_modules/semver/functions/cmp.js create mode 100644 tunestats/app/api/node_modules/semver/functions/coerce.js create mode 100644 tunestats/app/api/node_modules/semver/functions/compare-build.js create mode 100644 tunestats/app/api/node_modules/semver/functions/compare-loose.js create mode 100644 tunestats/app/api/node_modules/semver/functions/compare.js create mode 100644 tunestats/app/api/node_modules/semver/functions/diff.js create mode 100644 tunestats/app/api/node_modules/semver/functions/eq.js create mode 100644 tunestats/app/api/node_modules/semver/functions/gt.js create mode 100644 tunestats/app/api/node_modules/semver/functions/gte.js create mode 100644 tunestats/app/api/node_modules/semver/functions/inc.js create mode 100644 tunestats/app/api/node_modules/semver/functions/lt.js create mode 100644 tunestats/app/api/node_modules/semver/functions/lte.js create mode 100644 tunestats/app/api/node_modules/semver/functions/major.js create mode 100644 tunestats/app/api/node_modules/semver/functions/minor.js create mode 100644 tunestats/app/api/node_modules/semver/functions/neq.js create mode 100644 tunestats/app/api/node_modules/semver/functions/parse.js create mode 100644 tunestats/app/api/node_modules/semver/functions/patch.js create mode 100644 tunestats/app/api/node_modules/semver/functions/prerelease.js create mode 100644 tunestats/app/api/node_modules/semver/functions/rcompare.js create mode 100644 tunestats/app/api/node_modules/semver/functions/rsort.js create mode 100644 tunestats/app/api/node_modules/semver/functions/satisfies.js create mode 100644 tunestats/app/api/node_modules/semver/functions/sort.js create mode 100644 tunestats/app/api/node_modules/semver/functions/valid.js create mode 100644 tunestats/app/api/node_modules/semver/index.js create mode 100644 tunestats/app/api/node_modules/semver/internal/constants.js create mode 100644 tunestats/app/api/node_modules/semver/internal/debug.js create mode 100644 tunestats/app/api/node_modules/semver/internal/identifiers.js create mode 100644 tunestats/app/api/node_modules/semver/internal/lrucache.js create mode 100644 tunestats/app/api/node_modules/semver/internal/parse-options.js create mode 100644 tunestats/app/api/node_modules/semver/internal/re.js create mode 100644 tunestats/app/api/node_modules/semver/package.json create mode 100644 tunestats/app/api/node_modules/semver/preload.js create mode 100644 tunestats/app/api/node_modules/semver/range.bnf create mode 100644 tunestats/app/api/node_modules/semver/ranges/gtr.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/intersects.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/ltr.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/max-satisfying.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/min-satisfying.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/min-version.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/outside.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/simplify.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/subset.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/to-comparators.js create mode 100644 tunestats/app/api/node_modules/semver/ranges/valid.js create mode 100644 tunestats/app/api/node_modules/send/HISTORY.md create mode 100644 tunestats/app/api/node_modules/send/LICENSE create mode 100644 tunestats/app/api/node_modules/send/README.md create mode 100644 tunestats/app/api/node_modules/send/SECURITY.md create mode 100644 tunestats/app/api/node_modules/send/index.js create mode 100644 tunestats/app/api/node_modules/send/node_modules/ms/index.js create mode 100644 tunestats/app/api/node_modules/send/node_modules/ms/license.md create mode 100644 tunestats/app/api/node_modules/send/node_modules/ms/package.json create mode 100644 tunestats/app/api/node_modules/send/node_modules/ms/readme.md create mode 100644 tunestats/app/api/node_modules/send/package.json create mode 100644 tunestats/app/api/node_modules/serve-static/HISTORY.md create mode 100644 tunestats/app/api/node_modules/serve-static/LICENSE create mode 100644 tunestats/app/api/node_modules/serve-static/README.md create mode 100644 tunestats/app/api/node_modules/serve-static/index.js create mode 100644 tunestats/app/api/node_modules/serve-static/package.json create mode 100644 tunestats/app/api/node_modules/set-function-length/.eslintrc create mode 100644 tunestats/app/api/node_modules/set-function-length/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/set-function-length/.nycrc create mode 100644 tunestats/app/api/node_modules/set-function-length/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/set-function-length/LICENSE create mode 100644 tunestats/app/api/node_modules/set-function-length/README.md create mode 100644 tunestats/app/api/node_modules/set-function-length/env.d.ts create mode 100644 tunestats/app/api/node_modules/set-function-length/env.js create mode 100644 tunestats/app/api/node_modules/set-function-length/index.d.ts create mode 100644 tunestats/app/api/node_modules/set-function-length/index.js create mode 100644 tunestats/app/api/node_modules/set-function-length/package.json create mode 100644 tunestats/app/api/node_modules/set-function-length/tsconfig.json create mode 100644 tunestats/app/api/node_modules/setprototypeof/LICENSE create mode 100644 tunestats/app/api/node_modules/setprototypeof/README.md create mode 100644 tunestats/app/api/node_modules/setprototypeof/index.d.ts create mode 100644 tunestats/app/api/node_modules/setprototypeof/index.js create mode 100644 tunestats/app/api/node_modules/setprototypeof/package.json create mode 100644 tunestats/app/api/node_modules/setprototypeof/test/index.js create mode 100644 tunestats/app/api/node_modules/side-channel/.editorconfig create mode 100644 tunestats/app/api/node_modules/side-channel/.eslintrc create mode 100644 tunestats/app/api/node_modules/side-channel/.github/FUNDING.yml create mode 100644 tunestats/app/api/node_modules/side-channel/.nycrc create mode 100644 tunestats/app/api/node_modules/side-channel/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/side-channel/LICENSE create mode 100644 tunestats/app/api/node_modules/side-channel/README.md create mode 100644 tunestats/app/api/node_modules/side-channel/index.d.ts create mode 100644 tunestats/app/api/node_modules/side-channel/index.js create mode 100644 tunestats/app/api/node_modules/side-channel/package.json create mode 100644 tunestats/app/api/node_modules/side-channel/test/index.js create mode 100644 tunestats/app/api/node_modules/side-channel/tsconfig.json create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/LICENSE create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/README.md create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/build/index.d.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/build/index.js create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/package.json create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/borderedText.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/cache.spec.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/cache.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/getDistVersion.spec.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/getDistVersion.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/hasNewVersion.spec.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/hasNewVersion.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/index.spec.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/index.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/isNpmOrYarn.ts create mode 100644 tunestats/app/api/node_modules/simple-update-notifier/src/types.ts create mode 100644 tunestats/app/api/node_modules/sshpk/.travis.yml create mode 100644 tunestats/app/api/node_modules/sshpk/Jenkinsfile create mode 100644 tunestats/app/api/node_modules/sshpk/LICENSE create mode 100644 tunestats/app/api/node_modules/sshpk/README.md create mode 100755 tunestats/app/api/node_modules/sshpk/bin/sshpk-conv create mode 100755 tunestats/app/api/node_modules/sshpk/bin/sshpk-sign create mode 100755 tunestats/app/api/node_modules/sshpk/bin/sshpk-verify create mode 100644 tunestats/app/api/node_modules/sshpk/lib/algs.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/certificate.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/dhe.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/ed-compat.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/errors.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/fingerprint.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/auto.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/dnssec.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/openssh-cert.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/pem.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/pkcs1.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/pkcs8.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/putty.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/rfc4253.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/ssh-private.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/ssh.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/x509-pem.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/formats/x509.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/identity.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/index.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/key.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/private-key.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/signature.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/ssh-buffer.js create mode 100644 tunestats/app/api/node_modules/sshpk/lib/utils.js create mode 100644 tunestats/app/api/node_modules/sshpk/man/man1/sshpk-conv.1 create mode 100644 tunestats/app/api/node_modules/sshpk/man/man1/sshpk-sign.1 create mode 100644 tunestats/app/api/node_modules/sshpk/man/man1/sshpk-verify.1 create mode 100644 tunestats/app/api/node_modules/sshpk/package.json create mode 100644 tunestats/app/api/node_modules/statuses/HISTORY.md create mode 100644 tunestats/app/api/node_modules/statuses/LICENSE create mode 100644 tunestats/app/api/node_modules/statuses/README.md create mode 100644 tunestats/app/api/node_modules/statuses/codes.json create mode 100644 tunestats/app/api/node_modules/statuses/index.js create mode 100644 tunestats/app/api/node_modules/statuses/package.json create mode 100644 tunestats/app/api/node_modules/supports-color/browser.js create mode 100644 tunestats/app/api/node_modules/supports-color/index.js create mode 100644 tunestats/app/api/node_modules/supports-color/license create mode 100644 tunestats/app/api/node_modules/supports-color/package.json create mode 100644 tunestats/app/api/node_modules/supports-color/readme.md create mode 100644 tunestats/app/api/node_modules/to-regex-range/LICENSE create mode 100644 tunestats/app/api/node_modules/to-regex-range/README.md create mode 100644 tunestats/app/api/node_modules/to-regex-range/index.js create mode 100644 tunestats/app/api/node_modules/to-regex-range/package.json create mode 100644 tunestats/app/api/node_modules/toidentifier/HISTORY.md create mode 100644 tunestats/app/api/node_modules/toidentifier/LICENSE create mode 100644 tunestats/app/api/node_modules/toidentifier/README.md create mode 100644 tunestats/app/api/node_modules/toidentifier/index.js create mode 100644 tunestats/app/api/node_modules/toidentifier/package.json create mode 100644 tunestats/app/api/node_modules/touch/LICENSE create mode 100644 tunestats/app/api/node_modules/touch/README.md create mode 100755 tunestats/app/api/node_modules/touch/bin/nodetouch.js create mode 100644 tunestats/app/api/node_modules/touch/index.js create mode 100644 tunestats/app/api/node_modules/touch/package.json create mode 100644 tunestats/app/api/node_modules/tough-cookie/LICENSE create mode 100644 tunestats/app/api/node_modules/tough-cookie/README.md create mode 100644 tunestats/app/api/node_modules/tough-cookie/lib/cookie.js create mode 100644 tunestats/app/api/node_modules/tough-cookie/lib/memstore.js create mode 100644 tunestats/app/api/node_modules/tough-cookie/lib/pathMatch.js create mode 100644 tunestats/app/api/node_modules/tough-cookie/lib/permuteDomain.js create mode 100644 tunestats/app/api/node_modules/tough-cookie/lib/pubsuffix-psl.js create mode 100644 tunestats/app/api/node_modules/tough-cookie/lib/store.js create mode 100644 tunestats/app/api/node_modules/tough-cookie/lib/version.js create mode 100644 tunestats/app/api/node_modules/tough-cookie/package.json create mode 100644 tunestats/app/api/node_modules/tunnel-agent/LICENSE create mode 100644 tunestats/app/api/node_modules/tunnel-agent/README.md create mode 100644 tunestats/app/api/node_modules/tunnel-agent/index.js create mode 100644 tunestats/app/api/node_modules/tunnel-agent/package.json create mode 100644 tunestats/app/api/node_modules/tweetnacl/.npmignore create mode 100644 tunestats/app/api/node_modules/tweetnacl/AUTHORS.md create mode 100644 tunestats/app/api/node_modules/tweetnacl/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/tweetnacl/LICENSE create mode 100644 tunestats/app/api/node_modules/tweetnacl/PULL_REQUEST_TEMPLATE.md create mode 100644 tunestats/app/api/node_modules/tweetnacl/README.md create mode 100644 tunestats/app/api/node_modules/tweetnacl/nacl-fast.js create mode 100644 tunestats/app/api/node_modules/tweetnacl/nacl-fast.min.js create mode 100644 tunestats/app/api/node_modules/tweetnacl/nacl.d.ts create mode 100644 tunestats/app/api/node_modules/tweetnacl/nacl.js create mode 100644 tunestats/app/api/node_modules/tweetnacl/nacl.min.js create mode 100644 tunestats/app/api/node_modules/tweetnacl/package.json create mode 100644 tunestats/app/api/node_modules/type-is/HISTORY.md create mode 100644 tunestats/app/api/node_modules/type-is/LICENSE create mode 100644 tunestats/app/api/node_modules/type-is/README.md create mode 100644 tunestats/app/api/node_modules/type-is/index.js create mode 100644 tunestats/app/api/node_modules/type-is/package.json create mode 100644 tunestats/app/api/node_modules/undefsafe/.github/workflows/release.yml create mode 100644 tunestats/app/api/node_modules/undefsafe/.jscsrc create mode 100644 tunestats/app/api/node_modules/undefsafe/.jshintrc create mode 100644 tunestats/app/api/node_modules/undefsafe/.travis.yml create mode 100644 tunestats/app/api/node_modules/undefsafe/LICENSE create mode 100644 tunestats/app/api/node_modules/undefsafe/README.md create mode 100644 tunestats/app/api/node_modules/undefsafe/example.js create mode 100644 tunestats/app/api/node_modules/undefsafe/lib/undefsafe.js create mode 100644 tunestats/app/api/node_modules/undefsafe/package.json create mode 100644 tunestats/app/api/node_modules/unpipe/HISTORY.md create mode 100644 tunestats/app/api/node_modules/unpipe/LICENSE create mode 100644 tunestats/app/api/node_modules/unpipe/README.md create mode 100644 tunestats/app/api/node_modules/unpipe/index.js create mode 100644 tunestats/app/api/node_modules/unpipe/package.json create mode 100755 tunestats/app/api/node_modules/uri-js/LICENSE create mode 100755 tunestats/app/api/node_modules/uri-js/README.md create mode 100755 tunestats/app/api/node_modules/uri-js/dist/es5/uri.all.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/es5/uri.all.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/es5/uri.all.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/es5/uri.all.min.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/es5/uri.all.min.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/es5/uri.all.min.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/index.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/index.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/index.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/regexps-iri.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/regexps-iri.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/regexps-iri.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/regexps-uri.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/regexps-uri.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/regexps-uri.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/http.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/http.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/http.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/https.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/https.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/https.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/mailto.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/mailto.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/mailto.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/urn-uuid.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/urn-uuid.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/urn-uuid.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/urn.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/urn.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/urn.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/ws.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/ws.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/ws.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/wss.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/wss.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/schemes/wss.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/uri.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/uri.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/uri.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/util.d.ts create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/util.js create mode 100755 tunestats/app/api/node_modules/uri-js/dist/esnext/util.js.map create mode 100755 tunestats/app/api/node_modules/uri-js/package.json create mode 100755 tunestats/app/api/node_modules/uri-js/yarn.lock create mode 100644 tunestats/app/api/node_modules/utils-merge/.npmignore create mode 100644 tunestats/app/api/node_modules/utils-merge/LICENSE create mode 100644 tunestats/app/api/node_modules/utils-merge/README.md create mode 100644 tunestats/app/api/node_modules/utils-merge/index.js create mode 100644 tunestats/app/api/node_modules/utils-merge/package.json create mode 100644 tunestats/app/api/node_modules/uuid/AUTHORS create mode 100644 tunestats/app/api/node_modules/uuid/CHANGELOG.md create mode 100644 tunestats/app/api/node_modules/uuid/LICENSE.md create mode 100644 tunestats/app/api/node_modules/uuid/README.md create mode 100755 tunestats/app/api/node_modules/uuid/bin/uuid create mode 100644 tunestats/app/api/node_modules/uuid/index.js create mode 100644 tunestats/app/api/node_modules/uuid/lib/bytesToUuid.js create mode 100644 tunestats/app/api/node_modules/uuid/lib/md5-browser.js create mode 100644 tunestats/app/api/node_modules/uuid/lib/md5.js create mode 100644 tunestats/app/api/node_modules/uuid/lib/rng-browser.js create mode 100644 tunestats/app/api/node_modules/uuid/lib/rng.js create mode 100644 tunestats/app/api/node_modules/uuid/lib/sha1-browser.js create mode 100644 tunestats/app/api/node_modules/uuid/lib/sha1.js create mode 100644 tunestats/app/api/node_modules/uuid/lib/v35.js create mode 100644 tunestats/app/api/node_modules/uuid/package.json create mode 100644 tunestats/app/api/node_modules/uuid/v1.js create mode 100644 tunestats/app/api/node_modules/uuid/v3.js create mode 100644 tunestats/app/api/node_modules/uuid/v4.js create mode 100644 tunestats/app/api/node_modules/uuid/v5.js create mode 100644 tunestats/app/api/node_modules/vary/HISTORY.md create mode 100644 tunestats/app/api/node_modules/vary/LICENSE create mode 100644 tunestats/app/api/node_modules/vary/README.md create mode 100644 tunestats/app/api/node_modules/vary/index.js create mode 100644 tunestats/app/api/node_modules/vary/package.json create mode 100644 tunestats/app/api/node_modules/verror/.npmignore create mode 100644 tunestats/app/api/node_modules/verror/CHANGES.md create mode 100644 tunestats/app/api/node_modules/verror/CONTRIBUTING.md create mode 100644 tunestats/app/api/node_modules/verror/LICENSE create mode 100644 tunestats/app/api/node_modules/verror/README.md create mode 100644 tunestats/app/api/node_modules/verror/lib/verror.js create mode 100644 tunestats/app/api/node_modules/verror/package.json create mode 100644 tunestats/app/api/package-lock.json create mode 100644 tunestats/app/api/package.json create mode 100644 tunestats/app/components/footer.tsx create mode 100644 tunestats/app/dashboard/page.tsx create mode 100644 tunestats/app/favicon.ico create mode 100644 tunestats/app/globals.css create mode 100644 tunestats/app/layout.tsx create mode 100644 tunestats/app/page.tsx create mode 100644 tunestats/next.config.mjs create mode 100644 tunestats/package-lock.json create mode 100644 tunestats/package.json create mode 100644 tunestats/postcss.config.mjs create mode 100644 tunestats/public/next.svg create mode 100644 tunestats/public/vercel.svg create mode 100644 tunestats/tailwind.config.ts create mode 100644 tunestats/tsconfig.json diff --git a/.gitignore b/old/.gitignore similarity index 100% rename from .gitignore rename to old/.gitignore diff --git a/LICENSE.md b/old/LICENSE.md similarity index 100% rename from LICENSE.md rename to old/LICENSE.md diff --git a/README.md b/old/README.md similarity index 100% rename from README.md rename to old/README.md diff --git a/client/package-lock.json b/old/client/package-lock.json similarity index 100% rename from client/package-lock.json rename to old/client/package-lock.json diff --git a/client/package.json b/old/client/package.json similarity index 100% rename from client/package.json rename to old/client/package.json diff --git a/client/public/Tunestats_Privacy_Policy.pdf b/old/client/public/Tunestats_Privacy_Policy.pdf similarity index 100% rename from client/public/Tunestats_Privacy_Policy.pdf rename to old/client/public/Tunestats_Privacy_Policy.pdf diff --git a/client/public/favicon.ico b/old/client/public/favicon.ico similarity index 100% rename from client/public/favicon.ico rename to old/client/public/favicon.ico diff --git a/client/public/google5c484243c5870197.html b/old/client/public/google5c484243c5870197.html similarity index 100% rename from client/public/google5c484243c5870197.html rename to old/client/public/google5c484243c5870197.html diff --git a/client/public/index.html b/old/client/public/index.html similarity index 100% rename from client/public/index.html rename to old/client/public/index.html diff --git a/client/public/logo192.png b/old/client/public/logo192.png similarity index 100% rename from client/public/logo192.png rename to old/client/public/logo192.png diff --git a/client/public/logo512.png b/old/client/public/logo512.png similarity index 100% rename from client/public/logo512.png rename to old/client/public/logo512.png diff --git a/client/public/manifest.json b/old/client/public/manifest.json similarity index 100% rename from client/public/manifest.json rename to old/client/public/manifest.json diff --git a/client/public/robots.txt b/old/client/public/robots.txt similarity index 100% rename from client/public/robots.txt rename to old/client/public/robots.txt diff --git a/client/public/sitemap.xml b/old/client/public/sitemap.xml similarity index 100% rename from client/public/sitemap.xml rename to old/client/public/sitemap.xml diff --git a/client/public/spotify_logo.png b/old/client/public/spotify_logo.png similarity index 100% rename from client/public/spotify_logo.png rename to old/client/public/spotify_logo.png diff --git a/client/src/App.js b/old/client/src/App.js similarity index 100% rename from client/src/App.js rename to old/client/src/App.js diff --git a/client/src/assets/demo.png b/old/client/src/assets/demo.png similarity index 100% rename from client/src/assets/demo.png rename to old/client/src/assets/demo.png diff --git a/client/src/assets/style.css b/old/client/src/assets/style.css similarity index 100% rename from client/src/assets/style.css rename to old/client/src/assets/style.css diff --git a/client/src/components/ArtistDisplay.js b/old/client/src/components/ArtistDisplay.js similarity index 100% rename from client/src/components/ArtistDisplay.js rename to old/client/src/components/ArtistDisplay.js diff --git a/client/src/components/Footer.js b/old/client/src/components/Footer.js similarity index 100% rename from client/src/components/Footer.js rename to old/client/src/components/Footer.js diff --git a/client/src/components/Login.js b/old/client/src/components/Login.js similarity index 100% rename from client/src/components/Login.js rename to old/client/src/components/Login.js diff --git a/client/src/components/NavBar.js b/old/client/src/components/NavBar.js similarity index 100% rename from client/src/components/NavBar.js rename to old/client/src/components/NavBar.js diff --git a/client/src/components/SmallButton.js b/old/client/src/components/SmallButton.js similarity index 100% rename from client/src/components/SmallButton.js rename to old/client/src/components/SmallButton.js diff --git a/client/src/components/SmallButtonGroup.js b/old/client/src/components/SmallButtonGroup.js similarity index 100% rename from client/src/components/SmallButtonGroup.js rename to old/client/src/components/SmallButtonGroup.js diff --git a/client/src/components/SongDisplay.js b/old/client/src/components/SongDisplay.js similarity index 100% rename from client/src/components/SongDisplay.js rename to old/client/src/components/SongDisplay.js diff --git a/client/src/components/Titles.js b/old/client/src/components/Titles.js similarity index 100% rename from client/src/components/Titles.js rename to old/client/src/components/Titles.js diff --git a/client/src/index.js b/old/client/src/index.js similarity index 100% rename from client/src/index.js rename to old/client/src/index.js diff --git a/deploy.sh b/old/deploy.sh similarity index 100% rename from deploy.sh rename to old/deploy.sh diff --git a/push.sh b/old/push.sh similarity index 100% rename from push.sh rename to old/push.sh diff --git a/server/index.js b/old/server/index.js similarity index 100% rename from server/index.js rename to old/server/index.js diff --git a/server/package-lock.json b/old/server/package-lock.json similarity index 100% rename from server/package-lock.json rename to old/server/package-lock.json diff --git a/server/package.json b/old/server/package.json similarity index 100% rename from server/package.json rename to old/server/package.json diff --git a/.github/workflows/codeql-analysis.yml b/old/workflows/codeql-analysis.yml similarity index 100% rename from .github/workflows/codeql-analysis.yml rename to old/workflows/codeql-analysis.yml diff --git a/tunestats/.eslintrc.json b/tunestats/.eslintrc.json new file mode 100644 index 0000000..bffb357 --- /dev/null +++ b/tunestats/.eslintrc.json @@ -0,0 +1,3 @@ +{ + "extends": "next/core-web-vitals" +} diff --git a/tunestats/.gitignore b/tunestats/.gitignore new file mode 100644 index 0000000..fd3dbb5 --- /dev/null +++ b/tunestats/.gitignore @@ -0,0 +1,36 @@ +# See https://help.github.com/articles/ignoring-files/ for more about ignoring files. + +# dependencies +/node_modules +/.pnp +.pnp.js +.yarn/install-state.gz + +# testing +/coverage + +# next.js +/.next/ +/out/ + +# production +/build + +# misc +.DS_Store +*.pem + +# debug +npm-debug.log* +yarn-debug.log* +yarn-error.log* + +# local env files +.env*.local + +# vercel +.vercel + +# typescript +*.tsbuildinfo +next-env.d.ts diff --git a/tunestats/README.md b/tunestats/README.md new file mode 100644 index 0000000..c403366 --- /dev/null +++ b/tunestats/README.md @@ -0,0 +1,36 @@ +This is a [Next.js](https://nextjs.org/) project bootstrapped with [`create-next-app`](https://github.com/vercel/next.js/tree/canary/packages/create-next-app). + +## Getting Started + +First, run the development server: + +```bash +npm run dev +# or +yarn dev +# or +pnpm dev +# or +bun dev +``` + +Open [http://localhost:3000](http://localhost:3000) with your browser to see the result. + +You can start editing the page by modifying `app/page.tsx`. The page auto-updates as you edit the file. + +This project uses [`next/font`](https://nextjs.org/docs/basic-features/font-optimization) to automatically optimize and load Inter, a custom Google Font. + +## Learn More + +To learn more about Next.js, take a look at the following resources: + +- [Next.js Documentation](https://nextjs.org/docs) - learn about Next.js features and API. +- [Learn Next.js](https://nextjs.org/learn) - an interactive Next.js tutorial. + +You can check out [the Next.js GitHub repository](https://github.com/vercel/next.js/) - your feedback and contributions are welcome! + +## Deploy on Vercel + +The easiest way to deploy your Next.js app is to use the [Vercel Platform](https://vercel.com/new?utm_medium=default-template&filter=next.js&utm_source=create-next-app&utm_campaign=create-next-app-readme) from the creators of Next.js. + +Check out our [Next.js deployment documentation](https://nextjs.org/docs/deployment) for more details. diff --git a/tunestats/app/api/.env b/tunestats/app/api/.env new file mode 100644 index 0000000..c2a4623 --- /dev/null +++ b/tunestats/app/api/.env @@ -0,0 +1,3 @@ +CLIENT_ID="e891e4a23a36475090f934c8d39766c7" +CLIENT_SECRET="b9e6536bd37e41a9b95ea5f8a1d2b7e7" +REDIRECT_URI="http://localhost:3001/callback" \ No newline at end of file diff --git a/tunestats/app/api/index.js b/tunestats/app/api/index.js new file mode 100644 index 0000000..b04830c --- /dev/null +++ b/tunestats/app/api/index.js @@ -0,0 +1,152 @@ +/** + * This is an example of a basic node.js script that performs + * the Authorization Code oAuth2 flow to authenticate against + * the Spotify Accounts. + * + * For more information, read + * https://developer.spotify.com/web-api/authorization-guide/#authorization_code_flow + */ +require('dotenv').config(); + +var express = require('express'); // Express web server framework +var request = require('request'); // "Request" library +var cors = require('cors'); +var querystring = require('querystring'); +var cookieParser = require('cookie-parser'); +var client_id = process.env.CLIENT_ID; // Your client id +var client_secret = process.env.CLIENT_SECRET; // Your secret + +var redirect_uri = process.env.REDIRECT_URI; // Your redirect uri + +/** + * Generates a random string containing numbers and letters + * @param {number} length The length of the string + * @return {string} The generated string + */ +var generateRandomString = function (length) { + var text = ''; + var possible = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789'; + + for (var i = 0; i < length; i++) { + text += possible.charAt(Math.floor(Math.random() * possible.length)); + } + return text; +}; + +var stateKey = 'spotify_auth_state'; + +var app = express(); + +app.use(express.static(__dirname + '/public')) + .use(cors()) + .use(cookieParser()); + +app.get('/login', function (req, res) { + + var state = generateRandomString(16); + res.cookie(stateKey, state); + + // your application requests authorization + var scope = 'user-top-read user-read-recently-played playlist-modify-public' + res.redirect('https://accounts.spotify.com/authorize?' + + querystring.stringify({ + response_type: 'code', + client_id: client_id, + scope: scope, + redirect_uri: redirect_uri, + state: state, + //show_dialog: true + })); +}); + +app.get('/callback', function (req, res) { + + // your application requests refresh and access tokens + // after checking the state parameter + + var code = req.query.code || null; + var state = req.query.state || null; + var storedState = req.cookies ? req.cookies[stateKey] : null; + + if (state === null || state !== storedState) { + res.redirect('/#' + + querystring.stringify({ + error: 'state_mismatch' + })); + } else { + res.clearCookie(stateKey); + var authOptions = { + url: 'https://accounts.spotify.com/api/token', + form: { + code: code, + redirect_uri: redirect_uri, + grant_type: 'authorization_code' + }, + headers: { + 'Authorization': 'Basic ' + (Buffer.from(client_id + ':' + client_secret).toString('base64')) + }, + json: true + }; + + request.post(authOptions, function (error, response, body) { + if (!error && response.statusCode === 200) { + + var access_token = body.access_token, + refresh_token = body.refresh_token; + + var options = { + url: 'https://api.spotify.com/v1/me', + headers: { 'Authorization': 'Bearer ' + access_token }, + json: true + }; + + // use the access token to access the Spotify Web API + request.get(options, function (error, response, body) { + //console.log(body); + }); + + // we can also pass the token to the browser to make requests from there + res.redirect('http://localhost:3000/dashboard/#' + + querystring.stringify({ + access_token: access_token, + refresh_token: refresh_token + })); + } else { + res.redirect('/#' + + querystring.stringify({ + error: 'invalid_token' + })); + } + }); + } +}); + +app.get('/refresh_token', function (req, res) { + + // requesting access token from refresh token + var refresh_token = req.query.refresh_token; + var authOptions = { + url: 'https://accounts.spotify.com/api/token', + headers: { 'Authorization': 'Basic ' + (Buffer.from(client_id + ':' + client_secret).toString('base64')) }, + form: { + grant_type: 'refresh_token', + refresh_token: refresh_token + }, + json: true + }; + + request.post(authOptions, function (error, response, body) { + if (!error && response.statusCode === 200) { + var access_token = body.access_token; + res.send({ + 'access_token': access_token + }); + } + }); +}); + +const PORT = process.env.PORT || 3001 + +app.listen(PORT, () => { + console.log(`Server listening on ${PORT}`); +}); diff --git a/tunestats/app/api/node_modules/.bin/mime b/tunestats/app/api/node_modules/.bin/mime new file mode 120000 index 0000000..fbb7ee0 --- /dev/null +++ b/tunestats/app/api/node_modules/.bin/mime @@ -0,0 +1 @@ +../mime/cli.js \ No newline at end of file diff --git a/tunestats/app/api/node_modules/.bin/nodemon b/tunestats/app/api/node_modules/.bin/nodemon new file mode 120000 index 0000000..1056ddc --- /dev/null +++ b/tunestats/app/api/node_modules/.bin/nodemon @@ -0,0 +1 @@ +../nodemon/bin/nodemon.js \ No newline at end of file diff --git a/tunestats/app/api/node_modules/.bin/nodetouch b/tunestats/app/api/node_modules/.bin/nodetouch new file mode 120000 index 0000000..3409fdb --- /dev/null +++ b/tunestats/app/api/node_modules/.bin/nodetouch @@ -0,0 +1 @@ +../touch/bin/nodetouch.js \ No newline at end of file diff --git a/tunestats/app/api/node_modules/.bin/semver b/tunestats/app/api/node_modules/.bin/semver new file mode 120000 index 0000000..5aaadf4 --- /dev/null +++ b/tunestats/app/api/node_modules/.bin/semver @@ -0,0 +1 @@ +../semver/bin/semver.js \ No newline at end of file diff --git a/tunestats/app/api/node_modules/.bin/sshpk-conv b/tunestats/app/api/node_modules/.bin/sshpk-conv new file mode 120000 index 0000000..a2a295c --- /dev/null +++ b/tunestats/app/api/node_modules/.bin/sshpk-conv @@ -0,0 +1 @@ +../sshpk/bin/sshpk-conv \ No newline at end of file diff --git a/tunestats/app/api/node_modules/.bin/sshpk-sign b/tunestats/app/api/node_modules/.bin/sshpk-sign new file mode 120000 index 0000000..766b9b3 --- /dev/null +++ b/tunestats/app/api/node_modules/.bin/sshpk-sign @@ -0,0 +1 @@ +../sshpk/bin/sshpk-sign \ No newline at end of file diff --git a/tunestats/app/api/node_modules/.bin/sshpk-verify b/tunestats/app/api/node_modules/.bin/sshpk-verify new file mode 120000 index 0000000..bfd7e3a --- /dev/null +++ b/tunestats/app/api/node_modules/.bin/sshpk-verify @@ -0,0 +1 @@ +../sshpk/bin/sshpk-verify \ No newline at end of file diff --git a/tunestats/app/api/node_modules/.bin/uuid b/tunestats/app/api/node_modules/.bin/uuid new file mode 120000 index 0000000..b3e45bc --- /dev/null +++ b/tunestats/app/api/node_modules/.bin/uuid @@ -0,0 +1 @@ +../uuid/bin/uuid \ No newline at end of file diff --git a/tunestats/app/api/node_modules/.package-lock.json b/tunestats/app/api/node_modules/.package-lock.json new file mode 100644 index 0000000..c45f3be --- /dev/null +++ b/tunestats/app/api/node_modules/.package-lock.json @@ -0,0 +1,1433 @@ +{ + "name": "web-api-auth-examples", + "version": "0.0.2", + "lockfileVersion": 3, + "requires": true, + "packages": { + "node_modules/accepts": { + "version": "1.3.8", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz", + "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==", + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/ajv": { + "version": "6.12.6", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", + "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", + "dependencies": { + "fast-deep-equal": "^3.1.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/epoberezkin" + } + }, + "node_modules/anymatch": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.3.tgz", + "integrity": "sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==", + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg==" + }, + "node_modules/asn1": { + "version": "0.2.6", + "resolved": "https://registry.npmjs.org/asn1/-/asn1-0.2.6.tgz", + "integrity": "sha512-ix/FxPn0MDjeyJ7i/yoHGFt/EX6LyNbxSEhPPXODPL+KB0VPk86UYfL0lMdy+KCnv+fmvIzySwaK5COwqVbWTQ==", + "dependencies": { + "safer-buffer": "~2.1.0" + } + }, + "node_modules/assert-plus": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/assert-plus/-/assert-plus-1.0.0.tgz", + "integrity": "sha512-NfJ4UzBCcQGLDlQq7nHxH+tv3kyZ0hHQqF5BO6J7tNJeP5do1llPr8dZ8zHonfhAu0PHAdMkSo+8o0wxg9lZWw==", + "engines": { + "node": ">=0.8" + } + }, + "node_modules/asynckit": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz", + "integrity": "sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q==" + }, + "node_modules/aws-sign2": { + "version": "0.7.0", + "resolved": "https://registry.npmjs.org/aws-sign2/-/aws-sign2-0.7.0.tgz", + "integrity": "sha512-08kcGqnYf/YmjoRhfxyu+CLxBjUtHLXLXX/vUfx9l2LYzG3c1m61nrpyFUZI6zeS+Li/wWMMidD9KgrqtGq3mA==", + "engines": { + "node": "*" + } + }, + "node_modules/aws4": { + "version": "1.13.0", + "resolved": "https://registry.npmjs.org/aws4/-/aws4-1.13.0.tgz", + "integrity": "sha512-3AungXC4I8kKsS9PuS4JH2nc+0bVY/mjgrephHTIi8fpEeGsTHBUJeosp0Wc1myYMElmD0B3Oc4XL/HVJ4PV2g==" + }, + "node_modules/balanced-match": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==" + }, + "node_modules/bcrypt-pbkdf": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.2.tgz", + "integrity": "sha512-qeFIXtP4MSoi6NLqO12WfqARWWuCKi2Rn/9hJLEmtB5yTNr9DqFWkJRCf2qShWzPeAMRnOgCrq0sg/KLv5ES9w==", + "dependencies": { + "tweetnacl": "^0.14.3" + } + }, + "node_modules/binary-extensions": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.3.0.tgz", + "integrity": "sha512-Ceh+7ox5qe7LJuLHoY0feh3pHuUDHAcRUeyL2VYghZwfpkNIy/+8Ocg0a3UuSoYzavmylwuLWQOf3hl0jjMMIw==", + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/body-parser": { + "version": "1.20.2", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.2.tgz", + "integrity": "sha512-ml9pReCu3M61kGlqoTm2umSXTlRTuGTx0bfYj+uIUKKYycG5NtSbeetV3faSU6R7ajOPw0g/J1PvK4qNy7s5bA==", + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.5", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.11.0", + "raw-body": "2.5.2", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + } + }, + "node_modules/brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/braces": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.3.tgz", + "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==", + "dependencies": { + "fill-range": "^7.1.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/bytes": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz", + "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/call-bind": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.7.tgz", + "integrity": "sha512-GHTSNSYICQ7scH7sZ+M2rFopRoLh8t2bLSW6BbgrtLsahOIB5iyAVJf9GjWK3cYTDaMj4XdBpM1cA6pIS0Kv2w==", + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.4", + "set-function-length": "^1.2.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/caseless": { + "version": "0.12.0", + "resolved": "https://registry.npmjs.org/caseless/-/caseless-0.12.0.tgz", + "integrity": "sha512-4tYFyifaFfGacoiObjJegolkwSU4xQNGbVgUiNYVUxbQ2x2lUsFvY4hVgVzGiIe6WLOPqycWXA40l+PWsxthUw==" + }, + "node_modules/chokidar": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.6.0.tgz", + "integrity": "sha512-7VT13fmjotKpGipCW9JEQAusEPE+Ei8nl6/g4FBAmIm0GOOLMua9NDDo/DWp0ZAxCr3cPq5ZpBqmPAQgDda2Pw==", + "dependencies": { + "anymatch": "~3.1.2", + "braces": "~3.0.2", + "glob-parent": "~5.1.2", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.6.0" + }, + "engines": { + "node": ">= 8.10.0" + }, + "funding": { + "url": "https://paulmillr.com/funding/" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + } + }, + "node_modules/combined-stream": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz", + "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==", + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==" + }, + "node_modules/content-disposition": { + "version": "0.5.4", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz", + "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==", + "dependencies": { + "safe-buffer": "5.2.1" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/content-type": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.5.tgz", + "integrity": "sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.4.1.tgz", + "integrity": "sha512-ZwrFkGJxUR3EIoXtO+yVE69Eb7KlixbaeAWfBQB9vVsNn/o+Yw69gBWSSDK825hQNdN+wF8zELf3dFNl/kxkUA==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie-parser": { + "version": "1.4.6", + "resolved": "https://registry.npmjs.org/cookie-parser/-/cookie-parser-1.4.6.tgz", + "integrity": "sha512-z3IzaNjdwUC2olLIB5/ITd0/setiaFMLYiZJle7xg5Fe9KWAceil7xszYfHHBtDFYLSgJduS2Ty0P1uJdPDJeA==", + "dependencies": { + "cookie": "0.4.1", + "cookie-signature": "1.0.6" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha512-QADzlaHc8icV8I7vbaJXJwod9HWYp8uCqf1xa4OfNu1T7JVxQIrUgOWtHdNDtPiywmFbiS12VjotIXLrKM3orQ==" + }, + "node_modules/core-util-is": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", + "integrity": "sha512-3lqz5YjWTYnW6dlDa5TLaTCcShfar1e40rmcJVwCBJC6mWlFuj0eCHIElmG1g5kyuJ/GD+8Wn4FFCcz4gJPfaQ==" + }, + "node_modules/cors": { + "version": "2.8.5", + "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.5.tgz", + "integrity": "sha512-KIHbLJqu73RGr/hnbrO9uBeixNGuvSQjul/jdFvS/KFSIH1hWVd1ng7zOHx+YrEfInLG7q4n6GHQ9cDtxv/P6g==", + "dependencies": { + "object-assign": "^4", + "vary": "^1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/dashdash": { + "version": "1.14.1", + "resolved": "https://registry.npmjs.org/dashdash/-/dashdash-1.14.1.tgz", + "integrity": "sha512-jRFi8UDGo6j+odZiEpjazZaWqEal3w/basFjQHQEwVtZJGDpxbH1MeYluwCS8Xq5wmLJooDlMgvVarmWfGM44g==", + "dependencies": { + "assert-plus": "^1.0.0" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/define-data-property": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/define-data-property/-/define-data-property-1.1.4.tgz", + "integrity": "sha512-rBMvIzlpA8v6E+SJZoo++HAYqsLrkg7MSfIinMPFhmkorw7X+dOXVJQs+QT69zGkzMyfDnIMN2Wid1+NbL3T+A==", + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "gopd": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/delayed-stream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz", + "integrity": "sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ==", + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/destroy": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.2.0.tgz", + "integrity": "sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==", + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + } + }, + "node_modules/dotenv": { + "version": "16.4.5", + "resolved": "https://registry.npmjs.org/dotenv/-/dotenv-16.4.5.tgz", + "integrity": "sha512-ZmdL2rui+eB2YwhsWzjInR8LldtZHGDoQ1ugH85ppHKwpUHL7j7rN0Ti9NCnGiQbhaZ11FpR+7ao1dNsmduNUg==", + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://dotenvx.com" + } + }, + "node_modules/ecc-jsbn": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/ecc-jsbn/-/ecc-jsbn-0.1.2.tgz", + "integrity": "sha512-eh9O+hwRHNbG4BLTjEl3nw044CkGm5X6LoaCf7LPp7UU8Qrt47JYNi6nPX8xjW97TKGKm1ouctg0QSpZe9qrnw==", + "dependencies": { + "jsbn": "~0.1.0", + "safer-buffer": "^2.1.0" + } + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==" + }, + "node_modules/encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/es-define-property": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.0.tgz", + "integrity": "sha512-jxayLKShrEqqzJ0eumQbVhTYQM27CfT1T35+gCgDFoL82JLsXqTJ76zv6A0YLOgEnLUMvLzsDsGIrl8NFpT2gQ==", + "dependencies": { + "get-intrinsic": "^1.2.4" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-errors": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz", + "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==" + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/express": { + "version": "4.19.2", + "resolved": "https://registry.npmjs.org/express/-/express-4.19.2.tgz", + "integrity": "sha512-5T6nhjsT+EOMzuck8JjBHARTHfMht0POzlA60WV2pMD3gyXw2LZnZ+ueGdNxG+0calOJcWKbpFcuzLZ91YWq9Q==", + "dependencies": { + "accepts": "~1.3.8", + "array-flatten": "1.1.1", + "body-parser": "1.20.2", + "content-disposition": "0.5.4", + "content-type": "~1.0.4", + "cookie": "0.6.0", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "2.0.0", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "1.2.0", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.7", + "proxy-addr": "~2.0.7", + "qs": "6.11.0", + "range-parser": "~1.2.1", + "safe-buffer": "5.2.1", + "send": "0.18.0", + "serve-static": "1.15.0", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + }, + "engines": { + "node": ">= 0.10.0" + } + }, + "node_modules/express/node_modules/cookie": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.6.0.tgz", + "integrity": "sha512-U71cyTamuh1CRNCfpGY6to28lxvNwPG4Guz/EVjgf3Jmzv0vlDp1atT9eS5dDjMYHucpHbWns6Lwf3BKz6svdw==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/extend": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/extend/-/extend-3.0.2.tgz", + "integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==" + }, + "node_modules/extsprintf": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/extsprintf/-/extsprintf-1.3.0.tgz", + "integrity": "sha512-11Ndz7Nv+mvAC1j0ktTa7fAb0vLyGGX+rMHNBYQviQDGU0Hw7lhctJANqbPhu9nV9/izT/IntTgZ7Im/9LJs9g==", + "engines": [ + "node >=0.6.0" + ] + }, + "node_modules/fast-deep-equal": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", + "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==" + }, + "node_modules/fast-json-stable-stringify": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", + "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==" + }, + "node_modules/fill-range": { + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.1.1.tgz", + "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==", + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/finalhandler": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.2.0.tgz", + "integrity": "sha512-5uXcUVftlQMFnWC9qu/svkWv3GTd2PfUhK/3PLkYNAe7FbqJMt3515HaxE6eRL74GdsriiwujiawdaB1BpEISg==", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "statuses": "2.0.1", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/forever-agent": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/forever-agent/-/forever-agent-0.6.1.tgz", + "integrity": "sha512-j0KLYPhm6zeac4lz3oJ3o65qvgQCcPubiyotZrXqEaG4hNagNYO8qdlUrX5vwqv9ohqeT/Z3j6+yW067yWWdUw==", + "engines": { + "node": "*" + } + }, + "node_modules/form-data": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/form-data/-/form-data-2.3.3.tgz", + "integrity": "sha512-1lLKB2Mu3aGP1Q/2eCOx0fNbRMe7XdwktwOruhfqqd0rIJWwN4Dh+E3hrPSlDCXnSR7UtZ1N38rVXm+6+MEhJQ==", + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "^1.0.6", + "mime-types": "^2.1.12" + }, + "engines": { + "node": ">= 0.12" + } + }, + "node_modules/forwarded": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz", + "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/fresh": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "integrity": "sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/function-bind": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", + "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/get-intrinsic": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.4.tgz", + "integrity": "sha512-5uYhsJH8VJBTv7oslg4BznJYhDoRI6waYCxMmCdnTrcCrHA/fCFKoTFz2JKKE0HdDFUF7/oQuhzumXJK7paBRQ==", + "dependencies": { + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "has-proto": "^1.0.1", + "has-symbols": "^1.0.3", + "hasown": "^2.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/getpass": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/getpass/-/getpass-0.1.7.tgz", + "integrity": "sha512-0fzj9JxOLfJ+XGLhR8ze3unN0KZCgZwiSSDz168VERjK8Wl8kVSdcu2kspd4s4wtAa1y/qrVRiAA0WclVsu0ng==", + "dependencies": { + "assert-plus": "^1.0.0" + } + }, + "node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/gopd": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.0.1.tgz", + "integrity": "sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==", + "dependencies": { + "get-intrinsic": "^1.1.3" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/har-schema": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/har-schema/-/har-schema-2.0.0.tgz", + "integrity": "sha512-Oqluz6zhGX8cyRaTQlFMPw80bSJVG2x/cFb8ZPhUILGgHka9SsokCCOQgpveePerqidZOrT14ipqfJb7ILcW5Q==", + "engines": { + "node": ">=4" + } + }, + "node_modules/har-validator": { + "version": "5.1.5", + "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.1.5.tgz", + "integrity": "sha512-nmT2T0lljbxdQZfspsno9hgrG3Uir6Ks5afism62poxqBM6sDnMEuPmzTq8XN0OEwqKLLdh1jQI3qyE66Nzb3w==", + "deprecated": "this library is no longer supported", + "dependencies": { + "ajv": "^6.12.3", + "har-schema": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/has-flag": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", + "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==", + "engines": { + "node": ">=4" + } + }, + "node_modules/has-property-descriptors": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/has-property-descriptors/-/has-property-descriptors-1.0.2.tgz", + "integrity": "sha512-55JNKuIW+vq4Ke1BjOTjM2YctQIvCT7GFzHwmfZPGo5wnrgkid0YQtnAleFSqumZm4az3n2BS+erby5ipJdgrg==", + "dependencies": { + "es-define-property": "^1.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-proto": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.3.tgz", + "integrity": "sha512-SJ1amZAJUiZS+PhsVLf5tGydlaVB8EdFpaSO4gmiUKUOxk8qzn5AIy4ZeJUmh22znIdk/uMAUT2pl3FxzVUH+Q==", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-symbols": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz", + "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/hasown": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz", + "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==", + "dependencies": { + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/http-errors": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz", + "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==", + "dependencies": { + "depd": "2.0.0", + "inherits": "2.0.4", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "toidentifier": "1.0.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/http-signature": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/http-signature/-/http-signature-1.2.0.tgz", + "integrity": "sha512-CAbnr6Rz4CYQkLYUtSNXxQPUH2gK8f3iWexVlsnMeD+GjlsQ0Xsy1cOX+mN3dtxYomRy21CiOzU8Uhw6OwncEQ==", + "dependencies": { + "assert-plus": "^1.0.0", + "jsprim": "^1.2.2", + "sshpk": "^1.7.0" + }, + "engines": { + "node": ">=0.8", + "npm": ">=1.3.7" + } + }, + "node_modules/iconv-lite": { + "version": "0.4.24", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/ignore-by-default": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/ignore-by-default/-/ignore-by-default-1.0.1.tgz", + "integrity": "sha512-Ius2VYcGNk7T90CppJqcIkS5ooHUZyIQK+ClZfMfMNFEF9VSE73Fq+906u/CWu92x4gzZMWOwfFYckPObzdEbA==" + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" + }, + "node_modules/ipaddr.js": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz", + "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dependencies": { + "binary-extensions": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/is-typedarray": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-typedarray/-/is-typedarray-1.0.0.tgz", + "integrity": "sha512-cyA56iCMHAh5CdzjJIa4aohJyeO1YbwLi3Jc35MmRU6poroFjIGZzUzupGiRPOjgHg9TLu43xbpwXk523fMxKA==" + }, + "node_modules/isstream": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/isstream/-/isstream-0.1.2.tgz", + "integrity": "sha512-Yljz7ffyPbrLpLngrMtZ7NduUgVvi6wG9RJ9IUcyCd59YQ911PBJphODUcbOVbqYfxe1wuYf/LJ8PauMRwsM/g==" + }, + "node_modules/jsbn": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/jsbn/-/jsbn-0.1.1.tgz", + "integrity": "sha512-UVU9dibq2JcFWxQPA6KCqj5O42VOmAY3zQUfEKxU0KpTGXwNoCjkX1e13eHNvw/xPynt6pU0rZ1htjWTNTSXsg==" + }, + "node_modules/json-schema": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/json-schema/-/json-schema-0.4.0.tgz", + "integrity": "sha512-es94M3nTIfsEPisRafak+HDLfHXnKBhV3vU5eqPcS3flIWqcxJWgXHXiey3YrpaNsanY5ei1VoYEbOzijuq9BA==" + }, + "node_modules/json-schema-traverse": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz", + "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==" + }, + "node_modules/json-stringify-safe": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz", + "integrity": "sha512-ZClg6AaYvamvYEE82d3Iyd3vSSIjQ+odgjaTzRuO3s7toCdFKczob2i0zCh7JE8kWn17yvAWhUVxvqGwUalsRA==" + }, + "node_modules/jsprim": { + "version": "1.4.2", + "resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.4.2.tgz", + "integrity": "sha512-P2bSOMAc/ciLz6DzgjVlGJP9+BrJWu5UDGK70C2iweC5QBIeFf0ZXRvGjEj2uYgrY2MkAAhsSWHDWlFtEroZWw==", + "dependencies": { + "assert-plus": "1.0.0", + "extsprintf": "1.3.0", + "json-schema": "0.4.0", + "verror": "1.10.0" + }, + "engines": { + "node": ">=0.6.0" + } + }, + "node_modules/media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha512-dq+qelQ9akHpcOl/gUVRTxVIOkAJ1wR3QAvb4RsVjS8oVoFjDGTc679wJYmUmknUF5HwMLOgb5O+a3KxfWapPQ==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/merge-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "integrity": "sha512-cCi6g3/Zr1iqQi6ySbseM1Xvooa98N0w31jzUYrXPX2xqObmFGHJ0tQ5u74H3mVh7wLouTseZyYIq39g8cNp1w==" + }, + "node_modules/methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha512-iclAHeNqNm68zFtnZ0e+1L2yUIdvzNoauKU4WBA3VvH/vPFieF7qfRlwUZU+DA9P9bPXIS90ulxoUoCH23sV2w==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/mime-db": { + "version": "1.52.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz", + "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.35", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz", + "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==", + "dependencies": { + "mime-db": "1.52.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A==" + }, + "node_modules/negotiator": { + "version": "0.6.3", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz", + "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/nodemon": { + "version": "3.1.4", + "resolved": "https://registry.npmjs.org/nodemon/-/nodemon-3.1.4.tgz", + "integrity": "sha512-wjPBbFhtpJwmIeY2yP7QF+UKzPfltVGtfce1g/bB15/8vCGZj8uxD62b/b9M9/WVgme0NZudpownKN+c0plXlQ==", + "dependencies": { + "chokidar": "^3.5.2", + "debug": "^4", + "ignore-by-default": "^1.0.1", + "minimatch": "^3.1.2", + "pstree.remy": "^1.1.8", + "semver": "^7.5.3", + "simple-update-notifier": "^2.0.0", + "supports-color": "^5.5.0", + "touch": "^3.1.0", + "undefsafe": "^2.0.5" + }, + "bin": { + "nodemon": "bin/nodemon.js" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/nodemon" + } + }, + "node_modules/nodemon/node_modules/debug": { + "version": "4.3.5", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.5.tgz", + "integrity": "sha512-pt0bNEmneDIvdL1Xsd9oDQ/wrQRkXDT4AUWlNZNPKvW5x/jyO9VFXkJUP07vQ2upmw5PlaITaPKc31jK13V+jg==", + "dependencies": { + "ms": "2.1.2" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/nodemon/node_modules/ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==" + }, + "node_modules/normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/oauth-sign": { + "version": "0.9.0", + "resolved": "https://registry.npmjs.org/oauth-sign/-/oauth-sign-0.9.0.tgz", + "integrity": "sha512-fexhUFFPTGV8ybAtSIGbV6gOkSv8UtRbDBnAyLQw4QPKkgNlsH2ByPGtMUqdWkos6YCRmAqViwgZrJc/mRDzZQ==", + "engines": { + "node": "*" + } + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-inspect": { + "version": "1.13.2", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.2.tgz", + "integrity": "sha512-IRZSRuzJiynemAXPYtPe5BoI/RESNYR7TYm50MC5Mqbd3Jmw5y790sErYw3V6SryFJD64b74qQQs9wn5Bg/k3g==", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/on-finished": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz", + "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/path-to-regexp": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "integrity": "sha512-5DFkuoqlv1uYQKxy8omFBeJPQcdoE07Kv2sferDCrAq1ohOU+MSDswDIbnx3YAM60qIOnYa53wBhXW0EbMonrQ==" + }, + "node_modules/performance-now": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/performance-now/-/performance-now-2.1.0.tgz", + "integrity": "sha512-7EAHlyLHI56VEIdK57uwHdHKIaAGbnXPiw0yWbarQZOKaKpvUIgW0jWRVLiatnM+XXlSwsanIBH/hzGMJulMow==" + }, + "node_modules/picomatch": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", + "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", + "engines": { + "node": ">=8.6" + }, + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" + } + }, + "node_modules/proxy-addr": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz", + "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==", + "dependencies": { + "forwarded": "0.2.0", + "ipaddr.js": "1.9.1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/psl": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/psl/-/psl-1.9.0.tgz", + "integrity": "sha512-E/ZsdU4HLs/68gYzgGTkMicWTLPdAftJLfJFlLUAAKZGkStNU72sZjT66SnMDVOfOWY/YAoiD7Jxa9iHvngcag==" + }, + "node_modules/pstree.remy": { + "version": "1.1.8", + "resolved": "https://registry.npmjs.org/pstree.remy/-/pstree.remy-1.1.8.tgz", + "integrity": "sha512-77DZwxQmxKnu3aR542U+X8FypNzbfJ+C5XQDk3uWjWxn6151aIMGthWYRXTqT1E5oJvg+ljaa2OJi+VfvCOQ8w==" + }, + "node_modules/punycode": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.3.1.tgz", + "integrity": "sha512-vYt7UD1U9Wg6138shLtLOvdAu+8DsC/ilFtEVHcH+wydcSpNE20AfSOduf6MkRFahL5FY7X1oU7nKVZFtfq8Fg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/qs": { + "version": "6.11.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.11.0.tgz", + "integrity": "sha512-MvjoMCJwEarSbUYk5O+nmoSzSutSsTwF85zcHPQ9OrlFoZOYIjaqBAJIqIXjptyD5vThxGq52Xu/MaJzRkIk4Q==", + "dependencies": { + "side-channel": "^1.0.4" + }, + "engines": { + "node": ">=0.6" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/querystring": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.1.tgz", + "integrity": "sha512-wkvS7mL/JMugcup3/rMitHmd9ecIGd2lhFhK9N3UUQ450h66d1r3Y9nvXzQAW1Lq+wyx61k/1pfKS5KuKiyEbg==", + "deprecated": "The querystring API is considered Legacy. new code should use the URLSearchParams API instead.", + "engines": { + "node": ">=0.4.x" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/raw-body": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.5.2.tgz", + "integrity": "sha512-8zGqypfENjCIqGhgXToC8aB2r7YrBX+AQAfIPs/Mlk+BtPTztOvTS01NRW/3Eh60J+a48lt8qsCzirQ6loCVfA==", + "dependencies": { + "bytes": "3.1.2", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/readdirp": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz", + "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==", + "dependencies": { + "picomatch": "^2.2.1" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/request": { + "version": "2.88.2", + "resolved": "https://registry.npmjs.org/request/-/request-2.88.2.tgz", + "integrity": "sha512-MsvtOrfG9ZcrOwAW+Qi+F6HbD0CWXEh9ou77uOb7FM2WPhwT7smM833PzanhJLsgXjN89Ir6V2PczXNnMpwKhw==", + "deprecated": "request has been deprecated, see https://github.com/request/request/issues/3142", + "dependencies": { + "aws-sign2": "~0.7.0", + "aws4": "^1.8.0", + "caseless": "~0.12.0", + "combined-stream": "~1.0.6", + "extend": "~3.0.2", + "forever-agent": "~0.6.1", + "form-data": "~2.3.2", + "har-validator": "~5.1.3", + "http-signature": "~1.2.0", + "is-typedarray": "~1.0.0", + "isstream": "~0.1.2", + "json-stringify-safe": "~5.0.1", + "mime-types": "~2.1.19", + "oauth-sign": "~0.9.0", + "performance-now": "^2.1.0", + "qs": "~6.5.2", + "safe-buffer": "^5.1.2", + "tough-cookie": "~2.5.0", + "tunnel-agent": "^0.6.0", + "uuid": "^3.3.2" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/request/node_modules/qs": { + "version": "6.5.3", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.3.tgz", + "integrity": "sha512-qxXIEh4pCGfHICj1mAJQ2/2XVZkjCDTcEgfoSQxc/fYivUZxTkk7L3bDBJSoNrEzXI17oUO5Dp07ktqE5KzczA==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ] + }, + "node_modules/safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==" + }, + "node_modules/semver": { + "version": "7.6.2", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.6.2.tgz", + "integrity": "sha512-FNAIBWCx9qcRhoHcgcJ0gvU7SN1lYU2ZXuSfl04bSC5OpvDHFyJCjdNHomPXxjQlCBU67YW64PzY7/VIEH7F2w==", + "bin": { + "semver": "bin/semver.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/send": { + "version": "0.18.0", + "resolved": "https://registry.npmjs.org/send/-/send-0.18.0.tgz", + "integrity": "sha512-qqWzuOjSFOuqPjFe4NOsMLafToQQwBSOEpS+FwEt3A2V3vKubTquT3vmLTQpFgMXp8AlFWFuP1qKaJZOtPpVXg==", + "dependencies": { + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "mime": "1.6.0", + "ms": "2.1.3", + "on-finished": "2.4.1", + "range-parser": "~1.2.1", + "statuses": "2.0.1" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/send/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==" + }, + "node_modules/serve-static": { + "version": "1.15.0", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.15.0.tgz", + "integrity": "sha512-XGuRDNjXUijsUL0vl6nSD7cwURuzEgglbOaFuZM9g3kwDXOWVTck0jLzjPzGD+TazWbboZYu52/9/XPdUgne9g==", + "dependencies": { + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.18.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/set-function-length": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/set-function-length/-/set-function-length-1.2.2.tgz", + "integrity": "sha512-pgRc4hJ4/sNjWCSS9AmnS40x3bNMDTknHgL5UaMBTMyJnU90EgWh1Rz+MC9eFu4BuN/UwZjKQuY/1v3rM7HMfg==", + "dependencies": { + "define-data-property": "^1.1.4", + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.4", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/setprototypeof": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz", + "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==" + }, + "node_modules/side-channel": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.6.tgz", + "integrity": "sha512-fDW/EZ6Q9RiO8eFG8Hj+7u/oW+XrPTIChwCOM2+th2A6OblDtYYIpve9m+KvI9Z4C9qSEXlaGR6bTEYHReuglA==", + "dependencies": { + "call-bind": "^1.0.7", + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.4", + "object-inspect": "^1.13.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/simple-update-notifier": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/simple-update-notifier/-/simple-update-notifier-2.0.0.tgz", + "integrity": "sha512-a2B9Y0KlNXl9u/vsW6sTIu9vGEpfKu2wRV6l1H3XEas/0gUIzGzBoP/IouTcUQbm9JWZLH3COxyn03TYlFax6w==", + "dependencies": { + "semver": "^7.5.3" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/sshpk": { + "version": "1.18.0", + "resolved": "https://registry.npmjs.org/sshpk/-/sshpk-1.18.0.tgz", + "integrity": "sha512-2p2KJZTSqQ/I3+HX42EpYOa2l3f8Erv8MWKsy2I9uf4wA7yFIkXRffYdsx86y6z4vHtV8u7g+pPlr8/4ouAxsQ==", + "dependencies": { + "asn1": "~0.2.3", + "assert-plus": "^1.0.0", + "bcrypt-pbkdf": "^1.0.0", + "dashdash": "^1.12.0", + "ecc-jsbn": "~0.1.1", + "getpass": "^0.1.1", + "jsbn": "~0.1.0", + "safer-buffer": "^2.0.2", + "tweetnacl": "~0.14.0" + }, + "bin": { + "sshpk-conv": "bin/sshpk-conv", + "sshpk-sign": "bin/sshpk-sign", + "sshpk-verify": "bin/sshpk-verify" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/statuses": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz", + "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/supports-color": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", + "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + }, + "node_modules/toidentifier": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz", + "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/touch": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/touch/-/touch-3.1.1.tgz", + "integrity": "sha512-r0eojU4bI8MnHr8c5bNo7lJDdI2qXlWWJk6a9EAFG7vbhTjElYhBVS3/miuE0uOuoLdb8Mc/rVfsmm6eo5o9GA==", + "bin": { + "nodetouch": "bin/nodetouch.js" + } + }, + "node_modules/tough-cookie": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.5.0.tgz", + "integrity": "sha512-nlLsUzgm1kfLXSXfRZMc1KLAugd4hqJHDTvc2hDIwS3mZAfMEuMbc03SujMF+GEcpaX/qboeycw6iO8JwVv2+g==", + "dependencies": { + "psl": "^1.1.28", + "punycode": "^2.1.1" + }, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/tunnel-agent": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.6.0.tgz", + "integrity": "sha512-McnNiV1l8RYeY8tBgEpuodCC1mLUdbSN+CYBL7kJsJNInOP8UjDDEwdk6Mw60vdLLrr5NHKZhMAOSrR2NZuQ+w==", + "dependencies": { + "safe-buffer": "^5.0.1" + }, + "engines": { + "node": "*" + } + }, + "node_modules/tweetnacl": { + "version": "0.14.5", + "resolved": "https://registry.npmjs.org/tweetnacl/-/tweetnacl-0.14.5.tgz", + "integrity": "sha512-KXXFFdAbFXY4geFIwoyNK+f5Z1b7swfXABfL7HXCmoIWMKU3dmS26672A4EeQtDzLKy7SXmfBu51JolvEKwtGA==" + }, + "node_modules/type-is": { + "version": "1.6.18", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/undefsafe": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/undefsafe/-/undefsafe-2.0.5.tgz", + "integrity": "sha512-WxONCrssBM8TSPRqN5EmsjVrsv4A8X12J4ArBiiayv3DyyG3ZlIg6yysuuSYdZsVz3TKcTg2fd//Ujd4CHV1iA==" + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/uri-js": { + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.4.1.tgz", + "integrity": "sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==", + "dependencies": { + "punycode": "^2.1.0" + } + }, + "node_modules/utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/uuid": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.4.0.tgz", + "integrity": "sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A==", + "deprecated": "Please upgrade to version 7 or higher. Older versions may use Math.random() in certain circumstances, which is known to be problematic. See https://v8.dev/blog/math-random for details.", + "bin": { + "uuid": "bin/uuid" + } + }, + "node_modules/vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/verror": { + "version": "1.10.0", + "resolved": "https://registry.npmjs.org/verror/-/verror-1.10.0.tgz", + "integrity": "sha512-ZZKSmDAEFOijERBLkmYfJ+vmk3w+7hOLYDNkRCuRuMJGEmqYNCNLyBBFwWKVMhfwaEF3WOd0Zlw86U/WC/+nYw==", + "engines": [ + "node >=0.6.0" + ], + "dependencies": { + "assert-plus": "^1.0.0", + "core-util-is": "1.0.2", + "extsprintf": "^1.2.0" + } + } + } +} diff --git a/tunestats/app/api/node_modules/accepts/HISTORY.md b/tunestats/app/api/node_modules/accepts/HISTORY.md new file mode 100644 index 0000000..cb5990c --- /dev/null +++ b/tunestats/app/api/node_modules/accepts/HISTORY.md @@ -0,0 +1,243 @@ +1.3.8 / 2022-02-02 +================== + + * deps: mime-types@~2.1.34 + - deps: mime-db@~1.51.0 + * deps: negotiator@0.6.3 + +1.3.7 / 2019-04-29 +================== + + * deps: negotiator@0.6.2 + - Fix sorting charset, encoding, and language with extra parameters + +1.3.6 / 2019-04-28 +================== + + * deps: mime-types@~2.1.24 + - deps: mime-db@~1.40.0 + +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/tunestats/app/api/node_modules/accepts/LICENSE b/tunestats/app/api/node_modules/accepts/LICENSE new file mode 100644 index 0000000..0616607 --- /dev/null +++ b/tunestats/app/api/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/accepts/README.md b/tunestats/app/api/node_modules/accepts/README.md new file mode 100644 index 0000000..82680c5 --- /dev/null +++ b/tunestats/app/api/node_modules/accepts/README.md @@ -0,0 +1,140 @@ +# accepts + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master +[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master +[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml +[node-version-image]: https://badgen.net/npm/node/accepts +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/accepts +[npm-url]: https://npmjs.org/package/accepts +[npm-version-image]: https://badgen.net/npm/v/accepts diff --git a/tunestats/app/api/node_modules/accepts/index.js b/tunestats/app/api/node_modules/accepts/index.js new file mode 100644 index 0000000..e9b2f63 --- /dev/null +++ b/tunestats/app/api/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/tunestats/app/api/node_modules/accepts/package.json b/tunestats/app/api/node_modules/accepts/package.json new file mode 100644 index 0000000..0f2d15d --- /dev/null +++ b/tunestats/app/api/node_modules/accepts/package.json @@ -0,0 +1,47 @@ +{ + "name": "accepts", + "description": "Higher-level content negotiation", + "version": "1.3.8", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "jshttp/accepts", + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.3.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ] +} diff --git a/tunestats/app/api/node_modules/ajv/.tonic_example.js b/tunestats/app/api/node_modules/ajv/.tonic_example.js new file mode 100644 index 0000000..aa11812 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/.tonic_example.js @@ -0,0 +1,20 @@ +var Ajv = require('ajv'); +var ajv = new Ajv({allErrors: true}); + +var schema = { + "properties": { + "foo": { "type": "string" }, + "bar": { "type": "number", "maximum": 3 } + } +}; + +var validate = ajv.compile(schema); + +test({"foo": "abc", "bar": 2}); +test({"foo": 2, "bar": 4}); + +function test(data) { + var valid = validate(data); + if (valid) console.log('Valid!'); + else console.log('Invalid: ' + ajv.errorsText(validate.errors)); +} \ No newline at end of file diff --git a/tunestats/app/api/node_modules/ajv/LICENSE b/tunestats/app/api/node_modules/ajv/LICENSE new file mode 100644 index 0000000..96ee719 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/LICENSE @@ -0,0 +1,22 @@ +The MIT License (MIT) + +Copyright (c) 2015-2017 Evgeny Poberezkin + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. + diff --git a/tunestats/app/api/node_modules/ajv/README.md b/tunestats/app/api/node_modules/ajv/README.md new file mode 100644 index 0000000..5aa2078 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/README.md @@ -0,0 +1,1497 @@ +Ajv logo + +# Ajv: Another JSON Schema Validator + +The fastest JSON Schema validator for Node.js and browser. Supports draft-04/06/07. + +[![Build Status](https://travis-ci.org/ajv-validator/ajv.svg?branch=master)](https://travis-ci.org/ajv-validator/ajv) +[![npm](https://img.shields.io/npm/v/ajv.svg)](https://www.npmjs.com/package/ajv) +[![npm (beta)](https://img.shields.io/npm/v/ajv/beta)](https://www.npmjs.com/package/ajv/v/7.0.0-beta.0) +[![npm downloads](https://img.shields.io/npm/dm/ajv.svg)](https://www.npmjs.com/package/ajv) +[![Coverage Status](https://coveralls.io/repos/github/ajv-validator/ajv/badge.svg?branch=master)](https://coveralls.io/github/ajv-validator/ajv?branch=master) +[![Gitter](https://img.shields.io/gitter/room/ajv-validator/ajv.svg)](https://gitter.im/ajv-validator/ajv) +[![GitHub Sponsors](https://img.shields.io/badge/$-sponsors-brightgreen)](https://github.com/sponsors/epoberezkin) + + +## Ajv v7 beta is released + +[Ajv version 7.0.0-beta.0](https://github.com/ajv-validator/ajv/tree/v7-beta) is released with these changes: + +- to reduce the mistakes in JSON schemas and unexpected validation results, [strict mode](./docs/strict-mode.md) is added - it prohibits ignored or ambiguous JSON Schema elements. +- to make code injection from untrusted schemas impossible, [code generation](./docs/codegen.md) is fully re-written to be safe. +- to simplify Ajv extensions, the new keyword API that is used by pre-defined keywords is available to user-defined keywords - it is much easier to define any keywords now, especially with subschemas. +- schemas are compiled to ES6 code (ES5 code generation is supported with an option). +- to improve reliability and maintainability the code is migrated to TypeScript. + +**Please note**: + +- the support for JSON-Schema draft-04 is removed - if you have schemas using "id" attributes you have to replace them with "\$id" (or continue using version 6 that will be supported until 02/28/2021). +- all formats are separated to ajv-formats package - they have to be explicitely added if you use them. + +See [release notes](https://github.com/ajv-validator/ajv/releases/tag/v7.0.0-beta.0) for the details. + +To install the new version: + +```bash +npm install ajv@beta +``` + +See [Getting started with v7](https://github.com/ajv-validator/ajv/tree/v7-beta#usage) for code example. + + +## Mozilla MOSS grant and OpenJS Foundation + +[](https://www.mozilla.org/en-US/moss/)     [](https://openjsf.org/blog/2020/08/14/ajv-joins-openjs-foundation-as-an-incubation-project/) + +Ajv has been awarded a grant from Mozilla’s [Open Source Support (MOSS) program](https://www.mozilla.org/en-US/moss/) in the “Foundational Technology” track! It will sponsor the development of Ajv support of [JSON Schema version 2019-09](https://tools.ietf.org/html/draft-handrews-json-schema-02) and of [JSON Type Definition](https://tools.ietf.org/html/draft-ucarion-json-type-definition-04). + +Ajv also joined [OpenJS Foundation](https://openjsf.org/) – having this support will help ensure the longevity and stability of Ajv for all its users. + +This [blog post](https://www.poberezkin.com/posts/2020-08-14-ajv-json-validator-mozilla-open-source-grant-openjs-foundation.html) has more details. + +I am looking for the long term maintainers of Ajv – working with [ReadySet](https://www.thereadyset.co/), also sponsored by Mozilla, to establish clear guidelines for the role of a "maintainer" and the contribution standards, and to encourage a wider, more inclusive, contribution from the community. + + +## Please [sponsor Ajv development](https://github.com/sponsors/epoberezkin) + +Since I asked to support Ajv development 40 people and 6 organizations contributed via GitHub and OpenCollective - this support helped receiving the MOSS grant! + +Your continuing support is very important - the funds will be used to develop and maintain Ajv once the next major version is released. + +Please sponsor Ajv via: +- [GitHub sponsors page](https://github.com/sponsors/epoberezkin) (GitHub will match it) +- [Ajv Open Collective️](https://opencollective.com/ajv) + +Thank you. + + +#### Open Collective sponsors + + + + + + + + + + + + + + + +## Using version 6 + +[JSON Schema draft-07](http://json-schema.org/latest/json-schema-validation.html) is published. + +[Ajv version 6.0.0](https://github.com/ajv-validator/ajv/releases/tag/v6.0.0) that supports draft-07 is released. It may require either migrating your schemas or updating your code (to continue using draft-04 and v5 schemas, draft-06 schemas will be supported without changes). + +__Please note__: To use Ajv with draft-06 schemas you need to explicitly add the meta-schema to the validator instance: + +```javascript +ajv.addMetaSchema(require('ajv/lib/refs/json-schema-draft-06.json')); +``` + +To use Ajv with draft-04 schemas in addition to explicitly adding meta-schema you also need to use option schemaId: + +```javascript +var ajv = new Ajv({schemaId: 'id'}); +// If you want to use both draft-04 and draft-06/07 schemas: +// var ajv = new Ajv({schemaId: 'auto'}); +ajv.addMetaSchema(require('ajv/lib/refs/json-schema-draft-04.json')); +``` + + +## Contents + +- [Performance](#performance) +- [Features](#features) +- [Getting started](#getting-started) +- [Frequently Asked Questions](https://github.com/ajv-validator/ajv/blob/master/FAQ.md) +- [Using in browser](#using-in-browser) + - [Ajv and Content Security Policies (CSP)](#ajv-and-content-security-policies-csp) +- [Command line interface](#command-line-interface) +- Validation + - [Keywords](#validation-keywords) + - [Annotation keywords](#annotation-keywords) + - [Formats](#formats) + - [Combining schemas with $ref](#ref) + - [$data reference](#data-reference) + - NEW: [$merge and $patch keywords](#merge-and-patch-keywords) + - [Defining custom keywords](#defining-custom-keywords) + - [Asynchronous schema compilation](#asynchronous-schema-compilation) + - [Asynchronous validation](#asynchronous-validation) +- [Security considerations](#security-considerations) + - [Security contact](#security-contact) + - [Untrusted schemas](#untrusted-schemas) + - [Circular references in objects](#circular-references-in-javascript-objects) + - [Trusted schemas](#security-risks-of-trusted-schemas) + - [ReDoS attack](#redos-attack) +- Modifying data during validation + - [Filtering data](#filtering-data) + - [Assigning defaults](#assigning-defaults) + - [Coercing data types](#coercing-data-types) +- API + - [Methods](#api) + - [Options](#options) + - [Validation errors](#validation-errors) +- [Plugins](#plugins) +- [Related packages](#related-packages) +- [Some packages using Ajv](#some-packages-using-ajv) +- [Tests, Contributing, Changes history](#tests) +- [Support, Code of conduct, License](#open-source-software-support) + + +## Performance + +Ajv generates code using [doT templates](https://github.com/olado/doT) to turn JSON Schemas into super-fast validation functions that are efficient for v8 optimization. + +Currently Ajv is the fastest and the most standard compliant validator according to these benchmarks: + +- [json-schema-benchmark](https://github.com/ebdrup/json-schema-benchmark) - 50% faster than the second place +- [jsck benchmark](https://github.com/pandastrike/jsck#benchmarks) - 20-190% faster +- [z-schema benchmark](https://rawgit.com/zaggino/z-schema/master/benchmark/results.html) +- [themis benchmark](https://cdn.rawgit.com/playlyfe/themis/master/benchmark/results.html) + + +Performance of different validators by [json-schema-benchmark](https://github.com/ebdrup/json-schema-benchmark): + +[![performance](https://chart.googleapis.com/chart?chxt=x,y&cht=bhs&chco=76A4FB&chls=2.0&chbh=32,4,1&chs=600x416&chxl=-1:|djv|ajv|json-schema-validator-generator|jsen|is-my-json-valid|themis|z-schema|jsck|skeemas|json-schema-library|tv4&chd=t:100,98,72.1,66.8,50.1,15.1,6.1,3.8,1.2,0.7,0.2)](https://github.com/ebdrup/json-schema-benchmark/blob/master/README.md#performance) + + +## Features + +- Ajv implements full JSON Schema [draft-06/07](http://json-schema.org/) and draft-04 standards: + - all validation keywords (see [JSON Schema validation keywords](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md)) + - full support of remote refs (remote schemas have to be added with `addSchema` or compiled to be available) + - support of circular references between schemas + - correct string lengths for strings with unicode pairs (can be turned off) + - [formats](#formats) defined by JSON Schema draft-07 standard and custom formats (can be turned off) + - [validates schemas against meta-schema](#api-validateschema) +- supports [browsers](#using-in-browser) and Node.js 0.10-14.x +- [asynchronous loading](#asynchronous-schema-compilation) of referenced schemas during compilation +- "All errors" validation mode with [option allErrors](#options) +- [error messages with parameters](#validation-errors) describing error reasons to allow creating custom error messages +- i18n error messages support with [ajv-i18n](https://github.com/ajv-validator/ajv-i18n) package +- [filtering data](#filtering-data) from additional properties +- [assigning defaults](#assigning-defaults) to missing properties and items +- [coercing data](#coercing-data-types) to the types specified in `type` keywords +- [custom keywords](#defining-custom-keywords) +- draft-06/07 keywords `const`, `contains`, `propertyNames` and `if/then/else` +- draft-06 boolean schemas (`true`/`false` as a schema to always pass/fail). +- keywords `switch`, `patternRequired`, `formatMaximum` / `formatMinimum` and `formatExclusiveMaximum` / `formatExclusiveMinimum` from [JSON Schema extension proposals](https://github.com/json-schema/json-schema/wiki/v5-Proposals) with [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) package +- [$data reference](#data-reference) to use values from the validated data as values for the schema keywords +- [asynchronous validation](#asynchronous-validation) of custom formats and keywords + + +## Install + +``` +npm install ajv +``` + + +## Getting started + +Try it in the Node.js REPL: https://tonicdev.com/npm/ajv + + +The fastest validation call: + +```javascript +// Node.js require: +var Ajv = require('ajv'); +// or ESM/TypeScript import +import Ajv from 'ajv'; + +var ajv = new Ajv(); // options can be passed, e.g. {allErrors: true} +var validate = ajv.compile(schema); +var valid = validate(data); +if (!valid) console.log(validate.errors); +``` + +or with less code + +```javascript +// ... +var valid = ajv.validate(schema, data); +if (!valid) console.log(ajv.errors); +// ... +``` + +or + +```javascript +// ... +var valid = ajv.addSchema(schema, 'mySchema') + .validate('mySchema', data); +if (!valid) console.log(ajv.errorsText()); +// ... +``` + +See [API](#api) and [Options](#options) for more details. + +Ajv compiles schemas to functions and caches them in all cases (using schema serialized with [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) or a custom function as a key), so that the next time the same schema is used (not necessarily the same object instance) it won't be compiled again. + +The best performance is achieved when using compiled functions returned by `compile` or `getSchema` methods (there is no additional function call). + +__Please note__: every time a validation function or `ajv.validate` are called `errors` property is overwritten. You need to copy `errors` array reference to another variable if you want to use it later (e.g., in the callback). See [Validation errors](#validation-errors) + +__Note for TypeScript users__: `ajv` provides its own TypeScript declarations +out of the box, so you don't need to install the deprecated `@types/ajv` +module. + + +## Using in browser + +You can require Ajv directly from the code you browserify - in this case Ajv will be a part of your bundle. + +If you need to use Ajv in several bundles you can create a separate UMD bundle using `npm run bundle` script (thanks to [siddo420](https://github.com/siddo420)). + +Then you need to load Ajv in the browser: +```html + +``` + +This bundle can be used with different module systems; it creates global `Ajv` if no module system is found. + +The browser bundle is available on [cdnjs](https://cdnjs.com/libraries/ajv). + +Ajv is tested with these browsers: + +[![Sauce Test Status](https://saucelabs.com/browser-matrix/epoberezkin.svg)](https://saucelabs.com/u/epoberezkin) + +__Please note__: some frameworks, e.g. Dojo, may redefine global require in such way that is not compatible with CommonJS module format. In such case Ajv bundle has to be loaded before the framework and then you can use global Ajv (see issue [#234](https://github.com/ajv-validator/ajv/issues/234)). + + +### Ajv and Content Security Policies (CSP) + +If you're using Ajv to compile a schema (the typical use) in a browser document that is loaded with a Content Security Policy (CSP), that policy will require a `script-src` directive that includes the value `'unsafe-eval'`. +:warning: NOTE, however, that `unsafe-eval` is NOT recommended in a secure CSP[[1]](https://developer.chrome.com/extensions/contentSecurityPolicy#relaxing-eval), as it has the potential to open the document to cross-site scripting (XSS) attacks. + +In order to make use of Ajv without easing your CSP, you can [pre-compile a schema using the CLI](https://github.com/ajv-validator/ajv-cli#compile-schemas). This will transpile the schema JSON into a JavaScript file that exports a `validate` function that works simlarly to a schema compiled at runtime. + +Note that pre-compilation of schemas is performed using [ajv-pack](https://github.com/ajv-validator/ajv-pack) and there are [some limitations to the schema features it can compile](https://github.com/ajv-validator/ajv-pack#limitations). A successfully pre-compiled schema is equivalent to the same schema compiled at runtime. + + +## Command line interface + +CLI is available as a separate npm package [ajv-cli](https://github.com/ajv-validator/ajv-cli). It supports: + +- compiling JSON Schemas to test their validity +- BETA: generating standalone module exporting a validation function to be used without Ajv (using [ajv-pack](https://github.com/ajv-validator/ajv-pack)) +- migrate schemas to draft-07 (using [json-schema-migrate](https://github.com/epoberezkin/json-schema-migrate)) +- validating data file(s) against JSON Schema +- testing expected validity of data against JSON Schema +- referenced schemas +- custom meta-schemas +- files in JSON, JSON5, YAML, and JavaScript format +- all Ajv options +- reporting changes in data after validation in [JSON-patch](https://tools.ietf.org/html/rfc6902) format + + +## Validation keywords + +Ajv supports all validation keywords from draft-07 of JSON Schema standard: + +- [type](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#type) +- [for numbers](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-numbers) - maximum, minimum, exclusiveMaximum, exclusiveMinimum, multipleOf +- [for strings](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-strings) - maxLength, minLength, pattern, format +- [for arrays](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-arrays) - maxItems, minItems, uniqueItems, items, additionalItems, [contains](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#contains) +- [for objects](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-objects) - maxProperties, minProperties, required, properties, patternProperties, additionalProperties, dependencies, [propertyNames](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#propertynames) +- [for all types](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-all-types) - enum, [const](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#const) +- [compound keywords](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#compound-keywords) - not, oneOf, anyOf, allOf, [if/then/else](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#ifthenelse) + +With [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) package Ajv also supports validation keywords from [JSON Schema extension proposals](https://github.com/json-schema/json-schema/wiki/v5-Proposals) for JSON Schema standard: + +- [patternRequired](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#patternrequired-proposed) - like `required` but with patterns that some property should match. +- [formatMaximum, formatMinimum, formatExclusiveMaximum, formatExclusiveMinimum](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#formatmaximum--formatminimum-and-exclusiveformatmaximum--exclusiveformatminimum-proposed) - setting limits for date, time, etc. + +See [JSON Schema validation keywords](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md) for more details. + + +## Annotation keywords + +JSON Schema specification defines several annotation keywords that describe schema itself but do not perform any validation. + +- `title` and `description`: information about the data represented by that schema +- `$comment` (NEW in draft-07): information for developers. With option `$comment` Ajv logs or passes the comment string to the user-supplied function. See [Options](#options). +- `default`: a default value of the data instance, see [Assigning defaults](#assigning-defaults). +- `examples` (NEW in draft-06): an array of data instances. Ajv does not check the validity of these instances against the schema. +- `readOnly` and `writeOnly` (NEW in draft-07): marks data-instance as read-only or write-only in relation to the source of the data (database, api, etc.). +- `contentEncoding`: [RFC 2045](https://tools.ietf.org/html/rfc2045#section-6.1 ), e.g., "base64". +- `contentMediaType`: [RFC 2046](https://tools.ietf.org/html/rfc2046), e.g., "image/png". + +__Please note__: Ajv does not implement validation of the keywords `examples`, `contentEncoding` and `contentMediaType` but it reserves them. If you want to create a plugin that implements some of them, it should remove these keywords from the instance. + + +## Formats + +Ajv implements formats defined by JSON Schema specification and several other formats. It is recommended NOT to use "format" keyword implementations with untrusted data, as they use potentially unsafe regular expressions - see [ReDoS attack](#redos-attack). + +__Please note__: if you need to use "format" keyword to validate untrusted data, you MUST assess their suitability and safety for your validation scenarios. + +The following formats are implemented for string validation with "format" keyword: + +- _date_: full-date according to [RFC3339](http://tools.ietf.org/html/rfc3339#section-5.6). +- _time_: time with optional time-zone. +- _date-time_: date-time from the same source (time-zone is mandatory). `date`, `time` and `date-time` validate ranges in `full` mode and only regexp in `fast` mode (see [options](#options)). +- _uri_: full URI. +- _uri-reference_: URI reference, including full and relative URIs. +- _uri-template_: URI template according to [RFC6570](https://tools.ietf.org/html/rfc6570) +- _url_ (deprecated): [URL record](https://url.spec.whatwg.org/#concept-url). +- _email_: email address. +- _hostname_: host name according to [RFC1034](http://tools.ietf.org/html/rfc1034#section-3.5). +- _ipv4_: IP address v4. +- _ipv6_: IP address v6. +- _regex_: tests whether a string is a valid regular expression by passing it to RegExp constructor. +- _uuid_: Universally Unique IDentifier according to [RFC4122](http://tools.ietf.org/html/rfc4122). +- _json-pointer_: JSON-pointer according to [RFC6901](https://tools.ietf.org/html/rfc6901). +- _relative-json-pointer_: relative JSON-pointer according to [this draft](http://tools.ietf.org/html/draft-luff-relative-json-pointer-00). + +__Please note__: JSON Schema draft-07 also defines formats `iri`, `iri-reference`, `idn-hostname` and `idn-email` for URLs, hostnames and emails with international characters. Ajv does not implement these formats. If you create Ajv plugin that implements them please make a PR to mention this plugin here. + +There are two modes of format validation: `fast` and `full`. This mode affects formats `date`, `time`, `date-time`, `uri`, `uri-reference`, and `email`. See [Options](#options) for details. + +You can add additional formats and replace any of the formats above using [addFormat](#api-addformat) method. + +The option `unknownFormats` allows changing the default behaviour when an unknown format is encountered. In this case Ajv can either fail schema compilation (default) or ignore it (default in versions before 5.0.0). You also can allow specific format(s) that will be ignored. See [Options](#options) for details. + +You can find regular expressions used for format validation and the sources that were used in [formats.js](https://github.com/ajv-validator/ajv/blob/master/lib/compile/formats.js). + + +## Combining schemas with $ref + +You can structure your validation logic across multiple schema files and have schemas reference each other using `$ref` keyword. + +Example: + +```javascript +var schema = { + "$id": "http://example.com/schemas/schema.json", + "type": "object", + "properties": { + "foo": { "$ref": "defs.json#/definitions/int" }, + "bar": { "$ref": "defs.json#/definitions/str" } + } +}; + +var defsSchema = { + "$id": "http://example.com/schemas/defs.json", + "definitions": { + "int": { "type": "integer" }, + "str": { "type": "string" } + } +}; +``` + +Now to compile your schema you can either pass all schemas to Ajv instance: + +```javascript +var ajv = new Ajv({schemas: [schema, defsSchema]}); +var validate = ajv.getSchema('http://example.com/schemas/schema.json'); +``` + +or use `addSchema` method: + +```javascript +var ajv = new Ajv; +var validate = ajv.addSchema(defsSchema) + .compile(schema); +``` + +See [Options](#options) and [addSchema](#api) method. + +__Please note__: +- `$ref` is resolved as the uri-reference using schema $id as the base URI (see the example). +- References can be recursive (and mutually recursive) to implement the schemas for different data structures (such as linked lists, trees, graphs, etc.). +- You don't have to host your schema files at the URIs that you use as schema $id. These URIs are only used to identify the schemas, and according to JSON Schema specification validators should not expect to be able to download the schemas from these URIs. +- The actual location of the schema file in the file system is not used. +- You can pass the identifier of the schema as the second parameter of `addSchema` method or as a property name in `schemas` option. This identifier can be used instead of (or in addition to) schema $id. +- You cannot have the same $id (or the schema identifier) used for more than one schema - the exception will be thrown. +- You can implement dynamic resolution of the referenced schemas using `compileAsync` method. In this way you can store schemas in any system (files, web, database, etc.) and reference them without explicitly adding to Ajv instance. See [Asynchronous schema compilation](#asynchronous-schema-compilation). + + +## $data reference + +With `$data` option you can use values from the validated data as the values for the schema keywords. See [proposal](https://github.com/json-schema-org/json-schema-spec/issues/51) for more information about how it works. + +`$data` reference is supported in the keywords: const, enum, format, maximum/minimum, exclusiveMaximum / exclusiveMinimum, maxLength / minLength, maxItems / minItems, maxProperties / minProperties, formatMaximum / formatMinimum, formatExclusiveMaximum / formatExclusiveMinimum, multipleOf, pattern, required, uniqueItems. + +The value of "$data" should be a [JSON-pointer](https://tools.ietf.org/html/rfc6901) to the data (the root is always the top level data object, even if the $data reference is inside a referenced subschema) or a [relative JSON-pointer](http://tools.ietf.org/html/draft-luff-relative-json-pointer-00) (it is relative to the current point in data; if the $data reference is inside a referenced subschema it cannot point to the data outside of the root level for this subschema). + +Examples. + +This schema requires that the value in property `smaller` is less or equal than the value in the property larger: + +```javascript +var ajv = new Ajv({$data: true}); + +var schema = { + "properties": { + "smaller": { + "type": "number", + "maximum": { "$data": "1/larger" } + }, + "larger": { "type": "number" } + } +}; + +var validData = { + smaller: 5, + larger: 7 +}; + +ajv.validate(schema, validData); // true +``` + +This schema requires that the properties have the same format as their field names: + +```javascript +var schema = { + "additionalProperties": { + "type": "string", + "format": { "$data": "0#" } + } +}; + +var validData = { + 'date-time': '1963-06-19T08:30:06.283185Z', + email: 'joe.bloggs@example.com' +} +``` + +`$data` reference is resolved safely - it won't throw even if some property is undefined. If `$data` resolves to `undefined` the validation succeeds (with the exclusion of `const` keyword). If `$data` resolves to incorrect type (e.g. not "number" for maximum keyword) the validation fails. + + +## $merge and $patch keywords + +With the package [ajv-merge-patch](https://github.com/ajv-validator/ajv-merge-patch) you can use the keywords `$merge` and `$patch` that allow extending JSON Schemas with patches using formats [JSON Merge Patch (RFC 7396)](https://tools.ietf.org/html/rfc7396) and [JSON Patch (RFC 6902)](https://tools.ietf.org/html/rfc6902). + +To add keywords `$merge` and `$patch` to Ajv instance use this code: + +```javascript +require('ajv-merge-patch')(ajv); +``` + +Examples. + +Using `$merge`: + +```json +{ + "$merge": { + "source": { + "type": "object", + "properties": { "p": { "type": "string" } }, + "additionalProperties": false + }, + "with": { + "properties": { "q": { "type": "number" } } + } + } +} +``` + +Using `$patch`: + +```json +{ + "$patch": { + "source": { + "type": "object", + "properties": { "p": { "type": "string" } }, + "additionalProperties": false + }, + "with": [ + { "op": "add", "path": "/properties/q", "value": { "type": "number" } } + ] + } +} +``` + +The schemas above are equivalent to this schema: + +```json +{ + "type": "object", + "properties": { + "p": { "type": "string" }, + "q": { "type": "number" } + }, + "additionalProperties": false +} +``` + +The properties `source` and `with` in the keywords `$merge` and `$patch` can use absolute or relative `$ref` to point to other schemas previously added to the Ajv instance or to the fragments of the current schema. + +See the package [ajv-merge-patch](https://github.com/ajv-validator/ajv-merge-patch) for more information. + + +## Defining custom keywords + +The advantages of using custom keywords are: + +- allow creating validation scenarios that cannot be expressed using JSON Schema +- simplify your schemas +- help bringing a bigger part of the validation logic to your schemas +- make your schemas more expressive, less verbose and closer to your application domain +- implement custom data processors that modify your data (`modifying` option MUST be used in keyword definition) and/or create side effects while the data is being validated + +If a keyword is used only for side-effects and its validation result is pre-defined, use option `valid: true/false` in keyword definition to simplify both generated code (no error handling in case of `valid: true`) and your keyword functions (no need to return any validation result). + +The concerns you have to be aware of when extending JSON Schema standard with custom keywords are the portability and understanding of your schemas. You will have to support these custom keywords on other platforms and to properly document these keywords so that everybody can understand them in your schemas. + +You can define custom keywords with [addKeyword](#api-addkeyword) method. Keywords are defined on the `ajv` instance level - new instances will not have previously defined keywords. + +Ajv allows defining keywords with: +- validation function +- compilation function +- macro function +- inline compilation function that should return code (as string) that will be inlined in the currently compiled schema. + +Example. `range` and `exclusiveRange` keywords using compiled schema: + +```javascript +ajv.addKeyword('range', { + type: 'number', + compile: function (sch, parentSchema) { + var min = sch[0]; + var max = sch[1]; + + return parentSchema.exclusiveRange === true + ? function (data) { return data > min && data < max; } + : function (data) { return data >= min && data <= max; } + } +}); + +var schema = { "range": [2, 4], "exclusiveRange": true }; +var validate = ajv.compile(schema); +console.log(validate(2.01)); // true +console.log(validate(3.99)); // true +console.log(validate(2)); // false +console.log(validate(4)); // false +``` + +Several custom keywords (typeof, instanceof, range and propertyNames) are defined in [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) package - they can be used for your schemas and as a starting point for your own custom keywords. + +See [Defining custom keywords](https://github.com/ajv-validator/ajv/blob/master/CUSTOM.md) for more details. + + +## Asynchronous schema compilation + +During asynchronous compilation remote references are loaded using supplied function. See `compileAsync` [method](#api-compileAsync) and `loadSchema` [option](#options). + +Example: + +```javascript +var ajv = new Ajv({ loadSchema: loadSchema }); + +ajv.compileAsync(schema).then(function (validate) { + var valid = validate(data); + // ... +}); + +function loadSchema(uri) { + return request.json(uri).then(function (res) { + if (res.statusCode >= 400) + throw new Error('Loading error: ' + res.statusCode); + return res.body; + }); +} +``` + +__Please note__: [Option](#options) `missingRefs` should NOT be set to `"ignore"` or `"fail"` for asynchronous compilation to work. + + +## Asynchronous validation + +Example in Node.js REPL: https://tonicdev.com/esp/ajv-asynchronous-validation + +You can define custom formats and keywords that perform validation asynchronously by accessing database or some other service. You should add `async: true` in the keyword or format definition (see [addFormat](#api-addformat), [addKeyword](#api-addkeyword) and [Defining custom keywords](#defining-custom-keywords)). + +If your schema uses asynchronous formats/keywords or refers to some schema that contains them it should have `"$async": true` keyword so that Ajv can compile it correctly. If asynchronous format/keyword or reference to asynchronous schema is used in the schema without `$async` keyword Ajv will throw an exception during schema compilation. + +__Please note__: all asynchronous subschemas that are referenced from the current or other schemas should have `"$async": true` keyword as well, otherwise the schema compilation will fail. + +Validation function for an asynchronous custom format/keyword should return a promise that resolves with `true` or `false` (or rejects with `new Ajv.ValidationError(errors)` if you want to return custom errors from the keyword function). + +Ajv compiles asynchronous schemas to [es7 async functions](http://tc39.github.io/ecmascript-asyncawait/) that can optionally be transpiled with [nodent](https://github.com/MatAtBread/nodent). Async functions are supported in Node.js 7+ and all modern browsers. You can also supply any other transpiler as a function via `processCode` option. See [Options](#options). + +The compiled validation function has `$async: true` property (if the schema is asynchronous), so you can differentiate these functions if you are using both synchronous and asynchronous schemas. + +Validation result will be a promise that resolves with validated data or rejects with an exception `Ajv.ValidationError` that contains the array of validation errors in `errors` property. + + +Example: + +```javascript +var ajv = new Ajv; +// require('ajv-async')(ajv); + +ajv.addKeyword('idExists', { + async: true, + type: 'number', + validate: checkIdExists +}); + + +function checkIdExists(schema, data) { + return knex(schema.table) + .select('id') + .where('id', data) + .then(function (rows) { + return !!rows.length; // true if record is found + }); +} + +var schema = { + "$async": true, + "properties": { + "userId": { + "type": "integer", + "idExists": { "table": "users" } + }, + "postId": { + "type": "integer", + "idExists": { "table": "posts" } + } + } +}; + +var validate = ajv.compile(schema); + +validate({ userId: 1, postId: 19 }) +.then(function (data) { + console.log('Data is valid', data); // { userId: 1, postId: 19 } +}) +.catch(function (err) { + if (!(err instanceof Ajv.ValidationError)) throw err; + // data is invalid + console.log('Validation errors:', err.errors); +}); +``` + +### Using transpilers with asynchronous validation functions. + +[ajv-async](https://github.com/ajv-validator/ajv-async) uses [nodent](https://github.com/MatAtBread/nodent) to transpile async functions. To use another transpiler you should separately install it (or load its bundle in the browser). + + +#### Using nodent + +```javascript +var ajv = new Ajv; +require('ajv-async')(ajv); +// in the browser if you want to load ajv-async bundle separately you can: +// window.ajvAsync(ajv); +var validate = ajv.compile(schema); // transpiled es7 async function +validate(data).then(successFunc).catch(errorFunc); +``` + + +#### Using other transpilers + +```javascript +var ajv = new Ajv({ processCode: transpileFunc }); +var validate = ajv.compile(schema); // transpiled es7 async function +validate(data).then(successFunc).catch(errorFunc); +``` + +See [Options](#options). + + +## Security considerations + +JSON Schema, if properly used, can replace data sanitisation. It doesn't replace other API security considerations. It also introduces additional security aspects to consider. + + +##### Security contact + +To report a security vulnerability, please use the +[Tidelift security contact](https://tidelift.com/security). +Tidelift will coordinate the fix and disclosure. Please do NOT report security vulnerabilities via GitHub issues. + + +##### Untrusted schemas + +Ajv treats JSON schemas as trusted as your application code. This security model is based on the most common use case, when the schemas are static and bundled together with the application. + +If your schemas are received from untrusted sources (or generated from untrusted data) there are several scenarios you need to prevent: +- compiling schemas can cause stack overflow (if they are too deep) +- compiling schemas can be slow (e.g. [#557](https://github.com/ajv-validator/ajv/issues/557)) +- validating certain data can be slow + +It is difficult to predict all the scenarios, but at the very least it may help to limit the size of untrusted schemas (e.g. limit JSON string length) and also the maximum schema object depth (that can be high for relatively small JSON strings). You also may want to mitigate slow regular expressions in `pattern` and `patternProperties` keywords. + +Regardless the measures you take, using untrusted schemas increases security risks. + + +##### Circular references in JavaScript objects + +Ajv does not support schemas and validated data that have circular references in objects. See [issue #802](https://github.com/ajv-validator/ajv/issues/802). + +An attempt to compile such schemas or validate such data would cause stack overflow (or will not complete in case of asynchronous validation). Depending on the parser you use, untrusted data can lead to circular references. + + +##### Security risks of trusted schemas + +Some keywords in JSON Schemas can lead to very slow validation for certain data. These keywords include (but may be not limited to): + +- `pattern` and `format` for large strings - in some cases using `maxLength` can help mitigate it, but certain regular expressions can lead to exponential validation time even with relatively short strings (see [ReDoS attack](#redos-attack)). +- `patternProperties` for large property names - use `propertyNames` to mitigate, but some regular expressions can have exponential evaluation time as well. +- `uniqueItems` for large non-scalar arrays - use `maxItems` to mitigate + +__Please note__: The suggestions above to prevent slow validation would only work if you do NOT use `allErrors: true` in production code (using it would continue validation after validation errors). + +You can validate your JSON schemas against [this meta-schema](https://github.com/ajv-validator/ajv/blob/master/lib/refs/json-schema-secure.json) to check that these recommendations are followed: + +```javascript +const isSchemaSecure = ajv.compile(require('ajv/lib/refs/json-schema-secure.json')); + +const schema1 = {format: 'email'}; +isSchemaSecure(schema1); // false + +const schema2 = {format: 'email', maxLength: MAX_LENGTH}; +isSchemaSecure(schema2); // true +``` + +__Please note__: following all these recommendation is not a guarantee that validation of untrusted data is safe - it can still lead to some undesirable results. + + +##### Content Security Policies (CSP) +See [Ajv and Content Security Policies (CSP)](#ajv-and-content-security-policies-csp) + + +## ReDoS attack + +Certain regular expressions can lead to the exponential evaluation time even with relatively short strings. + +Please assess the regular expressions you use in the schemas on their vulnerability to this attack - see [safe-regex](https://github.com/substack/safe-regex), for example. + +__Please note__: some formats that Ajv implements use [regular expressions](https://github.com/ajv-validator/ajv/blob/master/lib/compile/formats.js) that can be vulnerable to ReDoS attack, so if you use Ajv to validate data from untrusted sources __it is strongly recommended__ to consider the following: + +- making assessment of "format" implementations in Ajv. +- using `format: 'fast'` option that simplifies some of the regular expressions (although it does not guarantee that they are safe). +- replacing format implementations provided by Ajv with your own implementations of "format" keyword that either uses different regular expressions or another approach to format validation. Please see [addFormat](#api-addformat) method. +- disabling format validation by ignoring "format" keyword with option `format: false` + +Whatever mitigation you choose, please assume all formats provided by Ajv as potentially unsafe and make your own assessment of their suitability for your validation scenarios. + + +## Filtering data + +With [option `removeAdditional`](#options) (added by [andyscott](https://github.com/andyscott)) you can filter data during the validation. + +This option modifies original data. + +Example: + +```javascript +var ajv = new Ajv({ removeAdditional: true }); +var schema = { + "additionalProperties": false, + "properties": { + "foo": { "type": "number" }, + "bar": { + "additionalProperties": { "type": "number" }, + "properties": { + "baz": { "type": "string" } + } + } + } +} + +var data = { + "foo": 0, + "additional1": 1, // will be removed; `additionalProperties` == false + "bar": { + "baz": "abc", + "additional2": 2 // will NOT be removed; `additionalProperties` != false + }, +} + +var validate = ajv.compile(schema); + +console.log(validate(data)); // true +console.log(data); // { "foo": 0, "bar": { "baz": "abc", "additional2": 2 } +``` + +If `removeAdditional` option in the example above were `"all"` then both `additional1` and `additional2` properties would have been removed. + +If the option were `"failing"` then property `additional1` would have been removed regardless of its value and property `additional2` would have been removed only if its value were failing the schema in the inner `additionalProperties` (so in the example above it would have stayed because it passes the schema, but any non-number would have been removed). + +__Please note__: If you use `removeAdditional` option with `additionalProperties` keyword inside `anyOf`/`oneOf` keywords your validation can fail with this schema, for example: + +```json +{ + "type": "object", + "oneOf": [ + { + "properties": { + "foo": { "type": "string" } + }, + "required": [ "foo" ], + "additionalProperties": false + }, + { + "properties": { + "bar": { "type": "integer" } + }, + "required": [ "bar" ], + "additionalProperties": false + } + ] +} +``` + +The intention of the schema above is to allow objects with either the string property "foo" or the integer property "bar", but not with both and not with any other properties. + +With the option `removeAdditional: true` the validation will pass for the object `{ "foo": "abc"}` but will fail for the object `{"bar": 1}`. It happens because while the first subschema in `oneOf` is validated, the property `bar` is removed because it is an additional property according to the standard (because it is not included in `properties` keyword in the same schema). + +While this behaviour is unexpected (issues [#129](https://github.com/ajv-validator/ajv/issues/129), [#134](https://github.com/ajv-validator/ajv/issues/134)), it is correct. To have the expected behaviour (both objects are allowed and additional properties are removed) the schema has to be refactored in this way: + +```json +{ + "type": "object", + "properties": { + "foo": { "type": "string" }, + "bar": { "type": "integer" } + }, + "additionalProperties": false, + "oneOf": [ + { "required": [ "foo" ] }, + { "required": [ "bar" ] } + ] +} +``` + +The schema above is also more efficient - it will compile into a faster function. + + +## Assigning defaults + +With [option `useDefaults`](#options) Ajv will assign values from `default` keyword in the schemas of `properties` and `items` (when it is the array of schemas) to the missing properties and items. + +With the option value `"empty"` properties and items equal to `null` or `""` (empty string) will be considered missing and assigned defaults. + +This option modifies original data. + +__Please note__: the default value is inserted in the generated validation code as a literal, so the value inserted in the data will be the deep clone of the default in the schema. + + +Example 1 (`default` in `properties`): + +```javascript +var ajv = new Ajv({ useDefaults: true }); +var schema = { + "type": "object", + "properties": { + "foo": { "type": "number" }, + "bar": { "type": "string", "default": "baz" } + }, + "required": [ "foo", "bar" ] +}; + +var data = { "foo": 1 }; + +var validate = ajv.compile(schema); + +console.log(validate(data)); // true +console.log(data); // { "foo": 1, "bar": "baz" } +``` + +Example 2 (`default` in `items`): + +```javascript +var schema = { + "type": "array", + "items": [ + { "type": "number" }, + { "type": "string", "default": "foo" } + ] +} + +var data = [ 1 ]; + +var validate = ajv.compile(schema); + +console.log(validate(data)); // true +console.log(data); // [ 1, "foo" ] +``` + +`default` keywords in other cases are ignored: + +- not in `properties` or `items` subschemas +- in schemas inside `anyOf`, `oneOf` and `not` (see [#42](https://github.com/ajv-validator/ajv/issues/42)) +- in `if` subschema of `switch` keyword +- in schemas generated by custom macro keywords + +The [`strictDefaults` option](#options) customizes Ajv's behavior for the defaults that Ajv ignores (`true` raises an error, and `"log"` outputs a warning). + + +## Coercing data types + +When you are validating user inputs all your data properties are usually strings. The option `coerceTypes` allows you to have your data types coerced to the types specified in your schema `type` keywords, both to pass the validation and to use the correctly typed data afterwards. + +This option modifies original data. + +__Please note__: if you pass a scalar value to the validating function its type will be coerced and it will pass the validation, but the value of the variable you pass won't be updated because scalars are passed by value. + + +Example 1: + +```javascript +var ajv = new Ajv({ coerceTypes: true }); +var schema = { + "type": "object", + "properties": { + "foo": { "type": "number" }, + "bar": { "type": "boolean" } + }, + "required": [ "foo", "bar" ] +}; + +var data = { "foo": "1", "bar": "false" }; + +var validate = ajv.compile(schema); + +console.log(validate(data)); // true +console.log(data); // { "foo": 1, "bar": false } +``` + +Example 2 (array coercions): + +```javascript +var ajv = new Ajv({ coerceTypes: 'array' }); +var schema = { + "properties": { + "foo": { "type": "array", "items": { "type": "number" } }, + "bar": { "type": "boolean" } + } +}; + +var data = { "foo": "1", "bar": ["false"] }; + +var validate = ajv.compile(schema); + +console.log(validate(data)); // true +console.log(data); // { "foo": [1], "bar": false } +``` + +The coercion rules, as you can see from the example, are different from JavaScript both to validate user input as expected and to have the coercion reversible (to correctly validate cases where different types are defined in subschemas of "anyOf" and other compound keywords). + +See [Coercion rules](https://github.com/ajv-validator/ajv/blob/master/COERCION.md) for details. + + +## API + +##### new Ajv(Object options) -> Object + +Create Ajv instance. + + +##### .compile(Object schema) -> Function<Object data> + +Generate validating function and cache the compiled schema for future use. + +Validating function returns a boolean value. This function has properties `errors` and `schema`. Errors encountered during the last validation are assigned to `errors` property (it is assigned `null` if there was no errors). `schema` property contains the reference to the original schema. + +The schema passed to this method will be validated against meta-schema unless `validateSchema` option is false. If schema is invalid, an error will be thrown. See [options](#options). + + +##### .compileAsync(Object schema [, Boolean meta] [, Function callback]) -> Promise + +Asynchronous version of `compile` method that loads missing remote schemas using asynchronous function in `options.loadSchema`. This function returns a Promise that resolves to a validation function. An optional callback passed to `compileAsync` will be called with 2 parameters: error (or null) and validating function. The returned promise will reject (and the callback will be called with an error) when: + +- missing schema can't be loaded (`loadSchema` returns a Promise that rejects). +- a schema containing a missing reference is loaded, but the reference cannot be resolved. +- schema (or some loaded/referenced schema) is invalid. + +The function compiles schema and loads the first missing schema (or meta-schema) until all missing schemas are loaded. + +You can asynchronously compile meta-schema by passing `true` as the second parameter. + +See example in [Asynchronous compilation](#asynchronous-schema-compilation). + + +##### .validate(Object schema|String key|String ref, data) -> Boolean + +Validate data using passed schema (it will be compiled and cached). + +Instead of the schema you can use the key that was previously passed to `addSchema`, the schema id if it was present in the schema or any previously resolved reference. + +Validation errors will be available in the `errors` property of Ajv instance (`null` if there were no errors). + +__Please note__: every time this method is called the errors are overwritten so you need to copy them to another variable if you want to use them later. + +If the schema is asynchronous (has `$async` keyword on the top level) this method returns a Promise. See [Asynchronous validation](#asynchronous-validation). + + +##### .addSchema(Array<Object>|Object schema [, String key]) -> Ajv + +Add schema(s) to validator instance. This method does not compile schemas (but it still validates them). Because of that dependencies can be added in any order and circular dependencies are supported. It also prevents unnecessary compilation of schemas that are containers for other schemas but not used as a whole. + +Array of schemas can be passed (schemas should have ids), the second parameter will be ignored. + +Key can be passed that can be used to reference the schema and will be used as the schema id if there is no id inside the schema. If the key is not passed, the schema id will be used as the key. + + +Once the schema is added, it (and all the references inside it) can be referenced in other schemas and used to validate data. + +Although `addSchema` does not compile schemas, explicit compilation is not required - the schema will be compiled when it is used first time. + +By default the schema is validated against meta-schema before it is added, and if the schema does not pass validation the exception is thrown. This behaviour is controlled by `validateSchema` option. + +__Please note__: Ajv uses the [method chaining syntax](https://en.wikipedia.org/wiki/Method_chaining) for all methods with the prefix `add*` and `remove*`. +This allows you to do nice things like the following. + +```javascript +var validate = new Ajv().addSchema(schema).addFormat(name, regex).getSchema(uri); +``` + +##### .addMetaSchema(Array<Object>|Object schema [, String key]) -> Ajv + +Adds meta schema(s) that can be used to validate other schemas. That function should be used instead of `addSchema` because there may be instance options that would compile a meta schema incorrectly (at the moment it is `removeAdditional` option). + +There is no need to explicitly add draft-07 meta schema (http://json-schema.org/draft-07/schema) - it is added by default, unless option `meta` is set to `false`. You only need to use it if you have a changed meta-schema that you want to use to validate your schemas. See `validateSchema`. + + +##### .validateSchema(Object schema) -> Boolean + +Validates schema. This method should be used to validate schemas rather than `validate` due to the inconsistency of `uri` format in JSON Schema standard. + +By default this method is called automatically when the schema is added, so you rarely need to use it directly. + +If schema doesn't have `$schema` property, it is validated against draft 6 meta-schema (option `meta` should not be false). + +If schema has `$schema` property, then the schema with this id (that should be previously added) is used to validate passed schema. + +Errors will be available at `ajv.errors`. + + +##### .getSchema(String key) -> Function<Object data> + +Retrieve compiled schema previously added with `addSchema` by the key passed to `addSchema` or by its full reference (id). The returned validating function has `schema` property with the reference to the original schema. + + +##### .removeSchema([Object schema|String key|String ref|RegExp pattern]) -> Ajv + +Remove added/cached schema. Even if schema is referenced by other schemas it can be safely removed as dependent schemas have local references. + +Schema can be removed using: +- key passed to `addSchema` +- it's full reference (id) +- RegExp that should match schema id or key (meta-schemas won't be removed) +- actual schema object that will be stable-stringified to remove schema from cache + +If no parameter is passed all schemas but meta-schemas will be removed and the cache will be cleared. + + +##### .addFormat(String name, String|RegExp|Function|Object format) -> Ajv + +Add custom format to validate strings or numbers. It can also be used to replace pre-defined formats for Ajv instance. + +Strings are converted to RegExp. + +Function should return validation result as `true` or `false`. + +If object is passed it should have properties `validate`, `compare` and `async`: + +- _validate_: a string, RegExp or a function as described above. +- _compare_: an optional comparison function that accepts two strings and compares them according to the format meaning. This function is used with keywords `formatMaximum`/`formatMinimum` (defined in [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) package). It should return `1` if the first value is bigger than the second value, `-1` if it is smaller and `0` if it is equal. +- _async_: an optional `true` value if `validate` is an asynchronous function; in this case it should return a promise that resolves with a value `true` or `false`. +- _type_: an optional type of data that the format applies to. It can be `"string"` (default) or `"number"` (see https://github.com/ajv-validator/ajv/issues/291#issuecomment-259923858). If the type of data is different, the validation will pass. + +Custom formats can be also added via `formats` option. + + +##### .addKeyword(String keyword, Object definition) -> Ajv + +Add custom validation keyword to Ajv instance. + +Keyword should be different from all standard JSON Schema keywords and different from previously defined keywords. There is no way to redefine keywords or to remove keyword definition from the instance. + +Keyword must start with a letter, `_` or `$`, and may continue with letters, numbers, `_`, `$`, or `-`. +It is recommended to use an application-specific prefix for keywords to avoid current and future name collisions. + +Example Keywords: +- `"xyz-example"`: valid, and uses prefix for the xyz project to avoid name collisions. +- `"example"`: valid, but not recommended as it could collide with future versions of JSON Schema etc. +- `"3-example"`: invalid as numbers are not allowed to be the first character in a keyword + +Keyword definition is an object with the following properties: + +- _type_: optional string or array of strings with data type(s) that the keyword applies to. If not present, the keyword will apply to all types. +- _validate_: validating function +- _compile_: compiling function +- _macro_: macro function +- _inline_: compiling function that returns code (as string) +- _schema_: an optional `false` value used with "validate" keyword to not pass schema +- _metaSchema_: an optional meta-schema for keyword schema +- _dependencies_: an optional list of properties that must be present in the parent schema - it will be checked during schema compilation +- _modifying_: `true` MUST be passed if keyword modifies data +- _statements_: `true` can be passed in case inline keyword generates statements (as opposed to expression) +- _valid_: pass `true`/`false` to pre-define validation result, the result returned from validation function will be ignored. This option cannot be used with macro keywords. +- _$data_: an optional `true` value to support [$data reference](#data-reference) as the value of custom keyword. The reference will be resolved at validation time. If the keyword has meta-schema it would be extended to allow $data and it will be used to validate the resolved value. Supporting $data reference requires that keyword has validating function (as the only option or in addition to compile, macro or inline function). +- _async_: an optional `true` value if the validation function is asynchronous (whether it is compiled or passed in _validate_ property); in this case it should return a promise that resolves with a value `true` or `false`. This option is ignored in case of "macro" and "inline" keywords. +- _errors_: an optional boolean or string `"full"` indicating whether keyword returns errors. If this property is not set Ajv will determine if the errors were set in case of failed validation. + +_compile_, _macro_ and _inline_ are mutually exclusive, only one should be used at a time. _validate_ can be used separately or in addition to them to support $data reference. + +__Please note__: If the keyword is validating data type that is different from the type(s) in its definition, the validation function will not be called (and expanded macro will not be used), so there is no need to check for data type inside validation function or inside schema returned by macro function (unless you want to enforce a specific type and for some reason do not want to use a separate `type` keyword for that). In the same way as standard keywords work, if the keyword does not apply to the data type being validated, the validation of this keyword will succeed. + +See [Defining custom keywords](#defining-custom-keywords) for more details. + + +##### .getKeyword(String keyword) -> Object|Boolean + +Returns custom keyword definition, `true` for pre-defined keywords and `false` if the keyword is unknown. + + +##### .removeKeyword(String keyword) -> Ajv + +Removes custom or pre-defined keyword so you can redefine them. + +While this method can be used to extend pre-defined keywords, it can also be used to completely change their meaning - it may lead to unexpected results. + +__Please note__: schemas compiled before the keyword is removed will continue to work without changes. To recompile schemas use `removeSchema` method and compile them again. + + +##### .errorsText([Array<Object> errors [, Object options]]) -> String + +Returns the text with all errors in a String. + +Options can have properties `separator` (string used to separate errors, ", " by default) and `dataVar` (the variable name that dataPaths are prefixed with, "data" by default). + + +## Options + +Defaults: + +```javascript +{ + // validation and reporting options: + $data: false, + allErrors: false, + verbose: false, + $comment: false, // NEW in Ajv version 6.0 + jsonPointers: false, + uniqueItems: true, + unicode: true, + nullable: false, + format: 'fast', + formats: {}, + unknownFormats: true, + schemas: {}, + logger: undefined, + // referenced schema options: + schemaId: '$id', + missingRefs: true, + extendRefs: 'ignore', // recommended 'fail' + loadSchema: undefined, // function(uri: string): Promise {} + // options to modify validated data: + removeAdditional: false, + useDefaults: false, + coerceTypes: false, + // strict mode options + strictDefaults: false, + strictKeywords: false, + strictNumbers: false, + // asynchronous validation options: + transpile: undefined, // requires ajv-async package + // advanced options: + meta: true, + validateSchema: true, + addUsedSchema: true, + inlineRefs: true, + passContext: false, + loopRequired: Infinity, + ownProperties: false, + multipleOfPrecision: false, + errorDataPath: 'object', // deprecated + messages: true, + sourceCode: false, + processCode: undefined, // function (str: string, schema: object): string {} + cache: new Cache, + serialize: undefined +} +``` + +##### Validation and reporting options + +- _$data_: support [$data references](#data-reference). Draft 6 meta-schema that is added by default will be extended to allow them. If you want to use another meta-schema you need to use $dataMetaSchema method to add support for $data reference. See [API](#api). +- _allErrors_: check all rules collecting all errors. Default is to return after the first error. +- _verbose_: include the reference to the part of the schema (`schema` and `parentSchema`) and validated data in errors (false by default). +- _$comment_ (NEW in Ajv version 6.0): log or pass the value of `$comment` keyword to a function. Option values: + - `false` (default): ignore $comment keyword. + - `true`: log the keyword value to console. + - function: pass the keyword value, its schema path and root schema to the specified function +- _jsonPointers_: set `dataPath` property of errors using [JSON Pointers](https://tools.ietf.org/html/rfc6901) instead of JavaScript property access notation. +- _uniqueItems_: validate `uniqueItems` keyword (true by default). +- _unicode_: calculate correct length of strings with unicode pairs (true by default). Pass `false` to use `.length` of strings that is faster, but gives "incorrect" lengths of strings with unicode pairs - each unicode pair is counted as two characters. +- _nullable_: support keyword "nullable" from [Open API 3 specification](https://swagger.io/docs/specification/data-models/data-types/). +- _format_: formats validation mode. Option values: + - `"fast"` (default) - simplified and fast validation (see [Formats](#formats) for details of which formats are available and affected by this option). + - `"full"` - more restrictive and slow validation. E.g., 25:00:00 and 2015/14/33 will be invalid time and date in 'full' mode but it will be valid in 'fast' mode. + - `false` - ignore all format keywords. +- _formats_: an object with custom formats. Keys and values will be passed to `addFormat` method. +- _keywords_: an object with custom keywords. Keys and values will be passed to `addKeyword` method. +- _unknownFormats_: handling of unknown formats. Option values: + - `true` (default) - if an unknown format is encountered the exception is thrown during schema compilation. If `format` keyword value is [$data reference](#data-reference) and it is unknown the validation will fail. + - `[String]` - an array of unknown format names that will be ignored. This option can be used to allow usage of third party schemas with format(s) for which you don't have definitions, but still fail if another unknown format is used. If `format` keyword value is [$data reference](#data-reference) and it is not in this array the validation will fail. + - `"ignore"` - to log warning during schema compilation and always pass validation (the default behaviour in versions before 5.0.0). This option is not recommended, as it allows to mistype format name and it won't be validated without any error message. This behaviour is required by JSON Schema specification. +- _schemas_: an array or object of schemas that will be added to the instance. In case you pass the array the schemas must have IDs in them. When the object is passed the method `addSchema(value, key)` will be called for each schema in this object. +- _logger_: sets the logging method. Default is the global `console` object that should have methods `log`, `warn` and `error`. See [Error logging](#error-logging). Option values: + - custom logger - it should have methods `log`, `warn` and `error`. If any of these methods is missing an exception will be thrown. + - `false` - logging is disabled. + + +##### Referenced schema options + +- _schemaId_: this option defines which keywords are used as schema URI. Option value: + - `"$id"` (default) - only use `$id` keyword as schema URI (as specified in JSON Schema draft-06/07), ignore `id` keyword (if it is present a warning will be logged). + - `"id"` - only use `id` keyword as schema URI (as specified in JSON Schema draft-04), ignore `$id` keyword (if it is present a warning will be logged). + - `"auto"` - use both `$id` and `id` keywords as schema URI. If both are present (in the same schema object) and different the exception will be thrown during schema compilation. +- _missingRefs_: handling of missing referenced schemas. Option values: + - `true` (default) - if the reference cannot be resolved during compilation the exception is thrown. The thrown error has properties `missingRef` (with hash fragment) and `missingSchema` (without it). Both properties are resolved relative to the current base id (usually schema id, unless it was substituted). + - `"ignore"` - to log error during compilation and always pass validation. + - `"fail"` - to log error and successfully compile schema but fail validation if this rule is checked. +- _extendRefs_: validation of other keywords when `$ref` is present in the schema. Option values: + - `"ignore"` (default) - when `$ref` is used other keywords are ignored (as per [JSON Reference](https://tools.ietf.org/html/draft-pbryan-zyp-json-ref-03#section-3) standard). A warning will be logged during the schema compilation. + - `"fail"` (recommended) - if other validation keywords are used together with `$ref` the exception will be thrown when the schema is compiled. This option is recommended to make sure schema has no keywords that are ignored, which can be confusing. + - `true` - validate all keywords in the schemas with `$ref` (the default behaviour in versions before 5.0.0). +- _loadSchema_: asynchronous function that will be used to load remote schemas when `compileAsync` [method](#api-compileAsync) is used and some reference is missing (option `missingRefs` should NOT be 'fail' or 'ignore'). This function should accept remote schema uri as a parameter and return a Promise that resolves to a schema. See example in [Asynchronous compilation](#asynchronous-schema-compilation). + + +##### Options to modify validated data + +- _removeAdditional_: remove additional properties - see example in [Filtering data](#filtering-data). This option is not used if schema is added with `addMetaSchema` method. Option values: + - `false` (default) - not to remove additional properties + - `"all"` - all additional properties are removed, regardless of `additionalProperties` keyword in schema (and no validation is made for them). + - `true` - only additional properties with `additionalProperties` keyword equal to `false` are removed. + - `"failing"` - additional properties that fail schema validation will be removed (where `additionalProperties` keyword is `false` or schema). +- _useDefaults_: replace missing or undefined properties and items with the values from corresponding `default` keywords. Default behaviour is to ignore `default` keywords. This option is not used if schema is added with `addMetaSchema` method. See examples in [Assigning defaults](#assigning-defaults). Option values: + - `false` (default) - do not use defaults + - `true` - insert defaults by value (object literal is used). + - `"empty"` - in addition to missing or undefined, use defaults for properties and items that are equal to `null` or `""` (an empty string). + - `"shared"` (deprecated) - insert defaults by reference. If the default is an object, it will be shared by all instances of validated data. If you modify the inserted default in the validated data, it will be modified in the schema as well. +- _coerceTypes_: change data type of data to match `type` keyword. See the example in [Coercing data types](#coercing-data-types) and [coercion rules](https://github.com/ajv-validator/ajv/blob/master/COERCION.md). Option values: + - `false` (default) - no type coercion. + - `true` - coerce scalar data types. + - `"array"` - in addition to coercions between scalar types, coerce scalar data to an array with one element and vice versa (as required by the schema). + + +##### Strict mode options + +- _strictDefaults_: report ignored `default` keywords in schemas. Option values: + - `false` (default) - ignored defaults are not reported + - `true` - if an ignored default is present, throw an error + - `"log"` - if an ignored default is present, log warning +- _strictKeywords_: report unknown keywords in schemas. Option values: + - `false` (default) - unknown keywords are not reported + - `true` - if an unknown keyword is present, throw an error + - `"log"` - if an unknown keyword is present, log warning +- _strictNumbers_: validate numbers strictly, failing validation for NaN and Infinity. Option values: + - `false` (default) - NaN or Infinity will pass validation for numeric types + - `true` - NaN or Infinity will not pass validation for numeric types + +##### Asynchronous validation options + +- _transpile_: Requires [ajv-async](https://github.com/ajv-validator/ajv-async) package. It determines whether Ajv transpiles compiled asynchronous validation function. Option values: + - `undefined` (default) - transpile with [nodent](https://github.com/MatAtBread/nodent) if async functions are not supported. + - `true` - always transpile with nodent. + - `false` - do not transpile; if async functions are not supported an exception will be thrown. + + +##### Advanced options + +- _meta_: add [meta-schema](http://json-schema.org/documentation.html) so it can be used by other schemas (true by default). If an object is passed, it will be used as the default meta-schema for schemas that have no `$schema` keyword. This default meta-schema MUST have `$schema` keyword. +- _validateSchema_: validate added/compiled schemas against meta-schema (true by default). `$schema` property in the schema can be http://json-schema.org/draft-07/schema or absent (draft-07 meta-schema will be used) or can be a reference to the schema previously added with `addMetaSchema` method. Option values: + - `true` (default) - if the validation fails, throw the exception. + - `"log"` - if the validation fails, log error. + - `false` - skip schema validation. +- _addUsedSchema_: by default methods `compile` and `validate` add schemas to the instance if they have `$id` (or `id`) property that doesn't start with "#". If `$id` is present and it is not unique the exception will be thrown. Set this option to `false` to skip adding schemas to the instance and the `$id` uniqueness check when these methods are used. This option does not affect `addSchema` method. +- _inlineRefs_: Affects compilation of referenced schemas. Option values: + - `true` (default) - the referenced schemas that don't have refs in them are inlined, regardless of their size - that substantially improves performance at the cost of the bigger size of compiled schema functions. + - `false` - to not inline referenced schemas (they will be compiled as separate functions). + - integer number - to limit the maximum number of keywords of the schema that will be inlined. +- _passContext_: pass validation context to custom keyword functions. If this option is `true` and you pass some context to the compiled validation function with `validate.call(context, data)`, the `context` will be available as `this` in your custom keywords. By default `this` is Ajv instance. +- _loopRequired_: by default `required` keyword is compiled into a single expression (or a sequence of statements in `allErrors` mode). In case of a very large number of properties in this keyword it may result in a very big validation function. Pass integer to set the number of properties above which `required` keyword will be validated in a loop - smaller validation function size but also worse performance. +- _ownProperties_: by default Ajv iterates over all enumerable object properties; when this option is `true` only own enumerable object properties (i.e. found directly on the object rather than on its prototype) are iterated. Contributed by @mbroadst. +- _multipleOfPrecision_: by default `multipleOf` keyword is validated by comparing the result of division with parseInt() of that result. It works for dividers that are bigger than 1. For small dividers such as 0.01 the result of the division is usually not integer (even when it should be integer, see issue [#84](https://github.com/ajv-validator/ajv/issues/84)). If you need to use fractional dividers set this option to some positive integer N to have `multipleOf` validated using this formula: `Math.abs(Math.round(division) - division) < 1e-N` (it is slower but allows for float arithmetics deviations). +- _errorDataPath_ (deprecated): set `dataPath` to point to 'object' (default) or to 'property' when validating keywords `required`, `additionalProperties` and `dependencies`. +- _messages_: Include human-readable messages in errors. `true` by default. `false` can be passed when custom messages are used (e.g. with [ajv-i18n](https://github.com/ajv-validator/ajv-i18n)). +- _sourceCode_: add `sourceCode` property to validating function (for debugging; this code can be different from the result of toString call). +- _processCode_: an optional function to process generated code before it is passed to Function constructor. It can be used to either beautify (the validating function is generated without line-breaks) or to transpile code. Starting from version 5.0.0 this option replaced options: + - `beautify` that formatted the generated function using [js-beautify](https://github.com/beautify-web/js-beautify). If you want to beautify the generated code pass a function calling `require('js-beautify').js_beautify` as `processCode: code => js_beautify(code)`. + - `transpile` that transpiled asynchronous validation function. You can still use `transpile` option with [ajv-async](https://github.com/ajv-validator/ajv-async) package. See [Asynchronous validation](#asynchronous-validation) for more information. +- _cache_: an optional instance of cache to store compiled schemas using stable-stringified schema as a key. For example, set-associative cache [sacjs](https://github.com/epoberezkin/sacjs) can be used. If not passed then a simple hash is used which is good enough for the common use case (a limited number of statically defined schemas). Cache should have methods `put(key, value)`, `get(key)`, `del(key)` and `clear()`. +- _serialize_: an optional function to serialize schema to cache key. Pass `false` to use schema itself as a key (e.g., if WeakMap used as a cache). By default [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used. + + +## Validation errors + +In case of validation failure, Ajv assigns the array of errors to `errors` property of validation function (or to `errors` property of Ajv instance when `validate` or `validateSchema` methods were called). In case of [asynchronous validation](#asynchronous-validation), the returned promise is rejected with exception `Ajv.ValidationError` that has `errors` property. + + +### Error objects + +Each error is an object with the following properties: + +- _keyword_: validation keyword. +- _dataPath_: the path to the part of the data that was validated. By default `dataPath` uses JavaScript property access notation (e.g., `".prop[1].subProp"`). When the option `jsonPointers` is true (see [Options](#options)) `dataPath` will be set using JSON pointer standard (e.g., `"/prop/1/subProp"`). +- _schemaPath_: the path (JSON-pointer as a URI fragment) to the schema of the keyword that failed validation. +- _params_: the object with the additional information about error that can be used to create custom error messages (e.g., using [ajv-i18n](https://github.com/ajv-validator/ajv-i18n) package). See below for parameters set by all keywords. +- _message_: the standard error message (can be excluded with option `messages` set to false). +- _schema_: the schema of the keyword (added with `verbose` option). +- _parentSchema_: the schema containing the keyword (added with `verbose` option) +- _data_: the data validated by the keyword (added with `verbose` option). + +__Please note__: `propertyNames` keyword schema validation errors have an additional property `propertyName`, `dataPath` points to the object. After schema validation for each property name, if it is invalid an additional error is added with the property `keyword` equal to `"propertyNames"`. + + +### Error parameters + +Properties of `params` object in errors depend on the keyword that failed validation. + +- `maxItems`, `minItems`, `maxLength`, `minLength`, `maxProperties`, `minProperties` - property `limit` (number, the schema of the keyword). +- `additionalItems` - property `limit` (the maximum number of allowed items in case when `items` keyword is an array of schemas and `additionalItems` is false). +- `additionalProperties` - property `additionalProperty` (the property not used in `properties` and `patternProperties` keywords). +- `dependencies` - properties: + - `property` (dependent property), + - `missingProperty` (required missing dependency - only the first one is reported currently) + - `deps` (required dependencies, comma separated list as a string), + - `depsCount` (the number of required dependencies). +- `format` - property `format` (the schema of the keyword). +- `maximum`, `minimum` - properties: + - `limit` (number, the schema of the keyword), + - `exclusive` (boolean, the schema of `exclusiveMaximum` or `exclusiveMinimum`), + - `comparison` (string, comparison operation to compare the data to the limit, with the data on the left and the limit on the right; can be "<", "<=", ">", ">=") +- `multipleOf` - property `multipleOf` (the schema of the keyword) +- `pattern` - property `pattern` (the schema of the keyword) +- `required` - property `missingProperty` (required property that is missing). +- `propertyNames` - property `propertyName` (an invalid property name). +- `patternRequired` (in ajv-keywords) - property `missingPattern` (required pattern that did not match any property). +- `type` - property `type` (required type(s), a string, can be a comma-separated list) +- `uniqueItems` - properties `i` and `j` (indices of duplicate items). +- `const` - property `allowedValue` pointing to the value (the schema of the keyword). +- `enum` - property `allowedValues` pointing to the array of values (the schema of the keyword). +- `$ref` - property `ref` with the referenced schema URI. +- `oneOf` - property `passingSchemas` (array of indices of passing schemas, null if no schema passes). +- custom keywords (in case keyword definition doesn't create errors) - property `keyword` (the keyword name). + + +### Error logging + +Using the `logger` option when initiallizing Ajv will allow you to define custom logging. Here you can build upon the exisiting logging. The use of other logging packages is supported as long as the package or its associated wrapper exposes the required methods. If any of the required methods are missing an exception will be thrown. +- **Required Methods**: `log`, `warn`, `error` + +```javascript +var otherLogger = new OtherLogger(); +var ajv = new Ajv({ + logger: { + log: console.log.bind(console), + warn: function warn() { + otherLogger.logWarn.apply(otherLogger, arguments); + }, + error: function error() { + otherLogger.logError.apply(otherLogger, arguments); + console.error.apply(console, arguments); + } + } +}); +``` + + +## Plugins + +Ajv can be extended with plugins that add custom keywords, formats or functions to process generated code. When such plugin is published as npm package it is recommended that it follows these conventions: + +- it exports a function +- this function accepts ajv instance as the first parameter and returns the same instance to allow chaining +- this function can accept an optional configuration as the second parameter + +If you have published a useful plugin please submit a PR to add it to the next section. + + +## Related packages + +- [ajv-async](https://github.com/ajv-validator/ajv-async) - plugin to configure async validation mode +- [ajv-bsontype](https://github.com/BoLaMN/ajv-bsontype) - plugin to validate mongodb's bsonType formats +- [ajv-cli](https://github.com/jessedc/ajv-cli) - command line interface +- [ajv-errors](https://github.com/ajv-validator/ajv-errors) - plugin for custom error messages +- [ajv-i18n](https://github.com/ajv-validator/ajv-i18n) - internationalised error messages +- [ajv-istanbul](https://github.com/ajv-validator/ajv-istanbul) - plugin to instrument generated validation code to measure test coverage of your schemas +- [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) - plugin with custom validation keywords (select, typeof, etc.) +- [ajv-merge-patch](https://github.com/ajv-validator/ajv-merge-patch) - plugin with keywords $merge and $patch +- [ajv-pack](https://github.com/ajv-validator/ajv-pack) - produces a compact module exporting validation functions +- [ajv-formats-draft2019](https://github.com/luzlab/ajv-formats-draft2019) - format validators for draft2019 that aren't already included in ajv (ie. `idn-hostname`, `idn-email`, `iri`, `iri-reference` and `duration`). + +## Some packages using Ajv + +- [webpack](https://github.com/webpack/webpack) - a module bundler. Its main purpose is to bundle JavaScript files for usage in a browser +- [jsonscript-js](https://github.com/JSONScript/jsonscript-js) - the interpreter for [JSONScript](http://www.jsonscript.org) - scripted processing of existing endpoints and services +- [osprey-method-handler](https://github.com/mulesoft-labs/osprey-method-handler) - Express middleware for validating requests and responses based on a RAML method object, used in [osprey](https://github.com/mulesoft/osprey) - validating API proxy generated from a RAML definition +- [har-validator](https://github.com/ahmadnassri/har-validator) - HTTP Archive (HAR) validator +- [jsoneditor](https://github.com/josdejong/jsoneditor) - a web-based tool to view, edit, format, and validate JSON http://jsoneditoronline.org +- [JSON Schema Lint](https://github.com/nickcmaynard/jsonschemalint) - a web tool to validate JSON/YAML document against a single JSON Schema http://jsonschemalint.com +- [objection](https://github.com/vincit/objection.js) - SQL-friendly ORM for Node.js +- [table](https://github.com/gajus/table) - formats data into a string table +- [ripple-lib](https://github.com/ripple/ripple-lib) - a JavaScript API for interacting with [Ripple](https://ripple.com) in Node.js and the browser +- [restbase](https://github.com/wikimedia/restbase) - distributed storage with REST API & dispatcher for backend services built to provide a low-latency & high-throughput API for Wikipedia / Wikimedia content +- [hippie-swagger](https://github.com/CacheControl/hippie-swagger) - [Hippie](https://github.com/vesln/hippie) wrapper that provides end to end API testing with swagger validation +- [react-form-controlled](https://github.com/seeden/react-form-controlled) - React controlled form components with validation +- [rabbitmq-schema](https://github.com/tjmehta/rabbitmq-schema) - a schema definition module for RabbitMQ graphs and messages +- [@query/schema](https://www.npmjs.com/package/@query/schema) - stream filtering with a URI-safe query syntax parsing to JSON Schema +- [chai-ajv-json-schema](https://github.com/peon374/chai-ajv-json-schema) - chai plugin to us JSON Schema with expect in mocha tests +- [grunt-jsonschema-ajv](https://github.com/SignpostMarv/grunt-jsonschema-ajv) - Grunt plugin for validating files against JSON Schema +- [extract-text-webpack-plugin](https://github.com/webpack-contrib/extract-text-webpack-plugin) - extract text from bundle into a file +- [electron-builder](https://github.com/electron-userland/electron-builder) - a solution to package and build a ready for distribution Electron app +- [addons-linter](https://github.com/mozilla/addons-linter) - Mozilla Add-ons Linter +- [gh-pages-generator](https://github.com/epoberezkin/gh-pages-generator) - multi-page site generator converting markdown files to GitHub pages +- [ESLint](https://github.com/eslint/eslint) - the pluggable linting utility for JavaScript and JSX + + +## Tests + +``` +npm install +git submodule update --init +npm test +``` + +## Contributing + +All validation functions are generated using doT templates in [dot](https://github.com/ajv-validator/ajv/tree/master/lib/dot) folder. Templates are precompiled so doT is not a run-time dependency. + +`npm run build` - compiles templates to [dotjs](https://github.com/ajv-validator/ajv/tree/master/lib/dotjs) folder. + +`npm run watch` - automatically compiles templates when files in dot folder change + +Please see [Contributing guidelines](https://github.com/ajv-validator/ajv/blob/master/CONTRIBUTING.md) + + +## Changes history + +See https://github.com/ajv-validator/ajv/releases + +__Please note__: [Changes in version 7.0.0-beta](https://github.com/ajv-validator/ajv/releases/tag/v7.0.0-beta.0) + +[Version 6.0.0](https://github.com/ajv-validator/ajv/releases/tag/v6.0.0). + +## Code of conduct + +Please review and follow the [Code of conduct](https://github.com/ajv-validator/ajv/blob/master/CODE_OF_CONDUCT.md). + +Please report any unacceptable behaviour to ajv.validator@gmail.com - it will be reviewed by the project team. + + +## Open-source software support + +Ajv is a part of [Tidelift subscription](https://tidelift.com/subscription/pkg/npm-ajv?utm_source=npm-ajv&utm_medium=referral&utm_campaign=readme) - it provides a centralised support to open-source software users, in addition to the support provided by software maintainers. + + +## License + +[MIT](https://github.com/ajv-validator/ajv/blob/master/LICENSE) diff --git a/tunestats/app/api/node_modules/ajv/dist/ajv.bundle.js b/tunestats/app/api/node_modules/ajv/dist/ajv.bundle.js new file mode 100644 index 0000000..e4d9d15 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/dist/ajv.bundle.js @@ -0,0 +1,7189 @@ +(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.Ajv = f()}})(function(){var define,module,exports;return (function(){function r(e,n,t){function o(i,f){if(!n[i]){if(!e[i]){var c="function"==typeof require&&require;if(!f&&c)return c(i,!0);if(u)return u(i,!0);var a=new Error("Cannot find module '"+i+"'");throw a.code="MODULE_NOT_FOUND",a}var p=n[i]={exports:{}};e[i][0].call(p.exports,function(r){var n=e[i][1][r];return o(n||r)},p,p.exports,r,e,n,t)}return n[i].exports}for(var u="function"==typeof require&&require,i=0;i%\\^`{|}]|%[0-9a-f]{2})|\{[+#./;?&=,!@|]?(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?(?:,(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?)*\})*$/i; +// For the source: https://gist.github.com/dperini/729294 +// For test cases: https://mathiasbynens.be/demo/url-regex +// @todo Delete current URL in favour of the commented out URL rule when this issue is fixed https://github.com/eslint/eslint/issues/7983. +// var URL = /^(?:(?:https?|ftp):\/\/)(?:\S+(?::\S*)?@)?(?:(?!10(?:\.\d{1,3}){3})(?!127(?:\.\d{1,3}){3})(?!169\.254(?:\.\d{1,3}){2})(?!192\.168(?:\.\d{1,3}){2})(?!172\.(?:1[6-9]|2\d|3[0-1])(?:\.\d{1,3}){2})(?:[1-9]\d?|1\d\d|2[01]\d|22[0-3])(?:\.(?:1?\d{1,2}|2[0-4]\d|25[0-5])){2}(?:\.(?:[1-9]\d?|1\d\d|2[0-4]\d|25[0-4]))|(?:(?:[a-z\u{00a1}-\u{ffff}0-9]+-)*[a-z\u{00a1}-\u{ffff}0-9]+)(?:\.(?:[a-z\u{00a1}-\u{ffff}0-9]+-)*[a-z\u{00a1}-\u{ffff}0-9]+)*(?:\.(?:[a-z\u{00a1}-\u{ffff}]{2,})))(?::\d{2,5})?(?:\/[^\s]*)?$/iu; +var URL = /^(?:(?:http[s\u017F]?|ftp):\/\/)(?:(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+(?::(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?@)?(?:(?!10(?:\.[0-9]{1,3}){3})(?!127(?:\.[0-9]{1,3}){3})(?!169\.254(?:\.[0-9]{1,3}){2})(?!192\.168(?:\.[0-9]{1,3}){2})(?!172\.(?:1[6-9]|2[0-9]|3[01])(?:\.[0-9]{1,3}){2})(?:[1-9][0-9]?|1[0-9][0-9]|2[01][0-9]|22[0-3])(?:\.(?:1?[0-9]{1,2}|2[0-4][0-9]|25[0-5])){2}(?:\.(?:[1-9][0-9]?|1[0-9][0-9]|2[0-4][0-9]|25[0-4]))|(?:(?:(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-)*(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)(?:\.(?:(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-)*(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)*(?:\.(?:(?:[a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]){2,})))(?::[0-9]{2,5})?(?:\/(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?$/i; +var UUID = /^(?:urn:uuid:)?[0-9a-f]{8}-(?:[0-9a-f]{4}-){3}[0-9a-f]{12}$/i; +var JSON_POINTER = /^(?:\/(?:[^~/]|~0|~1)*)*$/; +var JSON_POINTER_URI_FRAGMENT = /^#(?:\/(?:[a-z0-9_\-.!$&'()*+,;:=@]|%[0-9a-f]{2}|~0|~1)*)*$/i; +var RELATIVE_JSON_POINTER = /^(?:0|[1-9][0-9]*)(?:#|(?:\/(?:[^~/]|~0|~1)*)*)$/; + + +module.exports = formats; + +function formats(mode) { + mode = mode == 'full' ? 'full' : 'fast'; + return util.copy(formats[mode]); +} + + +formats.fast = { + // date: http://tools.ietf.org/html/rfc3339#section-5.6 + date: /^\d\d\d\d-[0-1]\d-[0-3]\d$/, + // date-time: http://tools.ietf.org/html/rfc3339#section-5.6 + time: /^(?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)?$/i, + 'date-time': /^\d\d\d\d-[0-1]\d-[0-3]\d[t\s](?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)$/i, + // uri: https://github.com/mafintosh/is-my-json-valid/blob/master/formats.js + uri: /^(?:[a-z][a-z0-9+\-.]*:)(?:\/?\/)?[^\s]*$/i, + 'uri-reference': /^(?:(?:[a-z][a-z0-9+\-.]*:)?\/?\/)?(?:[^\\\s#][^\s#]*)?(?:#[^\\\s]*)?$/i, + 'uri-template': URITEMPLATE, + url: URL, + // email (sources from jsen validator): + // http://stackoverflow.com/questions/201323/using-a-regular-expression-to-validate-an-email-address#answer-8829363 + // http://www.w3.org/TR/html5/forms.html#valid-e-mail-address (search for 'willful violation') + email: /^[a-z0-9.!#$%&'*+/=?^_`{|}~-]+@[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?)*$/i, + hostname: HOSTNAME, + // optimized https://www.safaribooksonline.com/library/view/regular-expressions-cookbook/9780596802837/ch07s16.html + ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, + // optimized http://stackoverflow.com/questions/53497/regular-expression-that-matches-valid-ipv6-addresses + ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, + regex: regex, + // uuid: http://tools.ietf.org/html/rfc4122 + uuid: UUID, + // JSON-pointer: https://tools.ietf.org/html/rfc6901 + // uri fragment: https://tools.ietf.org/html/rfc3986#appendix-A + 'json-pointer': JSON_POINTER, + 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, + // relative JSON-pointer: http://tools.ietf.org/html/draft-luff-relative-json-pointer-00 + 'relative-json-pointer': RELATIVE_JSON_POINTER +}; + + +formats.full = { + date: date, + time: time, + 'date-time': date_time, + uri: uri, + 'uri-reference': URIREF, + 'uri-template': URITEMPLATE, + url: URL, + email: /^[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@(?:[a-z0-9](?:[a-z0-9-]*[a-z0-9])?\.)+[a-z0-9](?:[a-z0-9-]*[a-z0-9])?$/i, + hostname: HOSTNAME, + ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, + ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, + regex: regex, + uuid: UUID, + 'json-pointer': JSON_POINTER, + 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, + 'relative-json-pointer': RELATIVE_JSON_POINTER +}; + + +function isLeapYear(year) { + // https://tools.ietf.org/html/rfc3339#appendix-C + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +} + + +function date(str) { + // full-date from http://tools.ietf.org/html/rfc3339#section-5.6 + var matches = str.match(DATE); + if (!matches) return false; + + var year = +matches[1]; + var month = +matches[2]; + var day = +matches[3]; + + return month >= 1 && month <= 12 && day >= 1 && + day <= (month == 2 && isLeapYear(year) ? 29 : DAYS[month]); +} + + +function time(str, full) { + var matches = str.match(TIME); + if (!matches) return false; + + var hour = matches[1]; + var minute = matches[2]; + var second = matches[3]; + var timeZone = matches[5]; + return ((hour <= 23 && minute <= 59 && second <= 59) || + (hour == 23 && minute == 59 && second == 60)) && + (!full || timeZone); +} + + +var DATE_TIME_SEPARATOR = /t|\s/i; +function date_time(str) { + // http://tools.ietf.org/html/rfc3339#section-5.6 + var dateTime = str.split(DATE_TIME_SEPARATOR); + return dateTime.length == 2 && date(dateTime[0]) && time(dateTime[1], true); +} + + +var NOT_URI_FRAGMENT = /\/|:/; +function uri(str) { + // http://jmrware.com/articles/2009/uri_regexp/URI_regex.html + optional protocol + required "." + return NOT_URI_FRAGMENT.test(str) && URI.test(str); +} + + +var Z_ANCHOR = /[^\\]\\Z/; +function regex(str) { + if (Z_ANCHOR.test(str)) return false; + try { + new RegExp(str); + return true; + } catch(e) { + return false; + } +} + +},{"./util":10}],5:[function(require,module,exports){ +'use strict'; + +var resolve = require('./resolve') + , util = require('./util') + , errorClasses = require('./error_classes') + , stableStringify = require('fast-json-stable-stringify'); + +var validateGenerator = require('../dotjs/validate'); + +/** + * Functions below are used inside compiled validations function + */ + +var ucs2length = util.ucs2length; +var equal = require('fast-deep-equal'); + +// this error is thrown by async schemas to return validation errors via exception +var ValidationError = errorClasses.Validation; + +module.exports = compile; + + +/** + * Compiles schema to validation function + * @this Ajv + * @param {Object} schema schema object + * @param {Object} root object with information about the root schema for this schema + * @param {Object} localRefs the hash of local references inside the schema (created by resolve.id), used for inline resolution + * @param {String} baseId base ID for IDs in the schema + * @return {Function} validation function + */ +function compile(schema, root, localRefs, baseId) { + /* jshint validthis: true, evil: true */ + /* eslint no-shadow: 0 */ + var self = this + , opts = this._opts + , refVal = [ undefined ] + , refs = {} + , patterns = [] + , patternsHash = {} + , defaults = [] + , defaultsHash = {} + , customRules = []; + + root = root || { schema: schema, refVal: refVal, refs: refs }; + + var c = checkCompiling.call(this, schema, root, baseId); + var compilation = this._compilations[c.index]; + if (c.compiling) return (compilation.callValidate = callValidate); + + var formats = this._formats; + var RULES = this.RULES; + + try { + var v = localCompile(schema, root, localRefs, baseId); + compilation.validate = v; + var cv = compilation.callValidate; + if (cv) { + cv.schema = v.schema; + cv.errors = null; + cv.refs = v.refs; + cv.refVal = v.refVal; + cv.root = v.root; + cv.$async = v.$async; + if (opts.sourceCode) cv.source = v.source; + } + return v; + } finally { + endCompiling.call(this, schema, root, baseId); + } + + /* @this {*} - custom context, see passContext option */ + function callValidate() { + /* jshint validthis: true */ + var validate = compilation.validate; + var result = validate.apply(this, arguments); + callValidate.errors = validate.errors; + return result; + } + + function localCompile(_schema, _root, localRefs, baseId) { + var isRoot = !_root || (_root && _root.schema == _schema); + if (_root.schema != root.schema) + return compile.call(self, _schema, _root, localRefs, baseId); + + var $async = _schema.$async === true; + + var sourceCode = validateGenerator({ + isTop: true, + schema: _schema, + isRoot: isRoot, + baseId: baseId, + root: _root, + schemaPath: '', + errSchemaPath: '#', + errorPath: '""', + MissingRefError: errorClasses.MissingRef, + RULES: RULES, + validate: validateGenerator, + util: util, + resolve: resolve, + resolveRef: resolveRef, + usePattern: usePattern, + useDefault: useDefault, + useCustomRule: useCustomRule, + opts: opts, + formats: formats, + logger: self.logger, + self: self + }); + + sourceCode = vars(refVal, refValCode) + vars(patterns, patternCode) + + vars(defaults, defaultCode) + vars(customRules, customRuleCode) + + sourceCode; + + if (opts.processCode) sourceCode = opts.processCode(sourceCode, _schema); + // console.log('\n\n\n *** \n', JSON.stringify(sourceCode)); + var validate; + try { + var makeValidate = new Function( + 'self', + 'RULES', + 'formats', + 'root', + 'refVal', + 'defaults', + 'customRules', + 'equal', + 'ucs2length', + 'ValidationError', + sourceCode + ); + + validate = makeValidate( + self, + RULES, + formats, + root, + refVal, + defaults, + customRules, + equal, + ucs2length, + ValidationError + ); + + refVal[0] = validate; + } catch(e) { + self.logger.error('Error compiling schema, function code:', sourceCode); + throw e; + } + + validate.schema = _schema; + validate.errors = null; + validate.refs = refs; + validate.refVal = refVal; + validate.root = isRoot ? validate : _root; + if ($async) validate.$async = true; + if (opts.sourceCode === true) { + validate.source = { + code: sourceCode, + patterns: patterns, + defaults: defaults + }; + } + + return validate; + } + + function resolveRef(baseId, ref, isRoot) { + ref = resolve.url(baseId, ref); + var refIndex = refs[ref]; + var _refVal, refCode; + if (refIndex !== undefined) { + _refVal = refVal[refIndex]; + refCode = 'refVal[' + refIndex + ']'; + return resolvedRef(_refVal, refCode); + } + if (!isRoot && root.refs) { + var rootRefId = root.refs[ref]; + if (rootRefId !== undefined) { + _refVal = root.refVal[rootRefId]; + refCode = addLocalRef(ref, _refVal); + return resolvedRef(_refVal, refCode); + } + } + + refCode = addLocalRef(ref); + var v = resolve.call(self, localCompile, root, ref); + if (v === undefined) { + var localSchema = localRefs && localRefs[ref]; + if (localSchema) { + v = resolve.inlineRef(localSchema, opts.inlineRefs) + ? localSchema + : compile.call(self, localSchema, root, localRefs, baseId); + } + } + + if (v === undefined) { + removeLocalRef(ref); + } else { + replaceLocalRef(ref, v); + return resolvedRef(v, refCode); + } + } + + function addLocalRef(ref, v) { + var refId = refVal.length; + refVal[refId] = v; + refs[ref] = refId; + return 'refVal' + refId; + } + + function removeLocalRef(ref) { + delete refs[ref]; + } + + function replaceLocalRef(ref, v) { + var refId = refs[ref]; + refVal[refId] = v; + } + + function resolvedRef(refVal, code) { + return typeof refVal == 'object' || typeof refVal == 'boolean' + ? { code: code, schema: refVal, inline: true } + : { code: code, $async: refVal && !!refVal.$async }; + } + + function usePattern(regexStr) { + var index = patternsHash[regexStr]; + if (index === undefined) { + index = patternsHash[regexStr] = patterns.length; + patterns[index] = regexStr; + } + return 'pattern' + index; + } + + function useDefault(value) { + switch (typeof value) { + case 'boolean': + case 'number': + return '' + value; + case 'string': + return util.toQuotedString(value); + case 'object': + if (value === null) return 'null'; + var valueStr = stableStringify(value); + var index = defaultsHash[valueStr]; + if (index === undefined) { + index = defaultsHash[valueStr] = defaults.length; + defaults[index] = value; + } + return 'default' + index; + } + } + + function useCustomRule(rule, schema, parentSchema, it) { + if (self._opts.validateSchema !== false) { + var deps = rule.definition.dependencies; + if (deps && !deps.every(function(keyword) { + return Object.prototype.hasOwnProperty.call(parentSchema, keyword); + })) + throw new Error('parent schema must have all required keywords: ' + deps.join(',')); + + var validateSchema = rule.definition.validateSchema; + if (validateSchema) { + var valid = validateSchema(schema); + if (!valid) { + var message = 'keyword schema is invalid: ' + self.errorsText(validateSchema.errors); + if (self._opts.validateSchema == 'log') self.logger.error(message); + else throw new Error(message); + } + } + } + + var compile = rule.definition.compile + , inline = rule.definition.inline + , macro = rule.definition.macro; + + var validate; + if (compile) { + validate = compile.call(self, schema, parentSchema, it); + } else if (macro) { + validate = macro.call(self, schema, parentSchema, it); + if (opts.validateSchema !== false) self.validateSchema(validate, true); + } else if (inline) { + validate = inline.call(self, it, rule.keyword, schema, parentSchema); + } else { + validate = rule.definition.validate; + if (!validate) return; + } + + if (validate === undefined) + throw new Error('custom keyword "' + rule.keyword + '"failed to compile'); + + var index = customRules.length; + customRules[index] = validate; + + return { + code: 'customRule' + index, + validate: validate + }; + } +} + + +/** + * Checks if the schema is currently compiled + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + * @return {Object} object with properties "index" (compilation index) and "compiling" (boolean) + */ +function checkCompiling(schema, root, baseId) { + /* jshint validthis: true */ + var index = compIndex.call(this, schema, root, baseId); + if (index >= 0) return { index: index, compiling: true }; + index = this._compilations.length; + this._compilations[index] = { + schema: schema, + root: root, + baseId: baseId + }; + return { index: index, compiling: false }; +} + + +/** + * Removes the schema from the currently compiled list + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + */ +function endCompiling(schema, root, baseId) { + /* jshint validthis: true */ + var i = compIndex.call(this, schema, root, baseId); + if (i >= 0) this._compilations.splice(i, 1); +} + + +/** + * Index of schema compilation in the currently compiled list + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + * @return {Integer} compilation index + */ +function compIndex(schema, root, baseId) { + /* jshint validthis: true */ + for (var i=0; i= 0xD800 && value <= 0xDBFF && pos < len) { + // high surrogate, and there is a next character + value = str.charCodeAt(pos); + if ((value & 0xFC00) == 0xDC00) pos++; // low surrogate + } + } + return length; +}; + +},{}],10:[function(require,module,exports){ +'use strict'; + + +module.exports = { + copy: copy, + checkDataType: checkDataType, + checkDataTypes: checkDataTypes, + coerceToTypes: coerceToTypes, + toHash: toHash, + getProperty: getProperty, + escapeQuotes: escapeQuotes, + equal: require('fast-deep-equal'), + ucs2length: require('./ucs2length'), + varOccurences: varOccurences, + varReplace: varReplace, + schemaHasRules: schemaHasRules, + schemaHasRulesExcept: schemaHasRulesExcept, + schemaUnknownRules: schemaUnknownRules, + toQuotedString: toQuotedString, + getPathExpr: getPathExpr, + getPath: getPath, + getData: getData, + unescapeFragment: unescapeFragment, + unescapeJsonPointer: unescapeJsonPointer, + escapeFragment: escapeFragment, + escapeJsonPointer: escapeJsonPointer +}; + + +function copy(o, to) { + to = to || {}; + for (var key in o) to[key] = o[key]; + return to; +} + + +function checkDataType(dataType, data, strictNumbers, negate) { + var EQUAL = negate ? ' !== ' : ' === ' + , AND = negate ? ' || ' : ' && ' + , OK = negate ? '!' : '' + , NOT = negate ? '' : '!'; + switch (dataType) { + case 'null': return data + EQUAL + 'null'; + case 'array': return OK + 'Array.isArray(' + data + ')'; + case 'object': return '(' + OK + data + AND + + 'typeof ' + data + EQUAL + '"object"' + AND + + NOT + 'Array.isArray(' + data + '))'; + case 'integer': return '(typeof ' + data + EQUAL + '"number"' + AND + + NOT + '(' + data + ' % 1)' + + AND + data + EQUAL + data + + (strictNumbers ? (AND + OK + 'isFinite(' + data + ')') : '') + ')'; + case 'number': return '(typeof ' + data + EQUAL + '"' + dataType + '"' + + (strictNumbers ? (AND + OK + 'isFinite(' + data + ')') : '') + ')'; + default: return 'typeof ' + data + EQUAL + '"' + dataType + '"'; + } +} + + +function checkDataTypes(dataTypes, data, strictNumbers) { + switch (dataTypes.length) { + case 1: return checkDataType(dataTypes[0], data, strictNumbers, true); + default: + var code = ''; + var types = toHash(dataTypes); + if (types.array && types.object) { + code = types.null ? '(': '(!' + data + ' || '; + code += 'typeof ' + data + ' !== "object")'; + delete types.null; + delete types.array; + delete types.object; + } + if (types.number) delete types.integer; + for (var t in types) + code += (code ? ' && ' : '' ) + checkDataType(t, data, strictNumbers, true); + + return code; + } +} + + +var COERCE_TO_TYPES = toHash([ 'string', 'number', 'integer', 'boolean', 'null' ]); +function coerceToTypes(optionCoerceTypes, dataTypes) { + if (Array.isArray(dataTypes)) { + var types = []; + for (var i=0; i= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); + return paths[lvl - up]; + } + + if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); + data = 'data' + ((lvl - up) || ''); + if (!jsonPointer) return data; + } + + var expr = data; + var segments = jsonPointer.split('/'); + for (var i=0; i', + $notOp = $isMax ? '>' : '<', + $errorKeyword = undefined; + if (!($isData || typeof $schema == 'number' || $schema === undefined)) { + throw new Error($keyword + ' must be number'); + } + if (!($isDataExcl || $schemaExcl === undefined || typeof $schemaExcl == 'number' || typeof $schemaExcl == 'boolean')) { + throw new Error($exclusiveKeyword + ' must be number or boolean'); + } + if ($isDataExcl) { + var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr), + $exclusive = 'exclusive' + $lvl, + $exclType = 'exclType' + $lvl, + $exclIsNumber = 'exclIsNumber' + $lvl, + $opExpr = 'op' + $lvl, + $opStr = '\' + ' + $opExpr + ' + \''; + out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; '; + $schemaValueExcl = 'schemaExcl' + $lvl; + out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { '; + var $errorKeyword = $exclusiveKeyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; '; + if ($schema === undefined) { + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $schemaValue = $schemaValueExcl; + $isData = $isDataExcl; + } + } else { + var $exclIsNumber = typeof $schemaExcl == 'number', + $opStr = $op; + if ($exclIsNumber && $isData) { + var $opExpr = '\'' + $opStr + '\''; + out += ' if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { '; + } else { + if ($exclIsNumber && $schema === undefined) { + $exclusive = true; + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $schemaValue = $schemaExcl; + $notOp += '='; + } else { + if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); + if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { + $exclusive = true; + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $notOp += '='; + } else { + $exclusive = false; + $opStr += '='; + } + } + var $opExpr = '\'' + $opStr + '\''; + out += ' if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { '; + } + } + $errorKeyword = $errorKeyword || $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be ' + ($opStr) + ' '; + if ($isData) { + out += '\' + ' + ($schemaValue); + } else { + out += '' + ($schemaValue) + '\''; + } + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + +},{}],14:[function(require,module,exports){ +'use strict'; +module.exports = function generate__limitItems(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!($isData || typeof $schema == 'number')) { + throw new Error($keyword + ' must be number'); + } + var $op = $keyword == 'maxItems' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have '; + if ($keyword == 'maxItems') { + out += 'more'; + } else { + out += 'fewer'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' items\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + +},{}],15:[function(require,module,exports){ +'use strict'; +module.exports = function generate__limitLength(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!($isData || typeof $schema == 'number')) { + throw new Error($keyword + ' must be number'); + } + var $op = $keyword == 'maxLength' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + if (it.opts.unicode === false) { + out += ' ' + ($data) + '.length '; + } else { + out += ' ucs2length(' + ($data) + ') '; + } + out += ' ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitLength') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be '; + if ($keyword == 'maxLength') { + out += 'longer'; + } else { + out += 'shorter'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' characters\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + +},{}],16:[function(require,module,exports){ +'use strict'; +module.exports = function generate__limitProperties(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!($isData || typeof $schema == 'number')) { + throw new Error($keyword + ' must be number'); + } + var $op = $keyword == 'maxProperties' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' Object.keys(' + ($data) + ').length ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have '; + if ($keyword == 'maxProperties') { + out += 'more'; + } else { + out += 'fewer'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' properties\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + +},{}],17:[function(require,module,exports){ +'use strict'; +module.exports = function generate_allOf(it, $keyword, $ruleType) { + var out = ' '; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $currentBaseId = $it.baseId, + $allSchemasEmpty = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + $allSchemasEmpty = false; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if ($breakOnError) { + if ($allSchemasEmpty) { + out += ' if (true) { '; + } else { + out += ' ' + ($closingBraces.slice(0, -1)) + ' '; + } + } + return out; +} + +},{}],18:[function(require,module,exports){ +'use strict'; +module.exports = function generate_anyOf(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $noEmptySchema = $schema.every(function($sch) { + return (it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all)); + }); + if ($noEmptySchema) { + var $currentBaseId = $it.baseId; + out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = false; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($valid) + ' || ' + ($nextValid) + '; if (!' + ($valid) + ') { '; + $closingBraces += '}'; + } + } + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' ' + ($closingBraces) + ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('anyOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should match some schema in anyOf\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; return false; '; + } + } + out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + if (it.opts.allErrors) { + out += ' } '; + } + } else { + if ($breakOnError) { + out += ' if (true) { '; + } + } + return out; +} + +},{}],19:[function(require,module,exports){ +'use strict'; +module.exports = function generate_comment(it, $keyword, $ruleType) { + var out = ' '; + var $schema = it.schema[$keyword]; + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $comment = it.util.toQuotedString($schema); + if (it.opts.$comment === true) { + out += ' console.log(' + ($comment) + ');'; + } else if (typeof it.opts.$comment == 'function') { + out += ' self._opts.$comment(' + ($comment) + ', ' + (it.util.toQuotedString($errSchemaPath)) + ', validate.root.schema);'; + } + return out; +} + +},{}],20:[function(require,module,exports){ +'use strict'; +module.exports = function generate_const(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!$isData) { + out += ' var schema' + ($lvl) + ' = validate.schema' + ($schemaPath) + ';'; + } + out += 'var ' + ($valid) + ' = equal(' + ($data) + ', schema' + ($lvl) + '); if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('const') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValue: schema' + ($lvl) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be equal to constant\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' }'; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + +},{}],21:[function(require,module,exports){ +'use strict'; +module.exports = function generate_contains(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $idx = 'i' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $currentBaseId = it.baseId, + $nonEmptySchema = (it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all)); + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if ($nonEmptySchema) { + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($nextValid) + ' = false; for (var ' + ($idx) + ' = 0; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' if (' + ($nextValid) + ') break; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' ' + ($closingBraces) + ' if (!' + ($nextValid) + ') {'; + } else { + out += ' if (' + ($data) + '.length == 0) {'; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('contains') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should contain a valid item\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + if ($nonEmptySchema) { + out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + } + if (it.opts.allErrors) { + out += ' } '; + } + return out; +} + +},{}],22:[function(require,module,exports){ +'use strict'; +module.exports = function generate_custom(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $rule = this, + $definition = 'definition' + $lvl, + $rDef = $rule.definition, + $closingBraces = ''; + var $compile, $inline, $macro, $ruleValidate, $validateCode; + if ($isData && $rDef.$data) { + $validateCode = 'keywordValidate' + $lvl; + var $validateSchema = $rDef.validateSchema; + out += ' var ' + ($definition) + ' = RULES.custom[\'' + ($keyword) + '\'].definition; var ' + ($validateCode) + ' = ' + ($definition) + '.validate;'; + } else { + $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it); + if (!$ruleValidate) return; + $schemaValue = 'validate.schema' + $schemaPath; + $validateCode = $ruleValidate.code; + $compile = $rDef.compile; + $inline = $rDef.inline; + $macro = $rDef.macro; + } + var $ruleErrs = $validateCode + '.errors', + $i = 'i' + $lvl, + $ruleErr = 'ruleErr' + $lvl, + $asyncKeyword = $rDef.async; + if ($asyncKeyword && !it.async) throw new Error('async keyword in sync schema'); + if (!($inline || $macro)) { + out += '' + ($ruleErrs) + ' = null;'; + } + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if ($isData && $rDef.$data) { + $closingBraces += '}'; + out += ' if (' + ($schemaValue) + ' === undefined) { ' + ($valid) + ' = true; } else { '; + if ($validateSchema) { + $closingBraces += '}'; + out += ' ' + ($valid) + ' = ' + ($definition) + '.validateSchema(' + ($schemaValue) + '); if (' + ($valid) + ') { '; + } + } + if ($inline) { + if ($rDef.statements) { + out += ' ' + ($ruleValidate.validate) + ' '; + } else { + out += ' ' + ($valid) + ' = ' + ($ruleValidate.validate) + '; '; + } + } else if ($macro) { + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + $it.schema = $ruleValidate.validate; + $it.schemaPath = ''; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var $code = it.validate($it).replace(/validate\.schema/g, $validateCode); + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' ' + ($code); + } else { + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; + out += ' ' + ($validateCode) + '.call( '; + if (it.opts.passContext) { + out += 'this'; + } else { + out += 'self'; + } + if ($compile || $rDef.schema === false) { + out += ' , ' + ($data) + ' '; + } else { + out += ' , ' + ($schemaValue) + ' , ' + ($data) + ' , validate.schema' + (it.schemaPath) + ' '; + } + out += ' , (dataPath || \'\')'; + if (it.errorPath != '""') { + out += ' + ' + (it.errorPath); + } + var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', + $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; + out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ' , rootData ) '; + var def_callRuleValidate = out; + out = $$outStack.pop(); + if ($rDef.errors === false) { + out += ' ' + ($valid) + ' = '; + if ($asyncKeyword) { + out += 'await '; + } + out += '' + (def_callRuleValidate) + '; '; + } else { + if ($asyncKeyword) { + $ruleErrs = 'customErrors' + $lvl; + out += ' var ' + ($ruleErrs) + ' = null; try { ' + ($valid) + ' = await ' + (def_callRuleValidate) + '; } catch (e) { ' + ($valid) + ' = false; if (e instanceof ValidationError) ' + ($ruleErrs) + ' = e.errors; else throw e; } '; + } else { + out += ' ' + ($ruleErrs) + ' = null; ' + ($valid) + ' = ' + (def_callRuleValidate) + '; '; + } + } + } + if ($rDef.modifying) { + out += ' if (' + ($parentData) + ') ' + ($data) + ' = ' + ($parentData) + '[' + ($parentDataProperty) + '];'; + } + out += '' + ($closingBraces); + if ($rDef.valid) { + if ($breakOnError) { + out += ' if (true) { '; + } + } else { + out += ' if ( '; + if ($rDef.valid === undefined) { + out += ' !'; + if ($macro) { + out += '' + ($nextValid); + } else { + out += '' + ($valid); + } + } else { + out += ' ' + (!$rDef.valid) + ' '; + } + out += ') { '; + $errorKeyword = $rule.keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'custom') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { keyword: \'' + ($rule.keyword) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should pass "' + ($rule.keyword) + '" keyword validation\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + var def_customError = out; + out = $$outStack.pop(); + if ($inline) { + if ($rDef.errors) { + if ($rDef.errors != 'full') { + out += ' for (var ' + ($i) + '=' + ($errs) + '; ' + ($i) + ' 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + out += ' ' + ($nextValid) + ' = true; if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; + } + out += ') { '; + $it.schema = $sch; + $it.schemaPath = $schemaPath + it.util.getProperty($property); + $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property); + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + } + return out; +} + +},{}],24:[function(require,module,exports){ +'use strict'; +module.exports = function generate_enum(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $i = 'i' + $lvl, + $vSchema = 'schema' + $lvl; + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + ';'; + } + out += 'var ' + ($valid) + ';'; + if ($isData) { + out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; + } + out += '' + ($valid) + ' = false;for (var ' + ($i) + '=0; ' + ($i) + '<' + ($vSchema) + '.length; ' + ($i) + '++) if (equal(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + '])) { ' + ($valid) + ' = true; break; }'; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('enum') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValues: schema' + ($lvl) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be equal to one of the allowed values\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' }'; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + +},{}],25:[function(require,module,exports){ +'use strict'; +module.exports = function generate_format(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + if (it.opts.format === false) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $unknownFormats = it.opts.unknownFormats, + $allowUnknown = Array.isArray($unknownFormats); + if ($isData) { + var $format = 'format' + $lvl, + $isObject = 'isObject' + $lvl, + $formatType = 'formatType' + $lvl; + out += ' var ' + ($format) + ' = formats[' + ($schemaValue) + ']; var ' + ($isObject) + ' = typeof ' + ($format) + ' == \'object\' && !(' + ($format) + ' instanceof RegExp) && ' + ($format) + '.validate; var ' + ($formatType) + ' = ' + ($isObject) + ' && ' + ($format) + '.type || \'string\'; if (' + ($isObject) + ') { '; + if (it.async) { + out += ' var async' + ($lvl) + ' = ' + ($format) + '.async; '; + } + out += ' ' + ($format) + ' = ' + ($format) + '.validate; } if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; + } + out += ' ('; + if ($unknownFormats != 'ignore') { + out += ' (' + ($schemaValue) + ' && !' + ($format) + ' '; + if ($allowUnknown) { + out += ' && self._opts.unknownFormats.indexOf(' + ($schemaValue) + ') == -1 '; + } + out += ') || '; + } + out += ' (' + ($format) + ' && ' + ($formatType) + ' == \'' + ($ruleType) + '\' && !(typeof ' + ($format) + ' == \'function\' ? '; + if (it.async) { + out += ' (async' + ($lvl) + ' ? await ' + ($format) + '(' + ($data) + ') : ' + ($format) + '(' + ($data) + ')) '; + } else { + out += ' ' + ($format) + '(' + ($data) + ') '; + } + out += ' : ' + ($format) + '.test(' + ($data) + '))))) {'; + } else { + var $format = it.formats[$schema]; + if (!$format) { + if ($unknownFormats == 'ignore') { + it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"'); + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } else if ($allowUnknown && $unknownFormats.indexOf($schema) >= 0) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } else { + throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"'); + } + } + var $isObject = typeof $format == 'object' && !($format instanceof RegExp) && $format.validate; + var $formatType = $isObject && $format.type || 'string'; + if ($isObject) { + var $async = $format.async === true; + $format = $format.validate; + } + if ($formatType != $ruleType) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } + if ($async) { + if (!it.async) throw new Error('async format in sync schema'); + var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate'; + out += ' if (!(await ' + ($formatRef) + '(' + ($data) + '))) { '; + } else { + out += ' if (! '; + var $formatRef = 'formats' + it.util.getProperty($schema); + if ($isObject) $formatRef += '.validate'; + if (typeof $format == 'function') { + out += ' ' + ($formatRef) + '(' + ($data) + ') '; + } else { + out += ' ' + ($formatRef) + '.test(' + ($data) + ') '; + } + out += ') { '; + } + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('format') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { format: '; + if ($isData) { + out += '' + ($schemaValue); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match format "'; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + (it.util.escapeQuotes($schema)); + } + out += '"\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + +},{}],26:[function(require,module,exports){ +'use strict'; +module.exports = function generate_if(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + $it.level++; + var $nextValid = 'valid' + $it.level; + var $thenSch = it.schema['then'], + $elseSch = it.schema['else'], + $thenPresent = $thenSch !== undefined && (it.opts.strictKeywords ? (typeof $thenSch == 'object' && Object.keys($thenSch).length > 0) || $thenSch === false : it.util.schemaHasRules($thenSch, it.RULES.all)), + $elsePresent = $elseSch !== undefined && (it.opts.strictKeywords ? (typeof $elseSch == 'object' && Object.keys($elseSch).length > 0) || $elseSch === false : it.util.schemaHasRules($elseSch, it.RULES.all)), + $currentBaseId = $it.baseId; + if ($thenPresent || $elsePresent) { + var $ifClause; + $it.createErrors = false; + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = true; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + $it.createErrors = true; + out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + if ($thenPresent) { + out += ' if (' + ($nextValid) + ') { '; + $it.schema = it.schema['then']; + $it.schemaPath = it.schemaPath + '.then'; + $it.errSchemaPath = it.errSchemaPath + '/then'; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; + if ($thenPresent && $elsePresent) { + $ifClause = 'ifClause' + $lvl; + out += ' var ' + ($ifClause) + ' = \'then\'; '; + } else { + $ifClause = '\'then\''; + } + out += ' } '; + if ($elsePresent) { + out += ' else { '; + } + } else { + out += ' if (!' + ($nextValid) + ') { '; + } + if ($elsePresent) { + $it.schema = it.schema['else']; + $it.schemaPath = it.schemaPath + '.else'; + $it.errSchemaPath = it.errSchemaPath + '/else'; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; + if ($thenPresent && $elsePresent) { + $ifClause = 'ifClause' + $lvl; + out += ' var ' + ($ifClause) + ' = \'else\'; '; + } else { + $ifClause = '\'else\''; + } + out += ' } '; + } + out += ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('if') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { failingKeyword: ' + ($ifClause) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match "\' + ' + ($ifClause) + ' + \'" schema\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; return false; '; + } + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + } else { + if ($breakOnError) { + out += ' if (true) { '; + } + } + return out; +} + +},{}],27:[function(require,module,exports){ +'use strict'; + +//all requires must be explicit because browserify won't work with dynamic requires +module.exports = { + '$ref': require('./ref'), + allOf: require('./allOf'), + anyOf: require('./anyOf'), + '$comment': require('./comment'), + const: require('./const'), + contains: require('./contains'), + dependencies: require('./dependencies'), + 'enum': require('./enum'), + format: require('./format'), + 'if': require('./if'), + items: require('./items'), + maximum: require('./_limit'), + minimum: require('./_limit'), + maxItems: require('./_limitItems'), + minItems: require('./_limitItems'), + maxLength: require('./_limitLength'), + minLength: require('./_limitLength'), + maxProperties: require('./_limitProperties'), + minProperties: require('./_limitProperties'), + multipleOf: require('./multipleOf'), + not: require('./not'), + oneOf: require('./oneOf'), + pattern: require('./pattern'), + properties: require('./properties'), + propertyNames: require('./propertyNames'), + required: require('./required'), + uniqueItems: require('./uniqueItems'), + validate: require('./validate') +}; + +},{"./_limit":13,"./_limitItems":14,"./_limitLength":15,"./_limitProperties":16,"./allOf":17,"./anyOf":18,"./comment":19,"./const":20,"./contains":21,"./dependencies":23,"./enum":24,"./format":25,"./if":26,"./items":28,"./multipleOf":29,"./not":30,"./oneOf":31,"./pattern":32,"./properties":33,"./propertyNames":34,"./ref":35,"./required":36,"./uniqueItems":37,"./validate":38}],28:[function(require,module,exports){ +'use strict'; +module.exports = function generate_items(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $idx = 'i' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $currentBaseId = it.baseId; + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if (Array.isArray($schema)) { + var $additionalItems = it.schema.additionalItems; + if ($additionalItems === false) { + out += ' ' + ($valid) + ' = ' + ($data) + '.length <= ' + ($schema.length) + '; '; + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalItems'; + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('additionalItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schema.length) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have more than ' + ($schema.length) + ' items\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + $errSchemaPath = $currErrSchemaPath; + if ($breakOnError) { + $closingBraces += '}'; + out += ' else { '; + } + } + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($i) + ') { '; + var $passData = $data + '[' + $i + ']'; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true); + $it.dataPathArr[$dataNxt] = $i; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if (typeof $additionalItems == 'object' && (it.opts.strictKeywords ? (typeof $additionalItems == 'object' && Object.keys($additionalItems).length > 0) || $additionalItems === false : it.util.schemaHasRules($additionalItems, it.RULES.all))) { + $it.schema = $additionalItems; + $it.schemaPath = it.schemaPath + '.additionalItems'; + $it.errSchemaPath = it.errSchemaPath + '/additionalItems'; + out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($schema.length) + ') { for (var ' + ($idx) + ' = ' + ($schema.length) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' } } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } else if ((it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' for (var ' + ($idx) + ' = ' + (0) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' }'; + } + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + } + return out; +} + +},{}],29:[function(require,module,exports){ +'use strict'; +module.exports = function generate_multipleOf(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!($isData || typeof $schema == 'number')) { + throw new Error($keyword + ' must be number'); + } + out += 'var division' + ($lvl) + ';if ('; + if ($isData) { + out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || '; + } + out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', '; + if (it.opts.multipleOfPrecision) { + out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' '; + } else { + out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') '; + } + out += ' ) '; + if ($isData) { + out += ' ) '; + } + out += ' ) { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be multiple of '; + if ($isData) { + out += '\' + ' + ($schemaValue); + } else { + out += '' + ($schemaValue) + '\''; + } + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + +},{}],30:[function(require,module,exports){ +'use strict'; +module.exports = function generate_not(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + $it.level++; + var $nextValid = 'valid' + $it.level; + if ((it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($errs) + ' = errors; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.createErrors = false; + var $allErrorsOption; + if ($it.opts.allErrors) { + $allErrorsOption = $it.opts.allErrors; + $it.opts.allErrors = false; + } + out += ' ' + (it.validate($it)) + ' '; + $it.createErrors = true; + if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption; + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' if (' + ($nextValid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be valid\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + if (it.opts.allErrors) { + out += ' } '; + } + } else { + out += ' var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be valid\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if ($breakOnError) { + out += ' if (false) { '; + } + } + return out; +} + +},{}],31:[function(require,module,exports){ +'use strict'; +module.exports = function generate_oneOf(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $currentBaseId = $it.baseId, + $prevValid = 'prevValid' + $lvl, + $passingSchemas = 'passingSchemas' + $lvl; + out += 'var ' + ($errs) + ' = errors , ' + ($prevValid) + ' = false , ' + ($valid) + ' = false , ' + ($passingSchemas) + ' = null; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + } else { + out += ' var ' + ($nextValid) + ' = true; '; + } + if ($i) { + out += ' if (' + ($nextValid) + ' && ' + ($prevValid) + ') { ' + ($valid) + ' = false; ' + ($passingSchemas) + ' = [' + ($passingSchemas) + ', ' + ($i) + ']; } else { '; + $closingBraces += '}'; + } + out += ' if (' + ($nextValid) + ') { ' + ($valid) + ' = ' + ($prevValid) + ' = true; ' + ($passingSchemas) + ' = ' + ($i) + '; }'; + } + } + it.compositeRule = $it.compositeRule = $wasComposite; + out += '' + ($closingBraces) + 'if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('oneOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { passingSchemas: ' + ($passingSchemas) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match exactly one schema in oneOf\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; return false; '; + } + } + out += '} else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; }'; + if (it.opts.allErrors) { + out += ' } '; + } + return out; +} + +},{}],32:[function(require,module,exports){ +'use strict'; +module.exports = function generate_pattern(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $regexp = $isData ? '(new RegExp(' + $schemaValue + '))' : it.usePattern($schema); + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; + } + out += ' !' + ($regexp) + '.test(' + ($data) + ') ) { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('pattern') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { pattern: '; + if ($isData) { + out += '' + ($schemaValue); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match pattern "'; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + (it.util.escapeQuotes($schema)); + } + out += '"\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + +},{}],33:[function(require,module,exports){ +'use strict'; +module.exports = function generate_properties(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $key = 'key' + $lvl, + $idx = 'idx' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $dataProperties = 'dataProperties' + $lvl; + var $schemaKeys = Object.keys($schema || {}).filter(notProto), + $pProperties = it.schema.patternProperties || {}, + $pPropertyKeys = Object.keys($pProperties).filter(notProto), + $aProperties = it.schema.additionalProperties, + $someProperties = $schemaKeys.length || $pPropertyKeys.length, + $noAdditional = $aProperties === false, + $additionalIsSchema = typeof $aProperties == 'object' && Object.keys($aProperties).length, + $removeAdditional = it.opts.removeAdditional, + $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional, + $ownProperties = it.opts.ownProperties, + $currentBaseId = it.baseId; + var $required = it.schema.required; + if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) { + var $requiredHash = it.util.toHash($required); + } + + function notProto(p) { + return p !== '__proto__'; + } + out += 'var ' + ($errs) + ' = errors;var ' + ($nextValid) + ' = true;'; + if ($ownProperties) { + out += ' var ' + ($dataProperties) + ' = undefined;'; + } + if ($checkAdditional) { + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + if ($someProperties) { + out += ' var isAdditional' + ($lvl) + ' = !(false '; + if ($schemaKeys.length) { + if ($schemaKeys.length > 8) { + out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') '; + } else { + var arr1 = $schemaKeys; + if (arr1) { + var $propertyKey, i1 = -1, + l1 = arr1.length - 1; + while (i1 < l1) { + $propertyKey = arr1[i1 += 1]; + out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' '; + } + } + } + } + if ($pPropertyKeys.length) { + var arr2 = $pPropertyKeys; + if (arr2) { + var $pProperty, $i = -1, + l2 = arr2.length - 1; + while ($i < l2) { + $pProperty = arr2[$i += 1]; + out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') '; + } + } + } + out += ' ); if (isAdditional' + ($lvl) + ') { '; + } + if ($removeAdditional == 'all') { + out += ' delete ' + ($data) + '[' + ($key) + ']; '; + } else { + var $currentErrorPath = it.errorPath; + var $additionalProperty = '\' + ' + $key + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + } + if ($noAdditional) { + if ($removeAdditional) { + out += ' delete ' + ($data) + '[' + ($key) + ']; '; + } else { + out += ' ' + ($nextValid) + ' = false; '; + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalProperties'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is an invalid additional property'; + } else { + out += 'should NOT have additional properties'; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + $errSchemaPath = $currErrSchemaPath; + if ($breakOnError) { + out += ' break; '; + } + } + } else if ($additionalIsSchema) { + if ($removeAdditional == 'failing') { + out += ' var ' + ($errs) + ' = errors; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.schema = $aProperties; + $it.schemaPath = it.schemaPath + '.additionalProperties'; + $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; + $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + } else { + $it.schema = $aProperties; + $it.schemaPath = it.schemaPath + '.additionalProperties'; + $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; + $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + } + } + it.errorPath = $currentErrorPath; + } + if ($someProperties) { + out += ' } '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + var $useDefaults = it.opts.useDefaults && !it.compositeRule; + if ($schemaKeys.length) { + var arr3 = $schemaKeys; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $sch = $schema[$propertyKey]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + var $prop = it.util.getProperty($propertyKey), + $passData = $data + $prop, + $hasDefault = $useDefaults && $sch.default !== undefined; + $it.schema = $sch; + $it.schemaPath = $schemaPath + $prop; + $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); + $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); + $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + $code = it.util.varReplace($code, $nextData, $passData); + var $useData = $passData; + } else { + var $useData = $nextData; + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; '; + } + if ($hasDefault) { + out += ' ' + ($code) + ' '; + } else { + if ($requiredHash && $requiredHash[$propertyKey]) { + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { ' + ($nextValid) + ' = false; '; + var $currentErrorPath = it.errorPath, + $currErrSchemaPath = $errSchemaPath, + $missingProperty = it.util.escapeQuotes($propertyKey); + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + $errSchemaPath = it.errSchemaPath + '/required'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + $errSchemaPath = $currErrSchemaPath; + it.errorPath = $currentErrorPath; + out += ' } else { '; + } else { + if ($breakOnError) { + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { ' + ($nextValid) + ' = true; } else { '; + } else { + out += ' if (' + ($useData) + ' !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ' ) { '; + } + } + out += ' ' + ($code) + ' } '; + } + } + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if ($pPropertyKeys.length) { + var arr4 = $pPropertyKeys; + if (arr4) { + var $pProperty, i4 = -1, + l4 = arr4.length - 1; + while (i4 < l4) { + $pProperty = arr4[i4 += 1]; + var $sch = $pProperties[$pProperty]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + $it.schema = $sch; + $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); + $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty); + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else ' + ($nextValid) + ' = true; '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + } + return out; +} + +},{}],34:[function(require,module,exports){ +'use strict'; +module.exports = function generate_propertyNames(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + out += 'var ' + ($errs) + ' = errors;'; + if ((it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + var $key = 'key' + $lvl, + $idx = 'idx' + $lvl, + $i = 'i' + $lvl, + $invalidName = '\' + ' + $key + ' + \'', + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $dataProperties = 'dataProperties' + $lvl, + $ownProperties = it.opts.ownProperties, + $currentBaseId = it.baseId; + if ($ownProperties) { + out += ' var ' + ($dataProperties) + ' = undefined; '; + } + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + out += ' var startErrs' + ($lvl) + ' = errors; '; + var $passData = $key; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' 0) || $propertySch === false : it.util.schemaHasRules($propertySch, it.RULES.all)))) { + $required[$required.length] = $property; + } + } + } + } else { + var $required = $schema; + } + } + if ($isData || $required.length) { + var $currentErrorPath = it.errorPath, + $loopRequired = $isData || $required.length >= it.opts.loopRequired, + $ownProperties = it.opts.ownProperties; + if ($breakOnError) { + out += ' var missing' + ($lvl) + '; '; + if ($loopRequired) { + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; + } + var $i = 'i' + $lvl, + $propertyPath = 'schema' + $lvl + '[' + $i + ']', + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); + } + out += ' var ' + ($valid) + ' = true; '; + if ($isData) { + out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; + } + out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { ' + ($valid) + ' = ' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; + } + out += '; if (!' + ($valid) + ') break; } '; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + } else { + out += ' if ( '; + var arr2 = $required; + if (arr2) { + var $propertyKey, $i = -1, + l2 = arr2.length - 1; + while ($i < l2) { + $propertyKey = arr2[$i += 1]; + if ($i) { + out += ' || '; + } + var $prop = it.util.getProperty($propertyKey), + $useData = $data + $prop; + out += ' ( ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; + } + } + out += ') { '; + var $propertyPath = 'missing' + $lvl, + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + } + } else { + if ($loopRequired) { + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; + } + var $i = 'i' + $lvl, + $propertyPath = 'schema' + $lvl + '[' + $i + ']', + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); + } + if ($isData) { + out += ' if (' + ($vSchema) + ' && !Array.isArray(' + ($vSchema) + ')) { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } else if (' + ($vSchema) + ' !== undefined) { '; + } + out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { if (' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; + } + out += ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } } '; + if ($isData) { + out += ' } '; + } + } else { + var arr3 = $required; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $prop = it.util.getProperty($propertyKey), + $missingProperty = it.util.escapeQuotes($propertyKey), + $useData = $data + $prop; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; + } + } + } + } + it.errorPath = $currentErrorPath; + } else if ($breakOnError) { + out += ' if (true) {'; + } + return out; +} + +},{}],37:[function(require,module,exports){ +'use strict'; +module.exports = function generate_uniqueItems(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (($schema || $isData) && it.opts.uniqueItems !== false) { + if ($isData) { + out += ' var ' + ($valid) + '; if (' + ($schemaValue) + ' === false || ' + ($schemaValue) + ' === undefined) ' + ($valid) + ' = true; else if (typeof ' + ($schemaValue) + ' != \'boolean\') ' + ($valid) + ' = false; else { '; + } + out += ' var i = ' + ($data) + '.length , ' + ($valid) + ' = true , j; if (i > 1) { '; + var $itemType = it.schema.items && it.schema.items.type, + $typeIsArray = Array.isArray($itemType); + if (!$itemType || $itemType == 'object' || $itemType == 'array' || ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0))) { + out += ' outer: for (;i--;) { for (j = i; j--;) { if (equal(' + ($data) + '[i], ' + ($data) + '[j])) { ' + ($valid) + ' = false; break outer; } } } '; + } else { + out += ' var itemIndices = {}, item; for (;i--;) { var item = ' + ($data) + '[i]; '; + var $method = 'checkDataType' + ($typeIsArray ? 's' : ''); + out += ' if (' + (it.util[$method]($itemType, 'item', it.opts.strictNumbers, true)) + ') continue; '; + if ($typeIsArray) { + out += ' if (typeof item == \'string\') item = \'"\' + item; '; + } + out += ' if (typeof itemIndices[item] == \'number\') { ' + ($valid) + ' = false; j = itemIndices[item]; break; } itemIndices[item] = i; } '; + } + out += ' } '; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('uniqueItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { i: i, j: j } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have duplicate items (items ## \' + j + \' and \' + i + \' are identical)\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + } else { + if ($breakOnError) { + out += ' if (true) { '; + } + } + return out; +} + +},{}],38:[function(require,module,exports){ +'use strict'; +module.exports = function generate_validate(it, $keyword, $ruleType) { + var out = ''; + var $async = it.schema.$async === true, + $refKeywords = it.util.schemaHasRulesExcept(it.schema, it.RULES.all, '$ref'), + $id = it.self._getId(it.schema); + if (it.opts.strictKeywords) { + var $unknownKwd = it.util.schemaUnknownRules(it.schema, it.RULES.keywords); + if ($unknownKwd) { + var $keywordsMsg = 'unknown keyword: ' + $unknownKwd; + if (it.opts.strictKeywords === 'log') it.logger.warn($keywordsMsg); + else throw new Error($keywordsMsg); + } + } + if (it.isTop) { + out += ' var validate = '; + if ($async) { + it.async = true; + out += 'async '; + } + out += 'function(data, dataPath, parentData, parentDataProperty, rootData) { \'use strict\'; '; + if ($id && (it.opts.sourceCode || it.opts.processCode)) { + out += ' ' + ('/\*# sourceURL=' + $id + ' */') + ' '; + } + } + if (typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref)) { + var $keyword = 'false schema'; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + if (it.schema === false) { + if (it.isTop) { + $breakOnError = true; + } else { + out += ' var ' + ($valid) + ' = false; '; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'false schema') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'boolean schema is false\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + } else { + if (it.isTop) { + if ($async) { + out += ' return data; '; + } else { + out += ' validate.errors = null; return true; '; + } + } else { + out += ' var ' + ($valid) + ' = true; '; + } + } + if (it.isTop) { + out += ' }; return validate; '; + } + return out; + } + if (it.isTop) { + var $top = it.isTop, + $lvl = it.level = 0, + $dataLvl = it.dataLevel = 0, + $data = 'data'; + it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema)); + it.baseId = it.baseId || it.rootId; + delete it.isTop; + it.dataPathArr = [""]; + if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored in the schema root'; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + out += ' var vErrors = null; '; + out += ' var errors = 0; '; + out += ' if (rootData === undefined) rootData = data; '; + } else { + var $lvl = it.level, + $dataLvl = it.dataLevel, + $data = 'data' + ($dataLvl || ''); + if ($id) it.baseId = it.resolve.url(it.baseId, $id); + if ($async && !it.async) throw new Error('async schema in sync schema'); + out += ' var errs_' + ($lvl) + ' = errors;'; + } + var $valid = 'valid' + $lvl, + $breakOnError = !it.opts.allErrors, + $closingBraces1 = '', + $closingBraces2 = ''; + var $errorKeyword; + var $typeSchema = it.schema.type, + $typeIsArray = Array.isArray($typeSchema); + if ($typeSchema && it.opts.nullable && it.schema.nullable === true) { + if ($typeIsArray) { + if ($typeSchema.indexOf('null') == -1) $typeSchema = $typeSchema.concat('null'); + } else if ($typeSchema != 'null') { + $typeSchema = [$typeSchema, 'null']; + $typeIsArray = true; + } + } + if ($typeIsArray && $typeSchema.length == 1) { + $typeSchema = $typeSchema[0]; + $typeIsArray = false; + } + if (it.schema.$ref && $refKeywords) { + if (it.opts.extendRefs == 'fail') { + throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)'); + } else if (it.opts.extendRefs !== true) { + $refKeywords = false; + it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"'); + } + } + if (it.schema.$comment && it.opts.$comment) { + out += ' ' + (it.RULES.all.$comment.code(it, '$comment')); + } + if ($typeSchema) { + if (it.opts.coerceTypes) { + var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema); + } + var $rulesGroup = it.RULES.types[$typeSchema]; + if ($coerceToTypes || $typeIsArray || $rulesGroup === true || ($rulesGroup && !$shouldUseGroup($rulesGroup))) { + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type'; + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type', + $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType'; + out += ' if (' + (it.util[$method]($typeSchema, $data, it.opts.strictNumbers, true)) + ') { '; + if ($coerceToTypes) { + var $dataType = 'dataType' + $lvl, + $coerced = 'coerced' + $lvl; + out += ' var ' + ($dataType) + ' = typeof ' + ($data) + '; var ' + ($coerced) + ' = undefined; '; + if (it.opts.coerceTypes == 'array') { + out += ' if (' + ($dataType) + ' == \'object\' && Array.isArray(' + ($data) + ') && ' + ($data) + '.length == 1) { ' + ($data) + ' = ' + ($data) + '[0]; ' + ($dataType) + ' = typeof ' + ($data) + '; if (' + (it.util.checkDataType(it.schema.type, $data, it.opts.strictNumbers)) + ') ' + ($coerced) + ' = ' + ($data) + '; } '; + } + out += ' if (' + ($coerced) + ' !== undefined) ; '; + var arr1 = $coerceToTypes; + if (arr1) { + var $type, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $type = arr1[$i += 1]; + if ($type == 'string') { + out += ' else if (' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\') ' + ($coerced) + ' = \'\' + ' + ($data) + '; else if (' + ($data) + ' === null) ' + ($coerced) + ' = \'\'; '; + } else if ($type == 'number' || $type == 'integer') { + out += ' else if (' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' === null || (' + ($dataType) + ' == \'string\' && ' + ($data) + ' && ' + ($data) + ' == +' + ($data) + ' '; + if ($type == 'integer') { + out += ' && !(' + ($data) + ' % 1)'; + } + out += ')) ' + ($coerced) + ' = +' + ($data) + '; '; + } else if ($type == 'boolean') { + out += ' else if (' + ($data) + ' === \'false\' || ' + ($data) + ' === 0 || ' + ($data) + ' === null) ' + ($coerced) + ' = false; else if (' + ($data) + ' === \'true\' || ' + ($data) + ' === 1) ' + ($coerced) + ' = true; '; + } else if ($type == 'null') { + out += ' else if (' + ($data) + ' === \'\' || ' + ($data) + ' === 0 || ' + ($data) + ' === false) ' + ($coerced) + ' = null; '; + } else if (it.opts.coerceTypes == 'array' && $type == 'array') { + out += ' else if (' + ($dataType) + ' == \'string\' || ' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' == null) ' + ($coerced) + ' = [' + ($data) + ']; '; + } + } + } + out += ' else { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } if (' + ($coerced) + ' !== undefined) { '; + var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', + $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; + out += ' ' + ($data) + ' = ' + ($coerced) + '; '; + if (!$dataLvl) { + out += 'if (' + ($parentData) + ' !== undefined)'; + } + out += ' ' + ($parentData) + '[' + ($parentDataProperty) + '] = ' + ($coerced) + '; } '; + } else { + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + } + out += ' } '; + } + } + if (it.schema.$ref && !$refKeywords) { + out += ' ' + (it.RULES.all.$ref.code(it, '$ref')) + ' '; + if ($breakOnError) { + out += ' } if (errors === '; + if ($top) { + out += '0'; + } else { + out += 'errs_' + ($lvl); + } + out += ') { '; + $closingBraces2 += '}'; + } + } else { + var arr2 = it.RULES; + if (arr2) { + var $rulesGroup, i2 = -1, + l2 = arr2.length - 1; + while (i2 < l2) { + $rulesGroup = arr2[i2 += 1]; + if ($shouldUseGroup($rulesGroup)) { + if ($rulesGroup.type) { + out += ' if (' + (it.util.checkDataType($rulesGroup.type, $data, it.opts.strictNumbers)) + ') { '; + } + if (it.opts.useDefaults) { + if ($rulesGroup.type == 'object' && it.schema.properties) { + var $schema = it.schema.properties, + $schemaKeys = Object.keys($schema); + var arr3 = $schemaKeys; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $sch = $schema[$propertyKey]; + if ($sch.default !== undefined) { + var $passData = $data + it.util.getProperty($propertyKey); + if (it.compositeRule) { + if (it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored for: ' + $passData; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + } else { + out += ' if (' + ($passData) + ' === undefined '; + if (it.opts.useDefaults == 'empty') { + out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; + } + out += ' ) ' + ($passData) + ' = '; + if (it.opts.useDefaults == 'shared') { + out += ' ' + (it.useDefault($sch.default)) + ' '; + } else { + out += ' ' + (JSON.stringify($sch.default)) + ' '; + } + out += '; '; + } + } + } + } + } else if ($rulesGroup.type == 'array' && Array.isArray(it.schema.items)) { + var arr4 = it.schema.items; + if (arr4) { + var $sch, $i = -1, + l4 = arr4.length - 1; + while ($i < l4) { + $sch = arr4[$i += 1]; + if ($sch.default !== undefined) { + var $passData = $data + '[' + $i + ']'; + if (it.compositeRule) { + if (it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored for: ' + $passData; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + } else { + out += ' if (' + ($passData) + ' === undefined '; + if (it.opts.useDefaults == 'empty') { + out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; + } + out += ' ) ' + ($passData) + ' = '; + if (it.opts.useDefaults == 'shared') { + out += ' ' + (it.useDefault($sch.default)) + ' '; + } else { + out += ' ' + (JSON.stringify($sch.default)) + ' '; + } + out += '; '; + } + } + } + } + } + } + var arr5 = $rulesGroup.rules; + if (arr5) { + var $rule, i5 = -1, + l5 = arr5.length - 1; + while (i5 < l5) { + $rule = arr5[i5 += 1]; + if ($shouldUseRule($rule)) { + var $code = $rule.code(it, $rule.keyword, $rulesGroup.type); + if ($code) { + out += ' ' + ($code) + ' '; + if ($breakOnError) { + $closingBraces1 += '}'; + } + } + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces1) + ' '; + $closingBraces1 = ''; + } + if ($rulesGroup.type) { + out += ' } '; + if ($typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes) { + out += ' else { '; + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + } + } + if ($breakOnError) { + out += ' if (errors === '; + if ($top) { + out += '0'; + } else { + out += 'errs_' + ($lvl); + } + out += ') { '; + $closingBraces2 += '}'; + } + } + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces2) + ' '; + } + if ($top) { + if ($async) { + out += ' if (errors === 0) return data; '; + out += ' else throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; '; + out += ' return errors === 0; '; + } + out += ' }; return validate;'; + } else { + out += ' var ' + ($valid) + ' = errors === errs_' + ($lvl) + ';'; + } + + function $shouldUseGroup($rulesGroup) { + var rules = $rulesGroup.rules; + for (var i = 0; i < rules.length; i++) + if ($shouldUseRule(rules[i])) return true; + } + + function $shouldUseRule($rule) { + return it.schema[$rule.keyword] !== undefined || ($rule.implements && $ruleImplementsSomeKeyword($rule)); + } + + function $ruleImplementsSomeKeyword($rule) { + var impl = $rule.implements; + for (var i = 0; i < impl.length; i++) + if (it.schema[impl[i]] !== undefined) return true; + } + return out; +} + +},{}],39:[function(require,module,exports){ +'use strict'; + +var IDENTIFIER = /^[a-z_$][a-z0-9_$-]*$/i; +var customRuleCode = require('./dotjs/custom'); +var definitionSchema = require('./definition_schema'); + +module.exports = { + add: addKeyword, + get: getKeyword, + remove: removeKeyword, + validate: validateKeyword +}; + + +/** + * Define custom keyword + * @this Ajv + * @param {String} keyword custom keyword, should be unique (including different from all standard, custom and macro keywords). + * @param {Object} definition keyword definition object with properties `type` (type(s) which the keyword applies to), `validate` or `compile`. + * @return {Ajv} this for method chaining + */ +function addKeyword(keyword, definition) { + /* jshint validthis: true */ + /* eslint no-shadow: 0 */ + var RULES = this.RULES; + if (RULES.keywords[keyword]) + throw new Error('Keyword ' + keyword + ' is already defined'); + + if (!IDENTIFIER.test(keyword)) + throw new Error('Keyword ' + keyword + ' is not a valid identifier'); + + if (definition) { + this.validateKeyword(definition, true); + + var dataType = definition.type; + if (Array.isArray(dataType)) { + for (var i=0; i 1) { + sets[0] = sets[0].slice(0, -1); + var xl = sets.length - 1; + for (var x = 1; x < xl; ++x) { + sets[x] = sets[x].slice(1, -1); + } + sets[xl] = sets[xl].slice(1); + return sets.join(''); + } else { + return sets[0]; + } +} +function subexp(str) { + return "(?:" + str + ")"; +} +function typeOf(o) { + return o === undefined ? "undefined" : o === null ? "null" : Object.prototype.toString.call(o).split(" ").pop().split("]").shift().toLowerCase(); +} +function toUpperCase(str) { + return str.toUpperCase(); +} +function toArray(obj) { + return obj !== undefined && obj !== null ? obj instanceof Array ? obj : typeof obj.length !== "number" || obj.split || obj.setInterval || obj.call ? [obj] : Array.prototype.slice.call(obj) : []; +} +function assign(target, source) { + var obj = target; + if (source) { + for (var key in source) { + obj[key] = source[key]; + } + } + return obj; +} + +function buildExps(isIRI) { + var ALPHA$$ = "[A-Za-z]", + CR$ = "[\\x0D]", + DIGIT$$ = "[0-9]", + DQUOTE$$ = "[\\x22]", + HEXDIG$$ = merge(DIGIT$$, "[A-Fa-f]"), + //case-insensitive + LF$$ = "[\\x0A]", + SP$$ = "[\\x20]", + PCT_ENCODED$ = subexp(subexp("%[EFef]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%[89A-Fa-f]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%" + HEXDIG$$ + HEXDIG$$)), + //expanded + GEN_DELIMS$$ = "[\\:\\/\\?\\#\\[\\]\\@]", + SUB_DELIMS$$ = "[\\!\\$\\&\\'\\(\\)\\*\\+\\,\\;\\=]", + RESERVED$$ = merge(GEN_DELIMS$$, SUB_DELIMS$$), + UCSCHAR$$ = isIRI ? "[\\xA0-\\u200D\\u2010-\\u2029\\u202F-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFEF]" : "[]", + //subset, excludes bidi control characters + IPRIVATE$$ = isIRI ? "[\\uE000-\\uF8FF]" : "[]", + //subset + UNRESERVED$$ = merge(ALPHA$$, DIGIT$$, "[\\-\\.\\_\\~]", UCSCHAR$$), + SCHEME$ = subexp(ALPHA$$ + merge(ALPHA$$, DIGIT$$, "[\\+\\-\\.]") + "*"), + USERINFO$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:]")) + "*"), + DEC_OCTET$ = subexp(subexp("25[0-5]") + "|" + subexp("2[0-4]" + DIGIT$$) + "|" + subexp("1" + DIGIT$$ + DIGIT$$) + "|" + subexp("[1-9]" + DIGIT$$) + "|" + DIGIT$$), + DEC_OCTET_RELAXED$ = subexp(subexp("25[0-5]") + "|" + subexp("2[0-4]" + DIGIT$$) + "|" + subexp("1" + DIGIT$$ + DIGIT$$) + "|" + subexp("0?[1-9]" + DIGIT$$) + "|0?0?" + DIGIT$$), + //relaxed parsing rules + IPV4ADDRESS$ = subexp(DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$), + H16$ = subexp(HEXDIG$$ + "{1,4}"), + LS32$ = subexp(subexp(H16$ + "\\:" + H16$) + "|" + IPV4ADDRESS$), + IPV6ADDRESS1$ = subexp(subexp(H16$ + "\\:") + "{6}" + LS32$), + // 6( h16 ":" ) ls32 + IPV6ADDRESS2$ = subexp("\\:\\:" + subexp(H16$ + "\\:") + "{5}" + LS32$), + // "::" 5( h16 ":" ) ls32 + IPV6ADDRESS3$ = subexp(subexp(H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{4}" + LS32$), + //[ h16 ] "::" 4( h16 ":" ) ls32 + IPV6ADDRESS4$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,1}" + H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{3}" + LS32$), + //[ *1( h16 ":" ) h16 ] "::" 3( h16 ":" ) ls32 + IPV6ADDRESS5$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,2}" + H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{2}" + LS32$), + //[ *2( h16 ":" ) h16 ] "::" 2( h16 ":" ) ls32 + IPV6ADDRESS6$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,3}" + H16$) + "?\\:\\:" + H16$ + "\\:" + LS32$), + //[ *3( h16 ":" ) h16 ] "::" h16 ":" ls32 + IPV6ADDRESS7$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,4}" + H16$) + "?\\:\\:" + LS32$), + //[ *4( h16 ":" ) h16 ] "::" ls32 + IPV6ADDRESS8$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,5}" + H16$) + "?\\:\\:" + H16$), + //[ *5( h16 ":" ) h16 ] "::" h16 + IPV6ADDRESS9$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,6}" + H16$) + "?\\:\\:"), + //[ *6( h16 ":" ) h16 ] "::" + IPV6ADDRESS$ = subexp([IPV6ADDRESS1$, IPV6ADDRESS2$, IPV6ADDRESS3$, IPV6ADDRESS4$, IPV6ADDRESS5$, IPV6ADDRESS6$, IPV6ADDRESS7$, IPV6ADDRESS8$, IPV6ADDRESS9$].join("|")), + ZONEID$ = subexp(subexp(UNRESERVED$$ + "|" + PCT_ENCODED$) + "+"), + //RFC 6874 + IPV6ADDRZ$ = subexp(IPV6ADDRESS$ + "\\%25" + ZONEID$), + //RFC 6874 + IPV6ADDRZ_RELAXED$ = subexp(IPV6ADDRESS$ + subexp("\\%25|\\%(?!" + HEXDIG$$ + "{2})") + ZONEID$), + //RFC 6874, with relaxed parsing rules + IPVFUTURE$ = subexp("[vV]" + HEXDIG$$ + "+\\." + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:]") + "+"), + IP_LITERAL$ = subexp("\\[" + subexp(IPV6ADDRZ_RELAXED$ + "|" + IPV6ADDRESS$ + "|" + IPVFUTURE$) + "\\]"), + //RFC 6874 + REG_NAME$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$)) + "*"), + HOST$ = subexp(IP_LITERAL$ + "|" + IPV4ADDRESS$ + "(?!" + REG_NAME$ + ")" + "|" + REG_NAME$), + PORT$ = subexp(DIGIT$$ + "*"), + AUTHORITY$ = subexp(subexp(USERINFO$ + "@") + "?" + HOST$ + subexp("\\:" + PORT$) + "?"), + PCHAR$ = subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@]")), + SEGMENT$ = subexp(PCHAR$ + "*"), + SEGMENT_NZ$ = subexp(PCHAR$ + "+"), + SEGMENT_NZ_NC$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\@]")) + "+"), + PATH_ABEMPTY$ = subexp(subexp("\\/" + SEGMENT$) + "*"), + PATH_ABSOLUTE$ = subexp("\\/" + subexp(SEGMENT_NZ$ + PATH_ABEMPTY$) + "?"), + //simplified + PATH_NOSCHEME$ = subexp(SEGMENT_NZ_NC$ + PATH_ABEMPTY$), + //simplified + PATH_ROOTLESS$ = subexp(SEGMENT_NZ$ + PATH_ABEMPTY$), + //simplified + PATH_EMPTY$ = "(?!" + PCHAR$ + ")", + PATH$ = subexp(PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$), + QUERY$ = subexp(subexp(PCHAR$ + "|" + merge("[\\/\\?]", IPRIVATE$$)) + "*"), + FRAGMENT$ = subexp(subexp(PCHAR$ + "|[\\/\\?]") + "*"), + HIER_PART$ = subexp(subexp("\\/\\/" + AUTHORITY$ + PATH_ABEMPTY$) + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$), + URI$ = subexp(SCHEME$ + "\\:" + HIER_PART$ + subexp("\\?" + QUERY$) + "?" + subexp("\\#" + FRAGMENT$) + "?"), + RELATIVE_PART$ = subexp(subexp("\\/\\/" + AUTHORITY$ + PATH_ABEMPTY$) + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_EMPTY$), + RELATIVE$ = subexp(RELATIVE_PART$ + subexp("\\?" + QUERY$) + "?" + subexp("\\#" + FRAGMENT$) + "?"), + URI_REFERENCE$ = subexp(URI$ + "|" + RELATIVE$), + ABSOLUTE_URI$ = subexp(SCHEME$ + "\\:" + HIER_PART$ + subexp("\\?" + QUERY$) + "?"), + GENERIC_REF$ = "^(" + SCHEME$ + ")\\:" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", + RELATIVE_REF$ = "^(){0}" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", + ABSOLUTE_REF$ = "^(" + SCHEME$ + ")\\:" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?$", + SAMEDOC_REF$ = "^" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", + AUTHORITY_REF$ = "^" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?$"; + return { + NOT_SCHEME: new RegExp(merge("[^]", ALPHA$$, DIGIT$$, "[\\+\\-\\.]"), "g"), + NOT_USERINFO: new RegExp(merge("[^\\%\\:]", UNRESERVED$$, SUB_DELIMS$$), "g"), + NOT_HOST: new RegExp(merge("[^\\%\\[\\]\\:]", UNRESERVED$$, SUB_DELIMS$$), "g"), + NOT_PATH: new RegExp(merge("[^\\%\\/\\:\\@]", UNRESERVED$$, SUB_DELIMS$$), "g"), + NOT_PATH_NOSCHEME: new RegExp(merge("[^\\%\\/\\@]", UNRESERVED$$, SUB_DELIMS$$), "g"), + NOT_QUERY: new RegExp(merge("[^\\%]", UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@\\/\\?]", IPRIVATE$$), "g"), + NOT_FRAGMENT: new RegExp(merge("[^\\%]", UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@\\/\\?]"), "g"), + ESCAPE: new RegExp(merge("[^]", UNRESERVED$$, SUB_DELIMS$$), "g"), + UNRESERVED: new RegExp(UNRESERVED$$, "g"), + OTHER_CHARS: new RegExp(merge("[^\\%]", UNRESERVED$$, RESERVED$$), "g"), + PCT_ENCODED: new RegExp(PCT_ENCODED$, "g"), + IPV4ADDRESS: new RegExp("^(" + IPV4ADDRESS$ + ")$"), + IPV6ADDRESS: new RegExp("^\\[?(" + IPV6ADDRESS$ + ")" + subexp(subexp("\\%25|\\%(?!" + HEXDIG$$ + "{2})") + "(" + ZONEID$ + ")") + "?\\]?$") //RFC 6874, with relaxed parsing rules + }; +} +var URI_PROTOCOL = buildExps(false); + +var IRI_PROTOCOL = buildExps(true); + +var slicedToArray = function () { + function sliceIterator(arr, i) { + var _arr = []; + var _n = true; + var _d = false; + var _e = undefined; + + try { + for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { + _arr.push(_s.value); + + if (i && _arr.length === i) break; + } + } catch (err) { + _d = true; + _e = err; + } finally { + try { + if (!_n && _i["return"]) _i["return"](); + } finally { + if (_d) throw _e; + } + } + + return _arr; + } + + return function (arr, i) { + if (Array.isArray(arr)) { + return arr; + } else if (Symbol.iterator in Object(arr)) { + return sliceIterator(arr, i); + } else { + throw new TypeError("Invalid attempt to destructure non-iterable instance"); + } + }; +}(); + + + + + + + + + + + + + +var toConsumableArray = function (arr) { + if (Array.isArray(arr)) { + for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) arr2[i] = arr[i]; + + return arr2; + } else { + return Array.from(arr); + } +}; + +/** Highest positive signed 32-bit float value */ + +var maxInt = 2147483647; // aka. 0x7FFFFFFF or 2^31-1 + +/** Bootstring parameters */ +var base = 36; +var tMin = 1; +var tMax = 26; +var skew = 38; +var damp = 700; +var initialBias = 72; +var initialN = 128; // 0x80 +var delimiter = '-'; // '\x2D' + +/** Regular expressions */ +var regexPunycode = /^xn--/; +var regexNonASCII = /[^\0-\x7E]/; // non-ASCII chars +var regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g; // RFC 3490 separators + +/** Error messages */ +var errors = { + 'overflow': 'Overflow: input needs wider integers to process', + 'not-basic': 'Illegal input >= 0x80 (not a basic code point)', + 'invalid-input': 'Invalid input' +}; + +/** Convenience shortcuts */ +var baseMinusTMin = base - tMin; +var floor = Math.floor; +var stringFromCharCode = String.fromCharCode; + +/*--------------------------------------------------------------------------*/ + +/** + * A generic error utility function. + * @private + * @param {String} type The error type. + * @returns {Error} Throws a `RangeError` with the applicable error message. + */ +function error$1(type) { + throw new RangeError(errors[type]); +} + +/** + * A generic `Array#map` utility function. + * @private + * @param {Array} array The array to iterate over. + * @param {Function} callback The function that gets called for every array + * item. + * @returns {Array} A new array of values returned by the callback function. + */ +function map(array, fn) { + var result = []; + var length = array.length; + while (length--) { + result[length] = fn(array[length]); + } + return result; +} + +/** + * A simple `Array#map`-like wrapper to work with domain name strings or email + * addresses. + * @private + * @param {String} domain The domain name or email address. + * @param {Function} callback The function that gets called for every + * character. + * @returns {Array} A new string of characters returned by the callback + * function. + */ +function mapDomain(string, fn) { + var parts = string.split('@'); + var result = ''; + if (parts.length > 1) { + // In email addresses, only the domain name should be punycoded. Leave + // the local part (i.e. everything up to `@`) intact. + result = parts[0] + '@'; + string = parts[1]; + } + // Avoid `split(regex)` for IE8 compatibility. See #17. + string = string.replace(regexSeparators, '\x2E'); + var labels = string.split('.'); + var encoded = map(labels, fn).join('.'); + return result + encoded; +} + +/** + * Creates an array containing the numeric code points of each Unicode + * character in the string. While JavaScript uses UCS-2 internally, + * this function will convert a pair of surrogate halves (each of which + * UCS-2 exposes as separate characters) into a single code point, + * matching UTF-16. + * @see `punycode.ucs2.encode` + * @see + * @memberOf punycode.ucs2 + * @name decode + * @param {String} string The Unicode input string (UCS-2). + * @returns {Array} The new array of code points. + */ +function ucs2decode(string) { + var output = []; + var counter = 0; + var length = string.length; + while (counter < length) { + var value = string.charCodeAt(counter++); + if (value >= 0xD800 && value <= 0xDBFF && counter < length) { + // It's a high surrogate, and there is a next character. + var extra = string.charCodeAt(counter++); + if ((extra & 0xFC00) == 0xDC00) { + // Low surrogate. + output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000); + } else { + // It's an unmatched surrogate; only append this code unit, in case the + // next code unit is the high surrogate of a surrogate pair. + output.push(value); + counter--; + } + } else { + output.push(value); + } + } + return output; +} + +/** + * Creates a string based on an array of numeric code points. + * @see `punycode.ucs2.decode` + * @memberOf punycode.ucs2 + * @name encode + * @param {Array} codePoints The array of numeric code points. + * @returns {String} The new Unicode string (UCS-2). + */ +var ucs2encode = function ucs2encode(array) { + return String.fromCodePoint.apply(String, toConsumableArray(array)); +}; + +/** + * Converts a basic code point into a digit/integer. + * @see `digitToBasic()` + * @private + * @param {Number} codePoint The basic numeric code point value. + * @returns {Number} The numeric value of a basic code point (for use in + * representing integers) in the range `0` to `base - 1`, or `base` if + * the code point does not represent a value. + */ +var basicToDigit = function basicToDigit(codePoint) { + if (codePoint - 0x30 < 0x0A) { + return codePoint - 0x16; + } + if (codePoint - 0x41 < 0x1A) { + return codePoint - 0x41; + } + if (codePoint - 0x61 < 0x1A) { + return codePoint - 0x61; + } + return base; +}; + +/** + * Converts a digit/integer into a basic code point. + * @see `basicToDigit()` + * @private + * @param {Number} digit The numeric value of a basic code point. + * @returns {Number} The basic code point whose value (when used for + * representing integers) is `digit`, which needs to be in the range + * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is + * used; else, the lowercase form is used. The behavior is undefined + * if `flag` is non-zero and `digit` has no uppercase form. + */ +var digitToBasic = function digitToBasic(digit, flag) { + // 0..25 map to ASCII a..z or A..Z + // 26..35 map to ASCII 0..9 + return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5); +}; + +/** + * Bias adaptation function as per section 3.4 of RFC 3492. + * https://tools.ietf.org/html/rfc3492#section-3.4 + * @private + */ +var adapt = function adapt(delta, numPoints, firstTime) { + var k = 0; + delta = firstTime ? floor(delta / damp) : delta >> 1; + delta += floor(delta / numPoints); + for (; /* no initialization */delta > baseMinusTMin * tMax >> 1; k += base) { + delta = floor(delta / baseMinusTMin); + } + return floor(k + (baseMinusTMin + 1) * delta / (delta + skew)); +}; + +/** + * Converts a Punycode string of ASCII-only symbols to a string of Unicode + * symbols. + * @memberOf punycode + * @param {String} input The Punycode string of ASCII-only symbols. + * @returns {String} The resulting string of Unicode symbols. + */ +var decode = function decode(input) { + // Don't use UCS-2. + var output = []; + var inputLength = input.length; + var i = 0; + var n = initialN; + var bias = initialBias; + + // Handle the basic code points: let `basic` be the number of input code + // points before the last delimiter, or `0` if there is none, then copy + // the first basic code points to the output. + + var basic = input.lastIndexOf(delimiter); + if (basic < 0) { + basic = 0; + } + + for (var j = 0; j < basic; ++j) { + // if it's not a basic code point + if (input.charCodeAt(j) >= 0x80) { + error$1('not-basic'); + } + output.push(input.charCodeAt(j)); + } + + // Main decoding loop: start just after the last delimiter if any basic code + // points were copied; start at the beginning otherwise. + + for (var index = basic > 0 ? basic + 1 : 0; index < inputLength;) /* no final expression */{ + + // `index` is the index of the next character to be consumed. + // Decode a generalized variable-length integer into `delta`, + // which gets added to `i`. The overflow checking is easier + // if we increase `i` as we go, then subtract off its starting + // value at the end to obtain `delta`. + var oldi = i; + for (var w = 1, k = base;; /* no condition */k += base) { + + if (index >= inputLength) { + error$1('invalid-input'); + } + + var digit = basicToDigit(input.charCodeAt(index++)); + + if (digit >= base || digit > floor((maxInt - i) / w)) { + error$1('overflow'); + } + + i += digit * w; + var t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; + + if (digit < t) { + break; + } + + var baseMinusT = base - t; + if (w > floor(maxInt / baseMinusT)) { + error$1('overflow'); + } + + w *= baseMinusT; + } + + var out = output.length + 1; + bias = adapt(i - oldi, out, oldi == 0); + + // `i` was supposed to wrap around from `out` to `0`, + // incrementing `n` each time, so we'll fix that now: + if (floor(i / out) > maxInt - n) { + error$1('overflow'); + } + + n += floor(i / out); + i %= out; + + // Insert `n` at position `i` of the output. + output.splice(i++, 0, n); + } + + return String.fromCodePoint.apply(String, output); +}; + +/** + * Converts a string of Unicode symbols (e.g. a domain name label) to a + * Punycode string of ASCII-only symbols. + * @memberOf punycode + * @param {String} input The string of Unicode symbols. + * @returns {String} The resulting Punycode string of ASCII-only symbols. + */ +var encode = function encode(input) { + var output = []; + + // Convert the input in UCS-2 to an array of Unicode code points. + input = ucs2decode(input); + + // Cache the length. + var inputLength = input.length; + + // Initialize the state. + var n = initialN; + var delta = 0; + var bias = initialBias; + + // Handle the basic code points. + var _iteratorNormalCompletion = true; + var _didIteratorError = false; + var _iteratorError = undefined; + + try { + for (var _iterator = input[Symbol.iterator](), _step; !(_iteratorNormalCompletion = (_step = _iterator.next()).done); _iteratorNormalCompletion = true) { + var _currentValue2 = _step.value; + + if (_currentValue2 < 0x80) { + output.push(stringFromCharCode(_currentValue2)); + } + } + } catch (err) { + _didIteratorError = true; + _iteratorError = err; + } finally { + try { + if (!_iteratorNormalCompletion && _iterator.return) { + _iterator.return(); + } + } finally { + if (_didIteratorError) { + throw _iteratorError; + } + } + } + + var basicLength = output.length; + var handledCPCount = basicLength; + + // `handledCPCount` is the number of code points that have been handled; + // `basicLength` is the number of basic code points. + + // Finish the basic string with a delimiter unless it's empty. + if (basicLength) { + output.push(delimiter); + } + + // Main encoding loop: + while (handledCPCount < inputLength) { + + // All non-basic code points < n have been handled already. Find the next + // larger one: + var m = maxInt; + var _iteratorNormalCompletion2 = true; + var _didIteratorError2 = false; + var _iteratorError2 = undefined; + + try { + for (var _iterator2 = input[Symbol.iterator](), _step2; !(_iteratorNormalCompletion2 = (_step2 = _iterator2.next()).done); _iteratorNormalCompletion2 = true) { + var currentValue = _step2.value; + + if (currentValue >= n && currentValue < m) { + m = currentValue; + } + } + + // Increase `delta` enough to advance the decoder's state to , + // but guard against overflow. + } catch (err) { + _didIteratorError2 = true; + _iteratorError2 = err; + } finally { + try { + if (!_iteratorNormalCompletion2 && _iterator2.return) { + _iterator2.return(); + } + } finally { + if (_didIteratorError2) { + throw _iteratorError2; + } + } + } + + var handledCPCountPlusOne = handledCPCount + 1; + if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) { + error$1('overflow'); + } + + delta += (m - n) * handledCPCountPlusOne; + n = m; + + var _iteratorNormalCompletion3 = true; + var _didIteratorError3 = false; + var _iteratorError3 = undefined; + + try { + for (var _iterator3 = input[Symbol.iterator](), _step3; !(_iteratorNormalCompletion3 = (_step3 = _iterator3.next()).done); _iteratorNormalCompletion3 = true) { + var _currentValue = _step3.value; + + if (_currentValue < n && ++delta > maxInt) { + error$1('overflow'); + } + if (_currentValue == n) { + // Represent delta as a generalized variable-length integer. + var q = delta; + for (var k = base;; /* no condition */k += base) { + var t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; + if (q < t) { + break; + } + var qMinusT = q - t; + var baseMinusT = base - t; + output.push(stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0))); + q = floor(qMinusT / baseMinusT); + } + + output.push(stringFromCharCode(digitToBasic(q, 0))); + bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength); + delta = 0; + ++handledCPCount; + } + } + } catch (err) { + _didIteratorError3 = true; + _iteratorError3 = err; + } finally { + try { + if (!_iteratorNormalCompletion3 && _iterator3.return) { + _iterator3.return(); + } + } finally { + if (_didIteratorError3) { + throw _iteratorError3; + } + } + } + + ++delta; + ++n; + } + return output.join(''); +}; + +/** + * Converts a Punycode string representing a domain name or an email address + * to Unicode. Only the Punycoded parts of the input will be converted, i.e. + * it doesn't matter if you call it on a string that has already been + * converted to Unicode. + * @memberOf punycode + * @param {String} input The Punycoded domain name or email address to + * convert to Unicode. + * @returns {String} The Unicode representation of the given Punycode + * string. + */ +var toUnicode = function toUnicode(input) { + return mapDomain(input, function (string) { + return regexPunycode.test(string) ? decode(string.slice(4).toLowerCase()) : string; + }); +}; + +/** + * Converts a Unicode string representing a domain name or an email address to + * Punycode. Only the non-ASCII parts of the domain name will be converted, + * i.e. it doesn't matter if you call it with a domain that's already in + * ASCII. + * @memberOf punycode + * @param {String} input The domain name or email address to convert, as a + * Unicode string. + * @returns {String} The Punycode representation of the given domain name or + * email address. + */ +var toASCII = function toASCII(input) { + return mapDomain(input, function (string) { + return regexNonASCII.test(string) ? 'xn--' + encode(string) : string; + }); +}; + +/*--------------------------------------------------------------------------*/ + +/** Define the public API */ +var punycode = { + /** + * A string representing the current Punycode.js version number. + * @memberOf punycode + * @type String + */ + 'version': '2.1.0', + /** + * An object of methods to convert from JavaScript's internal character + * representation (UCS-2) to Unicode code points, and back. + * @see + * @memberOf punycode + * @type Object + */ + 'ucs2': { + 'decode': ucs2decode, + 'encode': ucs2encode + }, + 'decode': decode, + 'encode': encode, + 'toASCII': toASCII, + 'toUnicode': toUnicode +}; + +/** + * URI.js + * + * @fileoverview An RFC 3986 compliant, scheme extendable URI parsing/validating/resolving library for JavaScript. + * @author Gary Court + * @see http://github.com/garycourt/uri-js + */ +/** + * Copyright 2011 Gary Court. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, are + * permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY GARY COURT ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND + * FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL GARY COURT OR + * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR + * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON + * ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF + * ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + * + * The views and conclusions contained in the software and documentation are those of the + * authors and should not be interpreted as representing official policies, either expressed + * or implied, of Gary Court. + */ +var SCHEMES = {}; +function pctEncChar(chr) { + var c = chr.charCodeAt(0); + var e = void 0; + if (c < 16) e = "%0" + c.toString(16).toUpperCase();else if (c < 128) e = "%" + c.toString(16).toUpperCase();else if (c < 2048) e = "%" + (c >> 6 | 192).toString(16).toUpperCase() + "%" + (c & 63 | 128).toString(16).toUpperCase();else e = "%" + (c >> 12 | 224).toString(16).toUpperCase() + "%" + (c >> 6 & 63 | 128).toString(16).toUpperCase() + "%" + (c & 63 | 128).toString(16).toUpperCase(); + return e; +} +function pctDecChars(str) { + var newStr = ""; + var i = 0; + var il = str.length; + while (i < il) { + var c = parseInt(str.substr(i + 1, 2), 16); + if (c < 128) { + newStr += String.fromCharCode(c); + i += 3; + } else if (c >= 194 && c < 224) { + if (il - i >= 6) { + var c2 = parseInt(str.substr(i + 4, 2), 16); + newStr += String.fromCharCode((c & 31) << 6 | c2 & 63); + } else { + newStr += str.substr(i, 6); + } + i += 6; + } else if (c >= 224) { + if (il - i >= 9) { + var _c = parseInt(str.substr(i + 4, 2), 16); + var c3 = parseInt(str.substr(i + 7, 2), 16); + newStr += String.fromCharCode((c & 15) << 12 | (_c & 63) << 6 | c3 & 63); + } else { + newStr += str.substr(i, 9); + } + i += 9; + } else { + newStr += str.substr(i, 3); + i += 3; + } + } + return newStr; +} +function _normalizeComponentEncoding(components, protocol) { + function decodeUnreserved(str) { + var decStr = pctDecChars(str); + return !decStr.match(protocol.UNRESERVED) ? str : decStr; + } + if (components.scheme) components.scheme = String(components.scheme).replace(protocol.PCT_ENCODED, decodeUnreserved).toLowerCase().replace(protocol.NOT_SCHEME, ""); + if (components.userinfo !== undefined) components.userinfo = String(components.userinfo).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_USERINFO, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + if (components.host !== undefined) components.host = String(components.host).replace(protocol.PCT_ENCODED, decodeUnreserved).toLowerCase().replace(protocol.NOT_HOST, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + if (components.path !== undefined) components.path = String(components.path).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(components.scheme ? protocol.NOT_PATH : protocol.NOT_PATH_NOSCHEME, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + if (components.query !== undefined) components.query = String(components.query).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_QUERY, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + if (components.fragment !== undefined) components.fragment = String(components.fragment).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_FRAGMENT, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + return components; +} + +function _stripLeadingZeros(str) { + return str.replace(/^0*(.*)/, "$1") || "0"; +} +function _normalizeIPv4(host, protocol) { + var matches = host.match(protocol.IPV4ADDRESS) || []; + + var _matches = slicedToArray(matches, 2), + address = _matches[1]; + + if (address) { + return address.split(".").map(_stripLeadingZeros).join("."); + } else { + return host; + } +} +function _normalizeIPv6(host, protocol) { + var matches = host.match(protocol.IPV6ADDRESS) || []; + + var _matches2 = slicedToArray(matches, 3), + address = _matches2[1], + zone = _matches2[2]; + + if (address) { + var _address$toLowerCase$ = address.toLowerCase().split('::').reverse(), + _address$toLowerCase$2 = slicedToArray(_address$toLowerCase$, 2), + last = _address$toLowerCase$2[0], + first = _address$toLowerCase$2[1]; + + var firstFields = first ? first.split(":").map(_stripLeadingZeros) : []; + var lastFields = last.split(":").map(_stripLeadingZeros); + var isLastFieldIPv4Address = protocol.IPV4ADDRESS.test(lastFields[lastFields.length - 1]); + var fieldCount = isLastFieldIPv4Address ? 7 : 8; + var lastFieldsStart = lastFields.length - fieldCount; + var fields = Array(fieldCount); + for (var x = 0; x < fieldCount; ++x) { + fields[x] = firstFields[x] || lastFields[lastFieldsStart + x] || ''; + } + if (isLastFieldIPv4Address) { + fields[fieldCount - 1] = _normalizeIPv4(fields[fieldCount - 1], protocol); + } + var allZeroFields = fields.reduce(function (acc, field, index) { + if (!field || field === "0") { + var lastLongest = acc[acc.length - 1]; + if (lastLongest && lastLongest.index + lastLongest.length === index) { + lastLongest.length++; + } else { + acc.push({ index: index, length: 1 }); + } + } + return acc; + }, []); + var longestZeroFields = allZeroFields.sort(function (a, b) { + return b.length - a.length; + })[0]; + var newHost = void 0; + if (longestZeroFields && longestZeroFields.length > 1) { + var newFirst = fields.slice(0, longestZeroFields.index); + var newLast = fields.slice(longestZeroFields.index + longestZeroFields.length); + newHost = newFirst.join(":") + "::" + newLast.join(":"); + } else { + newHost = fields.join(":"); + } + if (zone) { + newHost += "%" + zone; + } + return newHost; + } else { + return host; + } +} +var URI_PARSE = /^(?:([^:\/?#]+):)?(?:\/\/((?:([^\/?#@]*)@)?(\[[^\/?#\]]+\]|[^\/?#:]*)(?:\:(\d*))?))?([^?#]*)(?:\?([^#]*))?(?:#((?:.|\n|\r)*))?/i; +var NO_MATCH_IS_UNDEFINED = "".match(/(){0}/)[1] === undefined; +function parse(uriString) { + var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + + var components = {}; + var protocol = options.iri !== false ? IRI_PROTOCOL : URI_PROTOCOL; + if (options.reference === "suffix") uriString = (options.scheme ? options.scheme + ":" : "") + "//" + uriString; + var matches = uriString.match(URI_PARSE); + if (matches) { + if (NO_MATCH_IS_UNDEFINED) { + //store each component + components.scheme = matches[1]; + components.userinfo = matches[3]; + components.host = matches[4]; + components.port = parseInt(matches[5], 10); + components.path = matches[6] || ""; + components.query = matches[7]; + components.fragment = matches[8]; + //fix port number + if (isNaN(components.port)) { + components.port = matches[5]; + } + } else { + //IE FIX for improper RegExp matching + //store each component + components.scheme = matches[1] || undefined; + components.userinfo = uriString.indexOf("@") !== -1 ? matches[3] : undefined; + components.host = uriString.indexOf("//") !== -1 ? matches[4] : undefined; + components.port = parseInt(matches[5], 10); + components.path = matches[6] || ""; + components.query = uriString.indexOf("?") !== -1 ? matches[7] : undefined; + components.fragment = uriString.indexOf("#") !== -1 ? matches[8] : undefined; + //fix port number + if (isNaN(components.port)) { + components.port = uriString.match(/\/\/(?:.|\n)*\:(?:\/|\?|\#|$)/) ? matches[4] : undefined; + } + } + if (components.host) { + //normalize IP hosts + components.host = _normalizeIPv6(_normalizeIPv4(components.host, protocol), protocol); + } + //determine reference type + if (components.scheme === undefined && components.userinfo === undefined && components.host === undefined && components.port === undefined && !components.path && components.query === undefined) { + components.reference = "same-document"; + } else if (components.scheme === undefined) { + components.reference = "relative"; + } else if (components.fragment === undefined) { + components.reference = "absolute"; + } else { + components.reference = "uri"; + } + //check for reference errors + if (options.reference && options.reference !== "suffix" && options.reference !== components.reference) { + components.error = components.error || "URI is not a " + options.reference + " reference."; + } + //find scheme handler + var schemeHandler = SCHEMES[(options.scheme || components.scheme || "").toLowerCase()]; + //check if scheme can't handle IRIs + if (!options.unicodeSupport && (!schemeHandler || !schemeHandler.unicodeSupport)) { + //if host component is a domain name + if (components.host && (options.domainHost || schemeHandler && schemeHandler.domainHost)) { + //convert Unicode IDN -> ASCII IDN + try { + components.host = punycode.toASCII(components.host.replace(protocol.PCT_ENCODED, pctDecChars).toLowerCase()); + } catch (e) { + components.error = components.error || "Host's domain name can not be converted to ASCII via punycode: " + e; + } + } + //convert IRI -> URI + _normalizeComponentEncoding(components, URI_PROTOCOL); + } else { + //normalize encodings + _normalizeComponentEncoding(components, protocol); + } + //perform scheme specific parsing + if (schemeHandler && schemeHandler.parse) { + schemeHandler.parse(components, options); + } + } else { + components.error = components.error || "URI can not be parsed."; + } + return components; +} + +function _recomposeAuthority(components, options) { + var protocol = options.iri !== false ? IRI_PROTOCOL : URI_PROTOCOL; + var uriTokens = []; + if (components.userinfo !== undefined) { + uriTokens.push(components.userinfo); + uriTokens.push("@"); + } + if (components.host !== undefined) { + //normalize IP hosts, add brackets and escape zone separator for IPv6 + uriTokens.push(_normalizeIPv6(_normalizeIPv4(String(components.host), protocol), protocol).replace(protocol.IPV6ADDRESS, function (_, $1, $2) { + return "[" + $1 + ($2 ? "%25" + $2 : "") + "]"; + })); + } + if (typeof components.port === "number" || typeof components.port === "string") { + uriTokens.push(":"); + uriTokens.push(String(components.port)); + } + return uriTokens.length ? uriTokens.join("") : undefined; +} + +var RDS1 = /^\.\.?\//; +var RDS2 = /^\/\.(\/|$)/; +var RDS3 = /^\/\.\.(\/|$)/; +var RDS5 = /^\/?(?:.|\n)*?(?=\/|$)/; +function removeDotSegments(input) { + var output = []; + while (input.length) { + if (input.match(RDS1)) { + input = input.replace(RDS1, ""); + } else if (input.match(RDS2)) { + input = input.replace(RDS2, "/"); + } else if (input.match(RDS3)) { + input = input.replace(RDS3, "/"); + output.pop(); + } else if (input === "." || input === "..") { + input = ""; + } else { + var im = input.match(RDS5); + if (im) { + var s = im[0]; + input = input.slice(s.length); + output.push(s); + } else { + throw new Error("Unexpected dot segment condition"); + } + } + } + return output.join(""); +} + +function serialize(components) { + var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + + var protocol = options.iri ? IRI_PROTOCOL : URI_PROTOCOL; + var uriTokens = []; + //find scheme handler + var schemeHandler = SCHEMES[(options.scheme || components.scheme || "").toLowerCase()]; + //perform scheme specific serialization + if (schemeHandler && schemeHandler.serialize) schemeHandler.serialize(components, options); + if (components.host) { + //if host component is an IPv6 address + if (protocol.IPV6ADDRESS.test(components.host)) {} + //TODO: normalize IPv6 address as per RFC 5952 + + //if host component is a domain name + else if (options.domainHost || schemeHandler && schemeHandler.domainHost) { + //convert IDN via punycode + try { + components.host = !options.iri ? punycode.toASCII(components.host.replace(protocol.PCT_ENCODED, pctDecChars).toLowerCase()) : punycode.toUnicode(components.host); + } catch (e) { + components.error = components.error || "Host's domain name can not be converted to " + (!options.iri ? "ASCII" : "Unicode") + " via punycode: " + e; + } + } + } + //normalize encoding + _normalizeComponentEncoding(components, protocol); + if (options.reference !== "suffix" && components.scheme) { + uriTokens.push(components.scheme); + uriTokens.push(":"); + } + var authority = _recomposeAuthority(components, options); + if (authority !== undefined) { + if (options.reference !== "suffix") { + uriTokens.push("//"); + } + uriTokens.push(authority); + if (components.path && components.path.charAt(0) !== "/") { + uriTokens.push("/"); + } + } + if (components.path !== undefined) { + var s = components.path; + if (!options.absolutePath && (!schemeHandler || !schemeHandler.absolutePath)) { + s = removeDotSegments(s); + } + if (authority === undefined) { + s = s.replace(/^\/\//, "/%2F"); //don't allow the path to start with "//" + } + uriTokens.push(s); + } + if (components.query !== undefined) { + uriTokens.push("?"); + uriTokens.push(components.query); + } + if (components.fragment !== undefined) { + uriTokens.push("#"); + uriTokens.push(components.fragment); + } + return uriTokens.join(""); //merge tokens into a string +} + +function resolveComponents(base, relative) { + var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; + var skipNormalization = arguments[3]; + + var target = {}; + if (!skipNormalization) { + base = parse(serialize(base, options), options); //normalize base components + relative = parse(serialize(relative, options), options); //normalize relative components + } + options = options || {}; + if (!options.tolerant && relative.scheme) { + target.scheme = relative.scheme; + //target.authority = relative.authority; + target.userinfo = relative.userinfo; + target.host = relative.host; + target.port = relative.port; + target.path = removeDotSegments(relative.path || ""); + target.query = relative.query; + } else { + if (relative.userinfo !== undefined || relative.host !== undefined || relative.port !== undefined) { + //target.authority = relative.authority; + target.userinfo = relative.userinfo; + target.host = relative.host; + target.port = relative.port; + target.path = removeDotSegments(relative.path || ""); + target.query = relative.query; + } else { + if (!relative.path) { + target.path = base.path; + if (relative.query !== undefined) { + target.query = relative.query; + } else { + target.query = base.query; + } + } else { + if (relative.path.charAt(0) === "/") { + target.path = removeDotSegments(relative.path); + } else { + if ((base.userinfo !== undefined || base.host !== undefined || base.port !== undefined) && !base.path) { + target.path = "/" + relative.path; + } else if (!base.path) { + target.path = relative.path; + } else { + target.path = base.path.slice(0, base.path.lastIndexOf("/") + 1) + relative.path; + } + target.path = removeDotSegments(target.path); + } + target.query = relative.query; + } + //target.authority = base.authority; + target.userinfo = base.userinfo; + target.host = base.host; + target.port = base.port; + } + target.scheme = base.scheme; + } + target.fragment = relative.fragment; + return target; +} + +function resolve(baseURI, relativeURI, options) { + var schemelessOptions = assign({ scheme: 'null' }, options); + return serialize(resolveComponents(parse(baseURI, schemelessOptions), parse(relativeURI, schemelessOptions), schemelessOptions, true), schemelessOptions); +} + +function normalize(uri, options) { + if (typeof uri === "string") { + uri = serialize(parse(uri, options), options); + } else if (typeOf(uri) === "object") { + uri = parse(serialize(uri, options), options); + } + return uri; +} + +function equal(uriA, uriB, options) { + if (typeof uriA === "string") { + uriA = serialize(parse(uriA, options), options); + } else if (typeOf(uriA) === "object") { + uriA = serialize(uriA, options); + } + if (typeof uriB === "string") { + uriB = serialize(parse(uriB, options), options); + } else if (typeOf(uriB) === "object") { + uriB = serialize(uriB, options); + } + return uriA === uriB; +} + +function escapeComponent(str, options) { + return str && str.toString().replace(!options || !options.iri ? URI_PROTOCOL.ESCAPE : IRI_PROTOCOL.ESCAPE, pctEncChar); +} + +function unescapeComponent(str, options) { + return str && str.toString().replace(!options || !options.iri ? URI_PROTOCOL.PCT_ENCODED : IRI_PROTOCOL.PCT_ENCODED, pctDecChars); +} + +var handler = { + scheme: "http", + domainHost: true, + parse: function parse(components, options) { + //report missing host + if (!components.host) { + components.error = components.error || "HTTP URIs must have a host."; + } + return components; + }, + serialize: function serialize(components, options) { + var secure = String(components.scheme).toLowerCase() === "https"; + //normalize the default port + if (components.port === (secure ? 443 : 80) || components.port === "") { + components.port = undefined; + } + //normalize the empty path + if (!components.path) { + components.path = "/"; + } + //NOTE: We do not parse query strings for HTTP URIs + //as WWW Form Url Encoded query strings are part of the HTML4+ spec, + //and not the HTTP spec. + return components; + } +}; + +var handler$1 = { + scheme: "https", + domainHost: handler.domainHost, + parse: handler.parse, + serialize: handler.serialize +}; + +function isSecure(wsComponents) { + return typeof wsComponents.secure === 'boolean' ? wsComponents.secure : String(wsComponents.scheme).toLowerCase() === "wss"; +} +//RFC 6455 +var handler$2 = { + scheme: "ws", + domainHost: true, + parse: function parse(components, options) { + var wsComponents = components; + //indicate if the secure flag is set + wsComponents.secure = isSecure(wsComponents); + //construct resouce name + wsComponents.resourceName = (wsComponents.path || '/') + (wsComponents.query ? '?' + wsComponents.query : ''); + wsComponents.path = undefined; + wsComponents.query = undefined; + return wsComponents; + }, + serialize: function serialize(wsComponents, options) { + //normalize the default port + if (wsComponents.port === (isSecure(wsComponents) ? 443 : 80) || wsComponents.port === "") { + wsComponents.port = undefined; + } + //ensure scheme matches secure flag + if (typeof wsComponents.secure === 'boolean') { + wsComponents.scheme = wsComponents.secure ? 'wss' : 'ws'; + wsComponents.secure = undefined; + } + //reconstruct path from resource name + if (wsComponents.resourceName) { + var _wsComponents$resourc = wsComponents.resourceName.split('?'), + _wsComponents$resourc2 = slicedToArray(_wsComponents$resourc, 2), + path = _wsComponents$resourc2[0], + query = _wsComponents$resourc2[1]; + + wsComponents.path = path && path !== '/' ? path : undefined; + wsComponents.query = query; + wsComponents.resourceName = undefined; + } + //forbid fragment component + wsComponents.fragment = undefined; + return wsComponents; + } +}; + +var handler$3 = { + scheme: "wss", + domainHost: handler$2.domainHost, + parse: handler$2.parse, + serialize: handler$2.serialize +}; + +var O = {}; +var isIRI = true; +//RFC 3986 +var UNRESERVED$$ = "[A-Za-z0-9\\-\\.\\_\\~" + (isIRI ? "\\xA0-\\u200D\\u2010-\\u2029\\u202F-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFEF" : "") + "]"; +var HEXDIG$$ = "[0-9A-Fa-f]"; //case-insensitive +var PCT_ENCODED$ = subexp(subexp("%[EFef]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%[89A-Fa-f]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%" + HEXDIG$$ + HEXDIG$$)); //expanded +//RFC 5322, except these symbols as per RFC 6068: @ : / ? # [ ] & ; = +//const ATEXT$$ = "[A-Za-z0-9\\!\\#\\$\\%\\&\\'\\*\\+\\-\\/\\=\\?\\^\\_\\`\\{\\|\\}\\~]"; +//const WSP$$ = "[\\x20\\x09]"; +//const OBS_QTEXT$$ = "[\\x01-\\x08\\x0B\\x0C\\x0E-\\x1F\\x7F]"; //(%d1-8 / %d11-12 / %d14-31 / %d127) +//const QTEXT$$ = merge("[\\x21\\x23-\\x5B\\x5D-\\x7E]", OBS_QTEXT$$); //%d33 / %d35-91 / %d93-126 / obs-qtext +//const VCHAR$$ = "[\\x21-\\x7E]"; +//const WSP$$ = "[\\x20\\x09]"; +//const OBS_QP$ = subexp("\\\\" + merge("[\\x00\\x0D\\x0A]", OBS_QTEXT$$)); //%d0 / CR / LF / obs-qtext +//const FWS$ = subexp(subexp(WSP$$ + "*" + "\\x0D\\x0A") + "?" + WSP$$ + "+"); +//const QUOTED_PAIR$ = subexp(subexp("\\\\" + subexp(VCHAR$$ + "|" + WSP$$)) + "|" + OBS_QP$); +//const QUOTED_STRING$ = subexp('\\"' + subexp(FWS$ + "?" + QCONTENT$) + "*" + FWS$ + "?" + '\\"'); +var ATEXT$$ = "[A-Za-z0-9\\!\\$\\%\\'\\*\\+\\-\\^\\_\\`\\{\\|\\}\\~]"; +var QTEXT$$ = "[\\!\\$\\%\\'\\(\\)\\*\\+\\,\\-\\.0-9\\<\\>A-Z\\x5E-\\x7E]"; +var VCHAR$$ = merge(QTEXT$$, "[\\\"\\\\]"); +var SOME_DELIMS$$ = "[\\!\\$\\'\\(\\)\\*\\+\\,\\;\\:\\@]"; +var UNRESERVED = new RegExp(UNRESERVED$$, "g"); +var PCT_ENCODED = new RegExp(PCT_ENCODED$, "g"); +var NOT_LOCAL_PART = new RegExp(merge("[^]", ATEXT$$, "[\\.]", '[\\"]', VCHAR$$), "g"); +var NOT_HFNAME = new RegExp(merge("[^]", UNRESERVED$$, SOME_DELIMS$$), "g"); +var NOT_HFVALUE = NOT_HFNAME; +function decodeUnreserved(str) { + var decStr = pctDecChars(str); + return !decStr.match(UNRESERVED) ? str : decStr; +} +var handler$4 = { + scheme: "mailto", + parse: function parse$$1(components, options) { + var mailtoComponents = components; + var to = mailtoComponents.to = mailtoComponents.path ? mailtoComponents.path.split(",") : []; + mailtoComponents.path = undefined; + if (mailtoComponents.query) { + var unknownHeaders = false; + var headers = {}; + var hfields = mailtoComponents.query.split("&"); + for (var x = 0, xl = hfields.length; x < xl; ++x) { + var hfield = hfields[x].split("="); + switch (hfield[0]) { + case "to": + var toAddrs = hfield[1].split(","); + for (var _x = 0, _xl = toAddrs.length; _x < _xl; ++_x) { + to.push(toAddrs[_x]); + } + break; + case "subject": + mailtoComponents.subject = unescapeComponent(hfield[1], options); + break; + case "body": + mailtoComponents.body = unescapeComponent(hfield[1], options); + break; + default: + unknownHeaders = true; + headers[unescapeComponent(hfield[0], options)] = unescapeComponent(hfield[1], options); + break; + } + } + if (unknownHeaders) mailtoComponents.headers = headers; + } + mailtoComponents.query = undefined; + for (var _x2 = 0, _xl2 = to.length; _x2 < _xl2; ++_x2) { + var addr = to[_x2].split("@"); + addr[0] = unescapeComponent(addr[0]); + if (!options.unicodeSupport) { + //convert Unicode IDN -> ASCII IDN + try { + addr[1] = punycode.toASCII(unescapeComponent(addr[1], options).toLowerCase()); + } catch (e) { + mailtoComponents.error = mailtoComponents.error || "Email address's domain name can not be converted to ASCII via punycode: " + e; + } + } else { + addr[1] = unescapeComponent(addr[1], options).toLowerCase(); + } + to[_x2] = addr.join("@"); + } + return mailtoComponents; + }, + serialize: function serialize$$1(mailtoComponents, options) { + var components = mailtoComponents; + var to = toArray(mailtoComponents.to); + if (to) { + for (var x = 0, xl = to.length; x < xl; ++x) { + var toAddr = String(to[x]); + var atIdx = toAddr.lastIndexOf("@"); + var localPart = toAddr.slice(0, atIdx).replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_LOCAL_PART, pctEncChar); + var domain = toAddr.slice(atIdx + 1); + //convert IDN via punycode + try { + domain = !options.iri ? punycode.toASCII(unescapeComponent(domain, options).toLowerCase()) : punycode.toUnicode(domain); + } catch (e) { + components.error = components.error || "Email address's domain name can not be converted to " + (!options.iri ? "ASCII" : "Unicode") + " via punycode: " + e; + } + to[x] = localPart + "@" + domain; + } + components.path = to.join(","); + } + var headers = mailtoComponents.headers = mailtoComponents.headers || {}; + if (mailtoComponents.subject) headers["subject"] = mailtoComponents.subject; + if (mailtoComponents.body) headers["body"] = mailtoComponents.body; + var fields = []; + for (var name in headers) { + if (headers[name] !== O[name]) { + fields.push(name.replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_HFNAME, pctEncChar) + "=" + headers[name].replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_HFVALUE, pctEncChar)); + } + } + if (fields.length) { + components.query = fields.join("&"); + } + return components; + } +}; + +var URN_PARSE = /^([^\:]+)\:(.*)/; +//RFC 2141 +var handler$5 = { + scheme: "urn", + parse: function parse$$1(components, options) { + var matches = components.path && components.path.match(URN_PARSE); + var urnComponents = components; + if (matches) { + var scheme = options.scheme || urnComponents.scheme || "urn"; + var nid = matches[1].toLowerCase(); + var nss = matches[2]; + var urnScheme = scheme + ":" + (options.nid || nid); + var schemeHandler = SCHEMES[urnScheme]; + urnComponents.nid = nid; + urnComponents.nss = nss; + urnComponents.path = undefined; + if (schemeHandler) { + urnComponents = schemeHandler.parse(urnComponents, options); + } + } else { + urnComponents.error = urnComponents.error || "URN can not be parsed."; + } + return urnComponents; + }, + serialize: function serialize$$1(urnComponents, options) { + var scheme = options.scheme || urnComponents.scheme || "urn"; + var nid = urnComponents.nid; + var urnScheme = scheme + ":" + (options.nid || nid); + var schemeHandler = SCHEMES[urnScheme]; + if (schemeHandler) { + urnComponents = schemeHandler.serialize(urnComponents, options); + } + var uriComponents = urnComponents; + var nss = urnComponents.nss; + uriComponents.path = (nid || options.nid) + ":" + nss; + return uriComponents; + } +}; + +var UUID = /^[0-9A-Fa-f]{8}(?:\-[0-9A-Fa-f]{4}){3}\-[0-9A-Fa-f]{12}$/; +//RFC 4122 +var handler$6 = { + scheme: "urn:uuid", + parse: function parse(urnComponents, options) { + var uuidComponents = urnComponents; + uuidComponents.uuid = uuidComponents.nss; + uuidComponents.nss = undefined; + if (!options.tolerant && (!uuidComponents.uuid || !uuidComponents.uuid.match(UUID))) { + uuidComponents.error = uuidComponents.error || "UUID is not valid."; + } + return uuidComponents; + }, + serialize: function serialize(uuidComponents, options) { + var urnComponents = uuidComponents; + //normalize UUID + urnComponents.nss = (uuidComponents.uuid || "").toLowerCase(); + return urnComponents; + } +}; + +SCHEMES[handler.scheme] = handler; +SCHEMES[handler$1.scheme] = handler$1; +SCHEMES[handler$2.scheme] = handler$2; +SCHEMES[handler$3.scheme] = handler$3; +SCHEMES[handler$4.scheme] = handler$4; +SCHEMES[handler$5.scheme] = handler$5; +SCHEMES[handler$6.scheme] = handler$6; + +exports.SCHEMES = SCHEMES; +exports.pctEncChar = pctEncChar; +exports.pctDecChars = pctDecChars; +exports.parse = parse; +exports.removeDotSegments = removeDotSegments; +exports.serialize = serialize; +exports.resolveComponents = resolveComponents; +exports.resolve = resolve; +exports.normalize = normalize; +exports.equal = equal; +exports.escapeComponent = escapeComponent; +exports.unescapeComponent = unescapeComponent; + +Object.defineProperty(exports, '__esModule', { value: true }); + +}))); + + +},{}],"ajv":[function(require,module,exports){ +'use strict'; + +var compileSchema = require('./compile') + , resolve = require('./compile/resolve') + , Cache = require('./cache') + , SchemaObject = require('./compile/schema_obj') + , stableStringify = require('fast-json-stable-stringify') + , formats = require('./compile/formats') + , rules = require('./compile/rules') + , $dataMetaSchema = require('./data') + , util = require('./compile/util'); + +module.exports = Ajv; + +Ajv.prototype.validate = validate; +Ajv.prototype.compile = compile; +Ajv.prototype.addSchema = addSchema; +Ajv.prototype.addMetaSchema = addMetaSchema; +Ajv.prototype.validateSchema = validateSchema; +Ajv.prototype.getSchema = getSchema; +Ajv.prototype.removeSchema = removeSchema; +Ajv.prototype.addFormat = addFormat; +Ajv.prototype.errorsText = errorsText; + +Ajv.prototype._addSchema = _addSchema; +Ajv.prototype._compile = _compile; + +Ajv.prototype.compileAsync = require('./compile/async'); +var customKeyword = require('./keyword'); +Ajv.prototype.addKeyword = customKeyword.add; +Ajv.prototype.getKeyword = customKeyword.get; +Ajv.prototype.removeKeyword = customKeyword.remove; +Ajv.prototype.validateKeyword = customKeyword.validate; + +var errorClasses = require('./compile/error_classes'); +Ajv.ValidationError = errorClasses.Validation; +Ajv.MissingRefError = errorClasses.MissingRef; +Ajv.$dataMetaSchema = $dataMetaSchema; + +var META_SCHEMA_ID = 'http://json-schema.org/draft-07/schema'; + +var META_IGNORE_OPTIONS = [ 'removeAdditional', 'useDefaults', 'coerceTypes', 'strictDefaults' ]; +var META_SUPPORT_DATA = ['/properties']; + +/** + * Creates validator instance. + * Usage: `Ajv(opts)` + * @param {Object} opts optional options + * @return {Object} ajv instance + */ +function Ajv(opts) { + if (!(this instanceof Ajv)) return new Ajv(opts); + opts = this._opts = util.copy(opts) || {}; + setLogger(this); + this._schemas = {}; + this._refs = {}; + this._fragments = {}; + this._formats = formats(opts.format); + + this._cache = opts.cache || new Cache; + this._loadingSchemas = {}; + this._compilations = []; + this.RULES = rules(); + this._getId = chooseGetId(opts); + + opts.loopRequired = opts.loopRequired || Infinity; + if (opts.errorDataPath == 'property') opts._errorDataPathProperty = true; + if (opts.serialize === undefined) opts.serialize = stableStringify; + this._metaOpts = getMetaSchemaOptions(this); + + if (opts.formats) addInitialFormats(this); + if (opts.keywords) addInitialKeywords(this); + addDefaultMetaSchema(this); + if (typeof opts.meta == 'object') this.addMetaSchema(opts.meta); + if (opts.nullable) this.addKeyword('nullable', {metaSchema: {type: 'boolean'}}); + addInitialSchemas(this); +} + + + +/** + * Validate data using schema + * Schema will be compiled and cached (using serialized JSON as key. [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize. + * @this Ajv + * @param {String|Object} schemaKeyRef key, ref or schema object + * @param {Any} data to be validated + * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`). + */ +function validate(schemaKeyRef, data) { + var v; + if (typeof schemaKeyRef == 'string') { + v = this.getSchema(schemaKeyRef); + if (!v) throw new Error('no schema with key or ref "' + schemaKeyRef + '"'); + } else { + var schemaObj = this._addSchema(schemaKeyRef); + v = schemaObj.validate || this._compile(schemaObj); + } + + var valid = v(data); + if (v.$async !== true) this.errors = v.errors; + return valid; +} + + +/** + * Create validating function for passed schema. + * @this Ajv + * @param {Object} schema schema object + * @param {Boolean} _meta true if schema is a meta-schema. Used internally to compile meta schemas of custom keywords. + * @return {Function} validating function + */ +function compile(schema, _meta) { + var schemaObj = this._addSchema(schema, undefined, _meta); + return schemaObj.validate || this._compile(schemaObj); +} + + +/** + * Adds schema to the instance. + * @this Ajv + * @param {Object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored. + * @param {String} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`. + * @param {Boolean} _skipValidation true to skip schema validation. Used internally, option validateSchema should be used instead. + * @param {Boolean} _meta true if schema is a meta-schema. Used internally, addMetaSchema should be used instead. + * @return {Ajv} this for method chaining + */ +function addSchema(schema, key, _skipValidation, _meta) { + if (Array.isArray(schema)){ + for (var i=0; i} errors optional array of validation errors, if not passed errors from the instance are used. + * @param {Object} options optional options with properties `separator` and `dataVar`. + * @return {String} human readable string with all errors descriptions + */ +function errorsText(errors, options) { + errors = errors || this.errors; + if (!errors) return 'No errors'; + options = options || {}; + var separator = options.separator === undefined ? ', ' : options.separator; + var dataVar = options.dataVar === undefined ? 'data' : options.dataVar; + + var text = ''; + for (var i=0; i%\\^`{|}]|%[0-9a-f]{2})|\{[+#./;?&=,!@|]?(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?(?:,(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?)*\})*$/i,u=/^(?:(?:http[s\u017F]?|ftp):\/\/)(?:(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+(?::(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?@)?(?:(?!10(?:\.[0-9]{1,3}){3})(?!127(?:\.[0-9]{1,3}){3})(?!169\.254(?:\.[0-9]{1,3}){2})(?!192\.168(?:\.[0-9]{1,3}){2})(?!172\.(?:1[6-9]|2[0-9]|3[01])(?:\.[0-9]{1,3}){2})(?:[1-9][0-9]?|1[0-9][0-9]|2[01][0-9]|22[0-3])(?:\.(?:1?[0-9]{1,2}|2[0-4][0-9]|25[0-5])){2}(?:\.(?:[1-9][0-9]?|1[0-9][0-9]|2[0-4][0-9]|25[0-4]))|(?:(?:(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-)*(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)(?:\.(?:(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-)*(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)*(?:\.(?:(?:[a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]){2,})))(?::[0-9]{2,5})?(?:\/(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?$/i,h=/^(?:urn:uuid:)?[0-9a-f]{8}-(?:[0-9a-f]{4}-){3}[0-9a-f]{12}$/i,d=/^(?:\/(?:[^~/]|~0|~1)*)*$/,p=/^#(?:\/(?:[a-z0-9_\-.!$&'()*+,;:=@]|%[0-9a-f]{2}|~0|~1)*)*$/i,f=/^(?:0|[1-9][0-9]*)(?:#|(?:\/(?:[^~/]|~0|~1)*)*)$/;function m(e){return a.copy(m[e="full"==e?"full":"fast"])}function v(e){var r=e.match(o);if(!r)return!1;var t,a=+r[2],s=+r[3];return 1<=a&&a<=12&&1<=s&&s<=(2!=a||((t=+r[1])%4!=0||t%100==0&&t%400!=0)?i[a]:29)}function y(e,r){var t=e.match(n);if(!t)return!1;var a=t[1],s=t[2],o=t[3];return(a<=23&&s<=59&&o<=59||23==a&&59==s&&60==o)&&(!r||t[5])}(r.exports=m).fast={date:/^\d\d\d\d-[0-1]\d-[0-3]\d$/,time:/^(?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)?$/i,"date-time":/^\d\d\d\d-[0-1]\d-[0-3]\d[t\s](?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)$/i,uri:/^(?:[a-z][a-z0-9+\-.]*:)(?:\/?\/)?[^\s]*$/i,"uri-reference":/^(?:(?:[a-z][a-z0-9+\-.]*:)?\/?\/)?(?:[^\\\s#][^\s#]*)?(?:#[^\\\s]*)?$/i,"uri-template":c,url:u,email:/^[a-z0-9.!#$%&'*+/=?^_`{|}~-]+@[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?)*$/i,hostname:s,ipv4:/^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/,ipv6:/^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i,regex:w,uuid:h,"json-pointer":d,"json-pointer-uri-fragment":p,"relative-json-pointer":f},m.full={date:v,time:y,"date-time":function(e){var r=e.split(g);return 2==r.length&&v(r[0])&&y(r[1],!0)},uri:function(e){return P.test(e)&&l.test(e)},"uri-reference":/^(?:[a-z][a-z0-9+\-.]*:)?(?:\/?\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:]|%[0-9a-f]{2})*@)?(?:\[(?:(?:(?:(?:[0-9a-f]{1,4}:){6}|::(?:[0-9a-f]{1,4}:){5}|(?:[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){4}|(?:(?:[0-9a-f]{1,4}:){0,1}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){3}|(?:(?:[0-9a-f]{1,4}:){0,2}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){2}|(?:(?:[0-9a-f]{1,4}:){0,3}[0-9a-f]{1,4})?::[0-9a-f]{1,4}:|(?:(?:[0-9a-f]{1,4}:){0,4}[0-9a-f]{1,4})?::)(?:[0-9a-f]{1,4}:[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?))|(?:(?:[0-9a-f]{1,4}:){0,5}[0-9a-f]{1,4})?::[0-9a-f]{1,4}|(?:(?:[0-9a-f]{1,4}:){0,6}[0-9a-f]{1,4})?::)|[Vv][0-9a-f]+\.[a-z0-9\-._~!$&'()*+,;=:]+)\]|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)|(?:[a-z0-9\-._~!$&'"()*+,;=]|%[0-9a-f]{2})*)(?::\d*)?(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*|\/(?:(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*)?|(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*)?(?:\?(?:[a-z0-9\-._~!$&'"()*+,;=:@/?]|%[0-9a-f]{2})*)?(?:#(?:[a-z0-9\-._~!$&'"()*+,;=:@/?]|%[0-9a-f]{2})*)?$/i,"uri-template":c,url:u,email:/^[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@(?:[a-z0-9](?:[a-z0-9-]*[a-z0-9])?\.)+[a-z0-9](?:[a-z0-9-]*[a-z0-9])?$/i,hostname:s,ipv4:/^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/,ipv6:/^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i,regex:w,uuid:h,"json-pointer":d,"json-pointer-uri-fragment":p,"relative-json-pointer":f};var g=/t|\s/i;var P=/\/|:/;var E=/[^\\]\\Z/;function w(e){if(E.test(e))return!1;try{return new RegExp(e),!0}catch(e){return!1}}},{"./util":10}],5:[function(e,r,t){"use strict";var R=e("./resolve"),$=e("./util"),j=e("./error_classes"),D=e("fast-json-stable-stringify"),O=e("../dotjs/validate"),I=$.ucs2length,A=e("fast-deep-equal"),k=j.Validation;function C(e,c,u,r){var d=this,p=this._opts,h=[void 0],f={},l=[],t={},m=[],a={},v=[],s=function(e,r,t){var a=L.call(this,e,r,t);return 0<=a?{index:a,compiling:!0}:{index:a=this._compilations.length,compiling:!(this._compilations[a]={schema:e,root:r,baseId:t})}}.call(this,e,c=c||{schema:e,refVal:h,refs:f},r),o=this._compilations[s.index];if(s.compiling)return o.callValidate=P;var y=this._formats,g=this.RULES;try{var i=E(e,c,u,r);o.validate=i;var n=o.callValidate;return n&&(n.schema=i.schema,n.errors=null,n.refs=i.refs,n.refVal=i.refVal,n.root=i.root,n.$async=i.$async,p.sourceCode&&(n.source=i.source)),i}finally{(function(e,r,t){var a=L.call(this,e,r,t);0<=a&&this._compilations.splice(a,1)}).call(this,e,c,r)}function P(){var e=o.validate,r=e.apply(this,arguments);return P.errors=e.errors,r}function E(e,r,t,a){var s=!r||r&&r.schema==e;if(r.schema!=c.schema)return C.call(d,e,r,t,a);var o=!0===e.$async,i=O({isTop:!0,schema:e,isRoot:s,baseId:a,root:r,schemaPath:"",errSchemaPath:"#",errorPath:'""',MissingRefError:j.MissingRef,RULES:g,validate:O,util:$,resolve:R,resolveRef:w,usePattern:_,useDefault:F,useCustomRule:x,opts:p,formats:y,logger:d.logger,self:d}),i=Q(h,z)+Q(l,N)+Q(m,q)+Q(v,T)+i;p.processCode&&(i=p.processCode(i,e));try{var n=new Function("self","RULES","formats","root","refVal","defaults","customRules","equal","ucs2length","ValidationError",i)(d,g,y,c,h,m,v,A,I,k);h[0]=n}catch(e){throw d.logger.error("Error compiling schema, function code:",i),e}return n.schema=e,n.errors=null,n.refs=f,n.refVal=h,n.root=s?n:r,o&&(n.$async=!0),!0===p.sourceCode&&(n.source={code:i,patterns:l,defaults:m}),n}function w(e,r,t){r=R.url(e,r);var a,s,o=f[r];if(void 0!==o)return S(a=h[o],s="refVal["+o+"]");if(!t&&c.refs){var i=c.refs[r];if(void 0!==i)return S(a=c.refVal[i],s=b(r,a))}s=b(r);var n,l=R.call(d,E,c,r);if(void 0!==l||(n=u&&u[r])&&(l=R.inlineRef(n,p.inlineRefs)?n:C.call(d,n,c,u,e)),void 0!==l)return S(h[f[r]]=l,s);delete f[r]}function b(e,r){var t=h.length;return h[t]=r,"refVal"+(f[e]=t)}function S(e,r){return"object"==typeof e||"boolean"==typeof e?{code:r,schema:e,inline:!0}:{code:r,$async:e&&!!e.$async}}function _(e){var r=t[e];return void 0===r&&(r=t[e]=l.length,l[r]=e),"pattern"+r}function F(e){switch(typeof e){case"boolean":case"number":return""+e;case"string":return $.toQuotedString(e);case"object":if(null===e)return"null";var r=D(e),t=a[r];return void 0===t&&(t=a[r]=m.length,m[t]=e),"default"+t}}function x(e,r,t,a){if(!1!==d._opts.validateSchema){var s=e.definition.dependencies;if(s&&!s.every(function(e){return Object.prototype.hasOwnProperty.call(t,e)}))throw new Error("parent schema must have all required keywords: "+s.join(","));var o=e.definition.validateSchema;if(o)if(!o(r)){var i="keyword schema is invalid: "+d.errorsText(o.errors);if("log"!=d._opts.validateSchema)throw new Error(i);d.logger.error(i)}}var n,l=e.definition.compile,c=e.definition.inline,u=e.definition.macro;if(l)n=l.call(d,r,t,a);else if(u)n=u.call(d,r,t,a),!1!==p.validateSchema&&d.validateSchema(n,!0);else if(c)n=c.call(d,a,e.keyword,r,t);else if(!(n=e.definition.validate))return;if(void 0===n)throw new Error('custom keyword "'+e.keyword+'"failed to compile');var h=v.length;return{code:"customRule"+h,validate:v[h]=n}}}function L(e,r,t){for(var a=0;a",_=P?">":"<",F=void 0;if(!y&&"number"!=typeof d&&void 0!==d)throw new Error(r+" must be number");if(!b&&void 0!==w&&"number"!=typeof w&&"boolean"!=typeof w)throw new Error(E+" must be number or boolean");b?(o="exclIsNumber"+u,i="' + "+(n="op"+u)+" + '",c+=" var schemaExcl"+u+" = "+(t=e.util.getData(w.$data,h,e.dataPathArr))+"; ",F=E,(l=l||[]).push(c+=" var "+(a="exclusive"+u)+"; var "+(s="exclType"+u)+" = typeof "+(t="schemaExcl"+u)+"; if ("+s+" != 'boolean' && "+s+" != 'undefined' && "+s+" != 'number') { "),c="",!1!==e.createErrors?(c+=" { keyword: '"+(F||"_exclusiveLimit")+"' , dataPath: (dataPath || '') + "+e.errorPath+" , schemaPath: "+e.util.toQuotedString(f)+" , params: {} ",!1!==e.opts.messages&&(c+=" , message: '"+E+" should be boolean' "),e.opts.verbose&&(c+=" , schema: validate.schema"+p+" , parentSchema: validate.schema"+e.schemaPath+" , data: "+v+" "),c+=" } "):c+=" {} ",x=c,c=l.pop(),c+=!e.compositeRule&&m?e.async?" throw new ValidationError(["+x+"]); ":" validate.errors = ["+x+"]; return false; ":" var err = "+x+"; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ",c+=" } else if ( ",y&&(c+=" ("+g+" !== undefined && typeof "+g+" != 'number') || "),c+=" "+s+" == 'number' ? ( ("+a+" = "+g+" === undefined || "+t+" "+S+"= "+g+") ? "+v+" "+_+"= "+t+" : "+v+" "+_+" "+g+" ) : ( ("+a+" = "+t+" === true) ? "+v+" "+_+"= "+g+" : "+v+" "+_+" "+g+" ) || "+v+" !== "+v+") { var op"+u+" = "+a+" ? '"+S+"' : '"+S+"='; ",void 0===d&&(f=e.errSchemaPath+"/"+(F=E),g=t,y=b)):(i=S,(o="number"==typeof w)&&y?(n="'"+i+"'",c+=" if ( ",y&&(c+=" ("+g+" !== undefined && typeof "+g+" != 'number') || "),c+=" ( "+g+" === undefined || "+w+" "+S+"= "+g+" ? "+v+" "+_+"= "+w+" : "+v+" "+_+" "+g+" ) || "+v+" !== "+v+") { "):(o&&void 0===d?(a=!0,f=e.errSchemaPath+"/"+(F=E),g=w,_+="="):(o&&(g=Math[P?"min":"max"](w,d)),w===(!o||g)?(a=!0,f=e.errSchemaPath+"/"+(F=E),_+="="):(a=!1,i+="=")),n="'"+i+"'",c+=" if ( ",y&&(c+=" ("+g+" !== undefined && typeof "+g+" != 'number') || "),c+=" "+v+" "+_+" "+g+" || "+v+" !== "+v+") { ")),F=F||r,(l=l||[]).push(c),c="",!1!==e.createErrors?(c+=" { keyword: '"+(F||"_limit")+"' , dataPath: (dataPath || '') + "+e.errorPath+" , schemaPath: "+e.util.toQuotedString(f)+" , params: { comparison: "+n+", limit: "+g+", exclusive: "+a+" } ",!1!==e.opts.messages&&(c+=" , message: 'should be "+i+" ",c+=y?"' + "+g:g+"'"),e.opts.verbose&&(c+=" , schema: ",c+=y?"validate.schema"+p:""+d,c+=" , parentSchema: validate.schema"+e.schemaPath+" , data: "+v+" "),c+=" } "):c+=" {} ";var x=c;return c=l.pop(),c+=!e.compositeRule&&m?e.async?" throw new ValidationError(["+x+"]); ":" validate.errors = ["+x+"]; return false; ":" var err = "+x+"; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ",c+=" } ",m&&(c+=" else { "),c}},{}],14:[function(e,r,t){"use strict";r.exports=function(e,r){var t=" ",a=e.level,s=e.dataLevel,o=e.schema[r],i=e.schemaPath+e.util.getProperty(r),n=e.errSchemaPath+"/"+r,l=!e.opts.allErrors,c="data"+(s||""),u=e.opts.$data&&o&&o.$data,h=u?(t+=" var schema"+a+" = "+e.util.getData(o.$data,s,e.dataPathArr)+"; ","schema"+a):o;if(!u&&"number"!=typeof o)throw new Error(r+" must be number");t+="if ( ",u&&(t+=" ("+h+" !== undefined && typeof "+h+" != 'number') || ");var d=r,p=p||[];p.push(t+=" "+c+".length "+("maxItems"==r?">":"<")+" "+h+") { "),t="",!1!==e.createErrors?(t+=" { keyword: '"+(d||"_limitItems")+"' , dataPath: (dataPath || '') + "+e.errorPath+" , schemaPath: "+e.util.toQuotedString(n)+" , params: { limit: "+h+" } ",!1!==e.opts.messages&&(t+=" , message: 'should NOT have ",t+="maxItems"==r?"more":"fewer",t+=" than ",t+=u?"' + "+h+" + '":""+o,t+=" items' "),e.opts.verbose&&(t+=" , schema: ",t+=u?"validate.schema"+i:""+o,t+=" , parentSchema: validate.schema"+e.schemaPath+" , data: "+c+" "),t+=" } "):t+=" {} ";var f=t,t=p.pop();return t+=!e.compositeRule&&l?e.async?" throw new ValidationError(["+f+"]); ":" validate.errors = ["+f+"]; return false; ":" var err = "+f+"; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ",t+="} ",l&&(t+=" else { "),t}},{}],15:[function(e,r,t){"use strict";r.exports=function(e,r){var t=" ",a=e.level,s=e.dataLevel,o=e.schema[r],i=e.schemaPath+e.util.getProperty(r),n=e.errSchemaPath+"/"+r,l=!e.opts.allErrors,c="data"+(s||""),u=e.opts.$data&&o&&o.$data,h=u?(t+=" var schema"+a+" = "+e.util.getData(o.$data,s,e.dataPathArr)+"; ","schema"+a):o;if(!u&&"number"!=typeof o)throw new Error(r+" must be number");t+="if ( ",u&&(t+=" ("+h+" !== undefined && typeof "+h+" != 'number') || "),t+=!1===e.opts.unicode?" "+c+".length ":" ucs2length("+c+") ";var d=r,p=p||[];p.push(t+=" "+("maxLength"==r?">":"<")+" "+h+") { "),t="",!1!==e.createErrors?(t+=" { keyword: '"+(d||"_limitLength")+"' , dataPath: (dataPath || '') + "+e.errorPath+" , schemaPath: "+e.util.toQuotedString(n)+" , params: { limit: "+h+" } ",!1!==e.opts.messages&&(t+=" , message: 'should NOT be ",t+="maxLength"==r?"longer":"shorter",t+=" than ",t+=u?"' + "+h+" + '":""+o,t+=" characters' "),e.opts.verbose&&(t+=" , schema: ",t+=u?"validate.schema"+i:""+o,t+=" , parentSchema: validate.schema"+e.schemaPath+" , data: "+c+" "),t+=" } "):t+=" {} ";var f=t,t=p.pop();return t+=!e.compositeRule&&l?e.async?" throw new ValidationError(["+f+"]); ":" validate.errors = ["+f+"]; return false; ":" var err = "+f+"; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ",t+="} ",l&&(t+=" else { "),t}},{}],16:[function(e,r,t){"use strict";r.exports=function(e,r){var t=" ",a=e.level,s=e.dataLevel,o=e.schema[r],i=e.schemaPath+e.util.getProperty(r),n=e.errSchemaPath+"/"+r,l=!e.opts.allErrors,c="data"+(s||""),u=e.opts.$data&&o&&o.$data,h=u?(t+=" var schema"+a+" = "+e.util.getData(o.$data,s,e.dataPathArr)+"; ","schema"+a):o;if(!u&&"number"!=typeof o)throw new Error(r+" must be number");t+="if ( ",u&&(t+=" ("+h+" !== undefined && typeof "+h+" != 'number') || ");var d=r,p=p||[];p.push(t+=" Object.keys("+c+").length "+("maxProperties"==r?">":"<")+" "+h+") { "),t="",!1!==e.createErrors?(t+=" { keyword: '"+(d||"_limitProperties")+"' , dataPath: (dataPath || '') + "+e.errorPath+" , schemaPath: "+e.util.toQuotedString(n)+" , params: { limit: "+h+" } ",!1!==e.opts.messages&&(t+=" , message: 'should NOT have ",t+="maxProperties"==r?"more":"fewer",t+=" than ",t+=u?"' + "+h+" + '":""+o,t+=" properties' "),e.opts.verbose&&(t+=" , schema: ",t+=u?"validate.schema"+i:""+o,t+=" , parentSchema: validate.schema"+e.schemaPath+" , data: "+c+" "),t+=" } "):t+=" {} ";var f=t,t=p.pop();return t+=!e.compositeRule&&l?e.async?" throw new ValidationError(["+f+"]); ":" validate.errors = ["+f+"]; return false; ":" var err = "+f+"; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ",t+="} ",l&&(t+=" else { "),t}},{}],17:[function(e,r,t){"use strict";r.exports=function(e,r){var t=" ",a=e.schema[r],s=e.schemaPath+e.util.getProperty(r),o=e.errSchemaPath+"/"+r,i=!e.opts.allErrors,n=e.util.copy(e),l="";n.level++;var c="valid"+n.level,u=n.baseId,h=!0,d=a;if(d)for(var p,f=-1,m=d.length-1;f "+_+") { ",x=c+"["+_+"]",d.schema=$,d.schemaPath=i+"["+_+"]",d.errSchemaPath=n+"/"+_,d.errorPath=e.util.getPathExpr(e.errorPath,_,e.opts.jsonPointers,!0),d.dataPathArr[v]=_,R=e.validate(d),d.baseId=g,e.util.varOccurences(R,y)<2?t+=" "+e.util.varReplace(R,y,x)+" ":t+=" var "+y+" = "+x+"; "+R+" ",t+=" } ",l&&(t+=" if ("+f+") { ",p+="}"))}"object"==typeof b&&(e.opts.strictKeywords?"object"==typeof b&&0 "+o.length+") { for (var "+m+" = "+o.length+"; "+m+" < "+c+".length; "+m+"++) { ",d.errorPath=e.util.getPathExpr(e.errorPath,m,e.opts.jsonPointers,!0),x=c+"["+m+"]",d.dataPathArr[v]=m,R=e.validate(d),d.baseId=g,e.util.varOccurences(R,y)<2?t+=" "+e.util.varReplace(R,y,x)+" ":t+=" var "+y+" = "+x+"; "+R+" ",l&&(t+=" if (!"+f+") break; "),t+=" } } ",l&&(t+=" if ("+f+") { ",p+="}"))}else{(e.opts.strictKeywords?"object"==typeof o&&0 1e-"+e.opts.multipleOfPrecision+" ":" division"+a+" !== parseInt(division"+a+") ",t+=" ) ",u&&(t+=" ) ");var d=d||[];d.push(t+=" ) { "),t="",!1!==e.createErrors?(t+=" { keyword: 'multipleOf' , dataPath: (dataPath || '') + "+e.errorPath+" , schemaPath: "+e.util.toQuotedString(n)+" , params: { multipleOf: "+h+" } ",!1!==e.opts.messages&&(t+=" , message: 'should be multiple of ",t+=u?"' + "+h:h+"'"),e.opts.verbose&&(t+=" , schema: ",t+=u?"validate.schema"+i:""+o,t+=" , parentSchema: validate.schema"+e.schemaPath+" , data: "+c+" "),t+=" } "):t+=" {} ";var p=t,t=d.pop();return t+=!e.compositeRule&&l?e.async?" throw new ValidationError(["+p+"]); ":" validate.errors = ["+p+"]; return false; ":" var err = "+p+"; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ",t+="} ",l&&(t+=" else { "),t}},{}],30:[function(e,r,t){"use strict";r.exports=function(e,r){var t=" ",a=e.level,s=e.dataLevel,o=e.schema[r],i=e.schemaPath+e.util.getProperty(r),n=e.errSchemaPath+"/"+r,l=!e.opts.allErrors,c="data"+(s||""),u="errs__"+a,h=e.util.copy(e);h.level++;var d,p,f,m,v="valid"+h.level;return(e.opts.strictKeywords?"object"==typeof o&&0 1) { ",t=e.schema.items&&e.schema.items.type,a=Array.isArray(t),!t||"object"==t||"array"==t||a&&(0<=t.indexOf("object")||0<=t.indexOf("array"))?i+=" outer: for (;i--;) { for (j = i; j--;) { if (equal("+p+"[i], "+p+"[j])) { "+f+" = false; break outer; } } } ":(i+=" var itemIndices = {}, item; for (;i--;) { var item = "+p+"[i]; ",i+=" if ("+e.util["checkDataType"+(a?"s":"")](t,"item",e.opts.strictNumbers,!0)+") continue; ",a&&(i+=" if (typeof item == 'string') item = '\"' + item; "),i+=" if (typeof itemIndices[item] == 'number') { "+f+" = false; j = itemIndices[item]; break; } itemIndices[item] = i; } "),i+=" } ",m&&(i+=" } "),(s=s||[]).push(i+=" if (!"+f+") { "),i="",!1!==e.createErrors?(i+=" { keyword: 'uniqueItems' , dataPath: (dataPath || '') + "+e.errorPath+" , schemaPath: "+e.util.toQuotedString(h)+" , params: { i: i, j: j } ",!1!==e.opts.messages&&(i+=" , message: 'should NOT have duplicate items (items ## ' + j + ' and ' + i + ' are identical)' "),e.opts.verbose&&(i+=" , schema: ",i+=m?"validate.schema"+u:""+c,i+=" , parentSchema: validate.schema"+e.schemaPath+" , data: "+p+" "),i+=" } "):i+=" {} ",o=i,i=s.pop(),i+=!e.compositeRule&&d?e.async?" throw new ValidationError(["+o+"]); ":" validate.errors = ["+o+"]; return false; ":" var err = "+o+"; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ",i+=" } ",d&&(i+=" else { ")):d&&(i+=" if (true) { "),i}},{}],38:[function(e,r,t){"use strict";r.exports=function(a,e){var r="",t=!0===a.schema.$async,s=a.util.schemaHasRulesExcept(a.schema,a.RULES.all,"$ref"),o=a.self._getId(a.schema);if(a.opts.strictKeywords){var i=a.util.schemaUnknownRules(a.schema,a.RULES.keywords);if(i){var n="unknown keyword: "+i;if("log"!==a.opts.strictKeywords)throw new Error(n);a.logger.warn(n)}}if(a.isTop&&(r+=" var validate = ",t&&(a.async=!0,r+="async "),r+="function(data, dataPath, parentData, parentDataProperty, rootData) { 'use strict'; ",o&&(a.opts.sourceCode||a.opts.processCode)&&(r+=" /*# sourceURL="+o+" */ ")),"boolean"==typeof a.schema||!s&&!a.schema.$ref){var l=a.level,c=a.dataLevel,u=a.schema[e="false schema"],h=a.schemaPath+a.util.getProperty(e),d=a.errSchemaPath+"/"+e,p=!a.opts.allErrors,f="data"+(c||""),m="valid"+l;return!1===a.schema?(a.isTop?p=!0:r+=" var "+m+" = false; ",(U=U||[]).push(r),r="",!1!==a.createErrors?(r+=" { keyword: 'false schema' , dataPath: (dataPath || '') + "+a.errorPath+" , schemaPath: "+a.util.toQuotedString(d)+" , params: {} ",!1!==a.opts.messages&&(r+=" , message: 'boolean schema is false' "),a.opts.verbose&&(r+=" , schema: false , parentSchema: validate.schema"+a.schemaPath+" , data: "+f+" "),r+=" } "):r+=" {} ",D=r,r=U.pop(),r+=!a.compositeRule&&p?a.async?" throw new ValidationError(["+D+"]); ":" validate.errors = ["+D+"]; return false; ":" var err = "+D+"; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; "):r+=a.isTop?t?" return data; ":" validate.errors = null; return true; ":" var "+m+" = true; ",a.isTop&&(r+=" }; return validate; "),r}if(a.isTop){var v=a.isTop,l=a.level=0,c=a.dataLevel=0,f="data";if(a.rootId=a.resolve.fullPath(a.self._getId(a.root.schema)),a.baseId=a.baseId||a.rootId,delete a.isTop,a.dataPathArr=[""],void 0!==a.schema.default&&a.opts.useDefaults&&a.opts.strictDefaults){var y="default is ignored in the schema root";if("log"!==a.opts.strictDefaults)throw new Error(y);a.logger.warn(y)}r+=" var vErrors = null; ",r+=" var errors = 0; ",r+=" if (rootData === undefined) rootData = data; "}else{l=a.level,f="data"+((c=a.dataLevel)||"");if(o&&(a.baseId=a.resolve.url(a.baseId,o)),t&&!a.async)throw new Error("async schema in sync schema");r+=" var errs_"+l+" = errors;"}var g,m="valid"+l,p=!a.opts.allErrors,P="",E="",w=a.schema.type,b=Array.isArray(w);if(w&&a.opts.nullable&&!0===a.schema.nullable&&(b?-1==w.indexOf("null")&&(w=w.concat("null")):"null"!=w&&(w=[w,"null"],b=!0)),b&&1==w.length&&(w=w[0],b=!1),a.schema.$ref&&s){if("fail"==a.opts.extendRefs)throw new Error('$ref: validation keywords used in schema at path "'+a.errSchemaPath+'" (see option extendRefs)');!0!==a.opts.extendRefs&&(s=!1,a.logger.warn('$ref: keywords ignored in schema at path "'+a.errSchemaPath+'"'))}if(a.schema.$comment&&a.opts.$comment&&(r+=" "+a.RULES.all.$comment.code(a,"$comment")),w){a.opts.coerceTypes&&(g=a.util.coerceToTypes(a.opts.coerceTypes,w));var S=a.RULES.types[w];if(g||b||!0===S||S&&!Z(S)){h=a.schemaPath+".type",d=a.errSchemaPath+"/type",h=a.schemaPath+".type",d=a.errSchemaPath+"/type";if(r+=" if ("+a.util[b?"checkDataTypes":"checkDataType"](w,f,a.opts.strictNumbers,!0)+") { ",g){var _="dataType"+l,F="coerced"+l;r+=" var "+_+" = typeof "+f+"; var "+F+" = undefined; ","array"==a.opts.coerceTypes&&(r+=" if ("+_+" == 'object' && Array.isArray("+f+") && "+f+".length == 1) { "+f+" = "+f+"[0]; "+_+" = typeof "+f+"; if ("+a.util.checkDataType(a.schema.type,f,a.opts.strictNumbers)+") "+F+" = "+f+"; } "),r+=" if ("+F+" !== undefined) ; ";var x=g;if(x)for(var R,$=-1,j=x.length-1;$= 0x80 (not a basic code point)","invalid-input":"Invalid input"},k=Math.floor,C=String.fromCharCode;function L(e){throw new RangeError(i[e])}function n(e,r){var t=e.split("@"),a="";return 1>1,e+=k(e/r);455k((A-a)/h))&&L("overflow"),a+=p*h;var f=d<=o?1:o+26<=d?26:d-o;if(pk(A/m)&&L("overflow"),h*=m}var v=r.length+1,o=z(a-u,v,0==u);k(a/v)>A-s&&L("overflow"),s+=k(a/v),a%=v,r.splice(a++,0,s)}return String.fromCodePoint.apply(String,r)}function c(e){var r=[],t=(e=N(e)).length,a=128,s=0,o=72,i=!0,n=!1,l=void 0;try{for(var c,u=e[Symbol.iterator]();!(i=(c=u.next()).done);i=!0){var h=c.value;h<128&&r.push(C(h))}}catch(e){n=!0,l=e}finally{try{!i&&u.return&&u.return()}finally{if(n)throw l}}var d=r.length,p=d;for(d&&r.push("-");pk((A-s)/w)&&L("overflow"),s+=(f-a)*w,a=f;var b=!0,S=!1,_=void 0;try{for(var F,x=e[Symbol.iterator]();!(b=(F=x.next()).done);b=!0){var R=F.value;if(RA&&L("overflow"),R==a){for(var $=s,j=36;;j+=36){var D=j<=o?1:o+26<=j?26:j-o;if($>6|192).toString(16).toUpperCase()+"%"+(63&r|128).toString(16).toUpperCase():"%"+(r>>12|224).toString(16).toUpperCase()+"%"+(r>>6&63|128).toString(16).toUpperCase()+"%"+(63&r|128).toString(16).toUpperCase()}function p(e){for(var r="",t=0,a=e.length;tA-Z\\x5E-\\x7E]",'[\\"\\\\]')),Y=new RegExp(K,"g"),W=new RegExp("(?:(?:%[EFef][0-9A-Fa-f]%[0-9A-Fa-f][0-9A-Fa-f]%[0-9A-Fa-f][0-9A-Fa-f])|(?:%[89A-Fa-f][0-9A-Fa-f]%[0-9A-Fa-f][0-9A-Fa-f])|(?:%[0-9A-Fa-f][0-9A-Fa-f]))","g"),X=new RegExp(J("[^]","[A-Za-z0-9\\!\\$\\%\\'\\*\\+\\-\\^\\_\\`\\{\\|\\}\\~]","[\\.]",'[\\"]',G),"g"),ee=new RegExp(J("[^]",K,"[\\!\\$\\'\\(\\)\\*\\+\\,\\;\\:\\@]"),"g"),re=ee;function te(e){var r=p(e);return r.match(Y)?r:e}var ae={scheme:"mailto",parse:function(e,r){var t=e,a=t.to=t.path?t.path.split(","):[];if(t.path=void 0,t.query){for(var s=!1,o={},i=t.query.split("&"),n=0,l=i.length;n); + + message: string; + errors: Array; + ajv: true; + validation: true; + } + + class MissingRefError extends Error { + constructor(baseId: string, ref: string, message?: string); + static message: (baseId: string, ref: string) => string; + + message: string; + missingRef: string; + missingSchema: string; + } +} + +declare namespace ajv { + type ValidationError = AjvErrors.ValidationError; + + type MissingRefError = AjvErrors.MissingRefError; + + interface Ajv { + /** + * Validate data using schema + * Schema will be compiled and cached (using serialized JSON as key, [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize by default). + * @param {string|object|Boolean} schemaKeyRef key, ref or schema object + * @param {Any} data to be validated + * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`). + */ + validate(schemaKeyRef: object | string | boolean, data: any): boolean | PromiseLike; + /** + * Create validating function for passed schema. + * @param {object|Boolean} schema schema object + * @return {Function} validating function + */ + compile(schema: object | boolean): ValidateFunction; + /** + * Creates validating function for passed schema with asynchronous loading of missing schemas. + * `loadSchema` option should be a function that accepts schema uri and node-style callback. + * @this Ajv + * @param {object|Boolean} schema schema object + * @param {Boolean} meta optional true to compile meta-schema; this parameter can be skipped + * @param {Function} callback optional node-style callback, it is always called with 2 parameters: error (or null) and validating function. + * @return {PromiseLike} validating function + */ + compileAsync(schema: object | boolean, meta?: Boolean, callback?: (err: Error, validate: ValidateFunction) => any): PromiseLike; + /** + * Adds schema to the instance. + * @param {object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored. + * @param {string} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`. + * @return {Ajv} this for method chaining + */ + addSchema(schema: Array | object, key?: string): Ajv; + /** + * Add schema that will be used to validate other schemas + * options in META_IGNORE_OPTIONS are alway set to false + * @param {object} schema schema object + * @param {string} key optional schema key + * @return {Ajv} this for method chaining + */ + addMetaSchema(schema: object, key?: string): Ajv; + /** + * Validate schema + * @param {object|Boolean} schema schema to validate + * @return {Boolean} true if schema is valid + */ + validateSchema(schema: object | boolean): boolean; + /** + * Get compiled schema from the instance by `key` or `ref`. + * @param {string} keyRef `key` that was passed to `addSchema` or full schema reference (`schema.id` or resolved id). + * @return {Function} schema validating function (with property `schema`). Returns undefined if keyRef can't be resolved to an existing schema. + */ + getSchema(keyRef: string): ValidateFunction | undefined; + /** + * Remove cached schema(s). + * If no parameter is passed all schemas but meta-schemas are removed. + * If RegExp is passed all schemas with key/id matching pattern but meta-schemas are removed. + * Even if schema is referenced by other schemas it still can be removed as other schemas have local references. + * @param {string|object|RegExp|Boolean} schemaKeyRef key, ref, pattern to match key/ref or schema object + * @return {Ajv} this for method chaining + */ + removeSchema(schemaKeyRef?: object | string | RegExp | boolean): Ajv; + /** + * Add custom format + * @param {string} name format name + * @param {string|RegExp|Function} format string is converted to RegExp; function should return boolean (true when valid) + * @return {Ajv} this for method chaining + */ + addFormat(name: string, format: FormatValidator | FormatDefinition): Ajv; + /** + * Define custom keyword + * @this Ajv + * @param {string} keyword custom keyword, should be a valid identifier, should be different from all standard, custom and macro keywords. + * @param {object} definition keyword definition object with properties `type` (type(s) which the keyword applies to), `validate` or `compile`. + * @return {Ajv} this for method chaining + */ + addKeyword(keyword: string, definition: KeywordDefinition): Ajv; + /** + * Get keyword definition + * @this Ajv + * @param {string} keyword pre-defined or custom keyword. + * @return {object|Boolean} custom keyword definition, `true` if it is a predefined keyword, `false` otherwise. + */ + getKeyword(keyword: string): object | boolean; + /** + * Remove keyword + * @this Ajv + * @param {string} keyword pre-defined or custom keyword. + * @return {Ajv} this for method chaining + */ + removeKeyword(keyword: string): Ajv; + /** + * Validate keyword + * @this Ajv + * @param {object} definition keyword definition object + * @param {boolean} throwError true to throw exception if definition is invalid + * @return {boolean} validation result + */ + validateKeyword(definition: KeywordDefinition, throwError: boolean): boolean; + /** + * Convert array of error message objects to string + * @param {Array} errors optional array of validation errors, if not passed errors from the instance are used. + * @param {object} options optional options with properties `separator` and `dataVar`. + * @return {string} human readable string with all errors descriptions + */ + errorsText(errors?: Array | null, options?: ErrorsTextOptions): string; + errors?: Array | null; + _opts: Options; + } + + interface CustomLogger { + log(...args: any[]): any; + warn(...args: any[]): any; + error(...args: any[]): any; + } + + interface ValidateFunction { + ( + data: any, + dataPath?: string, + parentData?: object | Array, + parentDataProperty?: string | number, + rootData?: object | Array + ): boolean | PromiseLike; + schema?: object | boolean; + errors?: null | Array; + refs?: object; + refVal?: Array; + root?: ValidateFunction | object; + $async?: true; + source?: object; + } + + interface Options { + $data?: boolean; + allErrors?: boolean; + verbose?: boolean; + jsonPointers?: boolean; + uniqueItems?: boolean; + unicode?: boolean; + format?: false | string; + formats?: object; + keywords?: object; + unknownFormats?: true | string[] | 'ignore'; + schemas?: Array | object; + schemaId?: '$id' | 'id' | 'auto'; + missingRefs?: true | 'ignore' | 'fail'; + extendRefs?: true | 'ignore' | 'fail'; + loadSchema?: (uri: string, cb?: (err: Error, schema: object) => void) => PromiseLike; + removeAdditional?: boolean | 'all' | 'failing'; + useDefaults?: boolean | 'empty' | 'shared'; + coerceTypes?: boolean | 'array'; + strictDefaults?: boolean | 'log'; + strictKeywords?: boolean | 'log'; + strictNumbers?: boolean; + async?: boolean | string; + transpile?: string | ((code: string) => string); + meta?: boolean | object; + validateSchema?: boolean | 'log'; + addUsedSchema?: boolean; + inlineRefs?: boolean | number; + passContext?: boolean; + loopRequired?: number; + ownProperties?: boolean; + multipleOfPrecision?: boolean | number; + errorDataPath?: string, + messages?: boolean; + sourceCode?: boolean; + processCode?: (code: string, schema: object) => string; + cache?: object; + logger?: CustomLogger | false; + nullable?: boolean; + serialize?: ((schema: object | boolean) => any) | false; + } + + type FormatValidator = string | RegExp | ((data: string) => boolean | PromiseLike); + type NumberFormatValidator = ((data: number) => boolean | PromiseLike); + + interface NumberFormatDefinition { + type: "number", + validate: NumberFormatValidator; + compare?: (data1: number, data2: number) => number; + async?: boolean; + } + + interface StringFormatDefinition { + type?: "string", + validate: FormatValidator; + compare?: (data1: string, data2: string) => number; + async?: boolean; + } + + type FormatDefinition = NumberFormatDefinition | StringFormatDefinition; + + interface KeywordDefinition { + type?: string | Array; + async?: boolean; + $data?: boolean; + errors?: boolean | string; + metaSchema?: object; + // schema: false makes validate not to expect schema (ValidateFunction) + schema?: boolean; + statements?: boolean; + dependencies?: Array; + modifying?: boolean; + valid?: boolean; + // one and only one of the following properties should be present + validate?: SchemaValidateFunction | ValidateFunction; + compile?: (schema: any, parentSchema: object, it: CompilationContext) => ValidateFunction; + macro?: (schema: any, parentSchema: object, it: CompilationContext) => object | boolean; + inline?: (it: CompilationContext, keyword: string, schema: any, parentSchema: object) => string; + } + + interface CompilationContext { + level: number; + dataLevel: number; + dataPathArr: string[]; + schema: any; + schemaPath: string; + baseId: string; + async: boolean; + opts: Options; + formats: { + [index: string]: FormatDefinition | undefined; + }; + keywords: { + [index: string]: KeywordDefinition | undefined; + }; + compositeRule: boolean; + validate: (schema: object) => boolean; + util: { + copy(obj: any, target?: any): any; + toHash(source: string[]): { [index: string]: true | undefined }; + equal(obj: any, target: any): boolean; + getProperty(str: string): string; + schemaHasRules(schema: object, rules: any): string; + escapeQuotes(str: string): string; + toQuotedString(str: string): string; + getData(jsonPointer: string, dataLevel: number, paths: string[]): string; + escapeJsonPointer(str: string): string; + unescapeJsonPointer(str: string): string; + escapeFragment(str: string): string; + unescapeFragment(str: string): string; + }; + self: Ajv; + } + + interface SchemaValidateFunction { + ( + schema: any, + data: any, + parentSchema?: object, + dataPath?: string, + parentData?: object | Array, + parentDataProperty?: string | number, + rootData?: object | Array + ): boolean | PromiseLike; + errors?: Array; + } + + interface ErrorsTextOptions { + separator?: string; + dataVar?: string; + } + + interface ErrorObject { + keyword: string; + dataPath: string; + schemaPath: string; + params: ErrorParameters; + // Added to validation errors of propertyNames keyword schema + propertyName?: string; + // Excluded if messages set to false. + message?: string; + // These are added with the `verbose` option. + schema?: any; + parentSchema?: object; + data?: any; + } + + type ErrorParameters = RefParams | LimitParams | AdditionalPropertiesParams | + DependenciesParams | FormatParams | ComparisonParams | + MultipleOfParams | PatternParams | RequiredParams | + TypeParams | UniqueItemsParams | CustomParams | + PatternRequiredParams | PropertyNamesParams | + IfParams | SwitchParams | NoParams | EnumParams; + + interface RefParams { + ref: string; + } + + interface LimitParams { + limit: number; + } + + interface AdditionalPropertiesParams { + additionalProperty: string; + } + + interface DependenciesParams { + property: string; + missingProperty: string; + depsCount: number; + deps: string; + } + + interface FormatParams { + format: string + } + + interface ComparisonParams { + comparison: string; + limit: number | string; + exclusive: boolean; + } + + interface MultipleOfParams { + multipleOf: number; + } + + interface PatternParams { + pattern: string; + } + + interface RequiredParams { + missingProperty: string; + } + + interface TypeParams { + type: string; + } + + interface UniqueItemsParams { + i: number; + j: number; + } + + interface CustomParams { + keyword: string; + } + + interface PatternRequiredParams { + missingPattern: string; + } + + interface PropertyNamesParams { + propertyName: string; + } + + interface IfParams { + failingKeyword: string; + } + + interface SwitchParams { + caseIndex: number; + } + + interface NoParams { } + + interface EnumParams { + allowedValues: Array; + } +} + +export = ajv; diff --git a/tunestats/app/api/node_modules/ajv/lib/ajv.js b/tunestats/app/api/node_modules/ajv/lib/ajv.js new file mode 100644 index 0000000..06a45b6 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/ajv.js @@ -0,0 +1,506 @@ +'use strict'; + +var compileSchema = require('./compile') + , resolve = require('./compile/resolve') + , Cache = require('./cache') + , SchemaObject = require('./compile/schema_obj') + , stableStringify = require('fast-json-stable-stringify') + , formats = require('./compile/formats') + , rules = require('./compile/rules') + , $dataMetaSchema = require('./data') + , util = require('./compile/util'); + +module.exports = Ajv; + +Ajv.prototype.validate = validate; +Ajv.prototype.compile = compile; +Ajv.prototype.addSchema = addSchema; +Ajv.prototype.addMetaSchema = addMetaSchema; +Ajv.prototype.validateSchema = validateSchema; +Ajv.prototype.getSchema = getSchema; +Ajv.prototype.removeSchema = removeSchema; +Ajv.prototype.addFormat = addFormat; +Ajv.prototype.errorsText = errorsText; + +Ajv.prototype._addSchema = _addSchema; +Ajv.prototype._compile = _compile; + +Ajv.prototype.compileAsync = require('./compile/async'); +var customKeyword = require('./keyword'); +Ajv.prototype.addKeyword = customKeyword.add; +Ajv.prototype.getKeyword = customKeyword.get; +Ajv.prototype.removeKeyword = customKeyword.remove; +Ajv.prototype.validateKeyword = customKeyword.validate; + +var errorClasses = require('./compile/error_classes'); +Ajv.ValidationError = errorClasses.Validation; +Ajv.MissingRefError = errorClasses.MissingRef; +Ajv.$dataMetaSchema = $dataMetaSchema; + +var META_SCHEMA_ID = 'http://json-schema.org/draft-07/schema'; + +var META_IGNORE_OPTIONS = [ 'removeAdditional', 'useDefaults', 'coerceTypes', 'strictDefaults' ]; +var META_SUPPORT_DATA = ['/properties']; + +/** + * Creates validator instance. + * Usage: `Ajv(opts)` + * @param {Object} opts optional options + * @return {Object} ajv instance + */ +function Ajv(opts) { + if (!(this instanceof Ajv)) return new Ajv(opts); + opts = this._opts = util.copy(opts) || {}; + setLogger(this); + this._schemas = {}; + this._refs = {}; + this._fragments = {}; + this._formats = formats(opts.format); + + this._cache = opts.cache || new Cache; + this._loadingSchemas = {}; + this._compilations = []; + this.RULES = rules(); + this._getId = chooseGetId(opts); + + opts.loopRequired = opts.loopRequired || Infinity; + if (opts.errorDataPath == 'property') opts._errorDataPathProperty = true; + if (opts.serialize === undefined) opts.serialize = stableStringify; + this._metaOpts = getMetaSchemaOptions(this); + + if (opts.formats) addInitialFormats(this); + if (opts.keywords) addInitialKeywords(this); + addDefaultMetaSchema(this); + if (typeof opts.meta == 'object') this.addMetaSchema(opts.meta); + if (opts.nullable) this.addKeyword('nullable', {metaSchema: {type: 'boolean'}}); + addInitialSchemas(this); +} + + + +/** + * Validate data using schema + * Schema will be compiled and cached (using serialized JSON as key. [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize. + * @this Ajv + * @param {String|Object} schemaKeyRef key, ref or schema object + * @param {Any} data to be validated + * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`). + */ +function validate(schemaKeyRef, data) { + var v; + if (typeof schemaKeyRef == 'string') { + v = this.getSchema(schemaKeyRef); + if (!v) throw new Error('no schema with key or ref "' + schemaKeyRef + '"'); + } else { + var schemaObj = this._addSchema(schemaKeyRef); + v = schemaObj.validate || this._compile(schemaObj); + } + + var valid = v(data); + if (v.$async !== true) this.errors = v.errors; + return valid; +} + + +/** + * Create validating function for passed schema. + * @this Ajv + * @param {Object} schema schema object + * @param {Boolean} _meta true if schema is a meta-schema. Used internally to compile meta schemas of custom keywords. + * @return {Function} validating function + */ +function compile(schema, _meta) { + var schemaObj = this._addSchema(schema, undefined, _meta); + return schemaObj.validate || this._compile(schemaObj); +} + + +/** + * Adds schema to the instance. + * @this Ajv + * @param {Object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored. + * @param {String} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`. + * @param {Boolean} _skipValidation true to skip schema validation. Used internally, option validateSchema should be used instead. + * @param {Boolean} _meta true if schema is a meta-schema. Used internally, addMetaSchema should be used instead. + * @return {Ajv} this for method chaining + */ +function addSchema(schema, key, _skipValidation, _meta) { + if (Array.isArray(schema)){ + for (var i=0; i} errors optional array of validation errors, if not passed errors from the instance are used. + * @param {Object} options optional options with properties `separator` and `dataVar`. + * @return {String} human readable string with all errors descriptions + */ +function errorsText(errors, options) { + errors = errors || this.errors; + if (!errors) return 'No errors'; + options = options || {}; + var separator = options.separator === undefined ? ', ' : options.separator; + var dataVar = options.dataVar === undefined ? 'data' : options.dataVar; + + var text = ''; + for (var i=0; i%\\^`{|}]|%[0-9a-f]{2})|\{[+#./;?&=,!@|]?(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?(?:,(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?)*\})*$/i; +// For the source: https://gist.github.com/dperini/729294 +// For test cases: https://mathiasbynens.be/demo/url-regex +// @todo Delete current URL in favour of the commented out URL rule when this issue is fixed https://github.com/eslint/eslint/issues/7983. +// var URL = /^(?:(?:https?|ftp):\/\/)(?:\S+(?::\S*)?@)?(?:(?!10(?:\.\d{1,3}){3})(?!127(?:\.\d{1,3}){3})(?!169\.254(?:\.\d{1,3}){2})(?!192\.168(?:\.\d{1,3}){2})(?!172\.(?:1[6-9]|2\d|3[0-1])(?:\.\d{1,3}){2})(?:[1-9]\d?|1\d\d|2[01]\d|22[0-3])(?:\.(?:1?\d{1,2}|2[0-4]\d|25[0-5])){2}(?:\.(?:[1-9]\d?|1\d\d|2[0-4]\d|25[0-4]))|(?:(?:[a-z\u{00a1}-\u{ffff}0-9]+-)*[a-z\u{00a1}-\u{ffff}0-9]+)(?:\.(?:[a-z\u{00a1}-\u{ffff}0-9]+-)*[a-z\u{00a1}-\u{ffff}0-9]+)*(?:\.(?:[a-z\u{00a1}-\u{ffff}]{2,})))(?::\d{2,5})?(?:\/[^\s]*)?$/iu; +var URL = /^(?:(?:http[s\u017F]?|ftp):\/\/)(?:(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+(?::(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?@)?(?:(?!10(?:\.[0-9]{1,3}){3})(?!127(?:\.[0-9]{1,3}){3})(?!169\.254(?:\.[0-9]{1,3}){2})(?!192\.168(?:\.[0-9]{1,3}){2})(?!172\.(?:1[6-9]|2[0-9]|3[01])(?:\.[0-9]{1,3}){2})(?:[1-9][0-9]?|1[0-9][0-9]|2[01][0-9]|22[0-3])(?:\.(?:1?[0-9]{1,2}|2[0-4][0-9]|25[0-5])){2}(?:\.(?:[1-9][0-9]?|1[0-9][0-9]|2[0-4][0-9]|25[0-4]))|(?:(?:(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-)*(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)(?:\.(?:(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-)*(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)*(?:\.(?:(?:[a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]){2,})))(?::[0-9]{2,5})?(?:\/(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?$/i; +var UUID = /^(?:urn:uuid:)?[0-9a-f]{8}-(?:[0-9a-f]{4}-){3}[0-9a-f]{12}$/i; +var JSON_POINTER = /^(?:\/(?:[^~/]|~0|~1)*)*$/; +var JSON_POINTER_URI_FRAGMENT = /^#(?:\/(?:[a-z0-9_\-.!$&'()*+,;:=@]|%[0-9a-f]{2}|~0|~1)*)*$/i; +var RELATIVE_JSON_POINTER = /^(?:0|[1-9][0-9]*)(?:#|(?:\/(?:[^~/]|~0|~1)*)*)$/; + + +module.exports = formats; + +function formats(mode) { + mode = mode == 'full' ? 'full' : 'fast'; + return util.copy(formats[mode]); +} + + +formats.fast = { + // date: http://tools.ietf.org/html/rfc3339#section-5.6 + date: /^\d\d\d\d-[0-1]\d-[0-3]\d$/, + // date-time: http://tools.ietf.org/html/rfc3339#section-5.6 + time: /^(?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)?$/i, + 'date-time': /^\d\d\d\d-[0-1]\d-[0-3]\d[t\s](?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)$/i, + // uri: https://github.com/mafintosh/is-my-json-valid/blob/master/formats.js + uri: /^(?:[a-z][a-z0-9+\-.]*:)(?:\/?\/)?[^\s]*$/i, + 'uri-reference': /^(?:(?:[a-z][a-z0-9+\-.]*:)?\/?\/)?(?:[^\\\s#][^\s#]*)?(?:#[^\\\s]*)?$/i, + 'uri-template': URITEMPLATE, + url: URL, + // email (sources from jsen validator): + // http://stackoverflow.com/questions/201323/using-a-regular-expression-to-validate-an-email-address#answer-8829363 + // http://www.w3.org/TR/html5/forms.html#valid-e-mail-address (search for 'willful violation') + email: /^[a-z0-9.!#$%&'*+/=?^_`{|}~-]+@[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?)*$/i, + hostname: HOSTNAME, + // optimized https://www.safaribooksonline.com/library/view/regular-expressions-cookbook/9780596802837/ch07s16.html + ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, + // optimized http://stackoverflow.com/questions/53497/regular-expression-that-matches-valid-ipv6-addresses + ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, + regex: regex, + // uuid: http://tools.ietf.org/html/rfc4122 + uuid: UUID, + // JSON-pointer: https://tools.ietf.org/html/rfc6901 + // uri fragment: https://tools.ietf.org/html/rfc3986#appendix-A + 'json-pointer': JSON_POINTER, + 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, + // relative JSON-pointer: http://tools.ietf.org/html/draft-luff-relative-json-pointer-00 + 'relative-json-pointer': RELATIVE_JSON_POINTER +}; + + +formats.full = { + date: date, + time: time, + 'date-time': date_time, + uri: uri, + 'uri-reference': URIREF, + 'uri-template': URITEMPLATE, + url: URL, + email: /^[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@(?:[a-z0-9](?:[a-z0-9-]*[a-z0-9])?\.)+[a-z0-9](?:[a-z0-9-]*[a-z0-9])?$/i, + hostname: HOSTNAME, + ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, + ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, + regex: regex, + uuid: UUID, + 'json-pointer': JSON_POINTER, + 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, + 'relative-json-pointer': RELATIVE_JSON_POINTER +}; + + +function isLeapYear(year) { + // https://tools.ietf.org/html/rfc3339#appendix-C + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +} + + +function date(str) { + // full-date from http://tools.ietf.org/html/rfc3339#section-5.6 + var matches = str.match(DATE); + if (!matches) return false; + + var year = +matches[1]; + var month = +matches[2]; + var day = +matches[3]; + + return month >= 1 && month <= 12 && day >= 1 && + day <= (month == 2 && isLeapYear(year) ? 29 : DAYS[month]); +} + + +function time(str, full) { + var matches = str.match(TIME); + if (!matches) return false; + + var hour = matches[1]; + var minute = matches[2]; + var second = matches[3]; + var timeZone = matches[5]; + return ((hour <= 23 && minute <= 59 && second <= 59) || + (hour == 23 && minute == 59 && second == 60)) && + (!full || timeZone); +} + + +var DATE_TIME_SEPARATOR = /t|\s/i; +function date_time(str) { + // http://tools.ietf.org/html/rfc3339#section-5.6 + var dateTime = str.split(DATE_TIME_SEPARATOR); + return dateTime.length == 2 && date(dateTime[0]) && time(dateTime[1], true); +} + + +var NOT_URI_FRAGMENT = /\/|:/; +function uri(str) { + // http://jmrware.com/articles/2009/uri_regexp/URI_regex.html + optional protocol + required "." + return NOT_URI_FRAGMENT.test(str) && URI.test(str); +} + + +var Z_ANCHOR = /[^\\]\\Z/; +function regex(str) { + if (Z_ANCHOR.test(str)) return false; + try { + new RegExp(str); + return true; + } catch(e) { + return false; + } +} diff --git a/tunestats/app/api/node_modules/ajv/lib/compile/index.js b/tunestats/app/api/node_modules/ajv/lib/compile/index.js new file mode 100644 index 0000000..97518c4 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/compile/index.js @@ -0,0 +1,387 @@ +'use strict'; + +var resolve = require('./resolve') + , util = require('./util') + , errorClasses = require('./error_classes') + , stableStringify = require('fast-json-stable-stringify'); + +var validateGenerator = require('../dotjs/validate'); + +/** + * Functions below are used inside compiled validations function + */ + +var ucs2length = util.ucs2length; +var equal = require('fast-deep-equal'); + +// this error is thrown by async schemas to return validation errors via exception +var ValidationError = errorClasses.Validation; + +module.exports = compile; + + +/** + * Compiles schema to validation function + * @this Ajv + * @param {Object} schema schema object + * @param {Object} root object with information about the root schema for this schema + * @param {Object} localRefs the hash of local references inside the schema (created by resolve.id), used for inline resolution + * @param {String} baseId base ID for IDs in the schema + * @return {Function} validation function + */ +function compile(schema, root, localRefs, baseId) { + /* jshint validthis: true, evil: true */ + /* eslint no-shadow: 0 */ + var self = this + , opts = this._opts + , refVal = [ undefined ] + , refs = {} + , patterns = [] + , patternsHash = {} + , defaults = [] + , defaultsHash = {} + , customRules = []; + + root = root || { schema: schema, refVal: refVal, refs: refs }; + + var c = checkCompiling.call(this, schema, root, baseId); + var compilation = this._compilations[c.index]; + if (c.compiling) return (compilation.callValidate = callValidate); + + var formats = this._formats; + var RULES = this.RULES; + + try { + var v = localCompile(schema, root, localRefs, baseId); + compilation.validate = v; + var cv = compilation.callValidate; + if (cv) { + cv.schema = v.schema; + cv.errors = null; + cv.refs = v.refs; + cv.refVal = v.refVal; + cv.root = v.root; + cv.$async = v.$async; + if (opts.sourceCode) cv.source = v.source; + } + return v; + } finally { + endCompiling.call(this, schema, root, baseId); + } + + /* @this {*} - custom context, see passContext option */ + function callValidate() { + /* jshint validthis: true */ + var validate = compilation.validate; + var result = validate.apply(this, arguments); + callValidate.errors = validate.errors; + return result; + } + + function localCompile(_schema, _root, localRefs, baseId) { + var isRoot = !_root || (_root && _root.schema == _schema); + if (_root.schema != root.schema) + return compile.call(self, _schema, _root, localRefs, baseId); + + var $async = _schema.$async === true; + + var sourceCode = validateGenerator({ + isTop: true, + schema: _schema, + isRoot: isRoot, + baseId: baseId, + root: _root, + schemaPath: '', + errSchemaPath: '#', + errorPath: '""', + MissingRefError: errorClasses.MissingRef, + RULES: RULES, + validate: validateGenerator, + util: util, + resolve: resolve, + resolveRef: resolveRef, + usePattern: usePattern, + useDefault: useDefault, + useCustomRule: useCustomRule, + opts: opts, + formats: formats, + logger: self.logger, + self: self + }); + + sourceCode = vars(refVal, refValCode) + vars(patterns, patternCode) + + vars(defaults, defaultCode) + vars(customRules, customRuleCode) + + sourceCode; + + if (opts.processCode) sourceCode = opts.processCode(sourceCode, _schema); + // console.log('\n\n\n *** \n', JSON.stringify(sourceCode)); + var validate; + try { + var makeValidate = new Function( + 'self', + 'RULES', + 'formats', + 'root', + 'refVal', + 'defaults', + 'customRules', + 'equal', + 'ucs2length', + 'ValidationError', + sourceCode + ); + + validate = makeValidate( + self, + RULES, + formats, + root, + refVal, + defaults, + customRules, + equal, + ucs2length, + ValidationError + ); + + refVal[0] = validate; + } catch(e) { + self.logger.error('Error compiling schema, function code:', sourceCode); + throw e; + } + + validate.schema = _schema; + validate.errors = null; + validate.refs = refs; + validate.refVal = refVal; + validate.root = isRoot ? validate : _root; + if ($async) validate.$async = true; + if (opts.sourceCode === true) { + validate.source = { + code: sourceCode, + patterns: patterns, + defaults: defaults + }; + } + + return validate; + } + + function resolveRef(baseId, ref, isRoot) { + ref = resolve.url(baseId, ref); + var refIndex = refs[ref]; + var _refVal, refCode; + if (refIndex !== undefined) { + _refVal = refVal[refIndex]; + refCode = 'refVal[' + refIndex + ']'; + return resolvedRef(_refVal, refCode); + } + if (!isRoot && root.refs) { + var rootRefId = root.refs[ref]; + if (rootRefId !== undefined) { + _refVal = root.refVal[rootRefId]; + refCode = addLocalRef(ref, _refVal); + return resolvedRef(_refVal, refCode); + } + } + + refCode = addLocalRef(ref); + var v = resolve.call(self, localCompile, root, ref); + if (v === undefined) { + var localSchema = localRefs && localRefs[ref]; + if (localSchema) { + v = resolve.inlineRef(localSchema, opts.inlineRefs) + ? localSchema + : compile.call(self, localSchema, root, localRefs, baseId); + } + } + + if (v === undefined) { + removeLocalRef(ref); + } else { + replaceLocalRef(ref, v); + return resolvedRef(v, refCode); + } + } + + function addLocalRef(ref, v) { + var refId = refVal.length; + refVal[refId] = v; + refs[ref] = refId; + return 'refVal' + refId; + } + + function removeLocalRef(ref) { + delete refs[ref]; + } + + function replaceLocalRef(ref, v) { + var refId = refs[ref]; + refVal[refId] = v; + } + + function resolvedRef(refVal, code) { + return typeof refVal == 'object' || typeof refVal == 'boolean' + ? { code: code, schema: refVal, inline: true } + : { code: code, $async: refVal && !!refVal.$async }; + } + + function usePattern(regexStr) { + var index = patternsHash[regexStr]; + if (index === undefined) { + index = patternsHash[regexStr] = patterns.length; + patterns[index] = regexStr; + } + return 'pattern' + index; + } + + function useDefault(value) { + switch (typeof value) { + case 'boolean': + case 'number': + return '' + value; + case 'string': + return util.toQuotedString(value); + case 'object': + if (value === null) return 'null'; + var valueStr = stableStringify(value); + var index = defaultsHash[valueStr]; + if (index === undefined) { + index = defaultsHash[valueStr] = defaults.length; + defaults[index] = value; + } + return 'default' + index; + } + } + + function useCustomRule(rule, schema, parentSchema, it) { + if (self._opts.validateSchema !== false) { + var deps = rule.definition.dependencies; + if (deps && !deps.every(function(keyword) { + return Object.prototype.hasOwnProperty.call(parentSchema, keyword); + })) + throw new Error('parent schema must have all required keywords: ' + deps.join(',')); + + var validateSchema = rule.definition.validateSchema; + if (validateSchema) { + var valid = validateSchema(schema); + if (!valid) { + var message = 'keyword schema is invalid: ' + self.errorsText(validateSchema.errors); + if (self._opts.validateSchema == 'log') self.logger.error(message); + else throw new Error(message); + } + } + } + + var compile = rule.definition.compile + , inline = rule.definition.inline + , macro = rule.definition.macro; + + var validate; + if (compile) { + validate = compile.call(self, schema, parentSchema, it); + } else if (macro) { + validate = macro.call(self, schema, parentSchema, it); + if (opts.validateSchema !== false) self.validateSchema(validate, true); + } else if (inline) { + validate = inline.call(self, it, rule.keyword, schema, parentSchema); + } else { + validate = rule.definition.validate; + if (!validate) return; + } + + if (validate === undefined) + throw new Error('custom keyword "' + rule.keyword + '"failed to compile'); + + var index = customRules.length; + customRules[index] = validate; + + return { + code: 'customRule' + index, + validate: validate + }; + } +} + + +/** + * Checks if the schema is currently compiled + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + * @return {Object} object with properties "index" (compilation index) and "compiling" (boolean) + */ +function checkCompiling(schema, root, baseId) { + /* jshint validthis: true */ + var index = compIndex.call(this, schema, root, baseId); + if (index >= 0) return { index: index, compiling: true }; + index = this._compilations.length; + this._compilations[index] = { + schema: schema, + root: root, + baseId: baseId + }; + return { index: index, compiling: false }; +} + + +/** + * Removes the schema from the currently compiled list + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + */ +function endCompiling(schema, root, baseId) { + /* jshint validthis: true */ + var i = compIndex.call(this, schema, root, baseId); + if (i >= 0) this._compilations.splice(i, 1); +} + + +/** + * Index of schema compilation in the currently compiled list + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + * @return {Integer} compilation index + */ +function compIndex(schema, root, baseId) { + /* jshint validthis: true */ + for (var i=0; i= 0xD800 && value <= 0xDBFF && pos < len) { + // high surrogate, and there is a next character + value = str.charCodeAt(pos); + if ((value & 0xFC00) == 0xDC00) pos++; // low surrogate + } + } + return length; +}; diff --git a/tunestats/app/api/node_modules/ajv/lib/compile/util.js b/tunestats/app/api/node_modules/ajv/lib/compile/util.js new file mode 100644 index 0000000..ef07b8c --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/compile/util.js @@ -0,0 +1,239 @@ +'use strict'; + + +module.exports = { + copy: copy, + checkDataType: checkDataType, + checkDataTypes: checkDataTypes, + coerceToTypes: coerceToTypes, + toHash: toHash, + getProperty: getProperty, + escapeQuotes: escapeQuotes, + equal: require('fast-deep-equal'), + ucs2length: require('./ucs2length'), + varOccurences: varOccurences, + varReplace: varReplace, + schemaHasRules: schemaHasRules, + schemaHasRulesExcept: schemaHasRulesExcept, + schemaUnknownRules: schemaUnknownRules, + toQuotedString: toQuotedString, + getPathExpr: getPathExpr, + getPath: getPath, + getData: getData, + unescapeFragment: unescapeFragment, + unescapeJsonPointer: unescapeJsonPointer, + escapeFragment: escapeFragment, + escapeJsonPointer: escapeJsonPointer +}; + + +function copy(o, to) { + to = to || {}; + for (var key in o) to[key] = o[key]; + return to; +} + + +function checkDataType(dataType, data, strictNumbers, negate) { + var EQUAL = negate ? ' !== ' : ' === ' + , AND = negate ? ' || ' : ' && ' + , OK = negate ? '!' : '' + , NOT = negate ? '' : '!'; + switch (dataType) { + case 'null': return data + EQUAL + 'null'; + case 'array': return OK + 'Array.isArray(' + data + ')'; + case 'object': return '(' + OK + data + AND + + 'typeof ' + data + EQUAL + '"object"' + AND + + NOT + 'Array.isArray(' + data + '))'; + case 'integer': return '(typeof ' + data + EQUAL + '"number"' + AND + + NOT + '(' + data + ' % 1)' + + AND + data + EQUAL + data + + (strictNumbers ? (AND + OK + 'isFinite(' + data + ')') : '') + ')'; + case 'number': return '(typeof ' + data + EQUAL + '"' + dataType + '"' + + (strictNumbers ? (AND + OK + 'isFinite(' + data + ')') : '') + ')'; + default: return 'typeof ' + data + EQUAL + '"' + dataType + '"'; + } +} + + +function checkDataTypes(dataTypes, data, strictNumbers) { + switch (dataTypes.length) { + case 1: return checkDataType(dataTypes[0], data, strictNumbers, true); + default: + var code = ''; + var types = toHash(dataTypes); + if (types.array && types.object) { + code = types.null ? '(': '(!' + data + ' || '; + code += 'typeof ' + data + ' !== "object")'; + delete types.null; + delete types.array; + delete types.object; + } + if (types.number) delete types.integer; + for (var t in types) + code += (code ? ' && ' : '' ) + checkDataType(t, data, strictNumbers, true); + + return code; + } +} + + +var COERCE_TO_TYPES = toHash([ 'string', 'number', 'integer', 'boolean', 'null' ]); +function coerceToTypes(optionCoerceTypes, dataTypes) { + if (Array.isArray(dataTypes)) { + var types = []; + for (var i=0; i= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); + return paths[lvl - up]; + } + + if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); + data = 'data' + ((lvl - up) || ''); + if (!jsonPointer) return data; + } + + var expr = data; + var segments = jsonPointer.split('/'); + for (var i=0; i' + , $notOp = $isMax ? '>' : '<' + , $errorKeyword = undefined; + + if (!($isData || typeof $schema == 'number' || $schema === undefined)) { + throw new Error($keyword + ' must be number'); + } + if (!($isDataExcl || $schemaExcl === undefined + || typeof $schemaExcl == 'number' + || typeof $schemaExcl == 'boolean')) { + throw new Error($exclusiveKeyword + ' must be number or boolean'); + } +}} + +{{? $isDataExcl }} + {{ + var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr) + , $exclusive = 'exclusive' + $lvl + , $exclType = 'exclType' + $lvl + , $exclIsNumber = 'exclIsNumber' + $lvl + , $opExpr = 'op' + $lvl + , $opStr = '\' + ' + $opExpr + ' + \''; + }} + var schemaExcl{{=$lvl}} = {{=$schemaValueExcl}}; + {{ $schemaValueExcl = 'schemaExcl' + $lvl; }} + + var {{=$exclusive}}; + var {{=$exclType}} = typeof {{=$schemaValueExcl}}; + if ({{=$exclType}} != 'boolean' && {{=$exclType}} != 'undefined' && {{=$exclType}} != 'number') { + {{ var $errorKeyword = $exclusiveKeyword; }} + {{# def.error:'_exclusiveLimit' }} + } else if ({{# def.$dataNotType:'number' }} + {{=$exclType}} == 'number' + ? ( + ({{=$exclusive}} = {{=$schemaValue}} === undefined || {{=$schemaValueExcl}} {{=$op}}= {{=$schemaValue}}) + ? {{=$data}} {{=$notOp}}= {{=$schemaValueExcl}} + : {{=$data}} {{=$notOp}} {{=$schemaValue}} + ) + : ( + ({{=$exclusive}} = {{=$schemaValueExcl}} === true) + ? {{=$data}} {{=$notOp}}= {{=$schemaValue}} + : {{=$data}} {{=$notOp}} {{=$schemaValue}} + ) + || {{=$data}} !== {{=$data}}) { + var op{{=$lvl}} = {{=$exclusive}} ? '{{=$op}}' : '{{=$op}}='; + {{ + if ($schema === undefined) { + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $schemaValue = $schemaValueExcl; + $isData = $isDataExcl; + } + }} +{{??}} + {{ + var $exclIsNumber = typeof $schemaExcl == 'number' + , $opStr = $op; /*used in error*/ + }} + + {{? $exclIsNumber && $isData }} + {{ var $opExpr = '\'' + $opStr + '\''; /*used in error*/ }} + if ({{# def.$dataNotType:'number' }} + ( {{=$schemaValue}} === undefined + || {{=$schemaExcl}} {{=$op}}= {{=$schemaValue}} + ? {{=$data}} {{=$notOp}}= {{=$schemaExcl}} + : {{=$data}} {{=$notOp}} {{=$schemaValue}} ) + || {{=$data}} !== {{=$data}}) { + {{??}} + {{ + if ($exclIsNumber && $schema === undefined) { + {{# def.setExclusiveLimit }} + $schemaValue = $schemaExcl; + $notOp += '='; + } else { + if ($exclIsNumber) + $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); + + if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { + {{# def.setExclusiveLimit }} + $notOp += '='; + } else { + $exclusive = false; + $opStr += '='; + } + } + + var $opExpr = '\'' + $opStr + '\''; /*used in error*/ + }} + + if ({{# def.$dataNotType:'number' }} + {{=$data}} {{=$notOp}} {{=$schemaValue}} + || {{=$data}} !== {{=$data}}) { + {{?}} +{{?}} + {{ $errorKeyword = $errorKeyword || $keyword; }} + {{# def.error:'_limit' }} + } {{? $breakOnError }} else { {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/_limitItems.jst b/tunestats/app/api/node_modules/ajv/lib/dot/_limitItems.jst new file mode 100644 index 0000000..741329e --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/_limitItems.jst @@ -0,0 +1,12 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.$data }} + +{{# def.numberKeyword }} + +{{ var $op = $keyword == 'maxItems' ? '>' : '<'; }} +if ({{# def.$dataNotType:'number' }} {{=$data}}.length {{=$op}} {{=$schemaValue}}) { + {{ var $errorKeyword = $keyword; }} + {{# def.error:'_limitItems' }} +} {{? $breakOnError }} else { {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/_limitLength.jst b/tunestats/app/api/node_modules/ajv/lib/dot/_limitLength.jst new file mode 100644 index 0000000..285c66b --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/_limitLength.jst @@ -0,0 +1,12 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.$data }} + +{{# def.numberKeyword }} + +{{ var $op = $keyword == 'maxLength' ? '>' : '<'; }} +if ({{# def.$dataNotType:'number' }} {{# def.strLength }} {{=$op}} {{=$schemaValue}}) { + {{ var $errorKeyword = $keyword; }} + {{# def.error:'_limitLength' }} +} {{? $breakOnError }} else { {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/_limitProperties.jst b/tunestats/app/api/node_modules/ajv/lib/dot/_limitProperties.jst new file mode 100644 index 0000000..c4c2155 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/_limitProperties.jst @@ -0,0 +1,12 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.$data }} + +{{# def.numberKeyword }} + +{{ var $op = $keyword == 'maxProperties' ? '>' : '<'; }} +if ({{# def.$dataNotType:'number' }} Object.keys({{=$data}}).length {{=$op}} {{=$schemaValue}}) { + {{ var $errorKeyword = $keyword; }} + {{# def.error:'_limitProperties' }} +} {{? $breakOnError }} else { {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/allOf.jst b/tunestats/app/api/node_modules/ajv/lib/dot/allOf.jst new file mode 100644 index 0000000..0e782fe --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/allOf.jst @@ -0,0 +1,32 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + +{{ + var $currentBaseId = $it.baseId + , $allSchemasEmpty = true; +}} + +{{~ $schema:$sch:$i }} + {{? {{# def.nonEmptySchema:$sch }} }} + {{ + $allSchemasEmpty = false; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + }} + + {{# def.insertSubschemaCode }} + + {{# def.ifResultValid }} + {{?}} +{{~}} + +{{? $breakOnError }} + {{? $allSchemasEmpty }} + if (true) { + {{??}} + {{= $closingBraces.slice(0,-1) }} + {{?}} +{{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/anyOf.jst b/tunestats/app/api/node_modules/ajv/lib/dot/anyOf.jst new file mode 100644 index 0000000..ea909ee --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/anyOf.jst @@ -0,0 +1,46 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + +{{ + var $noEmptySchema = $schema.every(function($sch) { + return {{# def.nonEmptySchema:$sch }}; + }); +}} +{{? $noEmptySchema }} + {{ var $currentBaseId = $it.baseId; }} + var {{=$errs}} = errors; + var {{=$valid}} = false; + + {{# def.setCompositeRule }} + + {{~ $schema:$sch:$i }} + {{ + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + }} + + {{# def.insertSubschemaCode }} + + {{=$valid}} = {{=$valid}} || {{=$nextValid}}; + + if (!{{=$valid}}) { + {{ $closingBraces += '}'; }} + {{~}} + + {{# def.resetCompositeRule }} + + {{= $closingBraces }} + + if (!{{=$valid}}) { + {{# def.extraError:'anyOf' }} + } else { + {{# def.resetErrors }} + {{? it.opts.allErrors }} } {{?}} +{{??}} + {{? $breakOnError }} + if (true) { + {{?}} +{{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/coerce.def b/tunestats/app/api/node_modules/ajv/lib/dot/coerce.def new file mode 100644 index 0000000..c947ed6 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/coerce.def @@ -0,0 +1,51 @@ +{{## def.coerceType: + {{ + var $dataType = 'dataType' + $lvl + , $coerced = 'coerced' + $lvl; + }} + var {{=$dataType}} = typeof {{=$data}}; + var {{=$coerced}} = undefined; + + {{? it.opts.coerceTypes == 'array' }} + if ({{=$dataType}} == 'object' && Array.isArray({{=$data}}) && {{=$data}}.length == 1) { + {{=$data}} = {{=$data}}[0]; + {{=$dataType}} = typeof {{=$data}}; + if ({{=it.util.checkDataType(it.schema.type, $data, it.opts.strictNumbers)}}) {{=$coerced}} = {{=$data}}; + } + {{?}} + + if ({{=$coerced}} !== undefined) ; + {{~ $coerceToTypes:$type:$i }} + {{? $type == 'string' }} + else if ({{=$dataType}} == 'number' || {{=$dataType}} == 'boolean') + {{=$coerced}} = '' + {{=$data}}; + else if ({{=$data}} === null) {{=$coerced}} = ''; + {{?? $type == 'number' || $type == 'integer' }} + else if ({{=$dataType}} == 'boolean' || {{=$data}} === null + || ({{=$dataType}} == 'string' && {{=$data}} && {{=$data}} == +{{=$data}} + {{? $type == 'integer' }} && !({{=$data}} % 1){{?}})) + {{=$coerced}} = +{{=$data}}; + {{?? $type == 'boolean' }} + else if ({{=$data}} === 'false' || {{=$data}} === 0 || {{=$data}} === null) + {{=$coerced}} = false; + else if ({{=$data}} === 'true' || {{=$data}} === 1) + {{=$coerced}} = true; + {{?? $type == 'null' }} + else if ({{=$data}} === '' || {{=$data}} === 0 || {{=$data}} === false) + {{=$coerced}} = null; + {{?? it.opts.coerceTypes == 'array' && $type == 'array' }} + else if ({{=$dataType}} == 'string' || {{=$dataType}} == 'number' || {{=$dataType}} == 'boolean' || {{=$data}} == null) + {{=$coerced}} = [{{=$data}}]; + {{?}} + {{~}} + else { + {{# def.error:'type' }} + } + + if ({{=$coerced}} !== undefined) { + {{# def.setParentData }} + {{=$data}} = {{=$coerced}}; + {{? !$dataLvl }}if ({{=$parentData}} !== undefined){{?}} + {{=$parentData}}[{{=$parentDataProperty}}] = {{=$coerced}}; + } +#}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/comment.jst b/tunestats/app/api/node_modules/ajv/lib/dot/comment.jst new file mode 100644 index 0000000..f959150 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/comment.jst @@ -0,0 +1,9 @@ +{{# def.definitions }} +{{# def.setupKeyword }} + +{{ var $comment = it.util.toQuotedString($schema); }} +{{? it.opts.$comment === true }} + console.log({{=$comment}}); +{{?? typeof it.opts.$comment == 'function' }} + self._opts.$comment({{=$comment}}, {{=it.util.toQuotedString($errSchemaPath)}}, validate.root.schema); +{{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/const.jst b/tunestats/app/api/node_modules/ajv/lib/dot/const.jst new file mode 100644 index 0000000..2aa2298 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/const.jst @@ -0,0 +1,11 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.$data }} + +{{? !$isData }} + var schema{{=$lvl}} = validate.schema{{=$schemaPath}}; +{{?}} +var {{=$valid}} = equal({{=$data}}, schema{{=$lvl}}); +{{# def.checkError:'const' }} +{{? $breakOnError }} else { {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/contains.jst b/tunestats/app/api/node_modules/ajv/lib/dot/contains.jst new file mode 100644 index 0000000..4dc9967 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/contains.jst @@ -0,0 +1,55 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + + +{{ + var $idx = 'i' + $lvl + , $dataNxt = $it.dataLevel = it.dataLevel + 1 + , $nextData = 'data' + $dataNxt + , $currentBaseId = it.baseId + , $nonEmptySchema = {{# def.nonEmptySchema:$schema }}; +}} + +var {{=$errs}} = errors; +var {{=$valid}}; + +{{? $nonEmptySchema }} + {{# def.setCompositeRule }} + + {{ + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + }} + + var {{=$nextValid}} = false; + + for (var {{=$idx}} = 0; {{=$idx}} < {{=$data}}.length; {{=$idx}}++) { + {{ + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + }} + + {{# def.generateSubschemaCode }} + {{# def.optimizeValidate }} + + if ({{=$nextValid}}) break; + } + + {{# def.resetCompositeRule }} + {{= $closingBraces }} + + if (!{{=$nextValid}}) { +{{??}} + if ({{=$data}}.length == 0) { +{{?}} + + {{# def.error:'contains' }} + } else { + {{? $nonEmptySchema }} + {{# def.resetErrors }} + {{?}} + {{? it.opts.allErrors }} } {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/custom.jst b/tunestats/app/api/node_modules/ajv/lib/dot/custom.jst new file mode 100644 index 0000000..d30588f --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/custom.jst @@ -0,0 +1,191 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.$data }} + +{{ + var $rule = this + , $definition = 'definition' + $lvl + , $rDef = $rule.definition + , $closingBraces = ''; + var $validate = $rDef.validate; + var $compile, $inline, $macro, $ruleValidate, $validateCode; +}} + +{{? $isData && $rDef.$data }} + {{ + $validateCode = 'keywordValidate' + $lvl; + var $validateSchema = $rDef.validateSchema; + }} + var {{=$definition}} = RULES.custom['{{=$keyword}}'].definition; + var {{=$validateCode}} = {{=$definition}}.validate; +{{??}} + {{ + $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it); + if (!$ruleValidate) return; + $schemaValue = 'validate.schema' + $schemaPath; + $validateCode = $ruleValidate.code; + $compile = $rDef.compile; + $inline = $rDef.inline; + $macro = $rDef.macro; + }} +{{?}} + +{{ + var $ruleErrs = $validateCode + '.errors' + , $i = 'i' + $lvl + , $ruleErr = 'ruleErr' + $lvl + , $asyncKeyword = $rDef.async; + + if ($asyncKeyword && !it.async) + throw new Error('async keyword in sync schema'); +}} + + +{{? !($inline || $macro) }}{{=$ruleErrs}} = null;{{?}} +var {{=$errs}} = errors; +var {{=$valid}}; + +{{## def.callRuleValidate: + {{=$validateCode}}.call( + {{? it.opts.passContext }}this{{??}}self{{?}} + {{? $compile || $rDef.schema === false }} + , {{=$data}} + {{??}} + , {{=$schemaValue}} + , {{=$data}} + , validate.schema{{=it.schemaPath}} + {{?}} + , {{# def.dataPath }} + {{# def.passParentData }} + , rootData + ) +#}} + +{{## def.extendErrors:_inline: + for (var {{=$i}}={{=$errs}}; {{=$i}} 0) + || _schema === false + : it.util.schemaHasRules(_schema, it.RULES.all)) +#}} + + +{{## def.strLength: + {{? it.opts.unicode === false }} + {{=$data}}.length + {{??}} + ucs2length({{=$data}}) + {{?}} +#}} + + +{{## def.willOptimize: + it.util.varOccurences($code, $nextData) < 2 +#}} + + +{{## def.generateSubschemaCode: + {{ + var $code = it.validate($it); + $it.baseId = $currentBaseId; + }} +#}} + + +{{## def.insertSubschemaCode: + {{= it.validate($it) }} + {{ $it.baseId = $currentBaseId; }} +#}} + + +{{## def._optimizeValidate: + it.util.varReplace($code, $nextData, $passData) +#}} + + +{{## def.optimizeValidate: + {{? {{# def.willOptimize}} }} + {{= {{# def._optimizeValidate }} }} + {{??}} + var {{=$nextData}} = {{=$passData}}; + {{= $code }} + {{?}} +#}} + + +{{## def.$data: + {{ + var $isData = it.opts.$data && $schema && $schema.$data + , $schemaValue; + }} + {{? $isData }} + var schema{{=$lvl}} = {{= it.util.getData($schema.$data, $dataLvl, it.dataPathArr) }}; + {{ $schemaValue = 'schema' + $lvl; }} + {{??}} + {{ $schemaValue = $schema; }} + {{?}} +#}} + + +{{## def.$dataNotType:_type: + {{?$isData}} ({{=$schemaValue}} !== undefined && typeof {{=$schemaValue}} != _type) || {{?}} +#}} + + +{{## def.check$dataIsArray: + if (schema{{=$lvl}} === undefined) {{=$valid}} = true; + else if (!Array.isArray(schema{{=$lvl}})) {{=$valid}} = false; + else { +#}} + + +{{## def.numberKeyword: + {{? !($isData || typeof $schema == 'number') }} + {{ throw new Error($keyword + ' must be number'); }} + {{?}} +#}} + + +{{## def.beginDefOut: + {{ + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; + }} +#}} + + +{{## def.storeDefOut:_variable: + {{ + var _variable = out; + out = $$outStack.pop(); + }} +#}} + + +{{## def.dataPath:(dataPath || ''){{? it.errorPath != '""'}} + {{= it.errorPath }}{{?}}#}} + +{{## def.setParentData: + {{ + var $parentData = $dataLvl ? 'data' + (($dataLvl-1)||'') : 'parentData' + , $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; + }} +#}} + +{{## def.passParentData: + {{# def.setParentData }} + , {{= $parentData }} + , {{= $parentDataProperty }} +#}} + + +{{## def.iterateProperties: + {{? $ownProperties }} + {{=$dataProperties}} = {{=$dataProperties}} || Object.keys({{=$data}}); + for (var {{=$idx}}=0; {{=$idx}}<{{=$dataProperties}}.length; {{=$idx}}++) { + var {{=$key}} = {{=$dataProperties}}[{{=$idx}}]; + {{??}} + for (var {{=$key}} in {{=$data}}) { + {{?}} +#}} + + +{{## def.noPropertyInData: + {{=$useData}} === undefined + {{? $ownProperties }} + || !{{# def.isOwnProperty }} + {{?}} +#}} + + +{{## def.isOwnProperty: + Object.prototype.hasOwnProperty.call({{=$data}}, '{{=it.util.escapeQuotes($propertyKey)}}') +#}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/dependencies.jst b/tunestats/app/api/node_modules/ajv/lib/dot/dependencies.jst new file mode 100644 index 0000000..e4bddde --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/dependencies.jst @@ -0,0 +1,79 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.missing }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + + +{{## def.propertyInData: + {{=$data}}{{= it.util.getProperty($property) }} !== undefined + {{? $ownProperties }} + && Object.prototype.hasOwnProperty.call({{=$data}}, '{{=it.util.escapeQuotes($property)}}') + {{?}} +#}} + + +{{ + var $schemaDeps = {} + , $propertyDeps = {} + , $ownProperties = it.opts.ownProperties; + + for ($property in $schema) { + if ($property == '__proto__') continue; + var $sch = $schema[$property]; + var $deps = Array.isArray($sch) ? $propertyDeps : $schemaDeps; + $deps[$property] = $sch; + } +}} + +var {{=$errs}} = errors; + +{{ var $currentErrorPath = it.errorPath; }} + +var missing{{=$lvl}}; +{{ for (var $property in $propertyDeps) { }} + {{ $deps = $propertyDeps[$property]; }} + {{? $deps.length }} + if ({{# def.propertyInData }} + {{? $breakOnError }} + && ({{# def.checkMissingProperty:$deps }})) { + {{# def.errorMissingProperty:'dependencies' }} + {{??}} + ) { + {{~ $deps:$propertyKey }} + {{# def.allErrorsMissingProperty:'dependencies' }} + {{~}} + {{?}} + } {{# def.elseIfValid }} + {{?}} +{{ } }} + +{{ + it.errorPath = $currentErrorPath; + var $currentBaseId = $it.baseId; +}} + + +{{ for (var $property in $schemaDeps) { }} + {{ var $sch = $schemaDeps[$property]; }} + {{? {{# def.nonEmptySchema:$sch }} }} + {{=$nextValid}} = true; + + if ({{# def.propertyInData }}) { + {{ + $it.schema = $sch; + $it.schemaPath = $schemaPath + it.util.getProperty($property); + $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property); + }} + + {{# def.insertSubschemaCode }} + } + + {{# def.ifResultValid }} + {{?}} +{{ } }} + +{{? $breakOnError }} + {{= $closingBraces }} + if ({{=$errs}} == errors) { +{{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/enum.jst b/tunestats/app/api/node_modules/ajv/lib/dot/enum.jst new file mode 100644 index 0000000..357c2e8 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/enum.jst @@ -0,0 +1,30 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.$data }} + +{{ + var $i = 'i' + $lvl + , $vSchema = 'schema' + $lvl; +}} + +{{? !$isData }} + var {{=$vSchema}} = validate.schema{{=$schemaPath}}; +{{?}} +var {{=$valid}}; + +{{?$isData}}{{# def.check$dataIsArray }}{{?}} + +{{=$valid}} = false; + +for (var {{=$i}}=0; {{=$i}}<{{=$vSchema}}.length; {{=$i}}++) + if (equal({{=$data}}, {{=$vSchema}}[{{=$i}}])) { + {{=$valid}} = true; + break; + } + +{{? $isData }} } {{?}} + +{{# def.checkError:'enum' }} + +{{? $breakOnError }} else { {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/errors.def b/tunestats/app/api/node_modules/ajv/lib/dot/errors.def new file mode 100644 index 0000000..5c5752c --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/errors.def @@ -0,0 +1,194 @@ +{{# def.definitions }} + +{{## def._error:_rule: + {{ 'istanbul ignore else'; }} + {{? it.createErrors !== false }} + { + keyword: '{{= $errorKeyword || _rule }}' + , dataPath: (dataPath || '') + {{= it.errorPath }} + , schemaPath: {{=it.util.toQuotedString($errSchemaPath)}} + , params: {{# def._errorParams[_rule] }} + {{? it.opts.messages !== false }} + , message: {{# def._errorMessages[_rule] }} + {{?}} + {{? it.opts.verbose }} + , schema: {{# def._errorSchemas[_rule] }} + , parentSchema: validate.schema{{=it.schemaPath}} + , data: {{=$data}} + {{?}} + } + {{??}} + {} + {{?}} +#}} + + +{{## def._addError:_rule: + if (vErrors === null) vErrors = [err]; + else vErrors.push(err); + errors++; +#}} + + +{{## def.addError:_rule: + var err = {{# def._error:_rule }}; + {{# def._addError:_rule }} +#}} + + +{{## def.error:_rule: + {{# def.beginDefOut}} + {{# def._error:_rule }} + {{# def.storeDefOut:__err }} + + {{? !it.compositeRule && $breakOnError }} + {{ 'istanbul ignore if'; }} + {{? it.async }} + throw new ValidationError([{{=__err}}]); + {{??}} + validate.errors = [{{=__err}}]; + return false; + {{?}} + {{??}} + var err = {{=__err}}; + {{# def._addError:_rule }} + {{?}} +#}} + + +{{## def.extraError:_rule: + {{# def.addError:_rule}} + {{? !it.compositeRule && $breakOnError }} + {{ 'istanbul ignore if'; }} + {{? it.async }} + throw new ValidationError(vErrors); + {{??}} + validate.errors = vErrors; + return false; + {{?}} + {{?}} +#}} + + +{{## def.checkError:_rule: + if (!{{=$valid}}) { + {{# def.error:_rule }} + } +#}} + + +{{## def.resetErrors: + errors = {{=$errs}}; + if (vErrors !== null) { + if ({{=$errs}}) vErrors.length = {{=$errs}}; + else vErrors = null; + } +#}} + + +{{## def.concatSchema:{{?$isData}}' + {{=$schemaValue}} + '{{??}}{{=$schema}}{{?}}#}} +{{## def.appendSchema:{{?$isData}}' + {{=$schemaValue}}{{??}}{{=$schemaValue}}'{{?}}#}} +{{## def.concatSchemaEQ:{{?$isData}}' + {{=$schemaValue}} + '{{??}}{{=it.util.escapeQuotes($schema)}}{{?}}#}} + +{{## def._errorMessages = { + 'false schema': "'boolean schema is false'", + $ref: "'can\\\'t resolve reference {{=it.util.escapeQuotes($schema)}}'", + additionalItems: "'should NOT have more than {{=$schema.length}} items'", + additionalProperties: "'{{? it.opts._errorDataPathProperty }}is an invalid additional property{{??}}should NOT have additional properties{{?}}'", + anyOf: "'should match some schema in anyOf'", + const: "'should be equal to constant'", + contains: "'should contain a valid item'", + dependencies: "'should have {{? $deps.length == 1 }}property {{= it.util.escapeQuotes($deps[0]) }}{{??}}properties {{= it.util.escapeQuotes($deps.join(\", \")) }}{{?}} when property {{= it.util.escapeQuotes($property) }} is present'", + 'enum': "'should be equal to one of the allowed values'", + format: "'should match format \"{{#def.concatSchemaEQ}}\"'", + 'if': "'should match \"' + {{=$ifClause}} + '\" schema'", + _limit: "'should be {{=$opStr}} {{#def.appendSchema}}", + _exclusiveLimit: "'{{=$exclusiveKeyword}} should be boolean'", + _limitItems: "'should NOT have {{?$keyword=='maxItems'}}more{{??}}fewer{{?}} than {{#def.concatSchema}} items'", + _limitLength: "'should NOT be {{?$keyword=='maxLength'}}longer{{??}}shorter{{?}} than {{#def.concatSchema}} characters'", + _limitProperties:"'should NOT have {{?$keyword=='maxProperties'}}more{{??}}fewer{{?}} than {{#def.concatSchema}} properties'", + multipleOf: "'should be multiple of {{#def.appendSchema}}", + not: "'should NOT be valid'", + oneOf: "'should match exactly one schema in oneOf'", + pattern: "'should match pattern \"{{#def.concatSchemaEQ}}\"'", + propertyNames: "'property name \\'{{=$invalidName}}\\' is invalid'", + required: "'{{? it.opts._errorDataPathProperty }}is a required property{{??}}should have required property \\'{{=$missingProperty}}\\'{{?}}'", + type: "'should be {{? $typeIsArray }}{{= $typeSchema.join(\",\") }}{{??}}{{=$typeSchema}}{{?}}'", + uniqueItems: "'should NOT have duplicate items (items ## ' + j + ' and ' + i + ' are identical)'", + custom: "'should pass \"{{=$rule.keyword}}\" keyword validation'", + patternRequired: "'should have property matching pattern \\'{{=$missingPattern}}\\''", + switch: "'should pass \"switch\" keyword validation'", + _formatLimit: "'should be {{=$opStr}} \"{{#def.concatSchemaEQ}}\"'", + _formatExclusiveLimit: "'{{=$exclusiveKeyword}} should be boolean'" +} #}} + + +{{## def.schemaRefOrVal: {{?$isData}}validate.schema{{=$schemaPath}}{{??}}{{=$schema}}{{?}} #}} +{{## def.schemaRefOrQS: {{?$isData}}validate.schema{{=$schemaPath}}{{??}}{{=it.util.toQuotedString($schema)}}{{?}} #}} + +{{## def._errorSchemas = { + 'false schema': "false", + $ref: "{{=it.util.toQuotedString($schema)}}", + additionalItems: "false", + additionalProperties: "false", + anyOf: "validate.schema{{=$schemaPath}}", + const: "validate.schema{{=$schemaPath}}", + contains: "validate.schema{{=$schemaPath}}", + dependencies: "validate.schema{{=$schemaPath}}", + 'enum': "validate.schema{{=$schemaPath}}", + format: "{{#def.schemaRefOrQS}}", + 'if': "validate.schema{{=$schemaPath}}", + _limit: "{{#def.schemaRefOrVal}}", + _exclusiveLimit: "validate.schema{{=$schemaPath}}", + _limitItems: "{{#def.schemaRefOrVal}}", + _limitLength: "{{#def.schemaRefOrVal}}", + _limitProperties:"{{#def.schemaRefOrVal}}", + multipleOf: "{{#def.schemaRefOrVal}}", + not: "validate.schema{{=$schemaPath}}", + oneOf: "validate.schema{{=$schemaPath}}", + pattern: "{{#def.schemaRefOrQS}}", + propertyNames: "validate.schema{{=$schemaPath}}", + required: "validate.schema{{=$schemaPath}}", + type: "validate.schema{{=$schemaPath}}", + uniqueItems: "{{#def.schemaRefOrVal}}", + custom: "validate.schema{{=$schemaPath}}", + patternRequired: "validate.schema{{=$schemaPath}}", + switch: "validate.schema{{=$schemaPath}}", + _formatLimit: "{{#def.schemaRefOrQS}}", + _formatExclusiveLimit: "validate.schema{{=$schemaPath}}" +} #}} + + +{{## def.schemaValueQS: {{?$isData}}{{=$schemaValue}}{{??}}{{=it.util.toQuotedString($schema)}}{{?}} #}} + +{{## def._errorParams = { + 'false schema': "{}", + $ref: "{ ref: '{{=it.util.escapeQuotes($schema)}}' }", + additionalItems: "{ limit: {{=$schema.length}} }", + additionalProperties: "{ additionalProperty: '{{=$additionalProperty}}' }", + anyOf: "{}", + const: "{ allowedValue: schema{{=$lvl}} }", + contains: "{}", + dependencies: "{ property: '{{= it.util.escapeQuotes($property) }}', missingProperty: '{{=$missingProperty}}', depsCount: {{=$deps.length}}, deps: '{{= it.util.escapeQuotes($deps.length==1 ? $deps[0] : $deps.join(\", \")) }}' }", + 'enum': "{ allowedValues: schema{{=$lvl}} }", + format: "{ format: {{#def.schemaValueQS}} }", + 'if': "{ failingKeyword: {{=$ifClause}} }", + _limit: "{ comparison: {{=$opExpr}}, limit: {{=$schemaValue}}, exclusive: {{=$exclusive}} }", + _exclusiveLimit: "{}", + _limitItems: "{ limit: {{=$schemaValue}} }", + _limitLength: "{ limit: {{=$schemaValue}} }", + _limitProperties:"{ limit: {{=$schemaValue}} }", + multipleOf: "{ multipleOf: {{=$schemaValue}} }", + not: "{}", + oneOf: "{ passingSchemas: {{=$passingSchemas}} }", + pattern: "{ pattern: {{#def.schemaValueQS}} }", + propertyNames: "{ propertyName: '{{=$invalidName}}' }", + required: "{ missingProperty: '{{=$missingProperty}}' }", + type: "{ type: '{{? $typeIsArray }}{{= $typeSchema.join(\",\") }}{{??}}{{=$typeSchema}}{{?}}' }", + uniqueItems: "{ i: i, j: j }", + custom: "{ keyword: '{{=$rule.keyword}}' }", + patternRequired: "{ missingPattern: '{{=$missingPattern}}' }", + switch: "{ caseIndex: {{=$caseIndex}} }", + _formatLimit: "{ comparison: {{=$opExpr}}, limit: {{#def.schemaValueQS}}, exclusive: {{=$exclusive}} }", + _formatExclusiveLimit: "{}" +} #}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/format.jst b/tunestats/app/api/node_modules/ajv/lib/dot/format.jst new file mode 100644 index 0000000..37f14da --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/format.jst @@ -0,0 +1,106 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} + +{{## def.skipFormat: + {{? $breakOnError }} if (true) { {{?}} + {{ return out; }} +#}} + +{{? it.opts.format === false }}{{# def.skipFormat }}{{?}} + + +{{# def.$data }} + + +{{## def.$dataCheckFormat: + {{# def.$dataNotType:'string' }} + ({{? $unknownFormats != 'ignore' }} + ({{=$schemaValue}} && !{{=$format}} + {{? $allowUnknown }} + && self._opts.unknownFormats.indexOf({{=$schemaValue}}) == -1 + {{?}}) || + {{?}} + ({{=$format}} && {{=$formatType}} == '{{=$ruleType}}' + && !(typeof {{=$format}} == 'function' + ? {{? it.async}} + (async{{=$lvl}} ? await {{=$format}}({{=$data}}) : {{=$format}}({{=$data}})) + {{??}} + {{=$format}}({{=$data}}) + {{?}} + : {{=$format}}.test({{=$data}})))) +#}} + +{{## def.checkFormat: + {{ + var $formatRef = 'formats' + it.util.getProperty($schema); + if ($isObject) $formatRef += '.validate'; + }} + {{? typeof $format == 'function' }} + {{=$formatRef}}({{=$data}}) + {{??}} + {{=$formatRef}}.test({{=$data}}) + {{?}} +#}} + + +{{ + var $unknownFormats = it.opts.unknownFormats + , $allowUnknown = Array.isArray($unknownFormats); +}} + +{{? $isData }} + {{ + var $format = 'format' + $lvl + , $isObject = 'isObject' + $lvl + , $formatType = 'formatType' + $lvl; + }} + var {{=$format}} = formats[{{=$schemaValue}}]; + var {{=$isObject}} = typeof {{=$format}} == 'object' + && !({{=$format}} instanceof RegExp) + && {{=$format}}.validate; + var {{=$formatType}} = {{=$isObject}} && {{=$format}}.type || 'string'; + if ({{=$isObject}}) { + {{? it.async}} + var async{{=$lvl}} = {{=$format}}.async; + {{?}} + {{=$format}} = {{=$format}}.validate; + } + if ({{# def.$dataCheckFormat }}) { +{{??}} + {{ var $format = it.formats[$schema]; }} + {{? !$format }} + {{? $unknownFormats == 'ignore' }} + {{ it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"'); }} + {{# def.skipFormat }} + {{?? $allowUnknown && $unknownFormats.indexOf($schema) >= 0 }} + {{# def.skipFormat }} + {{??}} + {{ throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"'); }} + {{?}} + {{?}} + {{ + var $isObject = typeof $format == 'object' + && !($format instanceof RegExp) + && $format.validate; + var $formatType = $isObject && $format.type || 'string'; + if ($isObject) { + var $async = $format.async === true; + $format = $format.validate; + } + }} + {{? $formatType != $ruleType }} + {{# def.skipFormat }} + {{?}} + {{? $async }} + {{ + if (!it.async) throw new Error('async format in sync schema'); + var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate'; + }} + if (!(await {{=$formatRef}}({{=$data}}))) { + {{??}} + if (!{{# def.checkFormat }}) { + {{?}} +{{?}} + {{# def.error:'format' }} + } {{? $breakOnError }} else { {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/if.jst b/tunestats/app/api/node_modules/ajv/lib/dot/if.jst new file mode 100644 index 0000000..adb5036 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/if.jst @@ -0,0 +1,73 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + + +{{## def.validateIfClause:_clause: + {{ + $it.schema = it.schema['_clause']; + $it.schemaPath = it.schemaPath + '._clause'; + $it.errSchemaPath = it.errSchemaPath + '/_clause'; + }} + {{# def.insertSubschemaCode }} + {{=$valid}} = {{=$nextValid}}; + {{? $thenPresent && $elsePresent }} + {{ $ifClause = 'ifClause' + $lvl; }} + var {{=$ifClause}} = '_clause'; + {{??}} + {{ $ifClause = '\'_clause\''; }} + {{?}} +#}} + +{{ + var $thenSch = it.schema['then'] + , $elseSch = it.schema['else'] + , $thenPresent = $thenSch !== undefined && {{# def.nonEmptySchema:$thenSch }} + , $elsePresent = $elseSch !== undefined && {{# def.nonEmptySchema:$elseSch }} + , $currentBaseId = $it.baseId; +}} + +{{? $thenPresent || $elsePresent }} + {{ + var $ifClause; + $it.createErrors = false; + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + }} + var {{=$errs}} = errors; + var {{=$valid}} = true; + + {{# def.setCompositeRule }} + {{# def.insertSubschemaCode }} + {{ $it.createErrors = true; }} + {{# def.resetErrors }} + {{# def.resetCompositeRule }} + + {{? $thenPresent }} + if ({{=$nextValid}}) { + {{# def.validateIfClause:then }} + } + {{? $elsePresent }} + else { + {{?}} + {{??}} + if (!{{=$nextValid}}) { + {{?}} + + {{? $elsePresent }} + {{# def.validateIfClause:else }} + } + {{?}} + + if (!{{=$valid}}) { + {{# def.extraError:'if' }} + } + {{? $breakOnError }} else { {{?}} +{{??}} + {{? $breakOnError }} + if (true) { + {{?}} +{{?}} + diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/items.jst b/tunestats/app/api/node_modules/ajv/lib/dot/items.jst new file mode 100644 index 0000000..acc932a --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/items.jst @@ -0,0 +1,98 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + + +{{## def.validateItems:startFrom: + for (var {{=$idx}} = {{=startFrom}}; {{=$idx}} < {{=$data}}.length; {{=$idx}}++) { + {{ + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + }} + + {{# def.generateSubschemaCode }} + {{# def.optimizeValidate }} + + {{? $breakOnError }} + if (!{{=$nextValid}}) break; + {{?}} + } +#}} + +{{ + var $idx = 'i' + $lvl + , $dataNxt = $it.dataLevel = it.dataLevel + 1 + , $nextData = 'data' + $dataNxt + , $currentBaseId = it.baseId; +}} + +var {{=$errs}} = errors; +var {{=$valid}}; + +{{? Array.isArray($schema) }} + {{ /* 'items' is an array of schemas */}} + {{ var $additionalItems = it.schema.additionalItems; }} + {{? $additionalItems === false }} + {{=$valid}} = {{=$data}}.length <= {{= $schema.length }}; + {{ + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalItems'; + }} + {{# def.checkError:'additionalItems' }} + {{ $errSchemaPath = $currErrSchemaPath; }} + {{# def.elseIfValid}} + {{?}} + + {{~ $schema:$sch:$i }} + {{? {{# def.nonEmptySchema:$sch }} }} + {{=$nextValid}} = true; + + if ({{=$data}}.length > {{=$i}}) { + {{ + var $passData = $data + '[' + $i + ']'; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true); + $it.dataPathArr[$dataNxt] = $i; + }} + + {{# def.generateSubschemaCode }} + {{# def.optimizeValidate }} + } + + {{# def.ifResultValid }} + {{?}} + {{~}} + + {{? typeof $additionalItems == 'object' && {{# def.nonEmptySchema:$additionalItems }} }} + {{ + $it.schema = $additionalItems; + $it.schemaPath = it.schemaPath + '.additionalItems'; + $it.errSchemaPath = it.errSchemaPath + '/additionalItems'; + }} + {{=$nextValid}} = true; + + if ({{=$data}}.length > {{= $schema.length }}) { + {{# def.validateItems: $schema.length }} + } + + {{# def.ifResultValid }} + {{?}} + +{{?? {{# def.nonEmptySchema:$schema }} }} + {{ /* 'items' is a single schema */}} + {{ + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + }} + {{# def.validateItems: 0 }} +{{?}} + +{{? $breakOnError }} + {{= $closingBraces }} + if ({{=$errs}} == errors) { +{{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/missing.def b/tunestats/app/api/node_modules/ajv/lib/dot/missing.def new file mode 100644 index 0000000..a73b9f9 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/missing.def @@ -0,0 +1,39 @@ +{{## def.checkMissingProperty:_properties: + {{~ _properties:$propertyKey:$i }} + {{?$i}} || {{?}} + {{ + var $prop = it.util.getProperty($propertyKey) + , $useData = $data + $prop; + }} + ( ({{# def.noPropertyInData }}) && (missing{{=$lvl}} = {{= it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop) }}) ) + {{~}} +#}} + + +{{## def.errorMissingProperty:_error: + {{ + var $propertyPath = 'missing' + $lvl + , $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.opts.jsonPointers + ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) + : $currentErrorPath + ' + ' + $propertyPath; + } + }} + {{# def.error:_error }} +#}} + + +{{## def.allErrorsMissingProperty:_error: + {{ + var $prop = it.util.getProperty($propertyKey) + , $missingProperty = it.util.escapeQuotes($propertyKey) + , $useData = $data + $prop; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + }} + if ({{# def.noPropertyInData }}) { + {{# def.addError:_error }} + } +#}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/multipleOf.jst b/tunestats/app/api/node_modules/ajv/lib/dot/multipleOf.jst new file mode 100644 index 0000000..6d88a45 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/multipleOf.jst @@ -0,0 +1,22 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.$data }} + +{{# def.numberKeyword }} + +var division{{=$lvl}}; +if ({{?$isData}} + {{=$schemaValue}} !== undefined && ( + typeof {{=$schemaValue}} != 'number' || + {{?}} + (division{{=$lvl}} = {{=$data}} / {{=$schemaValue}}, + {{? it.opts.multipleOfPrecision }} + Math.abs(Math.round(division{{=$lvl}}) - division{{=$lvl}}) > 1e-{{=it.opts.multipleOfPrecision}} + {{??}} + division{{=$lvl}} !== parseInt(division{{=$lvl}}) + {{?}} + ) + {{?$isData}} ) {{?}} ) { + {{# def.error:'multipleOf' }} +} {{? $breakOnError }} else { {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/not.jst b/tunestats/app/api/node_modules/ajv/lib/dot/not.jst new file mode 100644 index 0000000..e03185a --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/not.jst @@ -0,0 +1,43 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + +{{? {{# def.nonEmptySchema:$schema }} }} + {{ + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + }} + + var {{=$errs}} = errors; + + {{# def.setCompositeRule }} + + {{ + $it.createErrors = false; + var $allErrorsOption; + if ($it.opts.allErrors) { + $allErrorsOption = $it.opts.allErrors; + $it.opts.allErrors = false; + } + }} + {{= it.validate($it) }} + {{ + $it.createErrors = true; + if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption; + }} + + {{# def.resetCompositeRule }} + + if ({{=$nextValid}}) { + {{# def.error:'not' }} + } else { + {{# def.resetErrors }} + {{? it.opts.allErrors }} } {{?}} +{{??}} + {{# def.addError:'not' }} + {{? $breakOnError}} + if (false) { + {{?}} +{{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/oneOf.jst b/tunestats/app/api/node_modules/ajv/lib/dot/oneOf.jst new file mode 100644 index 0000000..bcce2c6 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/oneOf.jst @@ -0,0 +1,54 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + +{{ + var $currentBaseId = $it.baseId + , $prevValid = 'prevValid' + $lvl + , $passingSchemas = 'passingSchemas' + $lvl; +}} + +var {{=$errs}} = errors + , {{=$prevValid}} = false + , {{=$valid}} = false + , {{=$passingSchemas}} = null; + +{{# def.setCompositeRule }} + +{{~ $schema:$sch:$i }} + {{? {{# def.nonEmptySchema:$sch }} }} + {{ + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + }} + + {{# def.insertSubschemaCode }} + {{??}} + var {{=$nextValid}} = true; + {{?}} + + {{? $i }} + if ({{=$nextValid}} && {{=$prevValid}}) { + {{=$valid}} = false; + {{=$passingSchemas}} = [{{=$passingSchemas}}, {{=$i}}]; + } else { + {{ $closingBraces += '}'; }} + {{?}} + + if ({{=$nextValid}}) { + {{=$valid}} = {{=$prevValid}} = true; + {{=$passingSchemas}} = {{=$i}}; + } +{{~}} + +{{# def.resetCompositeRule }} + +{{= $closingBraces }} + +if (!{{=$valid}}) { + {{# def.extraError:'oneOf' }} +} else { + {{# def.resetErrors }} +{{? it.opts.allErrors }} } {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/pattern.jst b/tunestats/app/api/node_modules/ajv/lib/dot/pattern.jst new file mode 100644 index 0000000..3a37ef6 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/pattern.jst @@ -0,0 +1,14 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.$data }} + +{{ + var $regexp = $isData + ? '(new RegExp(' + $schemaValue + '))' + : it.usePattern($schema); +}} + +if ({{# def.$dataNotType:'string' }} !{{=$regexp}}.test({{=$data}}) ) { + {{# def.error:'pattern' }} +} {{? $breakOnError }} else { {{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/properties.jst b/tunestats/app/api/node_modules/ajv/lib/dot/properties.jst new file mode 100644 index 0000000..5cebb9b --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/properties.jst @@ -0,0 +1,245 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + + +{{## def.validateAdditional: + {{ /* additionalProperties is schema */ + $it.schema = $aProperties; + $it.schemaPath = it.schemaPath + '.additionalProperties'; + $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; + $it.errorPath = it.opts._errorDataPathProperty + ? it.errorPath + : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + }} + + {{# def.generateSubschemaCode }} + {{# def.optimizeValidate }} +#}} + + +{{ + var $key = 'key' + $lvl + , $idx = 'idx' + $lvl + , $dataNxt = $it.dataLevel = it.dataLevel + 1 + , $nextData = 'data' + $dataNxt + , $dataProperties = 'dataProperties' + $lvl; + + var $schemaKeys = Object.keys($schema || {}).filter(notProto) + , $pProperties = it.schema.patternProperties || {} + , $pPropertyKeys = Object.keys($pProperties).filter(notProto) + , $aProperties = it.schema.additionalProperties + , $someProperties = $schemaKeys.length || $pPropertyKeys.length + , $noAdditional = $aProperties === false + , $additionalIsSchema = typeof $aProperties == 'object' + && Object.keys($aProperties).length + , $removeAdditional = it.opts.removeAdditional + , $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional + , $ownProperties = it.opts.ownProperties + , $currentBaseId = it.baseId; + + var $required = it.schema.required; + if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) { + var $requiredHash = it.util.toHash($required); + } + + function notProto(p) { return p !== '__proto__'; } +}} + + +var {{=$errs}} = errors; +var {{=$nextValid}} = true; +{{? $ownProperties }} + var {{=$dataProperties}} = undefined; +{{?}} + +{{? $checkAdditional }} + {{# def.iterateProperties }} + {{? $someProperties }} + var isAdditional{{=$lvl}} = !(false + {{? $schemaKeys.length }} + {{? $schemaKeys.length > 8 }} + || validate.schema{{=$schemaPath}}.hasOwnProperty({{=$key}}) + {{??}} + {{~ $schemaKeys:$propertyKey }} + || {{=$key}} == {{= it.util.toQuotedString($propertyKey) }} + {{~}} + {{?}} + {{?}} + {{? $pPropertyKeys.length }} + {{~ $pPropertyKeys:$pProperty:$i }} + || {{= it.usePattern($pProperty) }}.test({{=$key}}) + {{~}} + {{?}} + ); + + if (isAdditional{{=$lvl}}) { + {{?}} + {{? $removeAdditional == 'all' }} + delete {{=$data}}[{{=$key}}]; + {{??}} + {{ + var $currentErrorPath = it.errorPath; + var $additionalProperty = '\' + ' + $key + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + } + }} + {{? $noAdditional }} + {{? $removeAdditional }} + delete {{=$data}}[{{=$key}}]; + {{??}} + {{=$nextValid}} = false; + {{ + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalProperties'; + }} + {{# def.error:'additionalProperties' }} + {{ $errSchemaPath = $currErrSchemaPath; }} + {{? $breakOnError }} break; {{?}} + {{?}} + {{?? $additionalIsSchema }} + {{? $removeAdditional == 'failing' }} + var {{=$errs}} = errors; + {{# def.setCompositeRule }} + + {{# def.validateAdditional }} + + if (!{{=$nextValid}}) { + errors = {{=$errs}}; + if (validate.errors !== null) { + if (errors) validate.errors.length = errors; + else validate.errors = null; + } + delete {{=$data}}[{{=$key}}]; + } + + {{# def.resetCompositeRule }} + {{??}} + {{# def.validateAdditional }} + {{? $breakOnError }} if (!{{=$nextValid}}) break; {{?}} + {{?}} + {{?}} + {{ it.errorPath = $currentErrorPath; }} + {{?}} + {{? $someProperties }} + } + {{?}} + } + + {{# def.ifResultValid }} +{{?}} + +{{ var $useDefaults = it.opts.useDefaults && !it.compositeRule; }} + +{{? $schemaKeys.length }} + {{~ $schemaKeys:$propertyKey }} + {{ var $sch = $schema[$propertyKey]; }} + + {{? {{# def.nonEmptySchema:$sch}} }} + {{ + var $prop = it.util.getProperty($propertyKey) + , $passData = $data + $prop + , $hasDefault = $useDefaults && $sch.default !== undefined; + $it.schema = $sch; + $it.schemaPath = $schemaPath + $prop; + $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); + $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); + $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); + }} + + {{# def.generateSubschemaCode }} + + {{? {{# def.willOptimize }} }} + {{ + $code = {{# def._optimizeValidate }}; + var $useData = $passData; + }} + {{??}} + {{ var $useData = $nextData; }} + var {{=$nextData}} = {{=$passData}}; + {{?}} + + {{? $hasDefault }} + {{= $code }} + {{??}} + {{? $requiredHash && $requiredHash[$propertyKey] }} + if ({{# def.noPropertyInData }}) { + {{=$nextValid}} = false; + {{ + var $currentErrorPath = it.errorPath + , $currErrSchemaPath = $errSchemaPath + , $missingProperty = it.util.escapeQuotes($propertyKey); + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + $errSchemaPath = it.errSchemaPath + '/required'; + }} + {{# def.error:'required' }} + {{ $errSchemaPath = $currErrSchemaPath; }} + {{ it.errorPath = $currentErrorPath; }} + } else { + {{??}} + {{? $breakOnError }} + if ({{# def.noPropertyInData }}) { + {{=$nextValid}} = true; + } else { + {{??}} + if ({{=$useData}} !== undefined + {{? $ownProperties }} + && {{# def.isOwnProperty }} + {{?}} + ) { + {{?}} + {{?}} + + {{= $code }} + } + {{?}} {{ /* $hasDefault */ }} + {{?}} {{ /* def.nonEmptySchema */ }} + + {{# def.ifResultValid }} + {{~}} +{{?}} + +{{? $pPropertyKeys.length }} + {{~ $pPropertyKeys:$pProperty }} + {{ var $sch = $pProperties[$pProperty]; }} + + {{? {{# def.nonEmptySchema:$sch}} }} + {{ + $it.schema = $sch; + $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); + $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + + it.util.escapeFragment($pProperty); + }} + + {{# def.iterateProperties }} + if ({{= it.usePattern($pProperty) }}.test({{=$key}})) { + {{ + $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + }} + + {{# def.generateSubschemaCode }} + {{# def.optimizeValidate }} + + {{? $breakOnError }} if (!{{=$nextValid}}) break; {{?}} + } + {{? $breakOnError }} else {{=$nextValid}} = true; {{?}} + } + + {{# def.ifResultValid }} + {{?}} {{ /* def.nonEmptySchema */ }} + {{~}} +{{?}} + + +{{? $breakOnError }} + {{= $closingBraces }} + if ({{=$errs}} == errors) { +{{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/propertyNames.jst b/tunestats/app/api/node_modules/ajv/lib/dot/propertyNames.jst new file mode 100644 index 0000000..d456cca --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/propertyNames.jst @@ -0,0 +1,52 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.setupNextLevel }} + +var {{=$errs}} = errors; + +{{? {{# def.nonEmptySchema:$schema }} }} + {{ + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + }} + + {{ + var $key = 'key' + $lvl + , $idx = 'idx' + $lvl + , $i = 'i' + $lvl + , $invalidName = '\' + ' + $key + ' + \'' + , $dataNxt = $it.dataLevel = it.dataLevel + 1 + , $nextData = 'data' + $dataNxt + , $dataProperties = 'dataProperties' + $lvl + , $ownProperties = it.opts.ownProperties + , $currentBaseId = it.baseId; + }} + + {{? $ownProperties }} + var {{=$dataProperties}} = undefined; + {{?}} + {{# def.iterateProperties }} + var startErrs{{=$lvl}} = errors; + + {{ var $passData = $key; }} + {{# def.setCompositeRule }} + {{# def.generateSubschemaCode }} + {{# def.optimizeValidate }} + {{# def.resetCompositeRule }} + + if (!{{=$nextValid}}) { + for (var {{=$i}}=startErrs{{=$lvl}}; {{=$i}}= it.opts.loopRequired + , $ownProperties = it.opts.ownProperties; + }} + + {{? $breakOnError }} + var missing{{=$lvl}}; + {{? $loopRequired }} + {{# def.setupLoop }} + var {{=$valid}} = true; + + {{?$isData}}{{# def.check$dataIsArray }}{{?}} + + for (var {{=$i}} = 0; {{=$i}} < {{=$vSchema}}.length; {{=$i}}++) { + {{=$valid}} = {{=$data}}[{{=$vSchema}}[{{=$i}}]] !== undefined + {{? $ownProperties }} + && {{# def.isRequiredOwnProperty }} + {{?}}; + if (!{{=$valid}}) break; + } + + {{? $isData }} } {{?}} + + {{# def.checkError:'required' }} + else { + {{??}} + if ({{# def.checkMissingProperty:$required }}) { + {{# def.errorMissingProperty:'required' }} + } else { + {{?}} + {{??}} + {{? $loopRequired }} + {{# def.setupLoop }} + {{? $isData }} + if ({{=$vSchema}} && !Array.isArray({{=$vSchema}})) { + {{# def.addError:'required' }} + } else if ({{=$vSchema}} !== undefined) { + {{?}} + + for (var {{=$i}} = 0; {{=$i}} < {{=$vSchema}}.length; {{=$i}}++) { + if ({{=$data}}[{{=$vSchema}}[{{=$i}}]] === undefined + {{? $ownProperties }} + || !{{# def.isRequiredOwnProperty }} + {{?}}) { + {{# def.addError:'required' }} + } + } + + {{? $isData }} } {{?}} + {{??}} + {{~ $required:$propertyKey }} + {{# def.allErrorsMissingProperty:'required' }} + {{~}} + {{?}} + {{?}} + + {{ it.errorPath = $currentErrorPath; }} + +{{?? $breakOnError }} + if (true) { +{{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/uniqueItems.jst b/tunestats/app/api/node_modules/ajv/lib/dot/uniqueItems.jst new file mode 100644 index 0000000..e69b830 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/uniqueItems.jst @@ -0,0 +1,62 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.setupKeyword }} +{{# def.$data }} + + +{{? ($schema || $isData) && it.opts.uniqueItems !== false }} + {{? $isData }} + var {{=$valid}}; + if ({{=$schemaValue}} === false || {{=$schemaValue}} === undefined) + {{=$valid}} = true; + else if (typeof {{=$schemaValue}} != 'boolean') + {{=$valid}} = false; + else { + {{?}} + + var i = {{=$data}}.length + , {{=$valid}} = true + , j; + if (i > 1) { + {{ + var $itemType = it.schema.items && it.schema.items.type + , $typeIsArray = Array.isArray($itemType); + }} + {{? !$itemType || $itemType == 'object' || $itemType == 'array' || + ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0)) }} + outer: + for (;i--;) { + for (j = i; j--;) { + if (equal({{=$data}}[i], {{=$data}}[j])) { + {{=$valid}} = false; + break outer; + } + } + } + {{??}} + var itemIndices = {}, item; + for (;i--;) { + var item = {{=$data}}[i]; + {{ var $method = 'checkDataType' + ($typeIsArray ? 's' : ''); }} + if ({{= it.util[$method]($itemType, 'item', it.opts.strictNumbers, true) }}) continue; + {{? $typeIsArray}} + if (typeof item == 'string') item = '"' + item; + {{?}} + if (typeof itemIndices[item] == 'number') { + {{=$valid}} = false; + j = itemIndices[item]; + break; + } + itemIndices[item] = i; + } + {{?}} + } + + {{? $isData }} } {{?}} + + if (!{{=$valid}}) { + {{# def.error:'uniqueItems' }} + } {{? $breakOnError }} else { {{?}} +{{??}} + {{? $breakOnError }} if (true) { {{?}} +{{?}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dot/validate.jst b/tunestats/app/api/node_modules/ajv/lib/dot/validate.jst new file mode 100644 index 0000000..32087e7 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dot/validate.jst @@ -0,0 +1,276 @@ +{{# def.definitions }} +{{# def.errors }} +{{# def.defaults }} +{{# def.coerce }} + +{{ /** + * schema compilation (render) time: + * it = { schema, RULES, _validate, opts } + * it.validate - this template function, + * it is used recursively to generate code for subschemas + * + * runtime: + * "validate" is a variable name to which this function will be assigned + * validateRef etc. are defined in the parent scope in index.js + */ }} + +{{ + var $async = it.schema.$async === true + , $refKeywords = it.util.schemaHasRulesExcept(it.schema, it.RULES.all, '$ref') + , $id = it.self._getId(it.schema); +}} + +{{ + if (it.opts.strictKeywords) { + var $unknownKwd = it.util.schemaUnknownRules(it.schema, it.RULES.keywords); + if ($unknownKwd) { + var $keywordsMsg = 'unknown keyword: ' + $unknownKwd; + if (it.opts.strictKeywords === 'log') it.logger.warn($keywordsMsg); + else throw new Error($keywordsMsg); + } + } +}} + +{{? it.isTop }} + var validate = {{?$async}}{{it.async = true;}}async {{?}}function(data, dataPath, parentData, parentDataProperty, rootData) { + 'use strict'; + {{? $id && (it.opts.sourceCode || it.opts.processCode) }} + {{= '/\*# sourceURL=' + $id + ' */' }} + {{?}} +{{?}} + +{{? typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref) }} + {{ var $keyword = 'false schema'; }} + {{# def.setupKeyword }} + {{? it.schema === false}} + {{? it.isTop}} + {{ $breakOnError = true; }} + {{??}} + var {{=$valid}} = false; + {{?}} + {{# def.error:'false schema' }} + {{??}} + {{? it.isTop}} + {{? $async }} + return data; + {{??}} + validate.errors = null; + return true; + {{?}} + {{??}} + var {{=$valid}} = true; + {{?}} + {{?}} + + {{? it.isTop}} + }; + return validate; + {{?}} + + {{ return out; }} +{{?}} + + +{{? it.isTop }} + {{ + var $top = it.isTop + , $lvl = it.level = 0 + , $dataLvl = it.dataLevel = 0 + , $data = 'data'; + it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema)); + it.baseId = it.baseId || it.rootId; + delete it.isTop; + + it.dataPathArr = [""]; + + if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored in the schema root'; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + }} + + var vErrors = null; {{ /* don't edit, used in replace */ }} + var errors = 0; {{ /* don't edit, used in replace */ }} + if (rootData === undefined) rootData = data; {{ /* don't edit, used in replace */ }} +{{??}} + {{ + var $lvl = it.level + , $dataLvl = it.dataLevel + , $data = 'data' + ($dataLvl || ''); + + if ($id) it.baseId = it.resolve.url(it.baseId, $id); + + if ($async && !it.async) throw new Error('async schema in sync schema'); + }} + + var errs_{{=$lvl}} = errors; +{{?}} + +{{ + var $valid = 'valid' + $lvl + , $breakOnError = !it.opts.allErrors + , $closingBraces1 = '' + , $closingBraces2 = ''; + + var $errorKeyword; + var $typeSchema = it.schema.type + , $typeIsArray = Array.isArray($typeSchema); + + if ($typeSchema && it.opts.nullable && it.schema.nullable === true) { + if ($typeIsArray) { + if ($typeSchema.indexOf('null') == -1) + $typeSchema = $typeSchema.concat('null'); + } else if ($typeSchema != 'null') { + $typeSchema = [$typeSchema, 'null']; + $typeIsArray = true; + } + } + + if ($typeIsArray && $typeSchema.length == 1) { + $typeSchema = $typeSchema[0]; + $typeIsArray = false; + } +}} + +{{## def.checkType: + {{ + var $schemaPath = it.schemaPath + '.type' + , $errSchemaPath = it.errSchemaPath + '/type' + , $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType'; + }} + + if ({{= it.util[$method]($typeSchema, $data, it.opts.strictNumbers, true) }}) { +#}} + +{{? it.schema.$ref && $refKeywords }} + {{? it.opts.extendRefs == 'fail' }} + {{ throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)'); }} + {{?? it.opts.extendRefs !== true }} + {{ + $refKeywords = false; + it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"'); + }} + {{?}} +{{?}} + +{{? it.schema.$comment && it.opts.$comment }} + {{= it.RULES.all.$comment.code(it, '$comment') }} +{{?}} + +{{? $typeSchema }} + {{? it.opts.coerceTypes }} + {{ var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema); }} + {{?}} + + {{ var $rulesGroup = it.RULES.types[$typeSchema]; }} + {{? $coerceToTypes || $typeIsArray || $rulesGroup === true || + ($rulesGroup && !$shouldUseGroup($rulesGroup)) }} + {{ + var $schemaPath = it.schemaPath + '.type' + , $errSchemaPath = it.errSchemaPath + '/type'; + }} + {{# def.checkType }} + {{? $coerceToTypes }} + {{# def.coerceType }} + {{??}} + {{# def.error:'type' }} + {{?}} + } + {{?}} +{{?}} + + +{{? it.schema.$ref && !$refKeywords }} + {{= it.RULES.all.$ref.code(it, '$ref') }} + {{? $breakOnError }} + } + if (errors === {{?$top}}0{{??}}errs_{{=$lvl}}{{?}}) { + {{ $closingBraces2 += '}'; }} + {{?}} +{{??}} + {{~ it.RULES:$rulesGroup }} + {{? $shouldUseGroup($rulesGroup) }} + {{? $rulesGroup.type }} + if ({{= it.util.checkDataType($rulesGroup.type, $data, it.opts.strictNumbers) }}) { + {{?}} + {{? it.opts.useDefaults }} + {{? $rulesGroup.type == 'object' && it.schema.properties }} + {{# def.defaultProperties }} + {{?? $rulesGroup.type == 'array' && Array.isArray(it.schema.items) }} + {{# def.defaultItems }} + {{?}} + {{?}} + {{~ $rulesGroup.rules:$rule }} + {{? $shouldUseRule($rule) }} + {{ var $code = $rule.code(it, $rule.keyword, $rulesGroup.type); }} + {{? $code }} + {{= $code }} + {{? $breakOnError }} + {{ $closingBraces1 += '}'; }} + {{?}} + {{?}} + {{?}} + {{~}} + {{? $breakOnError }} + {{= $closingBraces1 }} + {{ $closingBraces1 = ''; }} + {{?}} + {{? $rulesGroup.type }} + } + {{? $typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes }} + else { + {{ + var $schemaPath = it.schemaPath + '.type' + , $errSchemaPath = it.errSchemaPath + '/type'; + }} + {{# def.error:'type' }} + } + {{?}} + {{?}} + + {{? $breakOnError }} + if (errors === {{?$top}}0{{??}}errs_{{=$lvl}}{{?}}) { + {{ $closingBraces2 += '}'; }} + {{?}} + {{?}} + {{~}} +{{?}} + +{{? $breakOnError }} {{= $closingBraces2 }} {{?}} + +{{? $top }} + {{? $async }} + if (errors === 0) return data; {{ /* don't edit, used in replace */ }} + else throw new ValidationError(vErrors); {{ /* don't edit, used in replace */ }} + {{??}} + validate.errors = vErrors; {{ /* don't edit, used in replace */ }} + return errors === 0; {{ /* don't edit, used in replace */ }} + {{?}} + }; + + return validate; +{{??}} + var {{=$valid}} = errors === errs_{{=$lvl}}; +{{?}} + +{{ + function $shouldUseGroup($rulesGroup) { + var rules = $rulesGroup.rules; + for (var i=0; i < rules.length; i++) + if ($shouldUseRule(rules[i])) + return true; + } + + function $shouldUseRule($rule) { + return it.schema[$rule.keyword] !== undefined || + ($rule.implements && $ruleImplementsSomeKeyword($rule)); + } + + function $ruleImplementsSomeKeyword($rule) { + var impl = $rule.implements; + for (var i=0; i < impl.length; i++) + if (it.schema[impl[i]] !== undefined) + return true; + } +}} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/README.md b/tunestats/app/api/node_modules/ajv/lib/dotjs/README.md new file mode 100644 index 0000000..4d99484 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/README.md @@ -0,0 +1,3 @@ +These files are compiled dot templates from dot folder. + +Do NOT edit them directly, edit the templates and run `npm run build` from main ajv folder. diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/_limit.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/_limit.js new file mode 100644 index 0000000..05a1979 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/_limit.js @@ -0,0 +1,163 @@ +'use strict'; +module.exports = function generate__limit(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $isMax = $keyword == 'maximum', + $exclusiveKeyword = $isMax ? 'exclusiveMaximum' : 'exclusiveMinimum', + $schemaExcl = it.schema[$exclusiveKeyword], + $isDataExcl = it.opts.$data && $schemaExcl && $schemaExcl.$data, + $op = $isMax ? '<' : '>', + $notOp = $isMax ? '>' : '<', + $errorKeyword = undefined; + if (!($isData || typeof $schema == 'number' || $schema === undefined)) { + throw new Error($keyword + ' must be number'); + } + if (!($isDataExcl || $schemaExcl === undefined || typeof $schemaExcl == 'number' || typeof $schemaExcl == 'boolean')) { + throw new Error($exclusiveKeyword + ' must be number or boolean'); + } + if ($isDataExcl) { + var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr), + $exclusive = 'exclusive' + $lvl, + $exclType = 'exclType' + $lvl, + $exclIsNumber = 'exclIsNumber' + $lvl, + $opExpr = 'op' + $lvl, + $opStr = '\' + ' + $opExpr + ' + \''; + out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; '; + $schemaValueExcl = 'schemaExcl' + $lvl; + out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { '; + var $errorKeyword = $exclusiveKeyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; '; + if ($schema === undefined) { + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $schemaValue = $schemaValueExcl; + $isData = $isDataExcl; + } + } else { + var $exclIsNumber = typeof $schemaExcl == 'number', + $opStr = $op; + if ($exclIsNumber && $isData) { + var $opExpr = '\'' + $opStr + '\''; + out += ' if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { '; + } else { + if ($exclIsNumber && $schema === undefined) { + $exclusive = true; + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $schemaValue = $schemaExcl; + $notOp += '='; + } else { + if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); + if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { + $exclusive = true; + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $notOp += '='; + } else { + $exclusive = false; + $opStr += '='; + } + } + var $opExpr = '\'' + $opStr + '\''; + out += ' if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { '; + } + } + $errorKeyword = $errorKeyword || $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be ' + ($opStr) + ' '; + if ($isData) { + out += '\' + ' + ($schemaValue); + } else { + out += '' + ($schemaValue) + '\''; + } + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/_limitItems.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/_limitItems.js new file mode 100644 index 0000000..e092a55 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/_limitItems.js @@ -0,0 +1,80 @@ +'use strict'; +module.exports = function generate__limitItems(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!($isData || typeof $schema == 'number')) { + throw new Error($keyword + ' must be number'); + } + var $op = $keyword == 'maxItems' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have '; + if ($keyword == 'maxItems') { + out += 'more'; + } else { + out += 'fewer'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' items\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/_limitLength.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/_limitLength.js new file mode 100644 index 0000000..ecbd3fe --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/_limitLength.js @@ -0,0 +1,85 @@ +'use strict'; +module.exports = function generate__limitLength(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!($isData || typeof $schema == 'number')) { + throw new Error($keyword + ' must be number'); + } + var $op = $keyword == 'maxLength' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + if (it.opts.unicode === false) { + out += ' ' + ($data) + '.length '; + } else { + out += ' ucs2length(' + ($data) + ') '; + } + out += ' ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitLength') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be '; + if ($keyword == 'maxLength') { + out += 'longer'; + } else { + out += 'shorter'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' characters\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/_limitProperties.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/_limitProperties.js new file mode 100644 index 0000000..d232755 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/_limitProperties.js @@ -0,0 +1,80 @@ +'use strict'; +module.exports = function generate__limitProperties(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!($isData || typeof $schema == 'number')) { + throw new Error($keyword + ' must be number'); + } + var $op = $keyword == 'maxProperties' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' Object.keys(' + ($data) + ').length ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have '; + if ($keyword == 'maxProperties') { + out += 'more'; + } else { + out += 'fewer'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' properties\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/allOf.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/allOf.js new file mode 100644 index 0000000..fb8c2e4 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/allOf.js @@ -0,0 +1,42 @@ +'use strict'; +module.exports = function generate_allOf(it, $keyword, $ruleType) { + var out = ' '; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $currentBaseId = $it.baseId, + $allSchemasEmpty = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + $allSchemasEmpty = false; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if ($breakOnError) { + if ($allSchemasEmpty) { + out += ' if (true) { '; + } else { + out += ' ' + ($closingBraces.slice(0, -1)) + ' '; + } + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/anyOf.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/anyOf.js new file mode 100644 index 0000000..0600a9d --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/anyOf.js @@ -0,0 +1,73 @@ +'use strict'; +module.exports = function generate_anyOf(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $noEmptySchema = $schema.every(function($sch) { + return (it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all)); + }); + if ($noEmptySchema) { + var $currentBaseId = $it.baseId; + out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = false; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($valid) + ' || ' + ($nextValid) + '; if (!' + ($valid) + ') { '; + $closingBraces += '}'; + } + } + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' ' + ($closingBraces) + ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('anyOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should match some schema in anyOf\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; return false; '; + } + } + out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + if (it.opts.allErrors) { + out += ' } '; + } + } else { + if ($breakOnError) { + out += ' if (true) { '; + } + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/comment.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/comment.js new file mode 100644 index 0000000..dd66bb8 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/comment.js @@ -0,0 +1,14 @@ +'use strict'; +module.exports = function generate_comment(it, $keyword, $ruleType) { + var out = ' '; + var $schema = it.schema[$keyword]; + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $comment = it.util.toQuotedString($schema); + if (it.opts.$comment === true) { + out += ' console.log(' + ($comment) + ');'; + } else if (typeof it.opts.$comment == 'function') { + out += ' self._opts.$comment(' + ($comment) + ', ' + (it.util.toQuotedString($errSchemaPath)) + ', validate.root.schema);'; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/const.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/const.js new file mode 100644 index 0000000..15b7c61 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/const.js @@ -0,0 +1,56 @@ +'use strict'; +module.exports = function generate_const(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!$isData) { + out += ' var schema' + ($lvl) + ' = validate.schema' + ($schemaPath) + ';'; + } + out += 'var ' + ($valid) + ' = equal(' + ($data) + ', schema' + ($lvl) + '); if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('const') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValue: schema' + ($lvl) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be equal to constant\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' }'; + if ($breakOnError) { + out += ' else { '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/contains.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/contains.js new file mode 100644 index 0000000..7d76300 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/contains.js @@ -0,0 +1,81 @@ +'use strict'; +module.exports = function generate_contains(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $idx = 'i' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $currentBaseId = it.baseId, + $nonEmptySchema = (it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all)); + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if ($nonEmptySchema) { + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($nextValid) + ' = false; for (var ' + ($idx) + ' = 0; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' if (' + ($nextValid) + ') break; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' ' + ($closingBraces) + ' if (!' + ($nextValid) + ') {'; + } else { + out += ' if (' + ($data) + '.length == 0) {'; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('contains') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should contain a valid item\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + if ($nonEmptySchema) { + out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + } + if (it.opts.allErrors) { + out += ' } '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/custom.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/custom.js new file mode 100644 index 0000000..f3e641e --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/custom.js @@ -0,0 +1,228 @@ +'use strict'; +module.exports = function generate_custom(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $rule = this, + $definition = 'definition' + $lvl, + $rDef = $rule.definition, + $closingBraces = ''; + var $compile, $inline, $macro, $ruleValidate, $validateCode; + if ($isData && $rDef.$data) { + $validateCode = 'keywordValidate' + $lvl; + var $validateSchema = $rDef.validateSchema; + out += ' var ' + ($definition) + ' = RULES.custom[\'' + ($keyword) + '\'].definition; var ' + ($validateCode) + ' = ' + ($definition) + '.validate;'; + } else { + $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it); + if (!$ruleValidate) return; + $schemaValue = 'validate.schema' + $schemaPath; + $validateCode = $ruleValidate.code; + $compile = $rDef.compile; + $inline = $rDef.inline; + $macro = $rDef.macro; + } + var $ruleErrs = $validateCode + '.errors', + $i = 'i' + $lvl, + $ruleErr = 'ruleErr' + $lvl, + $asyncKeyword = $rDef.async; + if ($asyncKeyword && !it.async) throw new Error('async keyword in sync schema'); + if (!($inline || $macro)) { + out += '' + ($ruleErrs) + ' = null;'; + } + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if ($isData && $rDef.$data) { + $closingBraces += '}'; + out += ' if (' + ($schemaValue) + ' === undefined) { ' + ($valid) + ' = true; } else { '; + if ($validateSchema) { + $closingBraces += '}'; + out += ' ' + ($valid) + ' = ' + ($definition) + '.validateSchema(' + ($schemaValue) + '); if (' + ($valid) + ') { '; + } + } + if ($inline) { + if ($rDef.statements) { + out += ' ' + ($ruleValidate.validate) + ' '; + } else { + out += ' ' + ($valid) + ' = ' + ($ruleValidate.validate) + '; '; + } + } else if ($macro) { + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + $it.schema = $ruleValidate.validate; + $it.schemaPath = ''; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var $code = it.validate($it).replace(/validate\.schema/g, $validateCode); + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' ' + ($code); + } else { + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; + out += ' ' + ($validateCode) + '.call( '; + if (it.opts.passContext) { + out += 'this'; + } else { + out += 'self'; + } + if ($compile || $rDef.schema === false) { + out += ' , ' + ($data) + ' '; + } else { + out += ' , ' + ($schemaValue) + ' , ' + ($data) + ' , validate.schema' + (it.schemaPath) + ' '; + } + out += ' , (dataPath || \'\')'; + if (it.errorPath != '""') { + out += ' + ' + (it.errorPath); + } + var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', + $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; + out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ' , rootData ) '; + var def_callRuleValidate = out; + out = $$outStack.pop(); + if ($rDef.errors === false) { + out += ' ' + ($valid) + ' = '; + if ($asyncKeyword) { + out += 'await '; + } + out += '' + (def_callRuleValidate) + '; '; + } else { + if ($asyncKeyword) { + $ruleErrs = 'customErrors' + $lvl; + out += ' var ' + ($ruleErrs) + ' = null; try { ' + ($valid) + ' = await ' + (def_callRuleValidate) + '; } catch (e) { ' + ($valid) + ' = false; if (e instanceof ValidationError) ' + ($ruleErrs) + ' = e.errors; else throw e; } '; + } else { + out += ' ' + ($ruleErrs) + ' = null; ' + ($valid) + ' = ' + (def_callRuleValidate) + '; '; + } + } + } + if ($rDef.modifying) { + out += ' if (' + ($parentData) + ') ' + ($data) + ' = ' + ($parentData) + '[' + ($parentDataProperty) + '];'; + } + out += '' + ($closingBraces); + if ($rDef.valid) { + if ($breakOnError) { + out += ' if (true) { '; + } + } else { + out += ' if ( '; + if ($rDef.valid === undefined) { + out += ' !'; + if ($macro) { + out += '' + ($nextValid); + } else { + out += '' + ($valid); + } + } else { + out += ' ' + (!$rDef.valid) + ' '; + } + out += ') { '; + $errorKeyword = $rule.keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'custom') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { keyword: \'' + ($rule.keyword) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should pass "' + ($rule.keyword) + '" keyword validation\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + var def_customError = out; + out = $$outStack.pop(); + if ($inline) { + if ($rDef.errors) { + if ($rDef.errors != 'full') { + out += ' for (var ' + ($i) + '=' + ($errs) + '; ' + ($i) + ' 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + out += ' ' + ($nextValid) + ' = true; if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; + } + out += ') { '; + $it.schema = $sch; + $it.schemaPath = $schemaPath + it.util.getProperty($property); + $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property); + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/enum.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/enum.js new file mode 100644 index 0000000..90580b9 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/enum.js @@ -0,0 +1,66 @@ +'use strict'; +module.exports = function generate_enum(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $i = 'i' + $lvl, + $vSchema = 'schema' + $lvl; + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + ';'; + } + out += 'var ' + ($valid) + ';'; + if ($isData) { + out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; + } + out += '' + ($valid) + ' = false;for (var ' + ($i) + '=0; ' + ($i) + '<' + ($vSchema) + '.length; ' + ($i) + '++) if (equal(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + '])) { ' + ($valid) + ' = true; break; }'; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('enum') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValues: schema' + ($lvl) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be equal to one of the allowed values\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' }'; + if ($breakOnError) { + out += ' else { '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/format.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/format.js new file mode 100644 index 0000000..cd9a569 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/format.js @@ -0,0 +1,150 @@ +'use strict'; +module.exports = function generate_format(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + if (it.opts.format === false) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $unknownFormats = it.opts.unknownFormats, + $allowUnknown = Array.isArray($unknownFormats); + if ($isData) { + var $format = 'format' + $lvl, + $isObject = 'isObject' + $lvl, + $formatType = 'formatType' + $lvl; + out += ' var ' + ($format) + ' = formats[' + ($schemaValue) + ']; var ' + ($isObject) + ' = typeof ' + ($format) + ' == \'object\' && !(' + ($format) + ' instanceof RegExp) && ' + ($format) + '.validate; var ' + ($formatType) + ' = ' + ($isObject) + ' && ' + ($format) + '.type || \'string\'; if (' + ($isObject) + ') { '; + if (it.async) { + out += ' var async' + ($lvl) + ' = ' + ($format) + '.async; '; + } + out += ' ' + ($format) + ' = ' + ($format) + '.validate; } if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; + } + out += ' ('; + if ($unknownFormats != 'ignore') { + out += ' (' + ($schemaValue) + ' && !' + ($format) + ' '; + if ($allowUnknown) { + out += ' && self._opts.unknownFormats.indexOf(' + ($schemaValue) + ') == -1 '; + } + out += ') || '; + } + out += ' (' + ($format) + ' && ' + ($formatType) + ' == \'' + ($ruleType) + '\' && !(typeof ' + ($format) + ' == \'function\' ? '; + if (it.async) { + out += ' (async' + ($lvl) + ' ? await ' + ($format) + '(' + ($data) + ') : ' + ($format) + '(' + ($data) + ')) '; + } else { + out += ' ' + ($format) + '(' + ($data) + ') '; + } + out += ' : ' + ($format) + '.test(' + ($data) + '))))) {'; + } else { + var $format = it.formats[$schema]; + if (!$format) { + if ($unknownFormats == 'ignore') { + it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"'); + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } else if ($allowUnknown && $unknownFormats.indexOf($schema) >= 0) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } else { + throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"'); + } + } + var $isObject = typeof $format == 'object' && !($format instanceof RegExp) && $format.validate; + var $formatType = $isObject && $format.type || 'string'; + if ($isObject) { + var $async = $format.async === true; + $format = $format.validate; + } + if ($formatType != $ruleType) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } + if ($async) { + if (!it.async) throw new Error('async format in sync schema'); + var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate'; + out += ' if (!(await ' + ($formatRef) + '(' + ($data) + '))) { '; + } else { + out += ' if (! '; + var $formatRef = 'formats' + it.util.getProperty($schema); + if ($isObject) $formatRef += '.validate'; + if (typeof $format == 'function') { + out += ' ' + ($formatRef) + '(' + ($data) + ') '; + } else { + out += ' ' + ($formatRef) + '.test(' + ($data) + ') '; + } + out += ') { '; + } + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('format') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { format: '; + if ($isData) { + out += '' + ($schemaValue); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match format "'; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + (it.util.escapeQuotes($schema)); + } + out += '"\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/if.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/if.js new file mode 100644 index 0000000..94d27ad --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/if.js @@ -0,0 +1,103 @@ +'use strict'; +module.exports = function generate_if(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + $it.level++; + var $nextValid = 'valid' + $it.level; + var $thenSch = it.schema['then'], + $elseSch = it.schema['else'], + $thenPresent = $thenSch !== undefined && (it.opts.strictKeywords ? (typeof $thenSch == 'object' && Object.keys($thenSch).length > 0) || $thenSch === false : it.util.schemaHasRules($thenSch, it.RULES.all)), + $elsePresent = $elseSch !== undefined && (it.opts.strictKeywords ? (typeof $elseSch == 'object' && Object.keys($elseSch).length > 0) || $elseSch === false : it.util.schemaHasRules($elseSch, it.RULES.all)), + $currentBaseId = $it.baseId; + if ($thenPresent || $elsePresent) { + var $ifClause; + $it.createErrors = false; + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = true; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + $it.createErrors = true; + out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + if ($thenPresent) { + out += ' if (' + ($nextValid) + ') { '; + $it.schema = it.schema['then']; + $it.schemaPath = it.schemaPath + '.then'; + $it.errSchemaPath = it.errSchemaPath + '/then'; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; + if ($thenPresent && $elsePresent) { + $ifClause = 'ifClause' + $lvl; + out += ' var ' + ($ifClause) + ' = \'then\'; '; + } else { + $ifClause = '\'then\''; + } + out += ' } '; + if ($elsePresent) { + out += ' else { '; + } + } else { + out += ' if (!' + ($nextValid) + ') { '; + } + if ($elsePresent) { + $it.schema = it.schema['else']; + $it.schemaPath = it.schemaPath + '.else'; + $it.errSchemaPath = it.errSchemaPath + '/else'; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; + if ($thenPresent && $elsePresent) { + $ifClause = 'ifClause' + $lvl; + out += ' var ' + ($ifClause) + ' = \'else\'; '; + } else { + $ifClause = '\'else\''; + } + out += ' } '; + } + out += ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('if') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { failingKeyword: ' + ($ifClause) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match "\' + ' + ($ifClause) + ' + \'" schema\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; return false; '; + } + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + } else { + if ($breakOnError) { + out += ' if (true) { '; + } + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/index.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/index.js new file mode 100644 index 0000000..2fb1b00 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/index.js @@ -0,0 +1,33 @@ +'use strict'; + +//all requires must be explicit because browserify won't work with dynamic requires +module.exports = { + '$ref': require('./ref'), + allOf: require('./allOf'), + anyOf: require('./anyOf'), + '$comment': require('./comment'), + const: require('./const'), + contains: require('./contains'), + dependencies: require('./dependencies'), + 'enum': require('./enum'), + format: require('./format'), + 'if': require('./if'), + items: require('./items'), + maximum: require('./_limit'), + minimum: require('./_limit'), + maxItems: require('./_limitItems'), + minItems: require('./_limitItems'), + maxLength: require('./_limitLength'), + minLength: require('./_limitLength'), + maxProperties: require('./_limitProperties'), + minProperties: require('./_limitProperties'), + multipleOf: require('./multipleOf'), + not: require('./not'), + oneOf: require('./oneOf'), + pattern: require('./pattern'), + properties: require('./properties'), + propertyNames: require('./propertyNames'), + required: require('./required'), + uniqueItems: require('./uniqueItems'), + validate: require('./validate') +}; diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/items.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/items.js new file mode 100644 index 0000000..bee5d67 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/items.js @@ -0,0 +1,140 @@ +'use strict'; +module.exports = function generate_items(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $idx = 'i' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $currentBaseId = it.baseId; + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if (Array.isArray($schema)) { + var $additionalItems = it.schema.additionalItems; + if ($additionalItems === false) { + out += ' ' + ($valid) + ' = ' + ($data) + '.length <= ' + ($schema.length) + '; '; + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalItems'; + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('additionalItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schema.length) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have more than ' + ($schema.length) + ' items\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + $errSchemaPath = $currErrSchemaPath; + if ($breakOnError) { + $closingBraces += '}'; + out += ' else { '; + } + } + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($i) + ') { '; + var $passData = $data + '[' + $i + ']'; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true); + $it.dataPathArr[$dataNxt] = $i; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if (typeof $additionalItems == 'object' && (it.opts.strictKeywords ? (typeof $additionalItems == 'object' && Object.keys($additionalItems).length > 0) || $additionalItems === false : it.util.schemaHasRules($additionalItems, it.RULES.all))) { + $it.schema = $additionalItems; + $it.schemaPath = it.schemaPath + '.additionalItems'; + $it.errSchemaPath = it.errSchemaPath + '/additionalItems'; + out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($schema.length) + ') { for (var ' + ($idx) + ' = ' + ($schema.length) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' } } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } else if ((it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' for (var ' + ($idx) + ' = ' + (0) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' }'; + } + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/multipleOf.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/multipleOf.js new file mode 100644 index 0000000..9d6401b --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/multipleOf.js @@ -0,0 +1,80 @@ +'use strict'; +module.exports = function generate_multipleOf(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!($isData || typeof $schema == 'number')) { + throw new Error($keyword + ' must be number'); + } + out += 'var division' + ($lvl) + ';if ('; + if ($isData) { + out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || '; + } + out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', '; + if (it.opts.multipleOfPrecision) { + out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' '; + } else { + out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') '; + } + out += ' ) '; + if ($isData) { + out += ' ) '; + } + out += ' ) { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be multiple of '; + if ($isData) { + out += '\' + ' + ($schemaValue); + } else { + out += '' + ($schemaValue) + '\''; + } + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/not.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/not.js new file mode 100644 index 0000000..f50c937 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/not.js @@ -0,0 +1,84 @@ +'use strict'; +module.exports = function generate_not(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + $it.level++; + var $nextValid = 'valid' + $it.level; + if ((it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($errs) + ' = errors; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.createErrors = false; + var $allErrorsOption; + if ($it.opts.allErrors) { + $allErrorsOption = $it.opts.allErrors; + $it.opts.allErrors = false; + } + out += ' ' + (it.validate($it)) + ' '; + $it.createErrors = true; + if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption; + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' if (' + ($nextValid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be valid\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + if (it.opts.allErrors) { + out += ' } '; + } + } else { + out += ' var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be valid\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if ($breakOnError) { + out += ' if (false) { '; + } + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/oneOf.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/oneOf.js new file mode 100644 index 0000000..dfe2fd5 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/oneOf.js @@ -0,0 +1,73 @@ +'use strict'; +module.exports = function generate_oneOf(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $currentBaseId = $it.baseId, + $prevValid = 'prevValid' + $lvl, + $passingSchemas = 'passingSchemas' + $lvl; + out += 'var ' + ($errs) + ' = errors , ' + ($prevValid) + ' = false , ' + ($valid) + ' = false , ' + ($passingSchemas) + ' = null; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + } else { + out += ' var ' + ($nextValid) + ' = true; '; + } + if ($i) { + out += ' if (' + ($nextValid) + ' && ' + ($prevValid) + ') { ' + ($valid) + ' = false; ' + ($passingSchemas) + ' = [' + ($passingSchemas) + ', ' + ($i) + ']; } else { '; + $closingBraces += '}'; + } + out += ' if (' + ($nextValid) + ') { ' + ($valid) + ' = ' + ($prevValid) + ' = true; ' + ($passingSchemas) + ' = ' + ($i) + '; }'; + } + } + it.compositeRule = $it.compositeRule = $wasComposite; + out += '' + ($closingBraces) + 'if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('oneOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { passingSchemas: ' + ($passingSchemas) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match exactly one schema in oneOf\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; return false; '; + } + } + out += '} else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; }'; + if (it.opts.allErrors) { + out += ' } '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/pattern.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/pattern.js new file mode 100644 index 0000000..1d74d6b --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/pattern.js @@ -0,0 +1,75 @@ +'use strict'; +module.exports = function generate_pattern(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $regexp = $isData ? '(new RegExp(' + $schemaValue + '))' : it.usePattern($schema); + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; + } + out += ' !' + ($regexp) + '.test(' + ($data) + ') ) { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('pattern') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { pattern: '; + if ($isData) { + out += '' + ($schemaValue); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match pattern "'; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + (it.util.escapeQuotes($schema)); + } + out += '"\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/properties.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/properties.js new file mode 100644 index 0000000..bc5ee55 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/properties.js @@ -0,0 +1,335 @@ +'use strict'; +module.exports = function generate_properties(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $key = 'key' + $lvl, + $idx = 'idx' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $dataProperties = 'dataProperties' + $lvl; + var $schemaKeys = Object.keys($schema || {}).filter(notProto), + $pProperties = it.schema.patternProperties || {}, + $pPropertyKeys = Object.keys($pProperties).filter(notProto), + $aProperties = it.schema.additionalProperties, + $someProperties = $schemaKeys.length || $pPropertyKeys.length, + $noAdditional = $aProperties === false, + $additionalIsSchema = typeof $aProperties == 'object' && Object.keys($aProperties).length, + $removeAdditional = it.opts.removeAdditional, + $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional, + $ownProperties = it.opts.ownProperties, + $currentBaseId = it.baseId; + var $required = it.schema.required; + if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) { + var $requiredHash = it.util.toHash($required); + } + + function notProto(p) { + return p !== '__proto__'; + } + out += 'var ' + ($errs) + ' = errors;var ' + ($nextValid) + ' = true;'; + if ($ownProperties) { + out += ' var ' + ($dataProperties) + ' = undefined;'; + } + if ($checkAdditional) { + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + if ($someProperties) { + out += ' var isAdditional' + ($lvl) + ' = !(false '; + if ($schemaKeys.length) { + if ($schemaKeys.length > 8) { + out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') '; + } else { + var arr1 = $schemaKeys; + if (arr1) { + var $propertyKey, i1 = -1, + l1 = arr1.length - 1; + while (i1 < l1) { + $propertyKey = arr1[i1 += 1]; + out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' '; + } + } + } + } + if ($pPropertyKeys.length) { + var arr2 = $pPropertyKeys; + if (arr2) { + var $pProperty, $i = -1, + l2 = arr2.length - 1; + while ($i < l2) { + $pProperty = arr2[$i += 1]; + out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') '; + } + } + } + out += ' ); if (isAdditional' + ($lvl) + ') { '; + } + if ($removeAdditional == 'all') { + out += ' delete ' + ($data) + '[' + ($key) + ']; '; + } else { + var $currentErrorPath = it.errorPath; + var $additionalProperty = '\' + ' + $key + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + } + if ($noAdditional) { + if ($removeAdditional) { + out += ' delete ' + ($data) + '[' + ($key) + ']; '; + } else { + out += ' ' + ($nextValid) + ' = false; '; + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalProperties'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is an invalid additional property'; + } else { + out += 'should NOT have additional properties'; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + $errSchemaPath = $currErrSchemaPath; + if ($breakOnError) { + out += ' break; '; + } + } + } else if ($additionalIsSchema) { + if ($removeAdditional == 'failing') { + out += ' var ' + ($errs) + ' = errors; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.schema = $aProperties; + $it.schemaPath = it.schemaPath + '.additionalProperties'; + $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; + $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + } else { + $it.schema = $aProperties; + $it.schemaPath = it.schemaPath + '.additionalProperties'; + $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; + $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + } + } + it.errorPath = $currentErrorPath; + } + if ($someProperties) { + out += ' } '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + var $useDefaults = it.opts.useDefaults && !it.compositeRule; + if ($schemaKeys.length) { + var arr3 = $schemaKeys; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $sch = $schema[$propertyKey]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + var $prop = it.util.getProperty($propertyKey), + $passData = $data + $prop, + $hasDefault = $useDefaults && $sch.default !== undefined; + $it.schema = $sch; + $it.schemaPath = $schemaPath + $prop; + $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); + $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); + $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + $code = it.util.varReplace($code, $nextData, $passData); + var $useData = $passData; + } else { + var $useData = $nextData; + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; '; + } + if ($hasDefault) { + out += ' ' + ($code) + ' '; + } else { + if ($requiredHash && $requiredHash[$propertyKey]) { + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { ' + ($nextValid) + ' = false; '; + var $currentErrorPath = it.errorPath, + $currErrSchemaPath = $errSchemaPath, + $missingProperty = it.util.escapeQuotes($propertyKey); + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + $errSchemaPath = it.errSchemaPath + '/required'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + $errSchemaPath = $currErrSchemaPath; + it.errorPath = $currentErrorPath; + out += ' } else { '; + } else { + if ($breakOnError) { + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { ' + ($nextValid) + ' = true; } else { '; + } else { + out += ' if (' + ($useData) + ' !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ' ) { '; + } + } + out += ' ' + ($code) + ' } '; + } + } + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if ($pPropertyKeys.length) { + var arr4 = $pPropertyKeys; + if (arr4) { + var $pProperty, i4 = -1, + l4 = arr4.length - 1; + while (i4 < l4) { + $pProperty = arr4[i4 += 1]; + var $sch = $pProperties[$pProperty]; + if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) { + $it.schema = $sch; + $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); + $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty); + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else ' + ($nextValid) + ' = true; '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/propertyNames.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/propertyNames.js new file mode 100644 index 0000000..2a54a08 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/propertyNames.js @@ -0,0 +1,81 @@ +'use strict'; +module.exports = function generate_propertyNames(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + out += 'var ' + ($errs) + ' = errors;'; + if ((it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + var $key = 'key' + $lvl, + $idx = 'idx' + $lvl, + $i = 'i' + $lvl, + $invalidName = '\' + ' + $key + ' + \'', + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $dataProperties = 'dataProperties' + $lvl, + $ownProperties = it.opts.ownProperties, + $currentBaseId = it.baseId; + if ($ownProperties) { + out += ' var ' + ($dataProperties) + ' = undefined; '; + } + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + out += ' var startErrs' + ($lvl) + ' = errors; '; + var $passData = $key; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' 0) || $propertySch === false : it.util.schemaHasRules($propertySch, it.RULES.all)))) { + $required[$required.length] = $property; + } + } + } + } else { + var $required = $schema; + } + } + if ($isData || $required.length) { + var $currentErrorPath = it.errorPath, + $loopRequired = $isData || $required.length >= it.opts.loopRequired, + $ownProperties = it.opts.ownProperties; + if ($breakOnError) { + out += ' var missing' + ($lvl) + '; '; + if ($loopRequired) { + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; + } + var $i = 'i' + $lvl, + $propertyPath = 'schema' + $lvl + '[' + $i + ']', + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); + } + out += ' var ' + ($valid) + ' = true; '; + if ($isData) { + out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; + } + out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { ' + ($valid) + ' = ' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; + } + out += '; if (!' + ($valid) + ') break; } '; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + } else { + out += ' if ( '; + var arr2 = $required; + if (arr2) { + var $propertyKey, $i = -1, + l2 = arr2.length - 1; + while ($i < l2) { + $propertyKey = arr2[$i += 1]; + if ($i) { + out += ' || '; + } + var $prop = it.util.getProperty($propertyKey), + $useData = $data + $prop; + out += ' ( ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; + } + } + out += ') { '; + var $propertyPath = 'missing' + $lvl, + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + } + } else { + if ($loopRequired) { + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; + } + var $i = 'i' + $lvl, + $propertyPath = 'schema' + $lvl + '[' + $i + ']', + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); + } + if ($isData) { + out += ' if (' + ($vSchema) + ' && !Array.isArray(' + ($vSchema) + ')) { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } else if (' + ($vSchema) + ' !== undefined) { '; + } + out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { if (' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; + } + out += ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } } '; + if ($isData) { + out += ' } '; + } + } else { + var arr3 = $required; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $prop = it.util.getProperty($propertyKey), + $missingProperty = it.util.escapeQuotes($propertyKey), + $useData = $data + $prop; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; + } + } + } + } + it.errorPath = $currentErrorPath; + } else if ($breakOnError) { + out += ' if (true) {'; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/uniqueItems.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/uniqueItems.js new file mode 100644 index 0000000..0736a0e --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/uniqueItems.js @@ -0,0 +1,86 @@ +'use strict'; +module.exports = function generate_uniqueItems(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (($schema || $isData) && it.opts.uniqueItems !== false) { + if ($isData) { + out += ' var ' + ($valid) + '; if (' + ($schemaValue) + ' === false || ' + ($schemaValue) + ' === undefined) ' + ($valid) + ' = true; else if (typeof ' + ($schemaValue) + ' != \'boolean\') ' + ($valid) + ' = false; else { '; + } + out += ' var i = ' + ($data) + '.length , ' + ($valid) + ' = true , j; if (i > 1) { '; + var $itemType = it.schema.items && it.schema.items.type, + $typeIsArray = Array.isArray($itemType); + if (!$itemType || $itemType == 'object' || $itemType == 'array' || ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0))) { + out += ' outer: for (;i--;) { for (j = i; j--;) { if (equal(' + ($data) + '[i], ' + ($data) + '[j])) { ' + ($valid) + ' = false; break outer; } } } '; + } else { + out += ' var itemIndices = {}, item; for (;i--;) { var item = ' + ($data) + '[i]; '; + var $method = 'checkDataType' + ($typeIsArray ? 's' : ''); + out += ' if (' + (it.util[$method]($itemType, 'item', it.opts.strictNumbers, true)) + ') continue; '; + if ($typeIsArray) { + out += ' if (typeof item == \'string\') item = \'"\' + item; '; + } + out += ' if (typeof itemIndices[item] == \'number\') { ' + ($valid) + ' = false; j = itemIndices[item]; break; } itemIndices[item] = i; } '; + } + out += ' } '; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('uniqueItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { i: i, j: j } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have duplicate items (items ## \' + j + \' and \' + i + \' are identical)\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + } else { + if ($breakOnError) { + out += ' if (true) { '; + } + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/dotjs/validate.js b/tunestats/app/api/node_modules/ajv/lib/dotjs/validate.js new file mode 100644 index 0000000..f295824 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/dotjs/validate.js @@ -0,0 +1,482 @@ +'use strict'; +module.exports = function generate_validate(it, $keyword, $ruleType) { + var out = ''; + var $async = it.schema.$async === true, + $refKeywords = it.util.schemaHasRulesExcept(it.schema, it.RULES.all, '$ref'), + $id = it.self._getId(it.schema); + if (it.opts.strictKeywords) { + var $unknownKwd = it.util.schemaUnknownRules(it.schema, it.RULES.keywords); + if ($unknownKwd) { + var $keywordsMsg = 'unknown keyword: ' + $unknownKwd; + if (it.opts.strictKeywords === 'log') it.logger.warn($keywordsMsg); + else throw new Error($keywordsMsg); + } + } + if (it.isTop) { + out += ' var validate = '; + if ($async) { + it.async = true; + out += 'async '; + } + out += 'function(data, dataPath, parentData, parentDataProperty, rootData) { \'use strict\'; '; + if ($id && (it.opts.sourceCode || it.opts.processCode)) { + out += ' ' + ('/\*# sourceURL=' + $id + ' */') + ' '; + } + } + if (typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref)) { + var $keyword = 'false schema'; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + if (it.schema === false) { + if (it.isTop) { + $breakOnError = true; + } else { + out += ' var ' + ($valid) + ' = false; '; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'false schema') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'boolean schema is false\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + } else { + if (it.isTop) { + if ($async) { + out += ' return data; '; + } else { + out += ' validate.errors = null; return true; '; + } + } else { + out += ' var ' + ($valid) + ' = true; '; + } + } + if (it.isTop) { + out += ' }; return validate; '; + } + return out; + } + if (it.isTop) { + var $top = it.isTop, + $lvl = it.level = 0, + $dataLvl = it.dataLevel = 0, + $data = 'data'; + it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema)); + it.baseId = it.baseId || it.rootId; + delete it.isTop; + it.dataPathArr = [""]; + if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored in the schema root'; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + out += ' var vErrors = null; '; + out += ' var errors = 0; '; + out += ' if (rootData === undefined) rootData = data; '; + } else { + var $lvl = it.level, + $dataLvl = it.dataLevel, + $data = 'data' + ($dataLvl || ''); + if ($id) it.baseId = it.resolve.url(it.baseId, $id); + if ($async && !it.async) throw new Error('async schema in sync schema'); + out += ' var errs_' + ($lvl) + ' = errors;'; + } + var $valid = 'valid' + $lvl, + $breakOnError = !it.opts.allErrors, + $closingBraces1 = '', + $closingBraces2 = ''; + var $errorKeyword; + var $typeSchema = it.schema.type, + $typeIsArray = Array.isArray($typeSchema); + if ($typeSchema && it.opts.nullable && it.schema.nullable === true) { + if ($typeIsArray) { + if ($typeSchema.indexOf('null') == -1) $typeSchema = $typeSchema.concat('null'); + } else if ($typeSchema != 'null') { + $typeSchema = [$typeSchema, 'null']; + $typeIsArray = true; + } + } + if ($typeIsArray && $typeSchema.length == 1) { + $typeSchema = $typeSchema[0]; + $typeIsArray = false; + } + if (it.schema.$ref && $refKeywords) { + if (it.opts.extendRefs == 'fail') { + throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)'); + } else if (it.opts.extendRefs !== true) { + $refKeywords = false; + it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"'); + } + } + if (it.schema.$comment && it.opts.$comment) { + out += ' ' + (it.RULES.all.$comment.code(it, '$comment')); + } + if ($typeSchema) { + if (it.opts.coerceTypes) { + var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema); + } + var $rulesGroup = it.RULES.types[$typeSchema]; + if ($coerceToTypes || $typeIsArray || $rulesGroup === true || ($rulesGroup && !$shouldUseGroup($rulesGroup))) { + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type'; + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type', + $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType'; + out += ' if (' + (it.util[$method]($typeSchema, $data, it.opts.strictNumbers, true)) + ') { '; + if ($coerceToTypes) { + var $dataType = 'dataType' + $lvl, + $coerced = 'coerced' + $lvl; + out += ' var ' + ($dataType) + ' = typeof ' + ($data) + '; var ' + ($coerced) + ' = undefined; '; + if (it.opts.coerceTypes == 'array') { + out += ' if (' + ($dataType) + ' == \'object\' && Array.isArray(' + ($data) + ') && ' + ($data) + '.length == 1) { ' + ($data) + ' = ' + ($data) + '[0]; ' + ($dataType) + ' = typeof ' + ($data) + '; if (' + (it.util.checkDataType(it.schema.type, $data, it.opts.strictNumbers)) + ') ' + ($coerced) + ' = ' + ($data) + '; } '; + } + out += ' if (' + ($coerced) + ' !== undefined) ; '; + var arr1 = $coerceToTypes; + if (arr1) { + var $type, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $type = arr1[$i += 1]; + if ($type == 'string') { + out += ' else if (' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\') ' + ($coerced) + ' = \'\' + ' + ($data) + '; else if (' + ($data) + ' === null) ' + ($coerced) + ' = \'\'; '; + } else if ($type == 'number' || $type == 'integer') { + out += ' else if (' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' === null || (' + ($dataType) + ' == \'string\' && ' + ($data) + ' && ' + ($data) + ' == +' + ($data) + ' '; + if ($type == 'integer') { + out += ' && !(' + ($data) + ' % 1)'; + } + out += ')) ' + ($coerced) + ' = +' + ($data) + '; '; + } else if ($type == 'boolean') { + out += ' else if (' + ($data) + ' === \'false\' || ' + ($data) + ' === 0 || ' + ($data) + ' === null) ' + ($coerced) + ' = false; else if (' + ($data) + ' === \'true\' || ' + ($data) + ' === 1) ' + ($coerced) + ' = true; '; + } else if ($type == 'null') { + out += ' else if (' + ($data) + ' === \'\' || ' + ($data) + ' === 0 || ' + ($data) + ' === false) ' + ($coerced) + ' = null; '; + } else if (it.opts.coerceTypes == 'array' && $type == 'array') { + out += ' else if (' + ($dataType) + ' == \'string\' || ' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' == null) ' + ($coerced) + ' = [' + ($data) + ']; '; + } + } + } + out += ' else { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } if (' + ($coerced) + ' !== undefined) { '; + var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', + $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; + out += ' ' + ($data) + ' = ' + ($coerced) + '; '; + if (!$dataLvl) { + out += 'if (' + ($parentData) + ' !== undefined)'; + } + out += ' ' + ($parentData) + '[' + ($parentDataProperty) + '] = ' + ($coerced) + '; } '; + } else { + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + } + out += ' } '; + } + } + if (it.schema.$ref && !$refKeywords) { + out += ' ' + (it.RULES.all.$ref.code(it, '$ref')) + ' '; + if ($breakOnError) { + out += ' } if (errors === '; + if ($top) { + out += '0'; + } else { + out += 'errs_' + ($lvl); + } + out += ') { '; + $closingBraces2 += '}'; + } + } else { + var arr2 = it.RULES; + if (arr2) { + var $rulesGroup, i2 = -1, + l2 = arr2.length - 1; + while (i2 < l2) { + $rulesGroup = arr2[i2 += 1]; + if ($shouldUseGroup($rulesGroup)) { + if ($rulesGroup.type) { + out += ' if (' + (it.util.checkDataType($rulesGroup.type, $data, it.opts.strictNumbers)) + ') { '; + } + if (it.opts.useDefaults) { + if ($rulesGroup.type == 'object' && it.schema.properties) { + var $schema = it.schema.properties, + $schemaKeys = Object.keys($schema); + var arr3 = $schemaKeys; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $sch = $schema[$propertyKey]; + if ($sch.default !== undefined) { + var $passData = $data + it.util.getProperty($propertyKey); + if (it.compositeRule) { + if (it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored for: ' + $passData; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + } else { + out += ' if (' + ($passData) + ' === undefined '; + if (it.opts.useDefaults == 'empty') { + out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; + } + out += ' ) ' + ($passData) + ' = '; + if (it.opts.useDefaults == 'shared') { + out += ' ' + (it.useDefault($sch.default)) + ' '; + } else { + out += ' ' + (JSON.stringify($sch.default)) + ' '; + } + out += '; '; + } + } + } + } + } else if ($rulesGroup.type == 'array' && Array.isArray(it.schema.items)) { + var arr4 = it.schema.items; + if (arr4) { + var $sch, $i = -1, + l4 = arr4.length - 1; + while ($i < l4) { + $sch = arr4[$i += 1]; + if ($sch.default !== undefined) { + var $passData = $data + '[' + $i + ']'; + if (it.compositeRule) { + if (it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored for: ' + $passData; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + } else { + out += ' if (' + ($passData) + ' === undefined '; + if (it.opts.useDefaults == 'empty') { + out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; + } + out += ' ) ' + ($passData) + ' = '; + if (it.opts.useDefaults == 'shared') { + out += ' ' + (it.useDefault($sch.default)) + ' '; + } else { + out += ' ' + (JSON.stringify($sch.default)) + ' '; + } + out += '; '; + } + } + } + } + } + } + var arr5 = $rulesGroup.rules; + if (arr5) { + var $rule, i5 = -1, + l5 = arr5.length - 1; + while (i5 < l5) { + $rule = arr5[i5 += 1]; + if ($shouldUseRule($rule)) { + var $code = $rule.code(it, $rule.keyword, $rulesGroup.type); + if ($code) { + out += ' ' + ($code) + ' '; + if ($breakOnError) { + $closingBraces1 += '}'; + } + } + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces1) + ' '; + $closingBraces1 = ''; + } + if ($rulesGroup.type) { + out += ' } '; + if ($typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes) { + out += ' else { '; + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + } + } + if ($breakOnError) { + out += ' if (errors === '; + if ($top) { + out += '0'; + } else { + out += 'errs_' + ($lvl); + } + out += ') { '; + $closingBraces2 += '}'; + } + } + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces2) + ' '; + } + if ($top) { + if ($async) { + out += ' if (errors === 0) return data; '; + out += ' else throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; '; + out += ' return errors === 0; '; + } + out += ' }; return validate;'; + } else { + out += ' var ' + ($valid) + ' = errors === errs_' + ($lvl) + ';'; + } + + function $shouldUseGroup($rulesGroup) { + var rules = $rulesGroup.rules; + for (var i = 0; i < rules.length; i++) + if ($shouldUseRule(rules[i])) return true; + } + + function $shouldUseRule($rule) { + return it.schema[$rule.keyword] !== undefined || ($rule.implements && $ruleImplementsSomeKeyword($rule)); + } + + function $ruleImplementsSomeKeyword($rule) { + var impl = $rule.implements; + for (var i = 0; i < impl.length; i++) + if (it.schema[impl[i]] !== undefined) return true; + } + return out; +} diff --git a/tunestats/app/api/node_modules/ajv/lib/keyword.js b/tunestats/app/api/node_modules/ajv/lib/keyword.js new file mode 100644 index 0000000..06da9a2 --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/lib/keyword.js @@ -0,0 +1,146 @@ +'use strict'; + +var IDENTIFIER = /^[a-z_$][a-z0-9_$-]*$/i; +var customRuleCode = require('./dotjs/custom'); +var definitionSchema = require('./definition_schema'); + +module.exports = { + add: addKeyword, + get: getKeyword, + remove: removeKeyword, + validate: validateKeyword +}; + + +/** + * Define custom keyword + * @this Ajv + * @param {String} keyword custom keyword, should be unique (including different from all standard, custom and macro keywords). + * @param {Object} definition keyword definition object with properties `type` (type(s) which the keyword applies to), `validate` or `compile`. + * @return {Ajv} this for method chaining + */ +function addKeyword(keyword, definition) { + /* jshint validthis: true */ + /* eslint no-shadow: 0 */ + var RULES = this.RULES; + if (RULES.keywords[keyword]) + throw new Error('Keyword ' + keyword + ' is already defined'); + + if (!IDENTIFIER.test(keyword)) + throw new Error('Keyword ' + keyword + ' is not a valid identifier'); + + if (definition) { + this.validateKeyword(definition, true); + + var dataType = definition.type; + if (Array.isArray(dataType)) { + for (var i=0; i ../ajv-dist/bower.json + cd ../ajv-dist + + if [[ `git status --porcelain` ]]; then + echo "Changes detected. Updating master branch..." + git add -A + git commit -m "updated by travis build #$TRAVIS_BUILD_NUMBER" + git push --quiet origin master > /dev/null 2>&1 + fi + + echo "Publishing tag..." + + git tag $TRAVIS_TAG + git push --tags > /dev/null 2>&1 + + echo "Done" +fi diff --git a/tunestats/app/api/node_modules/ajv/scripts/travis-gh-pages b/tunestats/app/api/node_modules/ajv/scripts/travis-gh-pages new file mode 100644 index 0000000..b3d4f3d --- /dev/null +++ b/tunestats/app/api/node_modules/ajv/scripts/travis-gh-pages @@ -0,0 +1,23 @@ +#!/usr/bin/env bash + +set -e + +if [[ "$TRAVIS_BRANCH" == "master" && "$TRAVIS_PULL_REQUEST" == "false" && $TRAVIS_JOB_NUMBER =~ ".3" ]]; then + git diff --name-only $TRAVIS_COMMIT_RANGE | grep -qE '\.md$|^LICENSE$|travis-gh-pages$' && { + rm -rf ../gh-pages + git clone -b gh-pages --single-branch https://${GITHUB_TOKEN}@github.com/ajv-validator/ajv.git ../gh-pages + mkdir -p ../gh-pages/_source + cp *.md ../gh-pages/_source + cp LICENSE ../gh-pages/_source + currentDir=$(pwd) + cd ../gh-pages + $currentDir/node_modules/.bin/gh-pages-generator + # remove logo from README + sed -i -E "s/]+ajv_logo[^>]+>//" index.md + git config user.email "$GIT_USER_EMAIL" + git config user.name "$GIT_USER_NAME" + git add . + git commit -am "updated by travis build #$TRAVIS_BUILD_NUMBER" + git push --quiet origin gh-pages > /dev/null 2>&1 + } +fi diff --git a/tunestats/app/api/node_modules/anymatch/LICENSE b/tunestats/app/api/node_modules/anymatch/LICENSE new file mode 100644 index 0000000..491766c --- /dev/null +++ b/tunestats/app/api/node_modules/anymatch/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) 2019 Elan Shanker, Paul Miller (https://paulmillr.com) + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/tunestats/app/api/node_modules/anymatch/README.md b/tunestats/app/api/node_modules/anymatch/README.md new file mode 100644 index 0000000..1dd67f5 --- /dev/null +++ b/tunestats/app/api/node_modules/anymatch/README.md @@ -0,0 +1,87 @@ +anymatch [![Build Status](https://travis-ci.org/micromatch/anymatch.svg?branch=master)](https://travis-ci.org/micromatch/anymatch) [![Coverage Status](https://img.shields.io/coveralls/micromatch/anymatch.svg?branch=master)](https://coveralls.io/r/micromatch/anymatch?branch=master) +====== +Javascript module to match a string against a regular expression, glob, string, +or function that takes the string as an argument and returns a truthy or falsy +value. The matcher can also be an array of any or all of these. Useful for +allowing a very flexible user-defined config to define things like file paths. + +__Note: This module has Bash-parity, please be aware that Windows-style backslashes are not supported as separators. See https://github.com/micromatch/micromatch#backslashes for more information.__ + + +Usage +----- +```sh +npm install anymatch +``` + +#### anymatch(matchers, testString, [returnIndex], [options]) +* __matchers__: (_Array|String|RegExp|Function_) +String to be directly matched, string with glob patterns, regular expression +test, function that takes the testString as an argument and returns a truthy +value if it should be matched, or an array of any number and mix of these types. +* __testString__: (_String|Array_) The string to test against the matchers. If +passed as an array, the first element of the array will be used as the +`testString` for non-function matchers, while the entire array will be applied +as the arguments for function matchers. +* __options__: (_Object_ [optional]_) Any of the [picomatch](https://github.com/micromatch/picomatch#options) options. + * __returnIndex__: (_Boolean [optional]_) If true, return the array index of +the first matcher that that testString matched, or -1 if no match, instead of a +boolean result. + +```js +const anymatch = require('anymatch'); + +const matchers = [ 'path/to/file.js', 'path/anyjs/**/*.js', /foo.js$/, string => string.includes('bar') && string.length > 10 ] ; + +anymatch(matchers, 'path/to/file.js'); // true +anymatch(matchers, 'path/anyjs/baz.js'); // true +anymatch(matchers, 'path/to/foo.js'); // true +anymatch(matchers, 'path/to/bar.js'); // true +anymatch(matchers, 'bar.js'); // false + +// returnIndex = true +anymatch(matchers, 'foo.js', {returnIndex: true}); // 2 +anymatch(matchers, 'path/anyjs/foo.js', {returnIndex: true}); // 1 + +// any picomatc + +// using globs to match directories and their children +anymatch('node_modules', 'node_modules'); // true +anymatch('node_modules', 'node_modules/somelib/index.js'); // false +anymatch('node_modules/**', 'node_modules/somelib/index.js'); // true +anymatch('node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // false +anymatch('**/node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // true + +const matcher = anymatch(matchers); +['foo.js', 'bar.js'].filter(matcher); // [ 'foo.js' ] +anymatch master* ❯ + +``` + +#### anymatch(matchers) +You can also pass in only your matcher(s) to get a curried function that has +already been bound to the provided matching criteria. This can be used as an +`Array#filter` callback. + +```js +var matcher = anymatch(matchers); + +matcher('path/to/file.js'); // true +matcher('path/anyjs/baz.js', true); // 1 + +['foo.js', 'bar.js'].filter(matcher); // ['foo.js'] +``` + +Changelog +---------- +[See release notes page on GitHub](https://github.com/micromatch/anymatch/releases) + +- **v3.0:** Removed `startIndex` and `endIndex` arguments. Node 8.x-only. +- **v2.0:** [micromatch](https://github.com/jonschlinkert/micromatch) moves away from minimatch-parity and inline with Bash. This includes handling backslashes differently (see https://github.com/micromatch/micromatch#backslashes for more information). +- **v1.2:** anymatch uses [micromatch](https://github.com/jonschlinkert/micromatch) +for glob pattern matching. Issues with glob pattern matching should be +reported directly to the [micromatch issue tracker](https://github.com/jonschlinkert/micromatch/issues). + +License +------- +[ISC](https://raw.github.com/micromatch/anymatch/master/LICENSE) diff --git a/tunestats/app/api/node_modules/anymatch/index.d.ts b/tunestats/app/api/node_modules/anymatch/index.d.ts new file mode 100644 index 0000000..3ef7eaa --- /dev/null +++ b/tunestats/app/api/node_modules/anymatch/index.d.ts @@ -0,0 +1,20 @@ +type AnymatchFn = (testString: string) => boolean; +type AnymatchPattern = string|RegExp|AnymatchFn; +type AnymatchMatcher = AnymatchPattern|AnymatchPattern[] +type AnymatchTester = { + (testString: string|any[], returnIndex: true): number; + (testString: string|any[]): boolean; +} + +type PicomatchOptions = {dot: boolean}; + +declare const anymatch: { + (matchers: AnymatchMatcher): AnymatchTester; + (matchers: AnymatchMatcher, testString: null, returnIndex: true | PicomatchOptions): AnymatchTester; + (matchers: AnymatchMatcher, testString: string|any[], returnIndex: true | PicomatchOptions): number; + (matchers: AnymatchMatcher, testString: string|any[]): boolean; +} + +export {AnymatchMatcher as Matcher} +export {AnymatchTester as Tester} +export default anymatch diff --git a/tunestats/app/api/node_modules/anymatch/index.js b/tunestats/app/api/node_modules/anymatch/index.js new file mode 100644 index 0000000..8eb73e9 --- /dev/null +++ b/tunestats/app/api/node_modules/anymatch/index.js @@ -0,0 +1,104 @@ +'use strict'; + +Object.defineProperty(exports, "__esModule", { value: true }); + +const picomatch = require('picomatch'); +const normalizePath = require('normalize-path'); + +/** + * @typedef {(testString: string) => boolean} AnymatchFn + * @typedef {string|RegExp|AnymatchFn} AnymatchPattern + * @typedef {AnymatchPattern|AnymatchPattern[]} AnymatchMatcher + */ +const BANG = '!'; +const DEFAULT_OPTIONS = {returnIndex: false}; +const arrify = (item) => Array.isArray(item) ? item : [item]; + +/** + * @param {AnymatchPattern} matcher + * @param {object} options + * @returns {AnymatchFn} + */ +const createPattern = (matcher, options) => { + if (typeof matcher === 'function') { + return matcher; + } + if (typeof matcher === 'string') { + const glob = picomatch(matcher, options); + return (string) => matcher === string || glob(string); + } + if (matcher instanceof RegExp) { + return (string) => matcher.test(string); + } + return (string) => false; +}; + +/** + * @param {Array} patterns + * @param {Array} negPatterns + * @param {String|Array} args + * @param {Boolean} returnIndex + * @returns {boolean|number} + */ +const matchPatterns = (patterns, negPatterns, args, returnIndex) => { + const isList = Array.isArray(args); + const _path = isList ? args[0] : args; + if (!isList && typeof _path !== 'string') { + throw new TypeError('anymatch: second argument must be a string: got ' + + Object.prototype.toString.call(_path)) + } + const path = normalizePath(_path, false); + + for (let index = 0; index < negPatterns.length; index++) { + const nglob = negPatterns[index]; + if (nglob(path)) { + return returnIndex ? -1 : false; + } + } + + const applied = isList && [path].concat(args.slice(1)); + for (let index = 0; index < patterns.length; index++) { + const pattern = patterns[index]; + if (isList ? pattern(...applied) : pattern(path)) { + return returnIndex ? index : true; + } + } + + return returnIndex ? -1 : false; +}; + +/** + * @param {AnymatchMatcher} matchers + * @param {Array|string} testString + * @param {object} options + * @returns {boolean|number|Function} + */ +const anymatch = (matchers, testString, options = DEFAULT_OPTIONS) => { + if (matchers == null) { + throw new TypeError('anymatch: specify first argument'); + } + const opts = typeof options === 'boolean' ? {returnIndex: options} : options; + const returnIndex = opts.returnIndex || false; + + // Early cache for matchers. + const mtchers = arrify(matchers); + const negatedGlobs = mtchers + .filter(item => typeof item === 'string' && item.charAt(0) === BANG) + .map(item => item.slice(1)) + .map(item => picomatch(item, opts)); + const patterns = mtchers + .filter(item => typeof item !== 'string' || (typeof item === 'string' && item.charAt(0) !== BANG)) + .map(matcher => createPattern(matcher, opts)); + + if (testString == null) { + return (testString, ri = false) => { + const returnIndex = typeof ri === 'boolean' ? ri : false; + return matchPatterns(patterns, negatedGlobs, testString, returnIndex); + } + } + + return matchPatterns(patterns, negatedGlobs, testString, returnIndex); +}; + +anymatch.default = anymatch; +module.exports = anymatch; diff --git a/tunestats/app/api/node_modules/anymatch/package.json b/tunestats/app/api/node_modules/anymatch/package.json new file mode 100644 index 0000000..2cb2307 --- /dev/null +++ b/tunestats/app/api/node_modules/anymatch/package.json @@ -0,0 +1,48 @@ +{ + "name": "anymatch", + "version": "3.1.3", + "description": "Matches strings against configurable strings, globs, regular expressions, and/or functions", + "files": [ + "index.js", + "index.d.ts" + ], + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "author": { + "name": "Elan Shanker", + "url": "https://github.com/es128" + }, + "license": "ISC", + "homepage": "https://github.com/micromatch/anymatch", + "repository": { + "type": "git", + "url": "https://github.com/micromatch/anymatch" + }, + "keywords": [ + "match", + "any", + "string", + "file", + "fs", + "list", + "glob", + "regex", + "regexp", + "regular", + "expression", + "function" + ], + "scripts": { + "test": "nyc mocha", + "mocha": "mocha" + }, + "devDependencies": { + "mocha": "^6.1.3", + "nyc": "^14.0.0" + }, + "engines": { + "node": ">= 8" + } +} diff --git a/tunestats/app/api/node_modules/array-flatten/LICENSE b/tunestats/app/api/node_modules/array-flatten/LICENSE new file mode 100644 index 0000000..983fbe8 --- /dev/null +++ b/tunestats/app/api/node_modules/array-flatten/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/array-flatten/README.md b/tunestats/app/api/node_modules/array-flatten/README.md new file mode 100644 index 0000000..91fa5b6 --- /dev/null +++ b/tunestats/app/api/node_modules/array-flatten/README.md @@ -0,0 +1,43 @@ +# Array Flatten + +[![NPM version][npm-image]][npm-url] +[![NPM downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +> Flatten an array of nested arrays into a single flat array. Accepts an optional depth. + +## Installation + +``` +npm install array-flatten --save +``` + +## Usage + +```javascript +var flatten = require('array-flatten') + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9]) +//=> [1, 2, 3, 4, 5, 6, 7, 8, 9] + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2) +//=> [1, 2, 3, [4, [5], 6], 7, 8, 9] + +(function () { + flatten(arguments) //=> [1, 2, 3] +})(1, [2, 3]) +``` + +## License + +MIT + +[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat +[npm-url]: https://npmjs.org/package/array-flatten +[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat +[downloads-url]: https://npmjs.org/package/array-flatten +[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat +[travis-url]: https://travis-ci.org/blakeembrey/array-flatten +[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat +[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master diff --git a/tunestats/app/api/node_modules/array-flatten/array-flatten.js b/tunestats/app/api/node_modules/array-flatten/array-flatten.js new file mode 100644 index 0000000..089117b --- /dev/null +++ b/tunestats/app/api/node_modules/array-flatten/array-flatten.js @@ -0,0 +1,64 @@ +'use strict' + +/** + * Expose `arrayFlatten`. + */ +module.exports = arrayFlatten + +/** + * Recursive flatten function with depth. + * + * @param {Array} array + * @param {Array} result + * @param {Number} depth + * @return {Array} + */ +function flattenWithDepth (array, result, depth) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (depth > 0 && Array.isArray(value)) { + flattenWithDepth(value, result, depth - 1) + } else { + result.push(value) + } + } + + return result +} + +/** + * Recursive flatten function. Omitting depth is slightly faster. + * + * @param {Array} array + * @param {Array} result + * @return {Array} + */ +function flattenForever (array, result) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (Array.isArray(value)) { + flattenForever(value, result) + } else { + result.push(value) + } + } + + return result +} + +/** + * Flatten an array, with the ability to define a depth. + * + * @param {Array} array + * @param {Number} depth + * @return {Array} + */ +function arrayFlatten (array, depth) { + if (depth == null) { + return flattenForever(array, []) + } + + return flattenWithDepth(array, [], depth) +} diff --git a/tunestats/app/api/node_modules/array-flatten/package.json b/tunestats/app/api/node_modules/array-flatten/package.json new file mode 100644 index 0000000..1a24e2a --- /dev/null +++ b/tunestats/app/api/node_modules/array-flatten/package.json @@ -0,0 +1,39 @@ +{ + "name": "array-flatten", + "version": "1.1.1", + "description": "Flatten an array of nested arrays into a single flat array", + "main": "array-flatten.js", + "files": [ + "array-flatten.js", + "LICENSE" + ], + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "repository": { + "type": "git", + "url": "git://github.com/blakeembrey/array-flatten.git" + }, + "keywords": [ + "array", + "flatten", + "arguments", + "depth" + ], + "author": { + "name": "Blake Embrey", + "email": "hello@blakeembrey.com", + "url": "http://blakeembrey.me" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/blakeembrey/array-flatten/issues" + }, + "homepage": "https://github.com/blakeembrey/array-flatten", + "devDependencies": { + "istanbul": "^0.3.13", + "mocha": "^2.2.4", + "pre-commit": "^1.0.7", + "standard": "^3.7.3" + } +} diff --git a/tunestats/app/api/node_modules/asn1/Jenkinsfile b/tunestats/app/api/node_modules/asn1/Jenkinsfile new file mode 100644 index 0000000..d1b4593 --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/Jenkinsfile @@ -0,0 +1,65 @@ +@Library('jenkins-joylib@v1.0.8') _ + +pipeline { + + agent none + + options { + buildDiscarder(logRotator(numToKeepStr: '45')) + timestamps() + } + + stages { + stage('top') { + parallel { + stage('v4-zone') { + agent { + label joyCommonLabels(image_ver: '15.4.1') + } + tools { + nodejs 'sdcnode-v4-zone' + } + stages { + stage('check') { + steps{ + sh('make check') + } + } + stage('test') { + steps{ + sh('make test') + } + } + } + } + + stage('v6-zone64') { + agent { + label joyCommonLabels(image_ver: '18.4.0') + } + tools { + nodejs 'sdcnode-v6-zone64' + } + stages { + stage('check') { + steps{ + sh('make check') + } + } + stage('test') { + steps{ + sh('make test') + } + } + } + } + } + } + } + + post { + always { + joySlackNotifications() + } + } +} diff --git a/tunestats/app/api/node_modules/asn1/LICENSE b/tunestats/app/api/node_modules/asn1/LICENSE new file mode 100644 index 0000000..9b5dcdb --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2011 Mark Cavage, All rights reserved. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE diff --git a/tunestats/app/api/node_modules/asn1/README.md b/tunestats/app/api/node_modules/asn1/README.md new file mode 100644 index 0000000..2208210 --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/README.md @@ -0,0 +1,50 @@ +node-asn1 is a library for encoding and decoding ASN.1 datatypes in pure JS. +Currently BER encoding is supported; at some point I'll likely have to do DER. + +## Usage + +Mostly, if you're *actually* needing to read and write ASN.1, you probably don't +need this readme to explain what and why. If you have no idea what ASN.1 is, +see this: ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc + +The source is pretty much self-explanatory, and has read/write methods for the +common types out there. + +### Decoding + +The following reads an ASN.1 sequence with a boolean. + + var Ber = require('asn1').Ber; + + var reader = new Ber.Reader(Buffer.from([0x30, 0x03, 0x01, 0x01, 0xff])); + + reader.readSequence(); + console.log('Sequence len: ' + reader.length); + if (reader.peek() === Ber.Boolean) + console.log(reader.readBoolean()); + +### Encoding + +The following generates the same payload as above. + + var Ber = require('asn1').Ber; + + var writer = new Ber.Writer(); + + writer.startSequence(); + writer.writeBoolean(true); + writer.endSequence(); + + console.log(writer.buffer); + +## Installation + + npm install asn1 + +## License + +MIT. + +## Bugs + +See . diff --git a/tunestats/app/api/node_modules/asn1/lib/ber/errors.js b/tunestats/app/api/node_modules/asn1/lib/ber/errors.js new file mode 100644 index 0000000..4557b8a --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/lib/ber/errors.js @@ -0,0 +1,13 @@ +// Copyright 2011 Mark Cavage All rights reserved. + + +module.exports = { + + newInvalidAsn1Error: function (msg) { + var e = new Error(); + e.name = 'InvalidAsn1Error'; + e.message = msg || ''; + return e; + } + +}; diff --git a/tunestats/app/api/node_modules/asn1/lib/ber/index.js b/tunestats/app/api/node_modules/asn1/lib/ber/index.js new file mode 100644 index 0000000..387d132 --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/lib/ber/index.js @@ -0,0 +1,27 @@ +// Copyright 2011 Mark Cavage All rights reserved. + +var errors = require('./errors'); +var types = require('./types'); + +var Reader = require('./reader'); +var Writer = require('./writer'); + + +// --- Exports + +module.exports = { + + Reader: Reader, + + Writer: Writer + +}; + +for (var t in types) { + if (types.hasOwnProperty(t)) + module.exports[t] = types[t]; +} +for (var e in errors) { + if (errors.hasOwnProperty(e)) + module.exports[e] = errors[e]; +} diff --git a/tunestats/app/api/node_modules/asn1/lib/ber/reader.js b/tunestats/app/api/node_modules/asn1/lib/ber/reader.js new file mode 100644 index 0000000..8a7e4ca --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/lib/ber/reader.js @@ -0,0 +1,262 @@ +// Copyright 2011 Mark Cavage All rights reserved. + +var assert = require('assert'); +var Buffer = require('safer-buffer').Buffer; + +var ASN1 = require('./types'); +var errors = require('./errors'); + + +// --- Globals + +var newInvalidAsn1Error = errors.newInvalidAsn1Error; + + + +// --- API + +function Reader(data) { + if (!data || !Buffer.isBuffer(data)) + throw new TypeError('data must be a node Buffer'); + + this._buf = data; + this._size = data.length; + + // These hold the "current" state + this._len = 0; + this._offset = 0; +} + +Object.defineProperty(Reader.prototype, 'length', { + enumerable: true, + get: function () { return (this._len); } +}); + +Object.defineProperty(Reader.prototype, 'offset', { + enumerable: true, + get: function () { return (this._offset); } +}); + +Object.defineProperty(Reader.prototype, 'remain', { + get: function () { return (this._size - this._offset); } +}); + +Object.defineProperty(Reader.prototype, 'buffer', { + get: function () { return (this._buf.slice(this._offset)); } +}); + + +/** + * Reads a single byte and advances offset; you can pass in `true` to make this + * a "peek" operation (i.e., get the byte, but don't advance the offset). + * + * @param {Boolean} peek true means don't move offset. + * @return {Number} the next byte, null if not enough data. + */ +Reader.prototype.readByte = function (peek) { + if (this._size - this._offset < 1) + return null; + + var b = this._buf[this._offset] & 0xff; + + if (!peek) + this._offset += 1; + + return b; +}; + + +Reader.prototype.peek = function () { + return this.readByte(true); +}; + + +/** + * Reads a (potentially) variable length off the BER buffer. This call is + * not really meant to be called directly, as callers have to manipulate + * the internal buffer afterwards. + * + * As a result of this call, you can call `Reader.length`, until the + * next thing called that does a readLength. + * + * @return {Number} the amount of offset to advance the buffer. + * @throws {InvalidAsn1Error} on bad ASN.1 + */ +Reader.prototype.readLength = function (offset) { + if (offset === undefined) + offset = this._offset; + + if (offset >= this._size) + return null; + + var lenB = this._buf[offset++] & 0xff; + if (lenB === null) + return null; + + if ((lenB & 0x80) === 0x80) { + lenB &= 0x7f; + + if (lenB === 0) + throw newInvalidAsn1Error('Indefinite length not supported'); + + if (lenB > 4) + throw newInvalidAsn1Error('encoding too long'); + + if (this._size - offset < lenB) + return null; + + this._len = 0; + for (var i = 0; i < lenB; i++) + this._len = (this._len << 8) + (this._buf[offset++] & 0xff); + + } else { + // Wasn't a variable length + this._len = lenB; + } + + return offset; +}; + + +/** + * Parses the next sequence in this BER buffer. + * + * To get the length of the sequence, call `Reader.length`. + * + * @return {Number} the sequence's tag. + */ +Reader.prototype.readSequence = function (tag) { + var seq = this.peek(); + if (seq === null) + return null; + if (tag !== undefined && tag !== seq) + throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + + ': got 0x' + seq.toString(16)); + + var o = this.readLength(this._offset + 1); // stored in `length` + if (o === null) + return null; + + this._offset = o; + return seq; +}; + + +Reader.prototype.readInt = function () { + return this._readTag(ASN1.Integer); +}; + + +Reader.prototype.readBoolean = function () { + return (this._readTag(ASN1.Boolean) === 0 ? false : true); +}; + + +Reader.prototype.readEnumeration = function () { + return this._readTag(ASN1.Enumeration); +}; + + +Reader.prototype.readString = function (tag, retbuf) { + if (!tag) + tag = ASN1.OctetString; + + var b = this.peek(); + if (b === null) + return null; + + if (b !== tag) + throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + + ': got 0x' + b.toString(16)); + + var o = this.readLength(this._offset + 1); // stored in `length` + + if (o === null) + return null; + + if (this.length > this._size - o) + return null; + + this._offset = o; + + if (this.length === 0) + return retbuf ? Buffer.alloc(0) : ''; + + var str = this._buf.slice(this._offset, this._offset + this.length); + this._offset += this.length; + + return retbuf ? str : str.toString('utf8'); +}; + +Reader.prototype.readOID = function (tag) { + if (!tag) + tag = ASN1.OID; + + var b = this.readString(tag, true); + if (b === null) + return null; + + var values = []; + var value = 0; + + for (var i = 0; i < b.length; i++) { + var byte = b[i] & 0xff; + + value <<= 7; + value += byte & 0x7f; + if ((byte & 0x80) === 0) { + values.push(value); + value = 0; + } + } + + value = values.shift(); + values.unshift(value % 40); + values.unshift((value / 40) >> 0); + + return values.join('.'); +}; + + +Reader.prototype._readTag = function (tag) { + assert.ok(tag !== undefined); + + var b = this.peek(); + + if (b === null) + return null; + + if (b !== tag) + throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + + ': got 0x' + b.toString(16)); + + var o = this.readLength(this._offset + 1); // stored in `length` + if (o === null) + return null; + + if (this.length > 4) + throw newInvalidAsn1Error('Integer too long: ' + this.length); + + if (this.length > this._size - o) + return null; + this._offset = o; + + var fb = this._buf[this._offset]; + var value = 0; + + for (var i = 0; i < this.length; i++) { + value <<= 8; + value |= (this._buf[this._offset++] & 0xff); + } + + if ((fb & 0x80) === 0x80 && i !== 4) + value -= (1 << (i * 8)); + + return value >> 0; +}; + + + +// --- Exported API + +module.exports = Reader; diff --git a/tunestats/app/api/node_modules/asn1/lib/ber/types.js b/tunestats/app/api/node_modules/asn1/lib/ber/types.js new file mode 100644 index 0000000..8aea000 --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/lib/ber/types.js @@ -0,0 +1,36 @@ +// Copyright 2011 Mark Cavage All rights reserved. + + +module.exports = { + EOC: 0, + Boolean: 1, + Integer: 2, + BitString: 3, + OctetString: 4, + Null: 5, + OID: 6, + ObjectDescriptor: 7, + External: 8, + Real: 9, // float + Enumeration: 10, + PDV: 11, + Utf8String: 12, + RelativeOID: 13, + Sequence: 16, + Set: 17, + NumericString: 18, + PrintableString: 19, + T61String: 20, + VideotexString: 21, + IA5String: 22, + UTCTime: 23, + GeneralizedTime: 24, + GraphicString: 25, + VisibleString: 26, + GeneralString: 28, + UniversalString: 29, + CharacterString: 30, + BMPString: 31, + Constructor: 32, + Context: 128 +}; diff --git a/tunestats/app/api/node_modules/asn1/lib/ber/writer.js b/tunestats/app/api/node_modules/asn1/lib/ber/writer.js new file mode 100644 index 0000000..3515acf --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/lib/ber/writer.js @@ -0,0 +1,317 @@ +// Copyright 2011 Mark Cavage All rights reserved. + +var assert = require('assert'); +var Buffer = require('safer-buffer').Buffer; +var ASN1 = require('./types'); +var errors = require('./errors'); + + +// --- Globals + +var newInvalidAsn1Error = errors.newInvalidAsn1Error; + +var DEFAULT_OPTS = { + size: 1024, + growthFactor: 8 +}; + + +// --- Helpers + +function merge(from, to) { + assert.ok(from); + assert.equal(typeof (from), 'object'); + assert.ok(to); + assert.equal(typeof (to), 'object'); + + var keys = Object.getOwnPropertyNames(from); + keys.forEach(function (key) { + if (to[key]) + return; + + var value = Object.getOwnPropertyDescriptor(from, key); + Object.defineProperty(to, key, value); + }); + + return to; +} + + + +// --- API + +function Writer(options) { + options = merge(DEFAULT_OPTS, options || {}); + + this._buf = Buffer.alloc(options.size || 1024); + this._size = this._buf.length; + this._offset = 0; + this._options = options; + + // A list of offsets in the buffer where we need to insert + // sequence tag/len pairs. + this._seq = []; +} + +Object.defineProperty(Writer.prototype, 'buffer', { + get: function () { + if (this._seq.length) + throw newInvalidAsn1Error(this._seq.length + ' unended sequence(s)'); + + return (this._buf.slice(0, this._offset)); + } +}); + +Writer.prototype.writeByte = function (b) { + if (typeof (b) !== 'number') + throw new TypeError('argument must be a Number'); + + this._ensure(1); + this._buf[this._offset++] = b; +}; + + +Writer.prototype.writeInt = function (i, tag) { + if (typeof (i) !== 'number') + throw new TypeError('argument must be a Number'); + if (typeof (tag) !== 'number') + tag = ASN1.Integer; + + var sz = 4; + + while ((((i & 0xff800000) === 0) || ((i & 0xff800000) === 0xff800000 >> 0)) && + (sz > 1)) { + sz--; + i <<= 8; + } + + if (sz > 4) + throw newInvalidAsn1Error('BER ints cannot be > 0xffffffff'); + + this._ensure(2 + sz); + this._buf[this._offset++] = tag; + this._buf[this._offset++] = sz; + + while (sz-- > 0) { + this._buf[this._offset++] = ((i & 0xff000000) >>> 24); + i <<= 8; + } + +}; + + +Writer.prototype.writeNull = function () { + this.writeByte(ASN1.Null); + this.writeByte(0x00); +}; + + +Writer.prototype.writeEnumeration = function (i, tag) { + if (typeof (i) !== 'number') + throw new TypeError('argument must be a Number'); + if (typeof (tag) !== 'number') + tag = ASN1.Enumeration; + + return this.writeInt(i, tag); +}; + + +Writer.prototype.writeBoolean = function (b, tag) { + if (typeof (b) !== 'boolean') + throw new TypeError('argument must be a Boolean'); + if (typeof (tag) !== 'number') + tag = ASN1.Boolean; + + this._ensure(3); + this._buf[this._offset++] = tag; + this._buf[this._offset++] = 0x01; + this._buf[this._offset++] = b ? 0xff : 0x00; +}; + + +Writer.prototype.writeString = function (s, tag) { + if (typeof (s) !== 'string') + throw new TypeError('argument must be a string (was: ' + typeof (s) + ')'); + if (typeof (tag) !== 'number') + tag = ASN1.OctetString; + + var len = Buffer.byteLength(s); + this.writeByte(tag); + this.writeLength(len); + if (len) { + this._ensure(len); + this._buf.write(s, this._offset); + this._offset += len; + } +}; + + +Writer.prototype.writeBuffer = function (buf, tag) { + if (typeof (tag) !== 'number') + throw new TypeError('tag must be a number'); + if (!Buffer.isBuffer(buf)) + throw new TypeError('argument must be a buffer'); + + this.writeByte(tag); + this.writeLength(buf.length); + this._ensure(buf.length); + buf.copy(this._buf, this._offset, 0, buf.length); + this._offset += buf.length; +}; + + +Writer.prototype.writeStringArray = function (strings) { + if ((!strings instanceof Array)) + throw new TypeError('argument must be an Array[String]'); + + var self = this; + strings.forEach(function (s) { + self.writeString(s); + }); +}; + +// This is really to solve DER cases, but whatever for now +Writer.prototype.writeOID = function (s, tag) { + if (typeof (s) !== 'string') + throw new TypeError('argument must be a string'); + if (typeof (tag) !== 'number') + tag = ASN1.OID; + + if (!/^([0-9]+\.){3,}[0-9]+$/.test(s)) + throw new Error('argument is not a valid OID string'); + + function encodeOctet(bytes, octet) { + if (octet < 128) { + bytes.push(octet); + } else if (octet < 16384) { + bytes.push((octet >>> 7) | 0x80); + bytes.push(octet & 0x7F); + } else if (octet < 2097152) { + bytes.push((octet >>> 14) | 0x80); + bytes.push(((octet >>> 7) | 0x80) & 0xFF); + bytes.push(octet & 0x7F); + } else if (octet < 268435456) { + bytes.push((octet >>> 21) | 0x80); + bytes.push(((octet >>> 14) | 0x80) & 0xFF); + bytes.push(((octet >>> 7) | 0x80) & 0xFF); + bytes.push(octet & 0x7F); + } else { + bytes.push(((octet >>> 28) | 0x80) & 0xFF); + bytes.push(((octet >>> 21) | 0x80) & 0xFF); + bytes.push(((octet >>> 14) | 0x80) & 0xFF); + bytes.push(((octet >>> 7) | 0x80) & 0xFF); + bytes.push(octet & 0x7F); + } + } + + var tmp = s.split('.'); + var bytes = []; + bytes.push(parseInt(tmp[0], 10) * 40 + parseInt(tmp[1], 10)); + tmp.slice(2).forEach(function (b) { + encodeOctet(bytes, parseInt(b, 10)); + }); + + var self = this; + this._ensure(2 + bytes.length); + this.writeByte(tag); + this.writeLength(bytes.length); + bytes.forEach(function (b) { + self.writeByte(b); + }); +}; + + +Writer.prototype.writeLength = function (len) { + if (typeof (len) !== 'number') + throw new TypeError('argument must be a Number'); + + this._ensure(4); + + if (len <= 0x7f) { + this._buf[this._offset++] = len; + } else if (len <= 0xff) { + this._buf[this._offset++] = 0x81; + this._buf[this._offset++] = len; + } else if (len <= 0xffff) { + this._buf[this._offset++] = 0x82; + this._buf[this._offset++] = len >> 8; + this._buf[this._offset++] = len; + } else if (len <= 0xffffff) { + this._buf[this._offset++] = 0x83; + this._buf[this._offset++] = len >> 16; + this._buf[this._offset++] = len >> 8; + this._buf[this._offset++] = len; + } else { + throw newInvalidAsn1Error('Length too long (> 4 bytes)'); + } +}; + +Writer.prototype.startSequence = function (tag) { + if (typeof (tag) !== 'number') + tag = ASN1.Sequence | ASN1.Constructor; + + this.writeByte(tag); + this._seq.push(this._offset); + this._ensure(3); + this._offset += 3; +}; + + +Writer.prototype.endSequence = function () { + var seq = this._seq.pop(); + var start = seq + 3; + var len = this._offset - start; + + if (len <= 0x7f) { + this._shift(start, len, -2); + this._buf[seq] = len; + } else if (len <= 0xff) { + this._shift(start, len, -1); + this._buf[seq] = 0x81; + this._buf[seq + 1] = len; + } else if (len <= 0xffff) { + this._buf[seq] = 0x82; + this._buf[seq + 1] = len >> 8; + this._buf[seq + 2] = len; + } else if (len <= 0xffffff) { + this._shift(start, len, 1); + this._buf[seq] = 0x83; + this._buf[seq + 1] = len >> 16; + this._buf[seq + 2] = len >> 8; + this._buf[seq + 3] = len; + } else { + throw newInvalidAsn1Error('Sequence too long'); + } +}; + + +Writer.prototype._shift = function (start, len, shift) { + assert.ok(start !== undefined); + assert.ok(len !== undefined); + assert.ok(shift); + + this._buf.copy(this._buf, start + shift, start, start + len); + this._offset += shift; +}; + +Writer.prototype._ensure = function (len) { + assert.ok(len); + + if (this._size - this._offset < len) { + var sz = this._size * this._options.growthFactor; + if (sz - this._offset < len) + sz += len; + + var buf = Buffer.alloc(sz); + + this._buf.copy(buf, 0, 0, this._offset); + this._buf = buf; + this._size = sz; + } +}; + + + +// --- Exported API + +module.exports = Writer; diff --git a/tunestats/app/api/node_modules/asn1/lib/index.js b/tunestats/app/api/node_modules/asn1/lib/index.js new file mode 100644 index 0000000..ede3ab2 --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/lib/index.js @@ -0,0 +1,20 @@ +// Copyright 2011 Mark Cavage All rights reserved. + +// If you have no idea what ASN.1 or BER is, see this: +// ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc + +var Ber = require('./ber/index'); + + + +// --- Exported API + +module.exports = { + + Ber: Ber, + + BerReader: Ber.Reader, + + BerWriter: Ber.Writer + +}; diff --git a/tunestats/app/api/node_modules/asn1/package.json b/tunestats/app/api/node_modules/asn1/package.json new file mode 100644 index 0000000..e31cce5 --- /dev/null +++ b/tunestats/app/api/node_modules/asn1/package.json @@ -0,0 +1,31 @@ +{ + "author": "Joyent (joyent.com)", + "contributors": [ + "Mark Cavage ", + "David Gwynne ", + "Yunong Xiao ", + "Alex Wilson " + ], + "name": "asn1", + "description": "Contains parsers and serializers for ASN.1 (currently BER only)", + "version": "0.2.6", + "repository": { + "type": "git", + "url": "https://github.com/joyent/node-asn1.git" + }, + "main": "lib/index.js", + "dependencies": { + "safer-buffer": "~2.1.0" + }, + "devDependencies": { + "istanbul": "^0.3.6", + "faucet": "0.0.1", + "tape": "^3.5.0", + "eslint": "2.13.1", + "eslint-plugin-joyent": "~1.3.0" + }, + "scripts": { + "test": "./node_modules/.bin/tape ./test/ber/*.test.js" + }, + "license": "MIT" +} diff --git a/tunestats/app/api/node_modules/assert-plus/AUTHORS b/tunestats/app/api/node_modules/assert-plus/AUTHORS new file mode 100644 index 0000000..1923524 --- /dev/null +++ b/tunestats/app/api/node_modules/assert-plus/AUTHORS @@ -0,0 +1,6 @@ +Dave Eddy +Fred Kuo +Lars-Magnus Skog +Mark Cavage +Patrick Mooney +Rob Gulewich diff --git a/tunestats/app/api/node_modules/assert-plus/CHANGES.md b/tunestats/app/api/node_modules/assert-plus/CHANGES.md new file mode 100644 index 0000000..57d92bf --- /dev/null +++ b/tunestats/app/api/node_modules/assert-plus/CHANGES.md @@ -0,0 +1,14 @@ +# assert-plus Changelog + +## 1.0.0 + +- *BREAKING* assert.number (and derivatives) now accept Infinity as valid input +- Add assert.finite check. Previous assert.number callers should use this if + they expect Infinity inputs to throw. + +## 0.2.0 + +- Fix `assert.object(null)` so it throws +- Fix optional/arrayOf exports for non-type-of asserts +- Add optiona/arrayOf exports for Stream/Date/Regex/uuid +- Add basic unit test coverage diff --git a/tunestats/app/api/node_modules/assert-plus/README.md b/tunestats/app/api/node_modules/assert-plus/README.md new file mode 100644 index 0000000..ec200d1 --- /dev/null +++ b/tunestats/app/api/node_modules/assert-plus/README.md @@ -0,0 +1,162 @@ +# assert-plus + +This library is a super small wrapper over node's assert module that has two +things: (1) the ability to disable assertions with the environment variable +NODE\_NDEBUG, and (2) some API wrappers for argument testing. Like +`assert.string(myArg, 'myArg')`. As a simple example, most of my code looks +like this: + +```javascript + var assert = require('assert-plus'); + + function fooAccount(options, callback) { + assert.object(options, 'options'); + assert.number(options.id, 'options.id'); + assert.bool(options.isManager, 'options.isManager'); + assert.string(options.name, 'options.name'); + assert.arrayOfString(options.email, 'options.email'); + assert.func(callback, 'callback'); + + // Do stuff + callback(null, {}); + } +``` + +# API + +All methods that *aren't* part of node's core assert API are simply assumed to +take an argument, and then a string 'name' that's not a message; `AssertionError` +will be thrown if the assertion fails with a message like: + + AssertionError: foo (string) is required + at test (/home/mark/work/foo/foo.js:3:9) + at Object. (/home/mark/work/foo/foo.js:15:1) + at Module._compile (module.js:446:26) + at Object..js (module.js:464:10) + at Module.load (module.js:353:31) + at Function._load (module.js:311:12) + at Array.0 (module.js:484:10) + at EventEmitter._tickCallback (node.js:190:38) + +from: + +```javascript + function test(foo) { + assert.string(foo, 'foo'); + } +``` + +There you go. You can check that arrays are of a homogeneous type with `Arrayof$Type`: + +```javascript + function test(foo) { + assert.arrayOfString(foo, 'foo'); + } +``` + +You can assert IFF an argument is not `undefined` (i.e., an optional arg): + +```javascript + assert.optionalString(foo, 'foo'); +``` + +Lastly, you can opt-out of assertion checking altogether by setting the +environment variable `NODE_NDEBUG=1`. This is pseudo-useful if you have +lots of assertions, and don't want to pay `typeof ()` taxes to v8 in +production. Be advised: The standard functions re-exported from `assert` are +also disabled in assert-plus if NDEBUG is specified. Using them directly from +the `assert` module avoids this behavior. + +The complete list of APIs is: + +* assert.array +* assert.bool +* assert.buffer +* assert.func +* assert.number +* assert.finite +* assert.object +* assert.string +* assert.stream +* assert.date +* assert.regexp +* assert.uuid +* assert.arrayOfArray +* assert.arrayOfBool +* assert.arrayOfBuffer +* assert.arrayOfFunc +* assert.arrayOfNumber +* assert.arrayOfFinite +* assert.arrayOfObject +* assert.arrayOfString +* assert.arrayOfStream +* assert.arrayOfDate +* assert.arrayOfRegexp +* assert.arrayOfUuid +* assert.optionalArray +* assert.optionalBool +* assert.optionalBuffer +* assert.optionalFunc +* assert.optionalNumber +* assert.optionalFinite +* assert.optionalObject +* assert.optionalString +* assert.optionalStream +* assert.optionalDate +* assert.optionalRegexp +* assert.optionalUuid +* assert.optionalArrayOfArray +* assert.optionalArrayOfBool +* assert.optionalArrayOfBuffer +* assert.optionalArrayOfFunc +* assert.optionalArrayOfNumber +* assert.optionalArrayOfFinite +* assert.optionalArrayOfObject +* assert.optionalArrayOfString +* assert.optionalArrayOfStream +* assert.optionalArrayOfDate +* assert.optionalArrayOfRegexp +* assert.optionalArrayOfUuid +* assert.AssertionError +* assert.fail +* assert.ok +* assert.equal +* assert.notEqual +* assert.deepEqual +* assert.notDeepEqual +* assert.strictEqual +* assert.notStrictEqual +* assert.throws +* assert.doesNotThrow +* assert.ifError + +# Installation + + npm install assert-plus + +## License + +The MIT License (MIT) +Copyright (c) 2012 Mark Cavage + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. + +## Bugs + +See . diff --git a/tunestats/app/api/node_modules/assert-plus/assert.js b/tunestats/app/api/node_modules/assert-plus/assert.js new file mode 100644 index 0000000..26f944e --- /dev/null +++ b/tunestats/app/api/node_modules/assert-plus/assert.js @@ -0,0 +1,211 @@ +// Copyright (c) 2012, Mark Cavage. All rights reserved. +// Copyright 2015 Joyent, Inc. + +var assert = require('assert'); +var Stream = require('stream').Stream; +var util = require('util'); + + +///--- Globals + +/* JSSTYLED */ +var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; + + +///--- Internal + +function _capitalize(str) { + return (str.charAt(0).toUpperCase() + str.slice(1)); +} + +function _toss(name, expected, oper, arg, actual) { + throw new assert.AssertionError({ + message: util.format('%s (%s) is required', name, expected), + actual: (actual === undefined) ? typeof (arg) : actual(arg), + expected: expected, + operator: oper || '===', + stackStartFunction: _toss.caller + }); +} + +function _getClass(arg) { + return (Object.prototype.toString.call(arg).slice(8, -1)); +} + +function noop() { + // Why even bother with asserts? +} + + +///--- Exports + +var types = { + bool: { + check: function (arg) { return typeof (arg) === 'boolean'; } + }, + func: { + check: function (arg) { return typeof (arg) === 'function'; } + }, + string: { + check: function (arg) { return typeof (arg) === 'string'; } + }, + object: { + check: function (arg) { + return typeof (arg) === 'object' && arg !== null; + } + }, + number: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg); + } + }, + finite: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); + } + }, + buffer: { + check: function (arg) { return Buffer.isBuffer(arg); }, + operator: 'Buffer.isBuffer' + }, + array: { + check: function (arg) { return Array.isArray(arg); }, + operator: 'Array.isArray' + }, + stream: { + check: function (arg) { return arg instanceof Stream; }, + operator: 'instanceof', + actual: _getClass + }, + date: { + check: function (arg) { return arg instanceof Date; }, + operator: 'instanceof', + actual: _getClass + }, + regexp: { + check: function (arg) { return arg instanceof RegExp; }, + operator: 'instanceof', + actual: _getClass + }, + uuid: { + check: function (arg) { + return typeof (arg) === 'string' && UUID_REGEXP.test(arg); + }, + operator: 'isUUID' + } +}; + +function _setExports(ndebug) { + var keys = Object.keys(types); + var out; + + /* re-export standard assert */ + if (process.env.NODE_NDEBUG) { + out = noop; + } else { + out = function (arg, msg) { + if (!arg) { + _toss(msg, 'true', arg); + } + }; + } + + /* standard checks */ + keys.forEach(function (k) { + if (ndebug) { + out[k] = noop; + return; + } + var type = types[k]; + out[k] = function (arg, msg) { + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* optional checks */ + keys.forEach(function (k) { + var name = 'optional' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* arrayOf checks */ + keys.forEach(function (k) { + var name = 'arrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* optionalArrayOf checks */ + keys.forEach(function (k) { + var name = 'optionalArrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* re-export built-in assertions */ + Object.keys(assert).forEach(function (k) { + if (k === 'AssertionError') { + out[k] = assert[k]; + return; + } + if (ndebug) { + out[k] = noop; + return; + } + out[k] = assert[k]; + }); + + /* export ourselves (for unit tests _only_) */ + out._setExports = _setExports; + + return out; +} + +module.exports = _setExports(process.env.NODE_NDEBUG); diff --git a/tunestats/app/api/node_modules/assert-plus/package.json b/tunestats/app/api/node_modules/assert-plus/package.json new file mode 100644 index 0000000..40d6a5c --- /dev/null +++ b/tunestats/app/api/node_modules/assert-plus/package.json @@ -0,0 +1,23 @@ +{ + "author": "Mark Cavage ", + "name": "assert-plus", + "description": "Extra assertions on top of node's assert module", + "version": "1.0.0", + "license": "MIT", + "main": "./assert.js", + "devDependencies": { + "tape": "4.2.2", + "faucet": "0.0.1" + }, + "optionalDependencies": {}, + "scripts": { + "test": "./node_modules/.bin/tape tests/*.js | ./node_modules/.bin/faucet" + }, + "repository": { + "type": "git", + "url": "https://github.com/mcavage/node-assert-plus.git" + }, + "engines": { + "node": ">=0.8" + } +} diff --git a/tunestats/app/api/node_modules/asynckit/LICENSE b/tunestats/app/api/node_modules/asynckit/LICENSE new file mode 100644 index 0000000..c9eca5d --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Alex Indigo + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/tunestats/app/api/node_modules/asynckit/README.md b/tunestats/app/api/node_modules/asynckit/README.md new file mode 100644 index 0000000..ddcc7e6 --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/README.md @@ -0,0 +1,233 @@ +# asynckit [![NPM Module](https://img.shields.io/npm/v/asynckit.svg?style=flat)](https://www.npmjs.com/package/asynckit) + +Minimal async jobs utility library, with streams support. + +[![PhantomJS Build](https://img.shields.io/travis/alexindigo/asynckit/v0.4.0.svg?label=browser&style=flat)](https://travis-ci.org/alexindigo/asynckit) +[![Linux Build](https://img.shields.io/travis/alexindigo/asynckit/v0.4.0.svg?label=linux:0.12-6.x&style=flat)](https://travis-ci.org/alexindigo/asynckit) +[![Windows Build](https://img.shields.io/appveyor/ci/alexindigo/asynckit/v0.4.0.svg?label=windows:0.12-6.x&style=flat)](https://ci.appveyor.com/project/alexindigo/asynckit) + +[![Coverage Status](https://img.shields.io/coveralls/alexindigo/asynckit/v0.4.0.svg?label=code+coverage&style=flat)](https://coveralls.io/github/alexindigo/asynckit?branch=master) +[![Dependency Status](https://img.shields.io/david/alexindigo/asynckit/v0.4.0.svg?style=flat)](https://david-dm.org/alexindigo/asynckit) +[![bitHound Overall Score](https://www.bithound.io/github/alexindigo/asynckit/badges/score.svg)](https://www.bithound.io/github/alexindigo/asynckit) + + + +AsyncKit provides harness for `parallel` and `serial` iterators over list of items represented by arrays or objects. +Optionally it accepts abort function (should be synchronously return by iterator for each item), and terminates left over jobs upon an error event. For specific iteration order built-in (`ascending` and `descending`) and custom sort helpers also supported, via `asynckit.serialOrdered` method. + +It ensures async operations to keep behavior more stable and prevent `Maximum call stack size exceeded` errors, from sync iterators. + +| compression | size | +| :----------------- | -------: | +| asynckit.js | 12.34 kB | +| asynckit.min.js | 4.11 kB | +| asynckit.min.js.gz | 1.47 kB | + + +## Install + +```sh +$ npm install --save asynckit +``` + +## Examples + +### Parallel Jobs + +Runs iterator over provided array in parallel. Stores output in the `result` array, +on the matching positions. In unlikely event of an error from one of the jobs, +will terminate rest of the active jobs (if abort function is provided) +and return error along with salvaged data to the main callback function. + +#### Input Array + +```javascript +var parallel = require('asynckit').parallel + , assert = require('assert') + ; + +var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ] + , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ] + , target = [] + ; + +parallel(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); +}); + +// async job accepts one element from the array +// and a callback function +function asyncJob(item, cb) +{ + // different delays (in ms) per item + var delay = item * 25; + + // pretend different jobs take different time to finish + // and not in consequential order + var timeoutId = setTimeout(function() { + target.push(item); + cb(null, item * 2); + }, delay); + + // allow to cancel "leftover" jobs upon error + // return function, invoking of which will abort this job + return clearTimeout.bind(null, timeoutId); +} +``` + +More examples could be found in [test/test-parallel-array.js](test/test-parallel-array.js). + +#### Input Object + +Also it supports named jobs, listed via object. + +```javascript +var parallel = require('asynckit/parallel') + , assert = require('assert') + ; + +var source = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 } + , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 } + , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ] + , expectedKeys = [ 'first', 'one', 'two', 'four', 'eight', 'sixteen', 'thirtyTwo', 'sixtyFour' ] + , target = [] + , keys = [] + ; + +parallel(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); + assert.deepEqual(keys, expectedKeys); +}); + +// supports full value, key, callback (shortcut) interface +function asyncJob(item, key, cb) +{ + // different delays (in ms) per item + var delay = item * 25; + + // pretend different jobs take different time to finish + // and not in consequential order + var timeoutId = setTimeout(function() { + keys.push(key); + target.push(item); + cb(null, item * 2); + }, delay); + + // allow to cancel "leftover" jobs upon error + // return function, invoking of which will abort this job + return clearTimeout.bind(null, timeoutId); +} +``` + +More examples could be found in [test/test-parallel-object.js](test/test-parallel-object.js). + +### Serial Jobs + +Runs iterator over provided array sequentially. Stores output in the `result` array, +on the matching positions. In unlikely event of an error from one of the jobs, +will not proceed to the rest of the items in the list +and return error along with salvaged data to the main callback function. + +#### Input Array + +```javascript +var serial = require('asynckit/serial') + , assert = require('assert') + ; + +var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ] + , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ] + , target = [] + ; + +serial(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); +}); + +// extended interface (item, key, callback) +// also supported for arrays +function asyncJob(item, key, cb) +{ + target.push(key); + + // it will be automatically made async + // even it iterator "returns" in the same event loop + cb(null, item * 2); +} +``` + +More examples could be found in [test/test-serial-array.js](test/test-serial-array.js). + +#### Input Object + +Also it supports named jobs, listed via object. + +```javascript +var serial = require('asynckit').serial + , assert = require('assert') + ; + +var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ] + , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ] + , target = [] + ; + +var source = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 } + , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 } + , expectedTarget = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , target = [] + ; + + +serial(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); +}); + +// shortcut interface (item, callback) +// works for object as well as for the arrays +function asyncJob(item, cb) +{ + target.push(item); + + // it will be automatically made async + // even it iterator "returns" in the same event loop + cb(null, item * 2); +} +``` + +More examples could be found in [test/test-serial-object.js](test/test-serial-object.js). + +_Note: Since _object_ is an _unordered_ collection of properties, +it may produce unexpected results with sequential iterations. +Whenever order of the jobs' execution is important please use `serialOrdered` method._ + +### Ordered Serial Iterations + +TBD + +For example [compare-property](compare-property) package. + +### Streaming interface + +TBD + +## Want to Know More? + +More examples can be found in [test folder](test/). + +Or open an [issue](https://github.com/alexindigo/asynckit/issues) with questions and/or suggestions. + +## License + +AsyncKit is licensed under the MIT license. diff --git a/tunestats/app/api/node_modules/asynckit/bench.js b/tunestats/app/api/node_modules/asynckit/bench.js new file mode 100644 index 0000000..c612f1a --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/bench.js @@ -0,0 +1,76 @@ +/* eslint no-console: "off" */ + +var asynckit = require('./') + , async = require('async') + , assert = require('assert') + , expected = 0 + ; + +var Benchmark = require('benchmark'); +var suite = new Benchmark.Suite; + +var source = []; +for (var z = 1; z < 100; z++) +{ + source.push(z); + expected += z; +} + +suite +// add tests + +.add('async.map', function(deferred) +{ + var total = 0; + + async.map(source, + function(i, cb) + { + setImmediate(function() + { + total += i; + cb(null, total); + }); + }, + function(err, result) + { + assert.ifError(err); + assert.equal(result[result.length - 1], expected); + deferred.resolve(); + }); +}, {'defer': true}) + + +.add('asynckit.parallel', function(deferred) +{ + var total = 0; + + asynckit.parallel(source, + function(i, cb) + { + setImmediate(function() + { + total += i; + cb(null, total); + }); + }, + function(err, result) + { + assert.ifError(err); + assert.equal(result[result.length - 1], expected); + deferred.resolve(); + }); +}, {'defer': true}) + + +// add listeners +.on('cycle', function(ev) +{ + console.log(String(ev.target)); +}) +.on('complete', function() +{ + console.log('Fastest is ' + this.filter('fastest').map('name')); +}) +// run async +.run({ 'async': true }); diff --git a/tunestats/app/api/node_modules/asynckit/index.js b/tunestats/app/api/node_modules/asynckit/index.js new file mode 100644 index 0000000..455f945 --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/index.js @@ -0,0 +1,6 @@ +module.exports = +{ + parallel : require('./parallel.js'), + serial : require('./serial.js'), + serialOrdered : require('./serialOrdered.js') +}; diff --git a/tunestats/app/api/node_modules/asynckit/lib/abort.js b/tunestats/app/api/node_modules/asynckit/lib/abort.js new file mode 100644 index 0000000..114367e --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/abort.js @@ -0,0 +1,29 @@ +// API +module.exports = abort; + +/** + * Aborts leftover active jobs + * + * @param {object} state - current state object + */ +function abort(state) +{ + Object.keys(state.jobs).forEach(clean.bind(state)); + + // reset leftover jobs + state.jobs = {}; +} + +/** + * Cleans up leftover job by invoking abort function for the provided job id + * + * @this state + * @param {string|number} key - job id to abort + */ +function clean(key) +{ + if (typeof this.jobs[key] == 'function') + { + this.jobs[key](); + } +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/async.js b/tunestats/app/api/node_modules/asynckit/lib/async.js new file mode 100644 index 0000000..7f1288a --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/async.js @@ -0,0 +1,34 @@ +var defer = require('./defer.js'); + +// API +module.exports = async; + +/** + * Runs provided callback asynchronously + * even if callback itself is not + * + * @param {function} callback - callback to invoke + * @returns {function} - augmented callback + */ +function async(callback) +{ + var isAsync = false; + + // check if async happened + defer(function() { isAsync = true; }); + + return function async_callback(err, result) + { + if (isAsync) + { + callback(err, result); + } + else + { + defer(function nextTick_callback() + { + callback(err, result); + }); + } + }; +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/defer.js b/tunestats/app/api/node_modules/asynckit/lib/defer.js new file mode 100644 index 0000000..b67110c --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/defer.js @@ -0,0 +1,26 @@ +module.exports = defer; + +/** + * Runs provided function on next iteration of the event loop + * + * @param {function} fn - function to run + */ +function defer(fn) +{ + var nextTick = typeof setImmediate == 'function' + ? setImmediate + : ( + typeof process == 'object' && typeof process.nextTick == 'function' + ? process.nextTick + : null + ); + + if (nextTick) + { + nextTick(fn); + } + else + { + setTimeout(fn, 0); + } +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/iterate.js b/tunestats/app/api/node_modules/asynckit/lib/iterate.js new file mode 100644 index 0000000..5d2839a --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/iterate.js @@ -0,0 +1,75 @@ +var async = require('./async.js') + , abort = require('./abort.js') + ; + +// API +module.exports = iterate; + +/** + * Iterates over each job object + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {object} state - current job status + * @param {function} callback - invoked when all elements processed + */ +function iterate(list, iterator, state, callback) +{ + // store current index + var key = state['keyedList'] ? state['keyedList'][state.index] : state.index; + + state.jobs[key] = runJob(iterator, key, list[key], function(error, output) + { + // don't repeat yourself + // skip secondary callbacks + if (!(key in state.jobs)) + { + return; + } + + // clean up jobs + delete state.jobs[key]; + + if (error) + { + // don't process rest of the results + // stop still active jobs + // and reset the list + abort(state); + } + else + { + state.results[key] = output; + } + + // return salvaged results + callback(error, state.results); + }); +} + +/** + * Runs iterator over provided job element + * + * @param {function} iterator - iterator to invoke + * @param {string|number} key - key/index of the element in the list of jobs + * @param {mixed} item - job description + * @param {function} callback - invoked after iterator is done with the job + * @returns {function|mixed} - job abort function or something else + */ +function runJob(iterator, key, item, callback) +{ + var aborter; + + // allow shortcut if iterator expects only two arguments + if (iterator.length == 2) + { + aborter = iterator(item, async(callback)); + } + // otherwise go with full three arguments + else + { + aborter = iterator(item, key, async(callback)); + } + + return aborter; +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/readable_asynckit.js b/tunestats/app/api/node_modules/asynckit/lib/readable_asynckit.js new file mode 100644 index 0000000..78ad240 --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/readable_asynckit.js @@ -0,0 +1,91 @@ +var streamify = require('./streamify.js') + , defer = require('./defer.js') + ; + +// API +module.exports = ReadableAsyncKit; + +/** + * Base constructor for all streams + * used to hold properties/methods + */ +function ReadableAsyncKit() +{ + ReadableAsyncKit.super_.apply(this, arguments); + + // list of active jobs + this.jobs = {}; + + // add stream methods + this.destroy = destroy; + this._start = _start; + this._read = _read; +} + +/** + * Destroys readable stream, + * by aborting outstanding jobs + * + * @returns {void} + */ +function destroy() +{ + if (this.destroyed) + { + return; + } + + this.destroyed = true; + + if (typeof this.terminator == 'function') + { + this.terminator(); + } +} + +/** + * Starts provided jobs in async manner + * + * @private + */ +function _start() +{ + // first argument – runner function + var runner = arguments[0] + // take away first argument + , args = Array.prototype.slice.call(arguments, 1) + // second argument - input data + , input = args[0] + // last argument - result callback + , endCb = streamify.callback.call(this, args[args.length - 1]) + ; + + args[args.length - 1] = endCb; + // third argument - iterator + args[1] = streamify.iterator.call(this, args[1]); + + // allow time for proper setup + defer(function() + { + if (!this.destroyed) + { + this.terminator = runner.apply(null, args); + } + else + { + endCb(null, Array.isArray(input) ? [] : {}); + } + }.bind(this)); +} + + +/** + * Implement _read to comply with Readable streams + * Doesn't really make sense for flowing object mode + * + * @private + */ +function _read() +{ + +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/readable_parallel.js b/tunestats/app/api/node_modules/asynckit/lib/readable_parallel.js new file mode 100644 index 0000000..5d2929f --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/readable_parallel.js @@ -0,0 +1,25 @@ +var parallel = require('../parallel.js'); + +// API +module.exports = ReadableParallel; + +/** + * Streaming wrapper to `asynckit.parallel` + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {stream.Readable#} + */ +function ReadableParallel(list, iterator, callback) +{ + if (!(this instanceof ReadableParallel)) + { + return new ReadableParallel(list, iterator, callback); + } + + // turn on object mode + ReadableParallel.super_.call(this, {objectMode: true}); + + this._start(parallel, list, iterator, callback); +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/readable_serial.js b/tunestats/app/api/node_modules/asynckit/lib/readable_serial.js new file mode 100644 index 0000000..7822698 --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/readable_serial.js @@ -0,0 +1,25 @@ +var serial = require('../serial.js'); + +// API +module.exports = ReadableSerial; + +/** + * Streaming wrapper to `asynckit.serial` + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {stream.Readable#} + */ +function ReadableSerial(list, iterator, callback) +{ + if (!(this instanceof ReadableSerial)) + { + return new ReadableSerial(list, iterator, callback); + } + + // turn on object mode + ReadableSerial.super_.call(this, {objectMode: true}); + + this._start(serial, list, iterator, callback); +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/readable_serial_ordered.js b/tunestats/app/api/node_modules/asynckit/lib/readable_serial_ordered.js new file mode 100644 index 0000000..3de89c4 --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/readable_serial_ordered.js @@ -0,0 +1,29 @@ +var serialOrdered = require('../serialOrdered.js'); + +// API +module.exports = ReadableSerialOrdered; +// expose sort helpers +module.exports.ascending = serialOrdered.ascending; +module.exports.descending = serialOrdered.descending; + +/** + * Streaming wrapper to `asynckit.serialOrdered` + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} sortMethod - custom sort function + * @param {function} callback - invoked when all elements processed + * @returns {stream.Readable#} + */ +function ReadableSerialOrdered(list, iterator, sortMethod, callback) +{ + if (!(this instanceof ReadableSerialOrdered)) + { + return new ReadableSerialOrdered(list, iterator, sortMethod, callback); + } + + // turn on object mode + ReadableSerialOrdered.super_.call(this, {objectMode: true}); + + this._start(serialOrdered, list, iterator, sortMethod, callback); +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/state.js b/tunestats/app/api/node_modules/asynckit/lib/state.js new file mode 100644 index 0000000..cbea7ad --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/state.js @@ -0,0 +1,37 @@ +// API +module.exports = state; + +/** + * Creates initial state object + * for iteration over list + * + * @param {array|object} list - list to iterate over + * @param {function|null} sortMethod - function to use for keys sort, + * or `null` to keep them as is + * @returns {object} - initial state object + */ +function state(list, sortMethod) +{ + var isNamedList = !Array.isArray(list) + , initState = + { + index : 0, + keyedList: isNamedList || sortMethod ? Object.keys(list) : null, + jobs : {}, + results : isNamedList ? {} : [], + size : isNamedList ? Object.keys(list).length : list.length + } + ; + + if (sortMethod) + { + // sort array keys based on it's values + // sort object's keys just on own merit + initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) + { + return sortMethod(list[a], list[b]); + }); + } + + return initState; +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/streamify.js b/tunestats/app/api/node_modules/asynckit/lib/streamify.js new file mode 100644 index 0000000..f56a1c9 --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/streamify.js @@ -0,0 +1,141 @@ +var async = require('./async.js'); + +// API +module.exports = { + iterator: wrapIterator, + callback: wrapCallback +}; + +/** + * Wraps iterators with long signature + * + * @this ReadableAsyncKit# + * @param {function} iterator - function to wrap + * @returns {function} - wrapped function + */ +function wrapIterator(iterator) +{ + var stream = this; + + return function(item, key, cb) + { + var aborter + , wrappedCb = async(wrapIteratorCallback.call(stream, cb, key)) + ; + + stream.jobs[key] = wrappedCb; + + // it's either shortcut (item, cb) + if (iterator.length == 2) + { + aborter = iterator(item, wrappedCb); + } + // or long format (item, key, cb) + else + { + aborter = iterator(item, key, wrappedCb); + } + + return aborter; + }; +} + +/** + * Wraps provided callback function + * allowing to execute snitch function before + * real callback + * + * @this ReadableAsyncKit# + * @param {function} callback - function to wrap + * @returns {function} - wrapped function + */ +function wrapCallback(callback) +{ + var stream = this; + + var wrapped = function(error, result) + { + return finisher.call(stream, error, result, callback); + }; + + return wrapped; +} + +/** + * Wraps provided iterator callback function + * makes sure snitch only called once, + * but passes secondary calls to the original callback + * + * @this ReadableAsyncKit# + * @param {function} callback - callback to wrap + * @param {number|string} key - iteration key + * @returns {function} wrapped callback + */ +function wrapIteratorCallback(callback, key) +{ + var stream = this; + + return function(error, output) + { + // don't repeat yourself + if (!(key in stream.jobs)) + { + callback(error, output); + return; + } + + // clean up jobs + delete stream.jobs[key]; + + return streamer.call(stream, error, {key: key, value: output}, callback); + }; +} + +/** + * Stream wrapper for iterator callback + * + * @this ReadableAsyncKit# + * @param {mixed} error - error response + * @param {mixed} output - iterator output + * @param {function} callback - callback that expects iterator results + */ +function streamer(error, output, callback) +{ + if (error && !this.error) + { + this.error = error; + this.pause(); + this.emit('error', error); + // send back value only, as expected + callback(error, output && output.value); + return; + } + + // stream stuff + this.push(output); + + // back to original track + // send back value only, as expected + callback(error, output && output.value); +} + +/** + * Stream wrapper for finishing callback + * + * @this ReadableAsyncKit# + * @param {mixed} error - error response + * @param {mixed} output - iterator output + * @param {function} callback - callback that expects final results + */ +function finisher(error, output, callback) +{ + // signal end of the stream + // only for successfully finished streams + if (!error) + { + this.push(null); + } + + // back to original track + callback(error, output); +} diff --git a/tunestats/app/api/node_modules/asynckit/lib/terminator.js b/tunestats/app/api/node_modules/asynckit/lib/terminator.js new file mode 100644 index 0000000..d6eb992 --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/lib/terminator.js @@ -0,0 +1,29 @@ +var abort = require('./abort.js') + , async = require('./async.js') + ; + +// API +module.exports = terminator; + +/** + * Terminates jobs in the attached state context + * + * @this AsyncKitState# + * @param {function} callback - final callback to invoke after termination + */ +function terminator(callback) +{ + if (!Object.keys(this.jobs).length) + { + return; + } + + // fast forward iteration index + this.index = this.size; + + // abort jobs + abort(this); + + // send back results we have so far + async(callback)(null, this.results); +} diff --git a/tunestats/app/api/node_modules/asynckit/package.json b/tunestats/app/api/node_modules/asynckit/package.json new file mode 100644 index 0000000..51147d6 --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/package.json @@ -0,0 +1,63 @@ +{ + "name": "asynckit", + "version": "0.4.0", + "description": "Minimal async jobs utility library, with streams support", + "main": "index.js", + "scripts": { + "clean": "rimraf coverage", + "lint": "eslint *.js lib/*.js test/*.js", + "test": "istanbul cover --reporter=json tape -- 'test/test-*.js' | tap-spec", + "win-test": "tape test/test-*.js", + "browser": "browserify -t browserify-istanbul test/lib/browserify_adjustment.js test/test-*.js | obake --coverage | tap-spec", + "report": "istanbul report", + "size": "browserify index.js | size-table asynckit", + "debug": "tape test/test-*.js" + }, + "pre-commit": [ + "clean", + "lint", + "test", + "browser", + "report", + "size" + ], + "repository": { + "type": "git", + "url": "git+https://github.com/alexindigo/asynckit.git" + }, + "keywords": [ + "async", + "jobs", + "parallel", + "serial", + "iterator", + "array", + "object", + "stream", + "destroy", + "terminate", + "abort" + ], + "author": "Alex Indigo ", + "license": "MIT", + "bugs": { + "url": "https://github.com/alexindigo/asynckit/issues" + }, + "homepage": "https://github.com/alexindigo/asynckit#readme", + "devDependencies": { + "browserify": "^13.0.0", + "browserify-istanbul": "^2.0.0", + "coveralls": "^2.11.9", + "eslint": "^2.9.0", + "istanbul": "^0.4.3", + "obake": "^0.1.2", + "phantomjs-prebuilt": "^2.1.7", + "pre-commit": "^1.1.3", + "reamde": "^1.1.0", + "rimraf": "^2.5.2", + "size-table": "^0.2.0", + "tap-spec": "^4.1.1", + "tape": "^4.5.1" + }, + "dependencies": {} +} diff --git a/tunestats/app/api/node_modules/asynckit/parallel.js b/tunestats/app/api/node_modules/asynckit/parallel.js new file mode 100644 index 0000000..3c50344 --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/parallel.js @@ -0,0 +1,43 @@ +var iterate = require('./lib/iterate.js') + , initState = require('./lib/state.js') + , terminator = require('./lib/terminator.js') + ; + +// Public API +module.exports = parallel; + +/** + * Runs iterator over provided array elements in parallel + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function parallel(list, iterator, callback) +{ + var state = initState(list); + + while (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, function(error, result) + { + if (error) + { + callback(error, result); + return; + } + + // looks like it's the last one + if (Object.keys(state.jobs).length === 0) + { + callback(null, state.results); + return; + } + }); + + state.index++; + } + + return terminator.bind(state, callback); +} diff --git a/tunestats/app/api/node_modules/asynckit/serial.js b/tunestats/app/api/node_modules/asynckit/serial.js new file mode 100644 index 0000000..6cd949a --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/serial.js @@ -0,0 +1,17 @@ +var serialOrdered = require('./serialOrdered.js'); + +// Public API +module.exports = serial; + +/** + * Runs iterator over provided array elements in series + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function serial(list, iterator, callback) +{ + return serialOrdered(list, iterator, null, callback); +} diff --git a/tunestats/app/api/node_modules/asynckit/serialOrdered.js b/tunestats/app/api/node_modules/asynckit/serialOrdered.js new file mode 100644 index 0000000..607eafe --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/serialOrdered.js @@ -0,0 +1,75 @@ +var iterate = require('./lib/iterate.js') + , initState = require('./lib/state.js') + , terminator = require('./lib/terminator.js') + ; + +// Public API +module.exports = serialOrdered; +// sorting helpers +module.exports.ascending = ascending; +module.exports.descending = descending; + +/** + * Runs iterator over provided sorted array elements in series + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} sortMethod - custom sort function + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function serialOrdered(list, iterator, sortMethod, callback) +{ + var state = initState(list, sortMethod); + + iterate(list, iterator, state, function iteratorHandler(error, result) + { + if (error) + { + callback(error, result); + return; + } + + state.index++; + + // are we there yet? + if (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, iteratorHandler); + return; + } + + // done here + callback(null, state.results); + }); + + return terminator.bind(state, callback); +} + +/* + * -- Sort methods + */ + +/** + * sort helper to sort array elements in ascending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function ascending(a, b) +{ + return a < b ? -1 : a > b ? 1 : 0; +} + +/** + * sort helper to sort array elements in descending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function descending(a, b) +{ + return -1 * ascending(a, b); +} diff --git a/tunestats/app/api/node_modules/asynckit/stream.js b/tunestats/app/api/node_modules/asynckit/stream.js new file mode 100644 index 0000000..d43465f --- /dev/null +++ b/tunestats/app/api/node_modules/asynckit/stream.js @@ -0,0 +1,21 @@ +var inherits = require('util').inherits + , Readable = require('stream').Readable + , ReadableAsyncKit = require('./lib/readable_asynckit.js') + , ReadableParallel = require('./lib/readable_parallel.js') + , ReadableSerial = require('./lib/readable_serial.js') + , ReadableSerialOrdered = require('./lib/readable_serial_ordered.js') + ; + +// API +module.exports = +{ + parallel : ReadableParallel, + serial : ReadableSerial, + serialOrdered : ReadableSerialOrdered, +}; + +inherits(ReadableAsyncKit, Readable); + +inherits(ReadableParallel, ReadableAsyncKit); +inherits(ReadableSerial, ReadableAsyncKit); +inherits(ReadableSerialOrdered, ReadableAsyncKit); diff --git a/tunestats/app/api/node_modules/aws-sign2/LICENSE b/tunestats/app/api/node_modules/aws-sign2/LICENSE new file mode 100644 index 0000000..a4a9aee --- /dev/null +++ b/tunestats/app/api/node_modules/aws-sign2/LICENSE @@ -0,0 +1,55 @@ +Apache License + +Version 2.0, January 2004 + +http://www.apache.org/licenses/ + +TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + +1. Definitions. + +"License" shall mean the terms and conditions for use, reproduction, and distribution as defined by Sections 1 through 9 of this document. + +"Licensor" shall mean the copyright owner or entity authorized by the copyright owner that is granting the License. + +"Legal Entity" shall mean the union of the acting entity and all other entities that control, are controlled by, or are under common control with that entity. For the purposes of this definition, "control" means (i) the power, direct or indirect, to cause the direction or management of such entity, whether by contract or otherwise, or (ii) ownership of fifty percent (50%) or more of the outstanding shares, or (iii) beneficial ownership of such entity. + +"You" (or "Your") shall mean an individual or Legal Entity exercising permissions granted by this License. + +"Source" form shall mean the preferred form for making modifications, including but not limited to software source code, documentation source, and configuration files. + +"Object" form shall mean any form resulting from mechanical transformation or translation of a Source form, including but not limited to compiled object code, generated documentation, and conversions to other media types. + +"Work" shall mean the work of authorship, whether in Source or Object form, made available under the License, as indicated by a copyright notice that is included in or attached to the work (an example is provided in the Appendix below). + +"Derivative Works" shall mean any work, whether in Source or Object form, that is based on (or derived from) the Work and for which the editorial revisions, annotations, elaborations, or other modifications represent, as a whole, an original work of authorship. For the purposes of this License, Derivative Works shall not include works that remain separable from, or merely link (or bind by name) to the interfaces of, the Work and Derivative Works thereof. + +"Contribution" shall mean any work of authorship, including the original version of the Work and any modifications or additions to that Work or Derivative Works thereof, that is intentionally submitted to Licensor for inclusion in the Work by the copyright owner or by an individual or Legal Entity authorized to submit on behalf of the copyright owner. For the purposes of this definition, "submitted" means any form of electronic, verbal, or written communication sent to the Licensor or its representatives, including but not limited to communication on electronic mailing lists, source code control systems, and issue tracking systems that are managed by, or on behalf of, the Licensor for the purpose of discussing and improving the Work, but excluding communication that is conspicuously marked or otherwise designated in writing by the copyright owner as "Not a Contribution." + +"Contributor" shall mean Licensor and any individual or Legal Entity on behalf of whom a Contribution has been received by Licensor and subsequently incorporated within the Work. + +2. Grant of Copyright License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable copyright license to reproduce, prepare Derivative Works of, publicly display, publicly perform, sublicense, and distribute the Work and such Derivative Works in Source or Object form. + +3. Grant of Patent License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable (except as stated in this section) patent license to make, have made, use, offer to sell, sell, import, and otherwise transfer the Work, where such license applies only to those patent claims licensable by such Contributor that are necessarily infringed by their Contribution(s) alone or by combination of their Contribution(s) with the Work to which such Contribution(s) was submitted. If You institute patent litigation against any entity (including a cross-claim or counterclaim in a lawsuit) alleging that the Work or a Contribution incorporated within the Work constitutes direct or contributory patent infringement, then any patent licenses granted to You under this License for that Work shall terminate as of the date such litigation is filed. + +4. Redistribution. You may reproduce and distribute copies of the Work or Derivative Works thereof in any medium, with or without modifications, and in Source or Object form, provided that You meet the following conditions: + +You must give any other recipients of the Work or Derivative Works a copy of this License; and + +You must cause any modified files to carry prominent notices stating that You changed the files; and + +You must retain, in the Source form of any Derivative Works that You distribute, all copyright, patent, trademark, and attribution notices from the Source form of the Work, excluding those notices that do not pertain to any part of the Derivative Works; and + +If the Work includes a "NOTICE" text file as part of its distribution, then any Derivative Works that You distribute must include a readable copy of the attribution notices contained within such NOTICE file, excluding those notices that do not pertain to any part of the Derivative Works, in at least one of the following places: within a NOTICE text file distributed as part of the Derivative Works; within the Source form or documentation, if provided along with the Derivative Works; or, within a display generated by the Derivative Works, if and wherever such third-party notices normally appear. The contents of the NOTICE file are for informational purposes only and do not modify the License. You may add Your own attribution notices within Derivative Works that You distribute, alongside or as an addendum to the NOTICE text from the Work, provided that such additional attribution notices cannot be construed as modifying the License. You may add Your own copyright statement to Your modifications and may provide additional or different license terms and conditions for use, reproduction, or distribution of Your modifications, or for any such Derivative Works as a whole, provided Your use, reproduction, and distribution of the Work otherwise complies with the conditions stated in this License. + +5. Submission of Contributions. Unless You explicitly state otherwise, any Contribution intentionally submitted for inclusion in the Work by You to the Licensor shall be under the terms and conditions of this License, without any additional terms or conditions. Notwithstanding the above, nothing herein shall supersede or modify the terms of any separate license agreement you may have executed with Licensor regarding such Contributions. + +6. Trademarks. This License does not grant permission to use the trade names, trademarks, service marks, or product names of the Licensor, except as required for reasonable and customary use in describing the origin of the Work and reproducing the content of the NOTICE file. + +7. Disclaimer of Warranty. Unless required by applicable law or agreed to in writing, Licensor provides the Work (and each Contributor provides its Contributions) on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied, including, without limitation, any warranties or conditions of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A PARTICULAR PURPOSE. You are solely responsible for determining the appropriateness of using or redistributing the Work and assume any risks associated with Your exercise of permissions under this License. + +8. Limitation of Liability. In no event and under no legal theory, whether in tort (including negligence), contract, or otherwise, unless required by applicable law (such as deliberate and grossly negligent acts) or agreed to in writing, shall any Contributor be liable to You for damages, including any direct, indirect, special, incidental, or consequential damages of any character arising as a result of this License or out of the use or inability to use the Work (including but not limited to damages for loss of goodwill, work stoppage, computer failure or malfunction, or any and all other commercial damages or losses), even if such Contributor has been advised of the possibility of such damages. + +9. Accepting Warranty or Additional Liability. While redistributing the Work or Derivative Works thereof, You may choose to offer, and charge a fee for, acceptance of support, warranty, indemnity, or other liability obligations and/or rights consistent with this License. However, in accepting such obligations, You may act only on Your own behalf and on Your sole responsibility, not on behalf of any other Contributor, and only if You agree to indemnify, defend, and hold each Contributor harmless for any liability incurred by, or claims asserted against, such Contributor by reason of your accepting any such warranty or additional liability. + +END OF TERMS AND CONDITIONS \ No newline at end of file diff --git a/tunestats/app/api/node_modules/aws-sign2/README.md b/tunestats/app/api/node_modules/aws-sign2/README.md new file mode 100644 index 0000000..763564e --- /dev/null +++ b/tunestats/app/api/node_modules/aws-sign2/README.md @@ -0,0 +1,4 @@ +aws-sign +======== + +AWS signing. Originally pulled from LearnBoost/knox, maintained as vendor in request, now a standalone module. diff --git a/tunestats/app/api/node_modules/aws-sign2/index.js b/tunestats/app/api/node_modules/aws-sign2/index.js new file mode 100644 index 0000000..fb35f6d --- /dev/null +++ b/tunestats/app/api/node_modules/aws-sign2/index.js @@ -0,0 +1,212 @@ + +/*! + * Copyright 2010 LearnBoost + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +/** + * Module dependencies. + */ + +var crypto = require('crypto') + , parse = require('url').parse + ; + +/** + * Valid keys. + */ + +var keys = + [ 'acl' + , 'location' + , 'logging' + , 'notification' + , 'partNumber' + , 'policy' + , 'requestPayment' + , 'torrent' + , 'uploadId' + , 'uploads' + , 'versionId' + , 'versioning' + , 'versions' + , 'website' + ] + +/** + * Return an "Authorization" header value with the given `options` + * in the form of "AWS :" + * + * @param {Object} options + * @return {String} + * @api private + */ + +function authorization (options) { + return 'AWS ' + options.key + ':' + sign(options) +} + +module.exports = authorization +module.exports.authorization = authorization + +/** + * Simple HMAC-SHA1 Wrapper + * + * @param {Object} options + * @return {String} + * @api private + */ + +function hmacSha1 (options) { + return crypto.createHmac('sha1', options.secret).update(options.message).digest('base64') +} + +module.exports.hmacSha1 = hmacSha1 + +/** + * Create a base64 sha1 HMAC for `options`. + * + * @param {Object} options + * @return {String} + * @api private + */ + +function sign (options) { + options.message = stringToSign(options) + return hmacSha1(options) +} +module.exports.sign = sign + +/** + * Create a base64 sha1 HMAC for `options`. + * + * Specifically to be used with S3 presigned URLs + * + * @param {Object} options + * @return {String} + * @api private + */ + +function signQuery (options) { + options.message = queryStringToSign(options) + return hmacSha1(options) +} +module.exports.signQuery= signQuery + +/** + * Return a string for sign() with the given `options`. + * + * Spec: + * + * \n + * \n + * \n + * \n + * [headers\n] + * + * + * @param {Object} options + * @return {String} + * @api private + */ + +function stringToSign (options) { + var headers = options.amazonHeaders || '' + if (headers) headers += '\n' + var r = + [ options.verb + , options.md5 + , options.contentType + , options.date ? options.date.toUTCString() : '' + , headers + options.resource + ] + return r.join('\n') +} +module.exports.stringToSign = stringToSign + +/** + * Return a string for sign() with the given `options`, but is meant exclusively + * for S3 presigned URLs + * + * Spec: + * + * \n + * + * + * @param {Object} options + * @return {String} + * @api private + */ + +function queryStringToSign (options){ + return 'GET\n\n\n' + options.date + '\n' + options.resource +} +module.exports.queryStringToSign = queryStringToSign + +/** + * Perform the following: + * + * - ignore non-amazon headers + * - lowercase fields + * - sort lexicographically + * - trim whitespace between ":" + * - join with newline + * + * @param {Object} headers + * @return {String} + * @api private + */ + +function canonicalizeHeaders (headers) { + var buf = [] + , fields = Object.keys(headers) + ; + for (var i = 0, len = fields.length; i < len; ++i) { + var field = fields[i] + , val = headers[field] + , field = field.toLowerCase() + ; + if (0 !== field.indexOf('x-amz')) continue + buf.push(field + ':' + val) + } + return buf.sort().join('\n') +} +module.exports.canonicalizeHeaders = canonicalizeHeaders + +/** + * Perform the following: + * + * - ignore non sub-resources + * - sort lexicographically + * + * @param {String} resource + * @return {String} + * @api private + */ + +function canonicalizeResource (resource) { + var url = parse(resource, true) + , path = url.pathname + , buf = [] + ; + + Object.keys(url.query).forEach(function(key){ + if (!~keys.indexOf(key)) return + var val = '' == url.query[key] ? '' : '=' + encodeURIComponent(url.query[key]) + buf.push(key + val) + }) + + return path + (buf.length ? '?' + buf.sort().join('&') : '') +} +module.exports.canonicalizeResource = canonicalizeResource diff --git a/tunestats/app/api/node_modules/aws-sign2/package.json b/tunestats/app/api/node_modules/aws-sign2/package.json new file mode 100644 index 0000000..4c3d57e --- /dev/null +++ b/tunestats/app/api/node_modules/aws-sign2/package.json @@ -0,0 +1,17 @@ +{ + "author": "Mikeal Rogers (http://www.futurealoof.com)", + "name": "aws-sign2", + "description": "AWS signing. Originally pulled from LearnBoost/knox, maintained as vendor in request, now a standalone module.", + "version": "0.7.0", + "repository": { + "url": "https://github.com/mikeal/aws-sign" + }, + "license": "Apache-2.0", + "main": "index.js", + "dependencies": {}, + "devDependencies": {}, + "optionalDependencies": {}, + "engines": { + "node": "*" + } +} diff --git a/tunestats/app/api/node_modules/aws4/LICENSE b/tunestats/app/api/node_modules/aws4/LICENSE new file mode 100644 index 0000000..4f321e5 --- /dev/null +++ b/tunestats/app/api/node_modules/aws4/LICENSE @@ -0,0 +1,19 @@ +Copyright 2013 Michael Hart (michael.hart.au@gmail.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/tunestats/app/api/node_modules/aws4/README.md b/tunestats/app/api/node_modules/aws4/README.md new file mode 100644 index 0000000..4e9e66f --- /dev/null +++ b/tunestats/app/api/node_modules/aws4/README.md @@ -0,0 +1,213 @@ +aws4 +---- + +[![Build Status](https://api.travis-ci.org/mhart/aws4.png?branch=master)](https://travis-ci.org/github/mhart/aws4) + +A small utility to sign vanilla Node.js http(s) request options using Amazon's +[AWS Signature Version 4](https://docs.aws.amazon.com/general/latest/gr/signature-version-4.html). + +If you want to sign and send AWS requests in a browser, or an environment like [Cloudflare Workers](https://developers.cloudflare.com/workers/), then check out [aws4fetch](https://github.com/mhart/aws4fetch) – otherwise you can also bundle this library for use [in older browsers](./browser). + +The only AWS service that *doesn't* support v4 as of 2020-05-22 is +[SimpleDB](https://docs.aws.amazon.com/AmazonSimpleDB/latest/DeveloperGuide/SDB_API.html) +(it only supports [AWS Signature Version 2](https://github.com/mhart/aws2)). + +It also provides defaults for a number of core AWS headers and +request parameters, making it very easy to query AWS services, or +build out a fully-featured AWS library. + +Example +------- + +```javascript +var https = require('https') +var aws4 = require('aws4') + +// to illustrate usage, we'll create a utility function to request and pipe to stdout +function request(opts) { https.request(opts, function(res) { res.pipe(process.stdout) }).end(opts.body || '') } + +// aws4 will sign an options object as you'd pass to http.request, with an AWS service and region +var opts = { host: 'my-bucket.s3.us-west-1.amazonaws.com', path: '/my-object', service: 's3', region: 'us-west-1' } + +// aws4.sign() will sign and modify these options, ready to pass to http.request +aws4.sign(opts, { accessKeyId: '', secretAccessKey: '' }) + +// or it can get credentials from process.env.AWS_ACCESS_KEY_ID, etc +aws4.sign(opts) + +// for most AWS services, aws4 can figure out the service and region if you pass a host +opts = { host: 'my-bucket.s3.us-west-1.amazonaws.com', path: '/my-object' } + +// usually it will add/modify request headers, but you can also sign the query: +opts = { host: 'my-bucket.s3.amazonaws.com', path: '/?X-Amz-Expires=12345', signQuery: true } + +// and for services with simple hosts, aws4 can infer the host from service and region: +opts = { service: 'sqs', region: 'us-east-1', path: '/?Action=ListQueues' } + +// and if you're using us-east-1, it's the default: +opts = { service: 'sqs', path: '/?Action=ListQueues' } + +aws4.sign(opts) +console.log(opts) +/* +{ + host: 'sqs.us-east-1.amazonaws.com', + path: '/?Action=ListQueues', + headers: { + Host: 'sqs.us-east-1.amazonaws.com', + 'X-Amz-Date': '20121226T061030Z', + Authorization: 'AWS4-HMAC-SHA256 Credential=ABCDEF/20121226/us-east-1/sqs/aws4_request, ...' + } +} +*/ + +// we can now use this to query AWS +request(opts) +/* + + +... +*/ + +// aws4 can infer the HTTP method if a body is passed in +// method will be POST and Content-Type: 'application/x-www-form-urlencoded; charset=utf-8' +request(aws4.sign({ service: 'iam', body: 'Action=ListGroups&Version=2010-05-08' })) +/* + +... +*/ + +// you can specify any custom option or header as per usual +request(aws4.sign({ + service: 'dynamodb', + region: 'ap-southeast-2', + method: 'POST', + path: '/', + headers: { + 'Content-Type': 'application/x-amz-json-1.0', + 'X-Amz-Target': 'DynamoDB_20120810.ListTables' + }, + body: '{}' +})) +/* +{"TableNames":[]} +... +*/ + +// you can also specify extra headers to ignore during signing +request(aws4.sign({ + host: '07tjusf2h91cunochc.us-east-1.aoss.amazonaws.com', + method: 'PUT', + path: '/my-index', + body: '{"mappings":{}}', + headers: { + 'Content-Type': 'application/json', + 'X-Amz-Content-Sha256': 'UNSIGNED-PAYLOAD' + }, + extraHeadersToIgnore: { + 'content-length': true + } +})) + +// and headers to include that would normally be ignored +request(aws4.sign({ + service: 'mycustomservice', + path: '/whatever', + headers: { + 'Range': 'bytes=200-1000, 2000-6576, 19000-' + }, + extraHeadersToInclude: { + 'range': true + } +})) + + +// The raw RequestSigner can be used to generate CodeCommit Git passwords +var signer = new aws4.RequestSigner({ + service: 'codecommit', + host: 'git-codecommit.us-east-1.amazonaws.com', + method: 'GIT', + path: '/v1/repos/MyAwesomeRepo', +}) +var password = signer.getDateTime() + 'Z' + signer.signature() + +// see example.js for examples with other services +``` + +API +--- + +### aws4.sign(requestOptions, [credentials]) + +Calculates and populates any necessary AWS headers and/or request +options on `requestOptions`. Returns `requestOptions` as a convenience for chaining. + +`requestOptions` is an object holding the same options that the Node.js +[http.request](https://nodejs.org/docs/latest/api/http.html#http_http_request_options_callback) +function takes. + +The following properties of `requestOptions` are used in the signing or +populated if they don't already exist: + +- `hostname` or `host` (will try to be determined from `service` and `region` if not given) +- `method` (will use `'GET'` if not given or `'POST'` if there is a `body`) +- `path` (will use `'/'` if not given) +- `body` (will use `''` if not given) +- `service` (will try to be calculated from `hostname` or `host` if not given) +- `region` (will try to be calculated from `hostname` or `host` or use `'us-east-1'` if not given) +- `signQuery` (to sign the query instead of adding an `Authorization` header, defaults to false) +- `extraHeadersToIgnore` (an object with lowercase header keys to ignore when signing, eg `{ 'content-length': true }`) +- `extraHeadersToInclude` (an object with lowercase header keys to include when signing, overriding any ignores) +- `headers['Host']` (will use `hostname` or `host` or be calculated if not given) +- `headers['Content-Type']` (will use `'application/x-www-form-urlencoded; charset=utf-8'` + if not given and there is a `body`) +- `headers['Date']` (used to calculate the signature date if given, otherwise `new Date` is used) + +Your AWS credentials (which can be found in your +[AWS console](https://portal.aws.amazon.com/gp/aws/securityCredentials)) +can be specified in one of two ways: + +- As the second argument, like this: + +```javascript +aws4.sign(requestOptions, { + secretAccessKey: "", + accessKeyId: "", + sessionToken: "" +}) +``` + +- From `process.env`, such as this: + +``` +export AWS_ACCESS_KEY_ID="" +export AWS_SECRET_ACCESS_KEY="" +export AWS_SESSION_TOKEN="" +``` + +(will also use `AWS_ACCESS_KEY` and `AWS_SECRET_KEY` if available) + +The `sessionToken` property and `AWS_SESSION_TOKEN` environment variable are optional for signing +with [IAM STS temporary credentials](https://docs.aws.amazon.com/IAM/latest/UserGuide/id_credentials_temp_use-resources.html). + +Installation +------------ + +With [npm](https://www.npmjs.com/) do: + +``` +npm install aws4 +``` + +Can also be used [in the browser](./browser). + +Thanks +------ + +Thanks to [@jed](https://github.com/jed) for his +[dynamo-client](https://github.com/jed/dynamo-client) lib where I first +committed and subsequently extracted this code. + +Also thanks to the +[official Node.js AWS SDK](https://github.com/aws/aws-sdk-js) for giving +me a start on implementing the v4 signature. diff --git a/tunestats/app/api/node_modules/aws4/aws4.js b/tunestats/app/api/node_modules/aws4/aws4.js new file mode 100644 index 0000000..6737574 --- /dev/null +++ b/tunestats/app/api/node_modules/aws4/aws4.js @@ -0,0 +1,381 @@ +var aws4 = exports, + url = require('url'), + querystring = require('querystring'), + crypto = require('crypto'), + lru = require('./lru'), + credentialsCache = lru(1000) + +// http://docs.amazonwebservices.com/general/latest/gr/signature-version-4.html + +function hmac(key, string, encoding) { + return crypto.createHmac('sha256', key).update(string, 'utf8').digest(encoding) +} + +function hash(string, encoding) { + return crypto.createHash('sha256').update(string, 'utf8').digest(encoding) +} + +// This function assumes the string has already been percent encoded +function encodeRfc3986(urlEncodedString) { + return urlEncodedString.replace(/[!'()*]/g, function(c) { + return '%' + c.charCodeAt(0).toString(16).toUpperCase() + }) +} + +function encodeRfc3986Full(str) { + return encodeRfc3986(encodeURIComponent(str)) +} + +// A bit of a combination of: +// https://github.com/aws/aws-sdk-java-v2/blob/dc695de6ab49ad03934e1b02e7263abbd2354be0/core/auth/src/main/java/software/amazon/awssdk/auth/signer/internal/AbstractAws4Signer.java#L59 +// https://github.com/aws/aws-sdk-js/blob/18cb7e5b463b46239f9fdd4a65e2ff8c81831e8f/lib/signers/v4.js#L191-L199 +// https://github.com/mhart/aws4fetch/blob/b3aed16b6f17384cf36ea33bcba3c1e9f3bdfefd/src/main.js#L25-L34 +var HEADERS_TO_IGNORE = { + 'authorization': true, + 'connection': true, + 'x-amzn-trace-id': true, + 'user-agent': true, + 'expect': true, + 'presigned-expires': true, + 'range': true, +} + +// request: { path | body, [host], [method], [headers], [service], [region] } +// credentials: { accessKeyId, secretAccessKey, [sessionToken] } +function RequestSigner(request, credentials) { + + if (typeof request === 'string') request = url.parse(request) + + var headers = request.headers = Object.assign({}, (request.headers || {})), + hostParts = (!this.service || !this.region) && this.matchHost(request.hostname || request.host || headers.Host || headers.host) + + this.request = request + this.credentials = credentials || this.defaultCredentials() + + this.service = request.service || hostParts[0] || '' + this.region = request.region || hostParts[1] || 'us-east-1' + + // SES uses a different domain from the service name + if (this.service === 'email') this.service = 'ses' + + if (!request.method && request.body) + request.method = 'POST' + + if (!headers.Host && !headers.host) { + headers.Host = request.hostname || request.host || this.createHost() + + // If a port is specified explicitly, use it as is + if (request.port) + headers.Host += ':' + request.port + } + if (!request.hostname && !request.host) + request.hostname = headers.Host || headers.host + + this.isCodeCommitGit = this.service === 'codecommit' && request.method === 'GIT' + + this.extraHeadersToIgnore = request.extraHeadersToIgnore || Object.create(null) + this.extraHeadersToInclude = request.extraHeadersToInclude || Object.create(null) +} + +RequestSigner.prototype.matchHost = function(host) { + var match = (host || '').match(/([^\.]+)\.(?:([^\.]*)\.)?amazonaws\.com(\.cn)?$/) + var hostParts = (match || []).slice(1, 3) + + // ES's hostParts are sometimes the other way round, if the value that is expected + // to be region equals ‘es’ switch them back + // e.g. search-cluster-name-aaaa00aaaa0aaa0aaaaaaa0aaa.us-east-1.es.amazonaws.com + if (hostParts[1] === 'es' || hostParts[1] === 'aoss') + hostParts = hostParts.reverse() + + if (hostParts[1] == 's3') { + hostParts[0] = 's3' + hostParts[1] = 'us-east-1' + } else { + for (var i = 0; i < 2; i++) { + if (/^s3-/.test(hostParts[i])) { + hostParts[1] = hostParts[i].slice(3) + hostParts[0] = 's3' + break + } + } + } + + return hostParts +} + +// http://docs.aws.amazon.com/general/latest/gr/rande.html +RequestSigner.prototype.isSingleRegion = function() { + // Special case for S3 and SimpleDB in us-east-1 + if (['s3', 'sdb'].indexOf(this.service) >= 0 && this.region === 'us-east-1') return true + + return ['cloudfront', 'ls', 'route53', 'iam', 'importexport', 'sts'] + .indexOf(this.service) >= 0 +} + +RequestSigner.prototype.createHost = function() { + var region = this.isSingleRegion() ? '' : '.' + this.region, + subdomain = this.service === 'ses' ? 'email' : this.service + return subdomain + region + '.amazonaws.com' +} + +RequestSigner.prototype.prepareRequest = function() { + this.parsePath() + + var request = this.request, headers = request.headers, query + + if (request.signQuery) { + + this.parsedPath.query = query = this.parsedPath.query || {} + + if (this.credentials.sessionToken) + query['X-Amz-Security-Token'] = this.credentials.sessionToken + + if (this.service === 's3' && !query['X-Amz-Expires']) + query['X-Amz-Expires'] = 86400 + + if (query['X-Amz-Date']) + this.datetime = query['X-Amz-Date'] + else + query['X-Amz-Date'] = this.getDateTime() + + query['X-Amz-Algorithm'] = 'AWS4-HMAC-SHA256' + query['X-Amz-Credential'] = this.credentials.accessKeyId + '/' + this.credentialString() + query['X-Amz-SignedHeaders'] = this.signedHeaders() + + } else { + + if (!request.doNotModifyHeaders && !this.isCodeCommitGit) { + if (request.body && !headers['Content-Type'] && !headers['content-type']) + headers['Content-Type'] = 'application/x-www-form-urlencoded; charset=utf-8' + + if (request.body && !headers['Content-Length'] && !headers['content-length']) + headers['Content-Length'] = Buffer.byteLength(request.body) + + if (this.credentials.sessionToken && !headers['X-Amz-Security-Token'] && !headers['x-amz-security-token']) + headers['X-Amz-Security-Token'] = this.credentials.sessionToken + + if (this.service === 's3' && !headers['X-Amz-Content-Sha256'] && !headers['x-amz-content-sha256']) + headers['X-Amz-Content-Sha256'] = hash(this.request.body || '', 'hex') + + if (headers['X-Amz-Date'] || headers['x-amz-date']) + this.datetime = headers['X-Amz-Date'] || headers['x-amz-date'] + else + headers['X-Amz-Date'] = this.getDateTime() + } + + delete headers.Authorization + delete headers.authorization + } +} + +RequestSigner.prototype.sign = function() { + if (!this.parsedPath) this.prepareRequest() + + if (this.request.signQuery) { + this.parsedPath.query['X-Amz-Signature'] = this.signature() + } else { + this.request.headers.Authorization = this.authHeader() + } + + this.request.path = this.formatPath() + + return this.request +} + +RequestSigner.prototype.getDateTime = function() { + if (!this.datetime) { + var headers = this.request.headers, + date = new Date(headers.Date || headers.date || new Date) + + this.datetime = date.toISOString().replace(/[:\-]|\.\d{3}/g, '') + + // Remove the trailing 'Z' on the timestamp string for CodeCommit git access + if (this.isCodeCommitGit) this.datetime = this.datetime.slice(0, -1) + } + return this.datetime +} + +RequestSigner.prototype.getDate = function() { + return this.getDateTime().substr(0, 8) +} + +RequestSigner.prototype.authHeader = function() { + return [ + 'AWS4-HMAC-SHA256 Credential=' + this.credentials.accessKeyId + '/' + this.credentialString(), + 'SignedHeaders=' + this.signedHeaders(), + 'Signature=' + this.signature(), + ].join(', ') +} + +RequestSigner.prototype.signature = function() { + var date = this.getDate(), + cacheKey = [this.credentials.secretAccessKey, date, this.region, this.service].join(), + kDate, kRegion, kService, kCredentials = credentialsCache.get(cacheKey) + if (!kCredentials) { + kDate = hmac('AWS4' + this.credentials.secretAccessKey, date) + kRegion = hmac(kDate, this.region) + kService = hmac(kRegion, this.service) + kCredentials = hmac(kService, 'aws4_request') + credentialsCache.set(cacheKey, kCredentials) + } + return hmac(kCredentials, this.stringToSign(), 'hex') +} + +RequestSigner.prototype.stringToSign = function() { + return [ + 'AWS4-HMAC-SHA256', + this.getDateTime(), + this.credentialString(), + hash(this.canonicalString(), 'hex'), + ].join('\n') +} + +RequestSigner.prototype.canonicalString = function() { + if (!this.parsedPath) this.prepareRequest() + + var pathStr = this.parsedPath.path, + query = this.parsedPath.query, + headers = this.request.headers, + queryStr = '', + normalizePath = this.service !== 's3', + decodePath = this.service === 's3' || this.request.doNotEncodePath, + decodeSlashesInPath = this.service === 's3', + firstValOnly = this.service === 's3', + bodyHash + + if (this.service === 's3' && this.request.signQuery) { + bodyHash = 'UNSIGNED-PAYLOAD' + } else if (this.isCodeCommitGit) { + bodyHash = '' + } else { + bodyHash = headers['X-Amz-Content-Sha256'] || headers['x-amz-content-sha256'] || + hash(this.request.body || '', 'hex') + } + + if (query) { + var reducedQuery = Object.keys(query).reduce(function(obj, key) { + if (!key) return obj + obj[encodeRfc3986Full(key)] = !Array.isArray(query[key]) ? query[key] : + (firstValOnly ? query[key][0] : query[key]) + return obj + }, {}) + var encodedQueryPieces = [] + Object.keys(reducedQuery).sort().forEach(function(key) { + if (!Array.isArray(reducedQuery[key])) { + encodedQueryPieces.push(key + '=' + encodeRfc3986Full(reducedQuery[key])) + } else { + reducedQuery[key].map(encodeRfc3986Full).sort() + .forEach(function(val) { encodedQueryPieces.push(key + '=' + val) }) + } + }) + queryStr = encodedQueryPieces.join('&') + } + if (pathStr !== '/') { + if (normalizePath) pathStr = pathStr.replace(/\/{2,}/g, '/') + pathStr = pathStr.split('/').reduce(function(path, piece) { + if (normalizePath && piece === '..') { + path.pop() + } else if (!normalizePath || piece !== '.') { + if (decodePath) piece = decodeURIComponent(piece.replace(/\+/g, ' ')) + path.push(encodeRfc3986Full(piece)) + } + return path + }, []).join('/') + if (pathStr[0] !== '/') pathStr = '/' + pathStr + if (decodeSlashesInPath) pathStr = pathStr.replace(/%2F/g, '/') + } + + return [ + this.request.method || 'GET', + pathStr, + queryStr, + this.canonicalHeaders() + '\n', + this.signedHeaders(), + bodyHash, + ].join('\n') +} + +RequestSigner.prototype.canonicalHeaders = function() { + var headers = this.request.headers + function trimAll(header) { + return header.toString().trim().replace(/\s+/g, ' ') + } + return Object.keys(headers) + .filter(function(key) { return HEADERS_TO_IGNORE[key.toLowerCase()] == null }) + .sort(function(a, b) { return a.toLowerCase() < b.toLowerCase() ? -1 : 1 }) + .map(function(key) { return key.toLowerCase() + ':' + trimAll(headers[key]) }) + .join('\n') +} + +RequestSigner.prototype.signedHeaders = function() { + var extraHeadersToInclude = this.extraHeadersToInclude, + extraHeadersToIgnore = this.extraHeadersToIgnore + return Object.keys(this.request.headers) + .map(function(key) { return key.toLowerCase() }) + .filter(function(key) { + return extraHeadersToInclude[key] || + (HEADERS_TO_IGNORE[key] == null && !extraHeadersToIgnore[key]) + }) + .sort() + .join(';') +} + +RequestSigner.prototype.credentialString = function() { + return [ + this.getDate(), + this.region, + this.service, + 'aws4_request', + ].join('/') +} + +RequestSigner.prototype.defaultCredentials = function() { + var env = process.env + return { + accessKeyId: env.AWS_ACCESS_KEY_ID || env.AWS_ACCESS_KEY, + secretAccessKey: env.AWS_SECRET_ACCESS_KEY || env.AWS_SECRET_KEY, + sessionToken: env.AWS_SESSION_TOKEN, + } +} + +RequestSigner.prototype.parsePath = function() { + var path = this.request.path || '/' + + // S3 doesn't always encode characters > 127 correctly and + // all services don't encode characters > 255 correctly + // So if there are non-reserved chars (and it's not already all % encoded), just encode them all + if (/[^0-9A-Za-z;,/?:@&=+$\-_.!~*'()#%]/.test(path)) { + path = encodeURI(decodeURI(path)) + } + + var queryIx = path.indexOf('?'), + query = null + + if (queryIx >= 0) { + query = querystring.parse(path.slice(queryIx + 1)) + path = path.slice(0, queryIx) + } + + this.parsedPath = { + path: path, + query: query, + } +} + +RequestSigner.prototype.formatPath = function() { + var path = this.parsedPath.path, + query = this.parsedPath.query + + if (!query) return path + + // Services don't support empty query string keys + if (query[''] != null) delete query[''] + + return path + '?' + encodeRfc3986(querystring.stringify(query)) +} + +aws4.RequestSigner = RequestSigner + +aws4.sign = function(request, credentials) { + return new RequestSigner(request, credentials).sign() +} diff --git a/tunestats/app/api/node_modules/aws4/lru.js b/tunestats/app/api/node_modules/aws4/lru.js new file mode 100644 index 0000000..333f66a --- /dev/null +++ b/tunestats/app/api/node_modules/aws4/lru.js @@ -0,0 +1,96 @@ +module.exports = function(size) { + return new LruCache(size) +} + +function LruCache(size) { + this.capacity = size | 0 + this.map = Object.create(null) + this.list = new DoublyLinkedList() +} + +LruCache.prototype.get = function(key) { + var node = this.map[key] + if (node == null) return undefined + this.used(node) + return node.val +} + +LruCache.prototype.set = function(key, val) { + var node = this.map[key] + if (node != null) { + node.val = val + } else { + if (!this.capacity) this.prune() + if (!this.capacity) return false + node = new DoublyLinkedNode(key, val) + this.map[key] = node + this.capacity-- + } + this.used(node) + return true +} + +LruCache.prototype.used = function(node) { + this.list.moveToFront(node) +} + +LruCache.prototype.prune = function() { + var node = this.list.pop() + if (node != null) { + delete this.map[node.key] + this.capacity++ + } +} + + +function DoublyLinkedList() { + this.firstNode = null + this.lastNode = null +} + +DoublyLinkedList.prototype.moveToFront = function(node) { + if (this.firstNode == node) return + + this.remove(node) + + if (this.firstNode == null) { + this.firstNode = node + this.lastNode = node + node.prev = null + node.next = null + } else { + node.prev = null + node.next = this.firstNode + node.next.prev = node + this.firstNode = node + } +} + +DoublyLinkedList.prototype.pop = function() { + var lastNode = this.lastNode + if (lastNode != null) { + this.remove(lastNode) + } + return lastNode +} + +DoublyLinkedList.prototype.remove = function(node) { + if (this.firstNode == node) { + this.firstNode = node.next + } else if (node.prev != null) { + node.prev.next = node.next + } + if (this.lastNode == node) { + this.lastNode = node.prev + } else if (node.next != null) { + node.next.prev = node.prev + } +} + + +function DoublyLinkedNode(key, val) { + this.key = key + this.val = val + this.prev = null + this.next = null +} diff --git a/tunestats/app/api/node_modules/aws4/package.json b/tunestats/app/api/node_modules/aws4/package.json new file mode 100644 index 0000000..ab47b8c --- /dev/null +++ b/tunestats/app/api/node_modules/aws4/package.json @@ -0,0 +1,21 @@ +{ + "name": "aws4", + "version": "1.13.0", + "description": "Signs and prepares requests using AWS Signature Version 4", + "author": "Michael Hart (https://github.com/mhart)", + "license": "MIT", + "repository": "github:mhart/aws4", + "main": "aws4.js", + "files": [ + "aws4.js", + "lru.js" + ], + "scripts": { + "test": "mocha ./test/fast.js -R list", + "integration": "node ./test/slow.js" + }, + "devDependencies": { + "mocha": "^10.4.0", + "should": "^13.2.3" + } +} diff --git a/tunestats/app/api/node_modules/balanced-match/.github/FUNDING.yml b/tunestats/app/api/node_modules/balanced-match/.github/FUNDING.yml new file mode 100644 index 0000000..cea8b16 --- /dev/null +++ b/tunestats/app/api/node_modules/balanced-match/.github/FUNDING.yml @@ -0,0 +1,2 @@ +tidelift: "npm/balanced-match" +patreon: juliangruber diff --git a/tunestats/app/api/node_modules/balanced-match/LICENSE.md b/tunestats/app/api/node_modules/balanced-match/LICENSE.md new file mode 100644 index 0000000..2cdc8e4 --- /dev/null +++ b/tunestats/app/api/node_modules/balanced-match/LICENSE.md @@ -0,0 +1,21 @@ +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/tunestats/app/api/node_modules/balanced-match/README.md b/tunestats/app/api/node_modules/balanced-match/README.md new file mode 100644 index 0000000..d2a48b6 --- /dev/null +++ b/tunestats/app/api/node_modules/balanced-match/README.md @@ -0,0 +1,97 @@ +# balanced-match + +Match balanced string pairs, like `{` and `}` or `` and ``. Supports regular expressions as well! + +[![build status](https://secure.travis-ci.org/juliangruber/balanced-match.svg)](http://travis-ci.org/juliangruber/balanced-match) +[![downloads](https://img.shields.io/npm/dm/balanced-match.svg)](https://www.npmjs.org/package/balanced-match) + +[![testling badge](https://ci.testling.com/juliangruber/balanced-match.png)](https://ci.testling.com/juliangruber/balanced-match) + +## Example + +Get the first matching pair of braces: + +```js +var balanced = require('balanced-match'); + +console.log(balanced('{', '}', 'pre{in{nested}}post')); +console.log(balanced('{', '}', 'pre{first}between{second}post')); +console.log(balanced(/\s+\{\s+/, /\s+\}\s+/, 'pre { in{nest} } post')); +``` + +The matches are: + +```bash +$ node example.js +{ start: 3, end: 14, pre: 'pre', body: 'in{nested}', post: 'post' } +{ start: 3, + end: 9, + pre: 'pre', + body: 'first', + post: 'between{second}post' } +{ start: 3, end: 17, pre: 'pre', body: 'in{nest}', post: 'post' } +``` + +## API + +### var m = balanced(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +object with those keys: + +* **start** the index of the first match of `a` +* **end** the index of the matching `b` +* **pre** the preamble, `a` and `b` not included +* **body** the match, `a` and `b` not included +* **post** the postscript, `a` and `b` not included + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']` and `{a}}` will match `['', 'a', '}']`. + +### var r = balanced.range(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +array with indexes: `[ , ]`. + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `[ 1, 3 ]` and `{a}}` will match `[0, 2]`. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install balanced-match +``` + +## Security contact information + +To report a security vulnerability, please use the +[Tidelift security contact](https://tidelift.com/security). +Tidelift will coordinate the fix and disclosure. + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/tunestats/app/api/node_modules/balanced-match/index.js b/tunestats/app/api/node_modules/balanced-match/index.js new file mode 100644 index 0000000..c67a646 --- /dev/null +++ b/tunestats/app/api/node_modules/balanced-match/index.js @@ -0,0 +1,62 @@ +'use strict'; +module.exports = balanced; +function balanced(a, b, str) { + if (a instanceof RegExp) a = maybeMatch(a, str); + if (b instanceof RegExp) b = maybeMatch(b, str); + + var r = range(a, b, str); + + return r && { + start: r[0], + end: r[1], + pre: str.slice(0, r[0]), + body: str.slice(r[0] + a.length, r[1]), + post: str.slice(r[1] + b.length) + }; +} + +function maybeMatch(reg, str) { + var m = str.match(reg); + return m ? m[0] : null; +} + +balanced.range = range; +function range(a, b, str) { + var begs, beg, left, right, result; + var ai = str.indexOf(a); + var bi = str.indexOf(b, ai + 1); + var i = ai; + + if (ai >= 0 && bi > 0) { + if(a===b) { + return [ai, bi]; + } + begs = []; + left = str.length; + + while (i >= 0 && !result) { + if (i == ai) { + begs.push(i); + ai = str.indexOf(a, i + 1); + } else if (begs.length == 1) { + result = [ begs.pop(), bi ]; + } else { + beg = begs.pop(); + if (beg < left) { + left = beg; + right = bi; + } + + bi = str.indexOf(b, i + 1); + } + + i = ai < bi && ai >= 0 ? ai : bi; + } + + if (begs.length) { + result = [ left, right ]; + } + } + + return result; +} diff --git a/tunestats/app/api/node_modules/balanced-match/package.json b/tunestats/app/api/node_modules/balanced-match/package.json new file mode 100644 index 0000000..ce6073e --- /dev/null +++ b/tunestats/app/api/node_modules/balanced-match/package.json @@ -0,0 +1,48 @@ +{ + "name": "balanced-match", + "description": "Match balanced character pairs, like \"{\" and \"}\"", + "version": "1.0.2", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/balanced-match.git" + }, + "homepage": "https://github.com/juliangruber/balanced-match", + "main": "index.js", + "scripts": { + "test": "tape test/test.js", + "bench": "matcha test/bench.js" + }, + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "keywords": [ + "match", + "regexp", + "test", + "balanced", + "parse" + ], + "author": { + "name": "Julian Gruber", + "email": "mail@juliangruber.com", + "url": "http://juliangruber.com" + }, + "license": "MIT", + "testling": { + "files": "test/*.js", + "browsers": [ + "ie/8..latest", + "firefox/20..latest", + "firefox/nightly", + "chrome/25..latest", + "chrome/canary", + "opera/12..latest", + "opera/next", + "safari/5.1..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "android-browser/4.2..latest" + ] + } +} diff --git a/tunestats/app/api/node_modules/bcrypt-pbkdf/CONTRIBUTING.md b/tunestats/app/api/node_modules/bcrypt-pbkdf/CONTRIBUTING.md new file mode 100644 index 0000000..401d34e --- /dev/null +++ b/tunestats/app/api/node_modules/bcrypt-pbkdf/CONTRIBUTING.md @@ -0,0 +1,13 @@ +# Contributing + +This repository uses [cr.joyent.us](https://cr.joyent.us) (Gerrit) for new +changes. Anyone can submit changes. To get started, see the [cr.joyent.us user +guide](https://github.com/joyent/joyent-gerrit/blob/master/docs/user/README.md). +This repo does not use GitHub pull requests. + +See the [Joyent Engineering +Guidelines](https://github.com/joyent/eng/blob/master/docs/index.md) for general +best practices expected in this repository. + +If you're changing something non-trivial or user-facing, you may want to submit +an issue first. diff --git a/tunestats/app/api/node_modules/bcrypt-pbkdf/LICENSE b/tunestats/app/api/node_modules/bcrypt-pbkdf/LICENSE new file mode 100644 index 0000000..fc58d2a --- /dev/null +++ b/tunestats/app/api/node_modules/bcrypt-pbkdf/LICENSE @@ -0,0 +1,66 @@ +The Blowfish portions are under the following license: + +Blowfish block cipher for OpenBSD +Copyright 1997 Niels Provos +All rights reserved. + +Implementation advice by David Mazieres . + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: +1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. +2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. +3. The name of the author may not be used to endorse or promote products + derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR +IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. +IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, +INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + + +The bcrypt_pbkdf portions are under the following license: + +Copyright (c) 2013 Ted Unangst + +Permission to use, copy, modify, and distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + + + +Performance improvements (Javascript-specific): + +Copyright 2016, Joyent Inc +Author: Alex Wilson + +Permission to use, copy, modify, and distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/tunestats/app/api/node_modules/bcrypt-pbkdf/README.md b/tunestats/app/api/node_modules/bcrypt-pbkdf/README.md new file mode 100644 index 0000000..7551f33 --- /dev/null +++ b/tunestats/app/api/node_modules/bcrypt-pbkdf/README.md @@ -0,0 +1,45 @@ +Port of the OpenBSD `bcrypt_pbkdf` function to pure Javascript. `npm`-ified +version of [Devi Mandiri's port](https://github.com/devi/tmp/blob/master/js/bcrypt_pbkdf.js), +with some minor performance improvements. The code is copied verbatim (and +un-styled) from Devi's work. + +This product includes software developed by Niels Provos. + +## API + +### `bcrypt_pbkdf.pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds)` + +Derive a cryptographic key of arbitrary length from a given password and salt, +using the OpenBSD `bcrypt_pbkdf` function. This is a combination of Blowfish and +SHA-512. + +See [this article](http://www.tedunangst.com/flak/post/bcrypt-pbkdf) for +further information. + +Parameters: + + * `pass`, a Uint8Array of length `passlen` + * `passlen`, an integer Number + * `salt`, a Uint8Array of length `saltlen` + * `saltlen`, an integer Number + * `key`, a Uint8Array of length `keylen`, will be filled with output + * `keylen`, an integer Number + * `rounds`, an integer Number, number of rounds of the PBKDF to run + +### `bcrypt_pbkdf.hash(sha2pass, sha2salt, out)` + +Calculate a Blowfish hash, given SHA2-512 output of a password and salt. Used as +part of the inner round function in the PBKDF. + +Parameters: + + * `sha2pass`, a Uint8Array of length 64 + * `sha2salt`, a Uint8Array of length 64 + * `out`, a Uint8Array of length 32, will be filled with output + +## License + +This source form is a 1:1 port from the OpenBSD `blowfish.c` and `bcrypt_pbkdf.c`. +As a result, it retains the original copyright and license. The two files are +under slightly different (but compatible) licenses, and are here combined in +one file. For each of the full license texts see `LICENSE`. diff --git a/tunestats/app/api/node_modules/bcrypt-pbkdf/index.js b/tunestats/app/api/node_modules/bcrypt-pbkdf/index.js new file mode 100644 index 0000000..b1b5ad4 --- /dev/null +++ b/tunestats/app/api/node_modules/bcrypt-pbkdf/index.js @@ -0,0 +1,556 @@ +'use strict'; + +var crypto_hash_sha512 = require('tweetnacl').lowlevel.crypto_hash; + +/* + * This file is a 1:1 port from the OpenBSD blowfish.c and bcrypt_pbkdf.c. As a + * result, it retains the original copyright and license. The two files are + * under slightly different (but compatible) licenses, and are here combined in + * one file. + * + * Credit for the actual porting work goes to: + * Devi Mandiri + */ + +/* + * The Blowfish portions are under the following license: + * + * Blowfish block cipher for OpenBSD + * Copyright 1997 Niels Provos + * All rights reserved. + * + * Implementation advice by David Mazieres . + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * The bcrypt_pbkdf portions are under the following license: + * + * Copyright (c) 2013 Ted Unangst + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +/* + * Performance improvements (Javascript-specific): + * + * Copyright 2016, Joyent Inc + * Author: Alex Wilson + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +// Ported from OpenBSD bcrypt_pbkdf.c v1.9 + +var BLF_J = 0; + +var Blowfish = function() { + this.S = [ + new Uint32Array([ + 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, + 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99, + 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, + 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, + 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee, + 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, + 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, + 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e, + 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, + 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, + 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, + 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, + 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, + 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677, + 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, + 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, + 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88, + 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, + 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, + 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0, + 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, + 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, + 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88, + 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, + 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, + 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, + 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, + 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, + 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba, + 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, + 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, + 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09, + 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, + 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, + 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279, + 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, + 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, + 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82, + 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, + 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, + 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, + 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, + 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, + 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8, + 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, + 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, + 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, + 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, + 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, + 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1, + 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, + 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, + 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477, + 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, + 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, + 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, + 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, + 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, + 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41, + 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, + 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, + 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915, + 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, + 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a]), + new Uint32Array([ + 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623, + 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, + 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, + 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e, + 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, + 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, + 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, + 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, + 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, + 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8, + 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, + 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, + 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701, + 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, + 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, + 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331, + 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, + 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, + 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e, + 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, + 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, + 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, + 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, + 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, + 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b, + 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, + 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, + 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, + 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, + 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, + 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4, + 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, + 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, + 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28, + 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, + 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, + 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, + 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, + 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, + 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e, + 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, + 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, + 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8, + 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, + 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, + 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696, + 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, + 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, + 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0, + 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, + 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, + 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, + 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, + 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, + 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00, + 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, + 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, + 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e, + 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, + 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, + 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9, + 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, + 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, + 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7]), + new Uint32Array([ + 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, + 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, + 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, + 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, + 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, + 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504, + 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, + 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, + 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee, + 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, + 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, + 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b, + 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, + 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, + 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527, + 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, + 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, + 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, + 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, + 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, + 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17, + 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, + 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, + 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115, + 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, + 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, + 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0, + 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, + 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, + 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d, + 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, + 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, + 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, + 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, + 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, + 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c, + 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, + 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, + 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a, + 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, + 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, + 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc, + 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, + 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, + 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2, + 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, + 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, + 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, + 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, + 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, + 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10, + 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, + 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, + 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027, + 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, + 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, + 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634, + 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, + 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, + 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc, + 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, + 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, + 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, + 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0]), + new Uint32Array([ + 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, + 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe, + 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, + 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, + 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8, + 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, + 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, + 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22, + 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, + 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, + 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9, + 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, + 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, + 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, + 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, + 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, + 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b, + 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, + 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, + 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd, + 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, + 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, + 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb, + 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, + 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, + 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32, + 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, + 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, + 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, + 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, + 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, + 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47, + 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, + 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, + 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84, + 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, + 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, + 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd, + 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, + 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, + 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38, + 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, + 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, + 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, + 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, + 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, + 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964, + 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, + 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, + 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, + 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, + 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, + 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02, + 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, + 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, + 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a, + 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, + 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, + 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, + 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, + 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, + 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9, + 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, + 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6]) + ]; + this.P = new Uint32Array([ + 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, + 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89, + 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, + 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, + 0x9216d5d9, 0x8979fb1b]); +}; + +function F(S, x8, i) { + return (((S[0][x8[i+3]] + + S[1][x8[i+2]]) ^ + S[2][x8[i+1]]) + + S[3][x8[i]]); +}; + +Blowfish.prototype.encipher = function(x, x8) { + if (x8 === undefined) { + x8 = new Uint8Array(x.buffer); + if (x.byteOffset !== 0) + x8 = x8.subarray(x.byteOffset); + } + x[0] ^= this.P[0]; + for (var i = 1; i < 16; i += 2) { + x[1] ^= F(this.S, x8, 0) ^ this.P[i]; + x[0] ^= F(this.S, x8, 4) ^ this.P[i+1]; + } + var t = x[0]; + x[0] = x[1] ^ this.P[17]; + x[1] = t; +}; + +Blowfish.prototype.decipher = function(x) { + var x8 = new Uint8Array(x.buffer); + if (x.byteOffset !== 0) + x8 = x8.subarray(x.byteOffset); + x[0] ^= this.P[17]; + for (var i = 16; i > 0; i -= 2) { + x[1] ^= F(this.S, x8, 0) ^ this.P[i]; + x[0] ^= F(this.S, x8, 4) ^ this.P[i-1]; + } + var t = x[0]; + x[0] = x[1] ^ this.P[0]; + x[1] = t; +}; + +function stream2word(data, databytes){ + var i, temp = 0; + for (i = 0; i < 4; i++, BLF_J++) { + if (BLF_J >= databytes) BLF_J = 0; + temp = (temp << 8) | data[BLF_J]; + } + return temp; +}; + +Blowfish.prototype.expand0state = function(key, keybytes) { + var d = new Uint32Array(2), i, k; + var d8 = new Uint8Array(d.buffer); + + for (i = 0, BLF_J = 0; i < 18; i++) { + this.P[i] ^= stream2word(key, keybytes); + } + BLF_J = 0; + + for (i = 0; i < 18; i += 2) { + this.encipher(d, d8); + this.P[i] = d[0]; + this.P[i+1] = d[1]; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + this.encipher(d, d8); + this.S[i][k] = d[0]; + this.S[i][k+1] = d[1]; + } + } +}; + +Blowfish.prototype.expandstate = function(data, databytes, key, keybytes) { + var d = new Uint32Array(2), i, k; + + for (i = 0, BLF_J = 0; i < 18; i++) { + this.P[i] ^= stream2word(key, keybytes); + } + + for (i = 0, BLF_J = 0; i < 18; i += 2) { + d[0] ^= stream2word(data, databytes); + d[1] ^= stream2word(data, databytes); + this.encipher(d); + this.P[i] = d[0]; + this.P[i+1] = d[1]; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + d[0] ^= stream2word(data, databytes); + d[1] ^= stream2word(data, databytes); + this.encipher(d); + this.S[i][k] = d[0]; + this.S[i][k+1] = d[1]; + } + } + BLF_J = 0; +}; + +Blowfish.prototype.enc = function(data, blocks) { + for (var i = 0; i < blocks; i++) { + this.encipher(data.subarray(i*2)); + } +}; + +Blowfish.prototype.dec = function(data, blocks) { + for (var i = 0; i < blocks; i++) { + this.decipher(data.subarray(i*2)); + } +}; + +var BCRYPT_BLOCKS = 8, + BCRYPT_HASHSIZE = 32; + +function bcrypt_hash(sha2pass, sha2salt, out) { + var state = new Blowfish(), + cdata = new Uint32Array(BCRYPT_BLOCKS), i, + ciphertext = new Uint8Array([79,120,121,99,104,114,111,109,97,116,105, + 99,66,108,111,119,102,105,115,104,83,119,97,116,68,121,110,97,109, + 105,116,101]); //"OxychromaticBlowfishSwatDynamite" + + state.expandstate(sha2salt, 64, sha2pass, 64); + for (i = 0; i < 64; i++) { + state.expand0state(sha2salt, 64); + state.expand0state(sha2pass, 64); + } + + for (i = 0; i < BCRYPT_BLOCKS; i++) + cdata[i] = stream2word(ciphertext, ciphertext.byteLength); + for (i = 0; i < 64; i++) + state.enc(cdata, cdata.byteLength / 8); + + for (i = 0; i < BCRYPT_BLOCKS; i++) { + out[4*i+3] = cdata[i] >>> 24; + out[4*i+2] = cdata[i] >>> 16; + out[4*i+1] = cdata[i] >>> 8; + out[4*i+0] = cdata[i]; + } +}; + +function bcrypt_pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds) { + var sha2pass = new Uint8Array(64), + sha2salt = new Uint8Array(64), + out = new Uint8Array(BCRYPT_HASHSIZE), + tmpout = new Uint8Array(BCRYPT_HASHSIZE), + countsalt = new Uint8Array(saltlen+4), + i, j, amt, stride, dest, count, + origkeylen = keylen; + + if (rounds < 1) + return -1; + if (passlen === 0 || saltlen === 0 || keylen === 0 || + keylen > (out.byteLength * out.byteLength) || saltlen > (1<<20)) + return -1; + + stride = Math.floor((keylen + out.byteLength - 1) / out.byteLength); + amt = Math.floor((keylen + stride - 1) / stride); + + for (i = 0; i < saltlen; i++) + countsalt[i] = salt[i]; + + crypto_hash_sha512(sha2pass, pass, passlen); + + for (count = 1; keylen > 0; count++) { + countsalt[saltlen+0] = count >>> 24; + countsalt[saltlen+1] = count >>> 16; + countsalt[saltlen+2] = count >>> 8; + countsalt[saltlen+3] = count; + + crypto_hash_sha512(sha2salt, countsalt, saltlen + 4); + bcrypt_hash(sha2pass, sha2salt, tmpout); + for (i = out.byteLength; i--;) + out[i] = tmpout[i]; + + for (i = 1; i < rounds; i++) { + crypto_hash_sha512(sha2salt, tmpout, tmpout.byteLength); + bcrypt_hash(sha2pass, sha2salt, tmpout); + for (j = 0; j < out.byteLength; j++) + out[j] ^= tmpout[j]; + } + + amt = Math.min(amt, keylen); + for (i = 0; i < amt; i++) { + dest = i * stride + (count - 1); + if (dest >= origkeylen) + break; + key[dest] = out[i]; + } + keylen -= i; + } + + return 0; +}; + +module.exports = { + BLOCKS: BCRYPT_BLOCKS, + HASHSIZE: BCRYPT_HASHSIZE, + hash: bcrypt_hash, + pbkdf: bcrypt_pbkdf +}; diff --git a/tunestats/app/api/node_modules/bcrypt-pbkdf/package.json b/tunestats/app/api/node_modules/bcrypt-pbkdf/package.json new file mode 100644 index 0000000..e93a969 --- /dev/null +++ b/tunestats/app/api/node_modules/bcrypt-pbkdf/package.json @@ -0,0 +1,15 @@ +{ + "name": "bcrypt-pbkdf", + "version": "1.0.2", + "description": "Port of the OpenBSD bcrypt_pbkdf function to pure JS", + "repository": { + "type": "git", + "url": "git://github.com/joyent/node-bcrypt-pbkdf.git" + }, + "main": "index.js", + "dependencies": { + "tweetnacl": "^0.14.3" + }, + "devDependencies": {}, + "license": "BSD-3-Clause" +} diff --git a/tunestats/app/api/node_modules/binary-extensions/binary-extensions.json b/tunestats/app/api/node_modules/binary-extensions/binary-extensions.json new file mode 100644 index 0000000..ac08048 --- /dev/null +++ b/tunestats/app/api/node_modules/binary-extensions/binary-extensions.json @@ -0,0 +1,263 @@ +[ + "3dm", + "3ds", + "3g2", + "3gp", + "7z", + "a", + "aac", + "adp", + "afdesign", + "afphoto", + "afpub", + "ai", + "aif", + "aiff", + "alz", + "ape", + "apk", + "appimage", + "ar", + "arj", + "asf", + "au", + "avi", + "bak", + "baml", + "bh", + "bin", + "bk", + "bmp", + "btif", + "bz2", + "bzip2", + "cab", + "caf", + "cgm", + "class", + "cmx", + "cpio", + "cr2", + "cur", + "dat", + "dcm", + "deb", + "dex", + "djvu", + "dll", + "dmg", + "dng", + "doc", + "docm", + "docx", + "dot", + "dotm", + "dra", + "DS_Store", + "dsk", + "dts", + "dtshd", + "dvb", + "dwg", + "dxf", + "ecelp4800", + "ecelp7470", + "ecelp9600", + "egg", + "eol", + "eot", + "epub", + "exe", + "f4v", + "fbs", + "fh", + "fla", + "flac", + "flatpak", + "fli", + "flv", + "fpx", + "fst", + "fvt", + "g3", + "gh", + "gif", + "graffle", + "gz", + "gzip", + "h261", + "h263", + "h264", + "icns", + "ico", + "ief", + "img", + "ipa", + "iso", + "jar", + "jpeg", + "jpg", + "jpgv", + "jpm", + "jxr", + "key", + "ktx", + "lha", + "lib", + "lvp", + "lz", + "lzh", + "lzma", + "lzo", + "m3u", + "m4a", + "m4v", + "mar", + "mdi", + "mht", + "mid", + "midi", + "mj2", + "mka", + "mkv", + "mmr", + "mng", + "mobi", + "mov", + "movie", + "mp3", + "mp4", + "mp4a", + "mpeg", + "mpg", + "mpga", + "mxu", + "nef", + "npx", + "numbers", + "nupkg", + "o", + "odp", + "ods", + "odt", + "oga", + "ogg", + "ogv", + "otf", + "ott", + "pages", + "pbm", + "pcx", + "pdb", + "pdf", + "pea", + "pgm", + "pic", + "png", + "pnm", + "pot", + "potm", + "potx", + "ppa", + "ppam", + "ppm", + "pps", + "ppsm", + "ppsx", + "ppt", + "pptm", + "pptx", + "psd", + "pya", + "pyc", + "pyo", + "pyv", + "qt", + "rar", + "ras", + "raw", + "resources", + "rgb", + "rip", + "rlc", + "rmf", + "rmvb", + "rpm", + "rtf", + "rz", + "s3m", + "s7z", + "scpt", + "sgi", + "shar", + "snap", + "sil", + "sketch", + "slk", + "smv", + "snk", + "so", + "stl", + "suo", + "sub", + "swf", + "tar", + "tbz", + "tbz2", + "tga", + "tgz", + "thmx", + "tif", + "tiff", + "tlz", + "ttc", + "ttf", + "txz", + "udf", + "uvh", + "uvi", + "uvm", + "uvp", + "uvs", + "uvu", + "viv", + "vob", + "war", + "wav", + "wax", + "wbmp", + "wdp", + "weba", + "webm", + "webp", + "whl", + "wim", + "wm", + "wma", + "wmv", + "wmx", + "woff", + "woff2", + "wrm", + "wvx", + "xbm", + "xif", + "xla", + "xlam", + "xls", + "xlsb", + "xlsm", + "xlsx", + "xlt", + "xltm", + "xltx", + "xm", + "xmind", + "xpi", + "xpm", + "xwd", + "xz", + "z", + "zip", + "zipx" +] diff --git a/tunestats/app/api/node_modules/binary-extensions/binary-extensions.json.d.ts b/tunestats/app/api/node_modules/binary-extensions/binary-extensions.json.d.ts new file mode 100644 index 0000000..94a248c --- /dev/null +++ b/tunestats/app/api/node_modules/binary-extensions/binary-extensions.json.d.ts @@ -0,0 +1,3 @@ +declare const binaryExtensionsJson: readonly string[]; + +export = binaryExtensionsJson; diff --git a/tunestats/app/api/node_modules/binary-extensions/index.d.ts b/tunestats/app/api/node_modules/binary-extensions/index.d.ts new file mode 100644 index 0000000..f469ac5 --- /dev/null +++ b/tunestats/app/api/node_modules/binary-extensions/index.d.ts @@ -0,0 +1,14 @@ +/** +List of binary file extensions. + +@example +``` +import binaryExtensions = require('binary-extensions'); + +console.log(binaryExtensions); +//=> ['3ds', '3g2', …] +``` +*/ +declare const binaryExtensions: readonly string[]; + +export = binaryExtensions; diff --git a/tunestats/app/api/node_modules/binary-extensions/index.js b/tunestats/app/api/node_modules/binary-extensions/index.js new file mode 100644 index 0000000..d46e468 --- /dev/null +++ b/tunestats/app/api/node_modules/binary-extensions/index.js @@ -0,0 +1 @@ +module.exports = require('./binary-extensions.json'); diff --git a/tunestats/app/api/node_modules/binary-extensions/license b/tunestats/app/api/node_modules/binary-extensions/license new file mode 100644 index 0000000..5493a1a --- /dev/null +++ b/tunestats/app/api/node_modules/binary-extensions/license @@ -0,0 +1,10 @@ +MIT License + +Copyright (c) Sindre Sorhus (https://sindresorhus.com) +Copyright (c) Paul Miller (https://paulmillr.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/binary-extensions/package.json b/tunestats/app/api/node_modules/binary-extensions/package.json new file mode 100644 index 0000000..4710c33 --- /dev/null +++ b/tunestats/app/api/node_modules/binary-extensions/package.json @@ -0,0 +1,40 @@ +{ + "name": "binary-extensions", + "version": "2.3.0", + "description": "List of binary file extensions", + "license": "MIT", + "repository": "sindresorhus/binary-extensions", + "funding": "https://github.com/sponsors/sindresorhus", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "https://sindresorhus.com" + }, + "sideEffects": false, + "engines": { + "node": ">=8" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "files": [ + "index.js", + "index.d.ts", + "binary-extensions.json", + "binary-extensions.json.d.ts" + ], + "keywords": [ + "binary", + "extensions", + "extension", + "file", + "json", + "list", + "array" + ], + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.2", + "xo": "^0.24.0" + } +} diff --git a/tunestats/app/api/node_modules/binary-extensions/readme.md b/tunestats/app/api/node_modules/binary-extensions/readme.md new file mode 100644 index 0000000..88519b3 --- /dev/null +++ b/tunestats/app/api/node_modules/binary-extensions/readme.md @@ -0,0 +1,25 @@ +# binary-extensions + +> List of binary file extensions + +The list is just a [JSON file](binary-extensions.json) and can be used anywhere. + +## Install + +```sh +npm install binary-extensions +``` + +## Usage + +```js +const binaryExtensions = require('binary-extensions'); + +console.log(binaryExtensions); +//=> ['3ds', '3g2', …] +``` + +## Related + +- [is-binary-path](https://github.com/sindresorhus/is-binary-path) - Check if a filepath is a binary file +- [text-extensions](https://github.com/sindresorhus/text-extensions) - List of text file extensions diff --git a/tunestats/app/api/node_modules/body-parser/HISTORY.md b/tunestats/app/api/node_modules/body-parser/HISTORY.md new file mode 100644 index 0000000..b892491 --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/HISTORY.md @@ -0,0 +1,665 @@ +1.20.2 / 2023-02-21 +=================== + + * Fix strict json error message on Node.js 19+ + * deps: content-type@~1.0.5 + - perf: skip value escaping when unnecessary + * deps: raw-body@2.5.2 + +1.20.1 / 2022-10-06 +=================== + + * deps: qs@6.11.0 + * perf: remove unnecessary object clone + +1.20.0 / 2022-04-02 +=================== + + * Fix error message for json parse whitespace in `strict` + * Fix internal error when inflated body exceeds limit + * Prevent loss of async hooks context + * Prevent hanging when request already read + * deps: depd@2.0.0 + - Replace internal `eval` usage with `Function` constructor + - Use instance methods on `process` to check for listeners + * deps: http-errors@2.0.0 + - deps: depd@2.0.0 + - deps: statuses@2.0.1 + * deps: on-finished@2.4.1 + * deps: qs@6.10.3 + * deps: raw-body@2.5.1 + - deps: http-errors@2.0.0 + +1.19.2 / 2022-02-15 +=================== + + * deps: bytes@3.1.2 + * deps: qs@6.9.7 + * Fix handling of `__proto__` keys + * deps: raw-body@2.4.3 + - deps: bytes@3.1.2 + +1.19.1 / 2021-12-10 +=================== + + * deps: bytes@3.1.1 + * deps: http-errors@1.8.1 + - deps: inherits@2.0.4 + - deps: toidentifier@1.0.1 + - deps: setprototypeof@1.2.0 + * deps: qs@6.9.6 + * deps: raw-body@2.4.2 + - deps: bytes@3.1.1 + - deps: http-errors@1.8.1 + * deps: safe-buffer@5.2.1 + * deps: type-is@~1.6.18 + +1.19.0 / 2019-04-25 +=================== + + * deps: bytes@3.1.0 + - Add petabyte (`pb`) support + * deps: http-errors@1.7.2 + - Set constructor name when possible + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: iconv-lite@0.4.24 + - Added encoding MIK + * deps: qs@6.7.0 + - Fix parsing array brackets after index + * deps: raw-body@2.4.0 + - deps: bytes@3.1.0 + - deps: http-errors@1.7.2 + - deps: iconv-lite@0.4.24 + * deps: type-is@~1.6.17 + - deps: mime-types@~2.1.24 + - perf: prevent internal `throw` on invalid type + +1.18.3 / 2018-05-14 +=================== + + * Fix stack trace for strict json parse error + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: http-errors@~1.6.3 + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.0 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.23 + - Fix loading encoding with year appended + - Fix deprecation warnings on Node.js 10+ + * deps: qs@6.5.2 + * deps: raw-body@2.3.3 + - deps: http-errors@1.6.3 + - deps: iconv-lite@0.4.23 + * deps: type-is@~1.6.16 + - deps: mime-types@~2.1.18 + +1.18.2 / 2017-09-22 +=================== + + * deps: debug@2.6.9 + * perf: remove argument reassignment + +1.18.1 / 2017-09-12 +=================== + + * deps: content-type@~1.0.4 + - perf: remove argument reassignment + - perf: skip parameter parsing when no parameters + * deps: iconv-lite@0.4.19 + - Fix ISO-8859-1 regression + - Update Windows-1255 + * deps: qs@6.5.1 + - Fix parsing & compacting very deep objects + * deps: raw-body@2.3.2 + - deps: iconv-lite@0.4.19 + +1.18.0 / 2017-09-08 +=================== + + * Fix JSON strict violation error to match native parse error + * Include the `body` property on verify errors + * Include the `type` property on all generated errors + * Use `http-errors` to set status code on errors + * deps: bytes@3.0.0 + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: http-errors@~1.6.2 + - deps: depd@1.1.1 + * deps: iconv-lite@0.4.18 + - Add support for React Native + - Add a warning if not loaded as utf-8 + - Fix CESU-8 decoding in Node.js 8 + - Improve speed of ISO-8859-1 encoding + * deps: qs@6.5.0 + * deps: raw-body@2.3.1 + - Use `http-errors` for standard emitted errors + - deps: bytes@3.0.0 + - deps: iconv-lite@0.4.18 + - perf: skip buffer decoding on overage chunk + * perf: prevent internal `throw` when missing charset + +1.17.2 / 2017-05-17 +=================== + + * deps: debug@2.6.7 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@2.0.0 + * deps: type-is@~1.6.15 + - deps: mime-types@~2.1.15 + +1.17.1 / 2017-03-06 +=================== + + * deps: qs@6.4.0 + - Fix regression parsing keys starting with `[` + +1.17.0 / 2017-03-01 +=================== + + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + * deps: qs@6.3.1 + - Fix compacting nested arrays + +1.16.1 / 2017-02-10 +=================== + + * deps: debug@2.6.1 + - Fix deprecation messages in WebStorm and other editors + - Undeprecate `DEBUG_FD` set to `1` or `2` + +1.16.0 / 2017-01-17 +=================== + + * deps: debug@2.6.0 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.15 + - Added encoding MS-31J + - Added encoding MS-932 + - Added encoding MS-936 + - Added encoding MS-949 + - Added encoding MS-950 + - Fix GBK/GB18030 handling of Euro character + * deps: qs@6.2.1 + - Fix array parsing from skipping empty values + * deps: raw-body@~2.2.0 + - deps: iconv-lite@0.4.15 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +1.15.2 / 2016-06-19 +=================== + + * deps: bytes@2.4.0 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: http-errors@~1.5.0 + - Use `setprototypeof` module to replace `__proto__` setting + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: qs@6.2.0 + * deps: raw-body@~2.1.7 + - deps: bytes@2.4.0 + - perf: remove double-cleanup on happy path + * deps: type-is@~1.6.13 + - deps: mime-types@~2.1.11 + +1.15.1 / 2016-05-05 +=================== + + * deps: bytes@2.3.0 + - Drop partial bytes on all parsed units + - Fix parsing byte string that looks like hex + * deps: raw-body@~2.1.6 + - deps: bytes@2.3.0 + * deps: type-is@~1.6.12 + - deps: mime-types@~2.1.10 + +1.15.0 / 2016-02-10 +=================== + + * deps: http-errors@~1.4.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.2.1 < 2' + * deps: qs@6.1.0 + * deps: type-is@~1.6.11 + - deps: mime-types@~2.1.9 + +1.14.2 / 2015-12-16 +=================== + + * deps: bytes@2.2.0 + * deps: iconv-lite@0.4.13 + * deps: qs@5.2.0 + * deps: raw-body@~2.1.5 + - deps: bytes@2.2.0 + - deps: iconv-lite@0.4.13 + * deps: type-is@~1.6.10 + - deps: mime-types@~2.1.8 + +1.14.1 / 2015-09-27 +=================== + + * Fix issue where invalid charset results in 400 when `verify` used + * deps: iconv-lite@0.4.12 + - Fix CESU-8 decoding in Node.js 4.x + * deps: raw-body@~2.1.4 + - Fix masking critical errors from `iconv-lite` + - deps: iconv-lite@0.4.12 + * deps: type-is@~1.6.9 + - deps: mime-types@~2.1.7 + +1.14.0 / 2015-09-16 +=================== + + * Fix JSON strict parse error to match syntax errors + * Provide static `require` analysis in `urlencoded` parser + * deps: depd@~1.1.0 + - Support web browser loading + * deps: qs@5.1.0 + * deps: raw-body@~2.1.3 + - Fix sync callback when attaching data listener causes sync read + * deps: type-is@~1.6.8 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.6 + +1.13.3 / 2015-07-31 +=================== + + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +1.13.2 / 2015-07-05 +=================== + + * deps: iconv-lite@0.4.11 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix user-visible incompatibilities from 3.1.0 + - Fix various parsing edge cases + * deps: raw-body@~2.1.2 + - Fix error stack traces to skip `makeError` + - deps: iconv-lite@0.4.11 + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +1.13.1 / 2015-06-16 +=================== + + * deps: qs@2.4.2 + - Downgraded from 3.1.0 because of user-visible incompatibilities + +1.13.0 / 2015-06-14 +=================== + + * Add `statusCode` property on `Error`s, in addition to `status` + * Change `type` default to `application/json` for JSON parser + * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser + * Provide static `require` analysis + * Use the `http-errors` module to generate errors + * deps: bytes@2.1.0 + - Slight optimizations + * deps: iconv-lite@0.4.10 + - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails + - Leading BOM is now removed when decoding + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: qs@3.1.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + - Parsed object now has `null` prototype + * deps: raw-body@~2.1.1 + - Use `unpipe` module for unpiping requests + - deps: iconv-lite@0.4.10 + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: remove argument reassignment + * perf: remove delete call + +1.12.4 / 2015-05-10 +=================== + + * deps: debug@~2.2.0 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: on-finished@~2.2.1 + * deps: raw-body@~2.0.1 + - Fix a false-positive when unpiping in Node.js 0.8 + - deps: bytes@2.0.1 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +1.12.3 / 2015-04-15 +=================== + + * Slight efficiency improvement when not debugging + * deps: depd@~1.0.1 + * deps: iconv-lite@0.4.8 + - Add encoding alias UNICODE-1-1-UTF-7 + * deps: raw-body@1.3.4 + - Fix hanging callback if request aborts during read + - deps: iconv-lite@0.4.8 + +1.12.2 / 2015-03-16 +=================== + + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + +1.12.1 / 2015-03-15 +=================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +1.12.0 / 2015-02-13 +=================== + + * add `debug` messages + * accept a function for the `type` option + * use `content-type` to parse `Content-Type` headers + * deps: iconv-lite@0.4.7 + - Gracefully support enumerables on `Object.prototype` + * deps: raw-body@1.3.3 + - deps: iconv-lite@0.4.7 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +1.11.0 / 2015-01-30 +=================== + + * make internal `extended: true` depth limit infinity + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +1.10.2 / 2015-01-20 +=================== + + * deps: iconv-lite@0.4.6 + - Fix rare aliases of single-byte encodings + * deps: raw-body@1.3.2 + - deps: iconv-lite@0.4.6 + +1.10.1 / 2015-01-01 +=================== + + * deps: on-finished@~2.2.0 + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +1.10.0 / 2014-12-02 +=================== + + * make internal `extended: true` array limit dynamic + +1.9.3 / 2014-11-21 +================== + + * deps: iconv-lite@0.4.5 + - Fix Windows-31J and X-SJIS encoding support + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + * deps: raw-body@1.3.1 + - deps: iconv-lite@0.4.5 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +1.9.2 / 2014-10-27 +================== + + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +1.9.1 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +1.9.0 / 2014-09-24 +================== + + * include the charset in "unsupported charset" error message + * include the encoding in "unsupported content encoding" error message + * deps: depd@~1.0.0 + +1.8.4 / 2014-09-23 +================== + + * fix content encoding to be case-insensitive + +1.8.3 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +1.8.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + +1.8.1 / 2014-09-07 +================== + + * deps: media-typer@0.3.0 + * deps: type-is@~1.5.1 + +1.8.0 / 2014-09-05 +================== + + * make empty-body-handling consistent between chunked requests + - empty `json` produces `{}` + - empty `raw` produces `new Buffer(0)` + - empty `text` produces `''` + - empty `urlencoded` produces `{}` + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: type-is@~1.5.0 + - fix `hasbody` to be true for `content-length: 0` + +1.7.0 / 2014-09-01 +================== + + * add `parameterLimit` option to `urlencoded` parser + * change `urlencoded` extended array limit to 100 + * respond with 413 when over `parameterLimit` in `urlencoded` + +1.6.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +1.6.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +1.6.5 / 2014-08-16 +================== + + * deps: on-finished@2.1.0 + +1.6.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + +1.6.3 / 2014-08-10 +================== + + * deps: qs@1.2.1 + +1.6.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +1.6.1 / 2014-08-06 +================== + + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +1.6.0 / 2014-08-05 +================== + + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + +1.5.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +1.5.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +1.5.0 / 2014-07-20 +================== + + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + * deps: raw-body@1.3.0 + - deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + - Fix `Cannot switch to old mode now` error on Node.js 0.10+ + * deps: type-is@~1.3.2 + +1.4.3 / 2014-06-19 +================== + + * deps: type-is@1.3.1 + - fix global variable leak + +1.4.2 / 2014-06-19 +================== + + * deps: type-is@1.3.0 + - improve type parsing + +1.4.1 / 2014-06-19 +================== + + * fix urlencoded extended deprecation message + +1.4.0 / 2014-06-19 +================== + + * add `text` parser + * add `raw` parser + * check accepted charset in content-type (accepts utf-8) + * check accepted encoding in content-encoding (accepts identity) + * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed + * deprecate `urlencoded()` without provided `extended` option + * lazy-load urlencoded parsers + * parsers split into files for reduced mem usage + * support gzip and deflate bodies + - set `inflate: false` to turn off + * deps: raw-body@1.2.2 + - Support all encodings from `iconv-lite` + +1.3.1 / 2014-06-11 +================== + + * deps: type-is@1.2.1 + - Switch dependency from mime to mime-types@1.0.0 + +1.3.0 / 2014-05-31 +================== + + * add `extended` option to urlencoded parser + +1.2.2 / 2014-05-27 +================== + + * deps: raw-body@1.1.6 + - assert stream encoding on node.js 0.8 + - assert stream encoding on node.js < 0.10.6 + - deps: bytes@1 + +1.2.1 / 2014-05-26 +================== + + * invoke `next(err)` after request fully read + - prevents hung responses and socket hang ups + +1.2.0 / 2014-05-11 +================== + + * add `verify` option + * deps: type-is@1.2.0 + - support suffix matching + +1.1.2 / 2014-05-11 +================== + + * improve json parser speed + +1.1.1 / 2014-05-11 +================== + + * fix repeated limit parsing with every request + +1.1.0 / 2014-05-10 +================== + + * add `type` option + * deps: pin for safety and consistency + +1.0.2 / 2014-04-14 +================== + + * use `type-is` module + +1.0.1 / 2014-03-20 +================== + + * lower default limits to 100kb diff --git a/tunestats/app/api/node_modules/body-parser/LICENSE b/tunestats/app/api/node_modules/body-parser/LICENSE new file mode 100644 index 0000000..386b7b6 --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/body-parser/README.md b/tunestats/app/api/node_modules/body-parser/README.md new file mode 100644 index 0000000..38553bf --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/README.md @@ -0,0 +1,465 @@ +# body-parser + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js body parsing middleware. + +Parse incoming request bodies in a middleware before your handlers, available +under the `req.body` property. + +**Note** As `req.body`'s shape is based on user-controlled input, all +properties and values in this object are untrusted and should be validated +before trusting. For example, `req.body.foo.toString()` may fail in multiple +ways, for example the `foo` property may not be there or may not be a string, +and `toString` may not be a function and instead a string or other user input. + +[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/). + +_This does not handle multipart bodies_, due to their complex and typically +large nature. For multipart bodies, you may be interested in the following +modules: + + * [busboy](https://www.npmjs.org/package/busboy#readme) and + [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme) + * [multiparty](https://www.npmjs.org/package/multiparty#readme) and + [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme) + * [formidable](https://www.npmjs.org/package/formidable#readme) + * [multer](https://www.npmjs.org/package/multer#readme) + +This module provides the following parsers: + + * [JSON body parser](#bodyparserjsonoptions) + * [Raw body parser](#bodyparserrawoptions) + * [Text body parser](#bodyparsertextoptions) + * [URL-encoded form body parser](#bodyparserurlencodedoptions) + +Other body parsers you might be interested in: + +- [body](https://www.npmjs.org/package/body#readme) +- [co-body](https://www.npmjs.org/package/co-body#readme) + +## Installation + +```sh +$ npm install body-parser +``` + +## API + +```js +var bodyParser = require('body-parser') +``` + +The `bodyParser` object exposes various factories to create middlewares. All +middlewares will populate the `req.body` property with the parsed body when +the `Content-Type` request header matches the `type` option, or an empty +object (`{}`) if there was no body to parse, the `Content-Type` was not matched, +or an error occurred. + +The various errors returned by this module are described in the +[errors section](#errors). + +### bodyParser.json([options]) + +Returns middleware that only parses `json` and only looks at requests where +the `Content-Type` header matches the `type` option. This parser accepts any +Unicode encoding of the body and supports automatic inflation of `gzip` and +`deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). + +#### Options + +The `json` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### reviver + +The `reviver` option is passed directly to `JSON.parse` as the second +argument. You can find more information on this argument +[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter). + +##### strict + +When set to `true`, will only accept arrays and objects; when `false` will +accept anything `JSON.parse` accepts. Defaults to `true`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not a +function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `json`), a mime type (like `application/json`), or +a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a truthy +value. Defaults to `application/json`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.raw([options]) + +Returns middleware that parses all bodies as a `Buffer` and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a `Buffer` object +of the body. + +#### Options + +The `raw` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. +If not a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this +can be an extension name (like `bin`), a mime type (like +`application/octet-stream`), or a mime type with a wildcard (like `*/*` or +`application/*`). If a function, the `type` option is called as `fn(req)` +and the request is parsed if it returns a truthy value. Defaults to +`application/octet-stream`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.text([options]) + +Returns middleware that parses all bodies as a string and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` string containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a string of the +body. + +#### Options + +The `text` function takes an optional `options` object that may contain any of +the following keys: + +##### defaultCharset + +Specify the default character set for the text content if the charset is not +specified in the `Content-Type` header of the request. Defaults to `utf-8`. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `txt`), a mime type (like `text/plain`), or a mime +type with a wildcard (like `*/*` or `text/*`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a +truthy value. Defaults to `text/plain`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.urlencoded([options]) + +Returns middleware that only parses `urlencoded` bodies and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser accepts only UTF-8 encoding of the body and supports automatic +inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This object will contain +key-value pairs, where the value can be a string or array (when `extended` is +`false`), or any type (when `extended` is `true`). + +#### Options + +The `urlencoded` function takes an optional `options` object that may contain +any of the following keys: + +##### extended + +The `extended` option allows to choose between parsing the URL-encoded data +with the `querystring` library (when `false`) or the `qs` library (when +`true`). The "extended" syntax allows for rich objects and arrays to be +encoded into the URL-encoded format, allowing for a JSON-like experience +with URL-encoded. For more information, please +[see the qs library](https://www.npmjs.org/package/qs#readme). + +Defaults to `true`, but using the default has been deprecated. Please +research into the difference between `qs` and `querystring` and choose the +appropriate setting. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### parameterLimit + +The `parameterLimit` option controls the maximum number of parameters that +are allowed in the URL-encoded data. If a request contains more parameters +than this value, a 413 will be returned to the client. Defaults to `1000`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `urlencoded`), a mime type (like +`application/x-www-form-urlencoded`), or a mime type with a wildcard (like +`*/x-www-form-urlencoded`). If a function, the `type` option is called as +`fn(req)` and the request is parsed if it returns a truthy value. Defaults +to `application/x-www-form-urlencoded`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +## Errors + +The middlewares provided by this module create errors using the +[`http-errors` module](https://www.npmjs.com/package/http-errors). The errors +will typically have a `status`/`statusCode` property that contains the suggested +HTTP response code, an `expose` property to determine if the `message` property +should be displayed to the client, a `type` property to determine the type of +error without matching against the `message`, and a `body` property containing +the read body, if available. + +The following are the common errors created, though any error can come through +for various reasons. + +### content encoding unsupported + +This error will occur when the request had a `Content-Encoding` header that +contained an encoding but the "inflation" option was set to `false`. The +`status` property is set to `415`, the `type` property is set to +`'encoding.unsupported'`, and the `charset` property will be set to the +encoding that is unsupported. + +### entity parse failed + +This error will occur when the request contained an entity that could not be +parsed by the middleware. The `status` property is set to `400`, the `type` +property is set to `'entity.parse.failed'`, and the `body` property is set to +the entity value that failed parsing. + +### entity verify failed + +This error will occur when the request contained an entity that could not be +failed verification by the defined `verify` option. The `status` property is +set to `403`, the `type` property is set to `'entity.verify.failed'`, and the +`body` property is set to the entity value that failed verification. + +### request aborted + +This error will occur when the request is aborted by the client before reading +the body has finished. The `received` property will be set to the number of +bytes received before the request was aborted and the `expected` property is +set to the number of expected bytes. The `status` property is set to `400` +and `type` property is set to `'request.aborted'`. + +### request entity too large + +This error will occur when the request body's size is larger than the "limit" +option. The `limit` property will be set to the byte limit and the `length` +property will be set to the request body's length. The `status` property is +set to `413` and the `type` property is set to `'entity.too.large'`. + +### request size did not match content length + +This error will occur when the request's length did not match the length from +the `Content-Length` header. This typically occurs when the request is malformed, +typically when the `Content-Length` header was calculated based on characters +instead of bytes. The `status` property is set to `400` and the `type` property +is set to `'request.size.invalid'`. + +### stream encoding should not be set + +This error will occur when something called the `req.setEncoding` method prior +to this middleware. This module operates directly on bytes only and you cannot +call `req.setEncoding` when using this module. The `status` property is set to +`500` and the `type` property is set to `'stream.encoding.set'`. + +### stream is not readable + +This error will occur when the request is no longer readable when this middleware +attempts to read it. This typically means something other than a middleware from +this module read the request body already and the middleware was also configured to +read the same request. The `status` property is set to `500` and the `type` +property is set to `'stream.not.readable'`. + +### too many parameters + +This error will occur when the content of the request exceeds the configured +`parameterLimit` for the `urlencoded` parser. The `status` property is set to +`413` and the `type` property is set to `'parameters.too.many'`. + +### unsupported charset "BOGUS" + +This error will occur when the request had a charset parameter in the +`Content-Type` header, but the `iconv-lite` module does not support it OR the +parser does not support it. The charset is contained in the message as well +as in the `charset` property. The `status` property is set to `415`, the +`type` property is set to `'charset.unsupported'`, and the `charset` property +is set to the charset that is unsupported. + +### unsupported content encoding "bogus" + +This error will occur when the request had a `Content-Encoding` header that +contained an unsupported encoding. The encoding is contained in the message +as well as in the `encoding` property. The `status` property is set to `415`, +the `type` property is set to `'encoding.unsupported'`, and the `encoding` +property is set to the encoding that is unsupported. + +## Examples + +### Express/Connect top-level generic + +This example demonstrates adding a generic JSON and URL-encoded parser as a +top-level middleware, which will parse the bodies of all incoming requests. +This is the simplest setup. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse application/x-www-form-urlencoded +app.use(bodyParser.urlencoded({ extended: false })) + +// parse application/json +app.use(bodyParser.json()) + +app.use(function (req, res) { + res.setHeader('Content-Type', 'text/plain') + res.write('you posted:\n') + res.end(JSON.stringify(req.body, null, 2)) +}) +``` + +### Express route-specific + +This example demonstrates adding body parsers specifically to the routes that +need them. In general, this is the most recommended way to use body-parser with +Express. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// create application/json parser +var jsonParser = bodyParser.json() + +// create application/x-www-form-urlencoded parser +var urlencodedParser = bodyParser.urlencoded({ extended: false }) + +// POST /login gets urlencoded bodies +app.post('/login', urlencodedParser, function (req, res) { + res.send('welcome, ' + req.body.username) +}) + +// POST /api/users gets JSON bodies +app.post('/api/users', jsonParser, function (req, res) { + // create user in req.body +}) +``` + +### Change accepted type for parsers + +All the parsers accept a `type` option which allows you to change the +`Content-Type` that the middleware will parse. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse various different custom JSON types as JSON +app.use(bodyParser.json({ type: 'application/*+json' })) + +// parse some custom thing into a Buffer +app.use(bodyParser.raw({ type: 'application/vnd.custom-type' })) + +// parse an HTML body into a string +app.use(bodyParser.text({ type: 'text/html' })) +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/expressjs/body-parser/master?label=ci +[ci-url]: https://github.com/expressjs/body-parser/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/body-parser/master +[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master +[node-version-image]: https://badgen.net/npm/node/body-parser +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/body-parser +[npm-url]: https://npmjs.org/package/body-parser +[npm-version-image]: https://badgen.net/npm/v/body-parser diff --git a/tunestats/app/api/node_modules/body-parser/SECURITY.md b/tunestats/app/api/node_modules/body-parser/SECURITY.md new file mode 100644 index 0000000..9694d42 --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/SECURITY.md @@ -0,0 +1,25 @@ +# Security Policies and Procedures + +## Reporting a Bug + +The Express team and community take all security bugs seriously. Thank you +for improving the security of Express. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the current owner(s) of `body-parser`. This +information can be found in the npm registry using the command +`npm owner ls body-parser`. +If unsure or unable to get the information from the above, open an issue +in the [project issue tracker](https://github.com/expressjs/body-parser/issues) +asking for the current contact information. + +To ensure the timely response to your report, please ensure that the entirety +of the report is contained within the email body and not solely behind a web +link or an attachment. + +At least one owner will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the owners will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. diff --git a/tunestats/app/api/node_modules/body-parser/index.js b/tunestats/app/api/node_modules/body-parser/index.js new file mode 100644 index 0000000..bb24d73 --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/index.js @@ -0,0 +1,156 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('body-parser') + +/** + * Cache of loaded parsers. + * @private + */ + +var parsers = Object.create(null) + +/** + * @typedef Parsers + * @type {function} + * @property {function} json + * @property {function} raw + * @property {function} text + * @property {function} urlencoded + */ + +/** + * Module exports. + * @type {Parsers} + */ + +exports = module.exports = deprecate.function(bodyParser, + 'bodyParser: use individual json/urlencoded middlewares') + +/** + * JSON parser. + * @public + */ + +Object.defineProperty(exports, 'json', { + configurable: true, + enumerable: true, + get: createParserGetter('json') +}) + +/** + * Raw parser. + * @public + */ + +Object.defineProperty(exports, 'raw', { + configurable: true, + enumerable: true, + get: createParserGetter('raw') +}) + +/** + * Text parser. + * @public + */ + +Object.defineProperty(exports, 'text', { + configurable: true, + enumerable: true, + get: createParserGetter('text') +}) + +/** + * URL-encoded parser. + * @public + */ + +Object.defineProperty(exports, 'urlencoded', { + configurable: true, + enumerable: true, + get: createParserGetter('urlencoded') +}) + +/** + * Create a middleware to parse json and urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @deprecated + * @public + */ + +function bodyParser (options) { + // use default type for parsers + var opts = Object.create(options || null, { + type: { + configurable: true, + enumerable: true, + value: undefined, + writable: true + } + }) + + var _urlencoded = exports.urlencoded(opts) + var _json = exports.json(opts) + + return function bodyParser (req, res, next) { + _json(req, res, function (err) { + if (err) return next(err) + _urlencoded(req, res, next) + }) + } +} + +/** + * Create a getter for loading a parser. + * @private + */ + +function createParserGetter (name) { + return function get () { + return loadParser(name) + } +} + +/** + * Load a parser module. + * @private + */ + +function loadParser (parserName) { + var parser = parsers[parserName] + + if (parser !== undefined) { + return parser + } + + // this uses a switch for static require analysis + switch (parserName) { + case 'json': + parser = require('./lib/types/json') + break + case 'raw': + parser = require('./lib/types/raw') + break + case 'text': + parser = require('./lib/types/text') + break + case 'urlencoded': + parser = require('./lib/types/urlencoded') + break + } + + // store to prevent invoking require() + return (parsers[parserName] = parser) +} diff --git a/tunestats/app/api/node_modules/body-parser/lib/read.js b/tunestats/app/api/node_modules/body-parser/lib/read.js new file mode 100644 index 0000000..fce6283 --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/lib/read.js @@ -0,0 +1,205 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var destroy = require('destroy') +var getBody = require('raw-body') +var iconv = require('iconv-lite') +var onFinished = require('on-finished') +var unpipe = require('unpipe') +var zlib = require('zlib') + +/** + * Module exports. + */ + +module.exports = read + +/** + * Read a request into a buffer and parse. + * + * @param {object} req + * @param {object} res + * @param {function} next + * @param {function} parse + * @param {function} debug + * @param {object} options + * @private + */ + +function read (req, res, next, parse, debug, options) { + var length + var opts = options + var stream + + // flag as parsed + req._body = true + + // read options + var encoding = opts.encoding !== null + ? opts.encoding + : null + var verify = opts.verify + + try { + // get the content stream + stream = contentstream(req, debug, opts.inflate) + length = stream.length + stream.length = undefined + } catch (err) { + return next(err) + } + + // set raw-body options + opts.length = length + opts.encoding = verify + ? null + : encoding + + // assert charset is supported + if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) { + return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + })) + } + + // read body + debug('read body') + getBody(stream, opts, function (error, body) { + if (error) { + var _error + + if (error.type === 'encoding.unsupported') { + // echo back charset + _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + }) + } else { + // set status code on error + _error = createError(400, error) + } + + // unpipe from stream and destroy + if (stream !== req) { + unpipe(req) + destroy(stream, true) + } + + // read off entire request + dump(req, function onfinished () { + next(createError(400, _error)) + }) + return + } + + // verify + if (verify) { + try { + debug('verify body') + verify(req, res, body, encoding) + } catch (err) { + next(createError(403, err, { + body: body, + type: err.type || 'entity.verify.failed' + })) + return + } + } + + // parse + var str = body + try { + debug('parse body') + str = typeof body !== 'string' && encoding !== null + ? iconv.decode(body, encoding) + : body + req.body = parse(str) + } catch (err) { + next(createError(400, err, { + body: str, + type: err.type || 'entity.parse.failed' + })) + return + } + + next() + }) +} + +/** + * Get the content stream of the request. + * + * @param {object} req + * @param {function} debug + * @param {boolean} [inflate=true] + * @return {object} + * @api private + */ + +function contentstream (req, debug, inflate) { + var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase() + var length = req.headers['content-length'] + var stream + + debug('content-encoding "%s"', encoding) + + if (inflate === false && encoding !== 'identity') { + throw createError(415, 'content encoding unsupported', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + switch (encoding) { + case 'deflate': + stream = zlib.createInflate() + debug('inflate body') + req.pipe(stream) + break + case 'gzip': + stream = zlib.createGunzip() + debug('gunzip body') + req.pipe(stream) + break + case 'identity': + stream = req + stream.length = length + break + default: + throw createError(415, 'unsupported content encoding "' + encoding + '"', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + return stream +} + +/** + * Dump the contents of a request. + * + * @param {object} req + * @param {function} callback + * @api private + */ + +function dump (req, callback) { + if (onFinished.isFinished(req)) { + callback(null) + } else { + onFinished(req, callback) + req.resume() + } +} diff --git a/tunestats/app/api/node_modules/body-parser/lib/types/json.js b/tunestats/app/api/node_modules/body-parser/lib/types/json.js new file mode 100644 index 0000000..59f3f7e --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/lib/types/json.js @@ -0,0 +1,247 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:json') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = json + +/** + * RegExp to match the first non-space in a string. + * + * Allowed whitespace is defined in RFC 7159: + * + * ws = *( + * %x20 / ; Space + * %x09 / ; Horizontal tab + * %x0A / ; Line feed or New line + * %x0D ) ; Carriage return + */ + +var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*([^\x20\x09\x0a\x0d])/ // eslint-disable-line no-control-regex + +var JSON_SYNTAX_CHAR = '#' +var JSON_SYNTAX_REGEXP = /#+/g + +/** + * Create a middleware to parse JSON bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function json (options) { + var opts = options || {} + + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var inflate = opts.inflate !== false + var reviver = opts.reviver + var strict = opts.strict !== false + var type = opts.type || 'application/json' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + if (body.length === 0) { + // special-case empty json body, as it's a common client-side mistake + // TODO: maybe make this configurable or part of "strict" option + return {} + } + + if (strict) { + var first = firstchar(body) + + if (first !== '{' && first !== '[') { + debug('strict violation') + throw createStrictSyntaxError(body, first) + } + } + + try { + debug('parse json') + return JSON.parse(body, reviver) + } catch (e) { + throw normalizeJsonSyntaxError(e, { + message: e.message, + stack: e.stack + }) + } + } + + return function jsonParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset per RFC 7159 sec 8.1 + var charset = getCharset(req) || 'utf-8' + if (charset.slice(0, 4) !== 'utf-') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Create strict violation syntax error matching native error. + * + * @param {string} str + * @param {string} char + * @return {Error} + * @private + */ + +function createStrictSyntaxError (str, char) { + var index = str.indexOf(char) + var partial = '' + + if (index !== -1) { + partial = str.substring(0, index) + JSON_SYNTAX_CHAR + + for (var i = index + 1; i < str.length; i++) { + partial += JSON_SYNTAX_CHAR + } + } + + try { + JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation') + } catch (e) { + return normalizeJsonSyntaxError(e, { + message: e.message.replace(JSON_SYNTAX_REGEXP, function (placeholder) { + return str.substring(index, index + placeholder.length) + }), + stack: e.stack + }) + } +} + +/** + * Get the first non-whitespace character in a string. + * + * @param {string} str + * @return {function} + * @private + */ + +function firstchar (str) { + var match = FIRST_CHAR_REGEXP.exec(str) + + return match + ? match[1] + : undefined +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Normalize a SyntaxError for JSON.parse. + * + * @param {SyntaxError} error + * @param {object} obj + * @return {SyntaxError} + */ + +function normalizeJsonSyntaxError (error, obj) { + var keys = Object.getOwnPropertyNames(error) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + if (key !== 'stack' && key !== 'message') { + delete error[key] + } + } + + // replace stack before message for Node.js 0.10 and below + error.stack = obj.stack.replace(error.message, obj.message) + error.message = obj.message + + return error +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/tunestats/app/api/node_modules/body-parser/lib/types/raw.js b/tunestats/app/api/node_modules/body-parser/lib/types/raw.js new file mode 100644 index 0000000..f5d1b67 --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/lib/types/raw.js @@ -0,0 +1,101 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var debug = require('debug')('body-parser:raw') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = raw + +/** + * Create a middleware to parse raw bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function raw (options) { + var opts = options || {} + + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/octet-stream' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function rawParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // read + read(req, res, next, parse, debug, { + encoding: null, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/tunestats/app/api/node_modules/body-parser/lib/types/text.js b/tunestats/app/api/node_modules/body-parser/lib/types/text.js new file mode 100644 index 0000000..083a009 --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/lib/types/text.js @@ -0,0 +1,121 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var debug = require('debug')('body-parser:text') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = text + +/** + * Create a middleware to parse text bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function text (options) { + var opts = options || {} + + var defaultCharset = opts.defaultCharset || 'utf-8' + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'text/plain' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function textParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // get charset + var charset = getCharset(req) || defaultCharset + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/tunestats/app/api/node_modules/body-parser/lib/types/urlencoded.js b/tunestats/app/api/node_modules/body-parser/lib/types/urlencoded.js new file mode 100644 index 0000000..b2ca8f1 --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/lib/types/urlencoded.js @@ -0,0 +1,284 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:urlencoded') +var deprecate = require('depd')('body-parser') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = urlencoded + +/** + * Cache of parser modules. + */ + +var parsers = Object.create(null) + +/** + * Create a middleware to parse urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function urlencoded (options) { + var opts = options || {} + + // notice because option default will flip in next major + if (opts.extended === undefined) { + deprecate('undefined extended: provide extended option') + } + + var extended = opts.extended !== false + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/x-www-form-urlencoded' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate query parser + var queryparse = extended + ? extendedparser(opts) + : simpleparser(opts) + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + return body.length + ? queryparse(body) + : {} + } + + return function urlencodedParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset + var charset = getCharset(req) || 'utf-8' + if (charset !== 'utf-8') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + debug: debug, + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the extended query parser. + * + * @param {object} options + */ + +function extendedparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('qs') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + var arrayLimit = Math.max(100, paramCount) + + debug('parse extended urlencoding') + return parse(body, { + allowPrototypes: true, + arrayLimit: arrayLimit, + depth: Infinity, + parameterLimit: parameterLimit + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Count the number of parameters, stopping once limit reached + * + * @param {string} body + * @param {number} limit + * @api private + */ + +function parameterCount (body, limit) { + var count = 0 + var index = 0 + + while ((index = body.indexOf('&', index)) !== -1) { + count++ + index++ + + if (count === limit) { + return undefined + } + } + + return count +} + +/** + * Get parser for module name dynamically. + * + * @param {string} name + * @return {function} + * @api private + */ + +function parser (name) { + var mod = parsers[name] + + if (mod !== undefined) { + return mod.parse + } + + // this uses a switch for static require analysis + switch (name) { + case 'qs': + mod = require('qs') + break + case 'querystring': + mod = require('querystring') + break + } + + // store to prevent invoking require() + parsers[name] = mod + + return mod.parse +} + +/** + * Get the simple query parser. + * + * @param {object} options + */ + +function simpleparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('querystring') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + debug('parse urlencoding') + return parse(body, undefined, undefined, { maxKeys: parameterLimit }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/tunestats/app/api/node_modules/body-parser/package.json b/tunestats/app/api/node_modules/body-parser/package.json new file mode 100644 index 0000000..4637304 --- /dev/null +++ b/tunestats/app/api/node_modules/body-parser/package.json @@ -0,0 +1,56 @@ +{ + "name": "body-parser", + "description": "Node.js body parsing middleware", + "version": "1.20.2", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "expressjs/body-parser", + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.5", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.11.0", + "raw-body": "2.5.2", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + }, + "devDependencies": { + "eslint": "8.34.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.27.5", + "eslint-plugin-markdown": "3.0.0", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.1.1", + "eslint-plugin-standard": "4.1.0", + "methods": "1.1.2", + "mocha": "10.2.0", + "nyc": "15.1.0", + "safe-buffer": "5.2.1", + "supertest": "6.3.3" + }, + "files": [ + "lib/", + "LICENSE", + "HISTORY.md", + "SECURITY.md", + "index.js" + ], + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/tunestats/app/api/node_modules/brace-expansion/LICENSE b/tunestats/app/api/node_modules/brace-expansion/LICENSE new file mode 100644 index 0000000..de32266 --- /dev/null +++ b/tunestats/app/api/node_modules/brace-expansion/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2013 Julian Gruber + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/tunestats/app/api/node_modules/brace-expansion/README.md b/tunestats/app/api/node_modules/brace-expansion/README.md new file mode 100644 index 0000000..6b4e0e1 --- /dev/null +++ b/tunestats/app/api/node_modules/brace-expansion/README.md @@ -0,0 +1,129 @@ +# brace-expansion + +[Brace expansion](https://www.gnu.org/software/bash/manual/html_node/Brace-Expansion.html), +as known from sh/bash, in JavaScript. + +[![build status](https://secure.travis-ci.org/juliangruber/brace-expansion.svg)](http://travis-ci.org/juliangruber/brace-expansion) +[![downloads](https://img.shields.io/npm/dm/brace-expansion.svg)](https://www.npmjs.org/package/brace-expansion) +[![Greenkeeper badge](https://badges.greenkeeper.io/juliangruber/brace-expansion.svg)](https://greenkeeper.io/) + +[![testling badge](https://ci.testling.com/juliangruber/brace-expansion.png)](https://ci.testling.com/juliangruber/brace-expansion) + +## Example + +```js +var expand = require('brace-expansion'); + +expand('file-{a,b,c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('-v{,,}') +// => ['-v', '-v', '-v'] + +expand('file{0..2}.jpg') +// => ['file0.jpg', 'file1.jpg', 'file2.jpg'] + +expand('file-{a..c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('file{2..0}.jpg') +// => ['file2.jpg', 'file1.jpg', 'file0.jpg'] + +expand('file{0..4..2}.jpg') +// => ['file0.jpg', 'file2.jpg', 'file4.jpg'] + +expand('file-{a..e..2}.jpg') +// => ['file-a.jpg', 'file-c.jpg', 'file-e.jpg'] + +expand('file{00..10..5}.jpg') +// => ['file00.jpg', 'file05.jpg', 'file10.jpg'] + +expand('{{A..C},{a..c}}') +// => ['A', 'B', 'C', 'a', 'b', 'c'] + +expand('ppp{,config,oe{,conf}}') +// => ['ppp', 'pppconfig', 'pppoe', 'pppoeconf'] +``` + +## API + +```js +var expand = require('brace-expansion'); +``` + +### var expanded = expand(str) + +Return an array of all possible and valid expansions of `str`. If none are +found, `[str]` is returned. + +Valid expansions are: + +```js +/^(.*,)+(.+)?$/ +// {a,b,...} +``` + +A comma separated list of options, like `{a,b}` or `{a,{b,c}}` or `{,a,}`. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +A numeric sequence from `x` to `y` inclusive, with optional increment. +If `x` or `y` start with a leading `0`, all the numbers will be padded +to have equal length. Negative numbers and backwards iteration work too. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +An alphabetic sequence from `x` to `y` inclusive, with optional increment. +`x` and `y` must be exactly one character, and if given, `incr` must be a +number. + +For compatibility reasons, the string `${` is not eligible for brace expansion. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install brace-expansion +``` + +## Contributors + +- [Julian Gruber](https://github.com/juliangruber) +- [Isaac Z. Schlueter](https://github.com/isaacs) + +## Sponsors + +This module is proudly supported by my [Sponsors](https://github.com/juliangruber/sponsors)! + +Do you want to support modules like this to improve their quality, stability and weigh in on new features? Then please consider donating to my [Patreon](https://www.patreon.com/juliangruber). Not sure how much of my modules you're using? Try [feross/thanks](https://github.com/feross/thanks)! + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/tunestats/app/api/node_modules/brace-expansion/index.js b/tunestats/app/api/node_modules/brace-expansion/index.js new file mode 100644 index 0000000..0478be8 --- /dev/null +++ b/tunestats/app/api/node_modules/brace-expansion/index.js @@ -0,0 +1,201 @@ +var concatMap = require('concat-map'); +var balanced = require('balanced-match'); + +module.exports = expandTop; + +var escSlash = '\0SLASH'+Math.random()+'\0'; +var escOpen = '\0OPEN'+Math.random()+'\0'; +var escClose = '\0CLOSE'+Math.random()+'\0'; +var escComma = '\0COMMA'+Math.random()+'\0'; +var escPeriod = '\0PERIOD'+Math.random()+'\0'; + +function numeric(str) { + return parseInt(str, 10) == str + ? parseInt(str, 10) + : str.charCodeAt(0); +} + +function escapeBraces(str) { + return str.split('\\\\').join(escSlash) + .split('\\{').join(escOpen) + .split('\\}').join(escClose) + .split('\\,').join(escComma) + .split('\\.').join(escPeriod); +} + +function unescapeBraces(str) { + return str.split(escSlash).join('\\') + .split(escOpen).join('{') + .split(escClose).join('}') + .split(escComma).join(',') + .split(escPeriod).join('.'); +} + + +// Basically just str.split(","), but handling cases +// where we have nested braced sections, which should be +// treated as individual members, like {a,{b,c},d} +function parseCommaParts(str) { + if (!str) + return ['']; + + var parts = []; + var m = balanced('{', '}', str); + + if (!m) + return str.split(','); + + var pre = m.pre; + var body = m.body; + var post = m.post; + var p = pre.split(','); + + p[p.length-1] += '{' + body + '}'; + var postParts = parseCommaParts(post); + if (post.length) { + p[p.length-1] += postParts.shift(); + p.push.apply(p, postParts); + } + + parts.push.apply(parts, p); + + return parts; +} + +function expandTop(str) { + if (!str) + return []; + + // I don't know why Bash 4.3 does this, but it does. + // Anything starting with {} will have the first two bytes preserved + // but *only* at the top level, so {},a}b will not expand to anything, + // but a{},b}c will be expanded to [a}c,abc]. + // One could argue that this is a bug in Bash, but since the goal of + // this module is to match Bash's rules, we escape a leading {} + if (str.substr(0, 2) === '{}') { + str = '\\{\\}' + str.substr(2); + } + + return expand(escapeBraces(str), true).map(unescapeBraces); +} + +function identity(e) { + return e; +} + +function embrace(str) { + return '{' + str + '}'; +} +function isPadded(el) { + return /^-?0\d/.test(el); +} + +function lte(i, y) { + return i <= y; +} +function gte(i, y) { + return i >= y; +} + +function expand(str, isTop) { + var expansions = []; + + var m = balanced('{', '}', str); + if (!m || /\$$/.test(m.pre)) return [str]; + + var isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body); + var isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body); + var isSequence = isNumericSequence || isAlphaSequence; + var isOptions = m.body.indexOf(',') >= 0; + if (!isSequence && !isOptions) { + // {a},b} + if (m.post.match(/,.*\}/)) { + str = m.pre + '{' + m.body + escClose + m.post; + return expand(str); + } + return [str]; + } + + var n; + if (isSequence) { + n = m.body.split(/\.\./); + } else { + n = parseCommaParts(m.body); + if (n.length === 1) { + // x{{a,b}}y ==> x{a}y x{b}y + n = expand(n[0], false).map(embrace); + if (n.length === 1) { + var post = m.post.length + ? expand(m.post, false) + : ['']; + return post.map(function(p) { + return m.pre + n[0] + p; + }); + } + } + } + + // at this point, n is the parts, and we know it's not a comma set + // with a single entry. + + // no need to expand pre, since it is guaranteed to be free of brace-sets + var pre = m.pre; + var post = m.post.length + ? expand(m.post, false) + : ['']; + + var N; + + if (isSequence) { + var x = numeric(n[0]); + var y = numeric(n[1]); + var width = Math.max(n[0].length, n[1].length) + var incr = n.length == 3 + ? Math.abs(numeric(n[2])) + : 1; + var test = lte; + var reverse = y < x; + if (reverse) { + incr *= -1; + test = gte; + } + var pad = n.some(isPadded); + + N = []; + + for (var i = x; test(i, y); i += incr) { + var c; + if (isAlphaSequence) { + c = String.fromCharCode(i); + if (c === '\\') + c = ''; + } else { + c = String(i); + if (pad) { + var need = width - c.length; + if (need > 0) { + var z = new Array(need + 1).join('0'); + if (i < 0) + c = '-' + z + c.slice(1); + else + c = z + c; + } + } + } + N.push(c); + } + } else { + N = concatMap(n, function(el) { return expand(el, false) }); + } + + for (var j = 0; j < N.length; j++) { + for (var k = 0; k < post.length; k++) { + var expansion = pre + N[j] + post[k]; + if (!isTop || isSequence || expansion) + expansions.push(expansion); + } + } + + return expansions; +} + diff --git a/tunestats/app/api/node_modules/brace-expansion/package.json b/tunestats/app/api/node_modules/brace-expansion/package.json new file mode 100644 index 0000000..a18faa8 --- /dev/null +++ b/tunestats/app/api/node_modules/brace-expansion/package.json @@ -0,0 +1,47 @@ +{ + "name": "brace-expansion", + "description": "Brace expansion as known from sh/bash", + "version": "1.1.11", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/brace-expansion.git" + }, + "homepage": "https://github.com/juliangruber/brace-expansion", + "main": "index.js", + "scripts": { + "test": "tape test/*.js", + "gentest": "bash test/generate.sh", + "bench": "matcha test/perf/bench.js" + }, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + }, + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "keywords": [], + "author": { + "name": "Julian Gruber", + "email": "mail@juliangruber.com", + "url": "http://juliangruber.com" + }, + "license": "MIT", + "testling": { + "files": "test/*.js", + "browsers": [ + "ie/8..latest", + "firefox/20..latest", + "firefox/nightly", + "chrome/25..latest", + "chrome/canary", + "opera/12..latest", + "opera/next", + "safari/5.1..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "android-browser/4.2..latest" + ] + } +} diff --git a/tunestats/app/api/node_modules/braces/LICENSE b/tunestats/app/api/node_modules/braces/LICENSE new file mode 100644 index 0000000..9af4a67 --- /dev/null +++ b/tunestats/app/api/node_modules/braces/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014-present, Jon Schlinkert. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/braces/README.md b/tunestats/app/api/node_modules/braces/README.md new file mode 100644 index 0000000..f59dd60 --- /dev/null +++ b/tunestats/app/api/node_modules/braces/README.md @@ -0,0 +1,586 @@ +# braces [![Donate](https://img.shields.io/badge/Donate-PayPal-green.svg)](https://www.paypal.com/cgi-bin/webscr?cmd=_s-xclick&hosted_button_id=W8YFZ425KND68) [![NPM version](https://img.shields.io/npm/v/braces.svg?style=flat)](https://www.npmjs.com/package/braces) [![NPM monthly downloads](https://img.shields.io/npm/dm/braces.svg?style=flat)](https://npmjs.org/package/braces) [![NPM total downloads](https://img.shields.io/npm/dt/braces.svg?style=flat)](https://npmjs.org/package/braces) [![Linux Build Status](https://img.shields.io/travis/micromatch/braces.svg?style=flat&label=Travis)](https://travis-ci.org/micromatch/braces) + +> Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed. + +Please consider following this project's author, [Jon Schlinkert](https://github.com/jonschlinkert), and consider starring the project to show your :heart: and support. + +## Install + +Install with [npm](https://www.npmjs.com/): + +```sh +$ npm install --save braces +``` + +## v3.0.0 Released!! + +See the [changelog](CHANGELOG.md) for details. + +## Why use braces? + +Brace patterns make globs more powerful by adding the ability to match specific ranges and sequences of characters. + +- **Accurate** - complete support for the [Bash 4.3 Brace Expansion](www.gnu.org/software/bash/) specification (passes all of the Bash braces tests) +- **[fast and performant](#benchmarks)** - Starts fast, runs fast and [scales well](#performance) as patterns increase in complexity. +- **Organized code base** - The parser and compiler are easy to maintain and update when edge cases crop up. +- **Well-tested** - Thousands of test assertions, and passes all of the Bash, minimatch, and [brace-expansion](https://github.com/juliangruber/brace-expansion) unit tests (as of the date this was written). +- **Safer** - You shouldn't have to worry about users defining aggressive or malicious brace patterns that can break your application. Braces takes measures to prevent malicious regex that can be used for DDoS attacks (see [catastrophic backtracking](https://www.regular-expressions.info/catastrophic.html)). +- [Supports lists](#lists) - (aka "sets") `a/{b,c}/d` => `['a/b/d', 'a/c/d']` +- [Supports sequences](#sequences) - (aka "ranges") `{01..03}` => `['01', '02', '03']` +- [Supports steps](#steps) - (aka "increments") `{2..10..2}` => `['2', '4', '6', '8', '10']` +- [Supports escaping](#escaping) - To prevent evaluation of special characters. + +## Usage + +The main export is a function that takes one or more brace `patterns` and `options`. + +```js +const braces = require('braces'); +// braces(patterns[, options]); + +console.log(braces(['{01..05}', '{a..e}'])); +//=> ['(0[1-5])', '([a-e])'] + +console.log(braces(['{01..05}', '{a..e}'], { expand: true })); +//=> ['01', '02', '03', '04', '05', 'a', 'b', 'c', 'd', 'e'] +``` + +### Brace Expansion vs. Compilation + +By default, brace patterns are compiled into strings that are optimized for creating regular expressions and matching. + +**Compiled** + +```js +console.log(braces('a/{x,y,z}/b')); +//=> ['a/(x|y|z)/b'] +console.log(braces(['a/{01..20}/b', 'a/{1..5}/b'])); +//=> [ 'a/(0[1-9]|1[0-9]|20)/b', 'a/([1-5])/b' ] +``` + +**Expanded** + +Enable brace expansion by setting the `expand` option to true, or by using [braces.expand()](#expand) (returns an array similar to what you'd expect from Bash, or `echo {1..5}`, or [minimatch](https://github.com/isaacs/minimatch)): + +```js +console.log(braces('a/{x,y,z}/b', { expand: true })); +//=> ['a/x/b', 'a/y/b', 'a/z/b'] + +console.log(braces.expand('{01..10}')); +//=> ['01','02','03','04','05','06','07','08','09','10'] +``` + +### Lists + +Expand lists (like Bash "sets"): + +```js +console.log(braces('a/{foo,bar,baz}/*.js')); +//=> ['a/(foo|bar|baz)/*.js'] + +console.log(braces.expand('a/{foo,bar,baz}/*.js')); +//=> ['a/foo/*.js', 'a/bar/*.js', 'a/baz/*.js'] +``` + +### Sequences + +Expand ranges of characters (like Bash "sequences"): + +```js +console.log(braces.expand('{1..3}')); // ['1', '2', '3'] +console.log(braces.expand('a/{1..3}/b')); // ['a/1/b', 'a/2/b', 'a/3/b'] +console.log(braces('{a..c}', { expand: true })); // ['a', 'b', 'c'] +console.log(braces('foo/{a..c}', { expand: true })); // ['foo/a', 'foo/b', 'foo/c'] + +// supports zero-padded ranges +console.log(braces('a/{01..03}/b')); //=> ['a/(0[1-3])/b'] +console.log(braces('a/{001..300}/b')); //=> ['a/(0{2}[1-9]|0[1-9][0-9]|[12][0-9]{2}|300)/b'] +``` + +See [fill-range](https://github.com/jonschlinkert/fill-range) for all available range-expansion options. + +### Steppped ranges + +Steps, or increments, may be used with ranges: + +```js +console.log(braces.expand('{2..10..2}')); +//=> ['2', '4', '6', '8', '10'] + +console.log(braces('{2..10..2}')); +//=> ['(2|4|6|8|10)'] +``` + +When the [.optimize](#optimize) method is used, or [options.optimize](#optionsoptimize) is set to true, sequences are passed to [to-regex-range](https://github.com/jonschlinkert/to-regex-range) for expansion. + +### Nesting + +Brace patterns may be nested. The results of each expanded string are not sorted, and left to right order is preserved. + +**"Expanded" braces** + +```js +console.log(braces.expand('a{b,c,/{x,y}}/e')); +//=> ['ab/e', 'ac/e', 'a/x/e', 'a/y/e'] + +console.log(braces.expand('a/{x,{1..5},y}/c')); +//=> ['a/x/c', 'a/1/c', 'a/2/c', 'a/3/c', 'a/4/c', 'a/5/c', 'a/y/c'] +``` + +**"Optimized" braces** + +```js +console.log(braces('a{b,c,/{x,y}}/e')); +//=> ['a(b|c|/(x|y))/e'] + +console.log(braces('a/{x,{1..5},y}/c')); +//=> ['a/(x|([1-5])|y)/c'] +``` + +### Escaping + +**Escaping braces** + +A brace pattern will not be expanded or evaluted if _either the opening or closing brace is escaped_: + +```js +console.log(braces.expand('a\\{d,c,b}e')); +//=> ['a{d,c,b}e'] + +console.log(braces.expand('a{d,c,b\\}e')); +//=> ['a{d,c,b}e'] +``` + +**Escaping commas** + +Commas inside braces may also be escaped: + +```js +console.log(braces.expand('a{b\\,c}d')); +//=> ['a{b,c}d'] + +console.log(braces.expand('a{d\\,c,b}e')); +//=> ['ad,ce', 'abe'] +``` + +**Single items** + +Following bash conventions, a brace pattern is also not expanded when it contains a single character: + +```js +console.log(braces.expand('a{b}c')); +//=> ['a{b}c'] +``` + +## Options + +### options.maxLength + +**Type**: `Number` + +**Default**: `10,000` + +**Description**: Limit the length of the input string. Useful when the input string is generated or your application allows users to pass a string, et cetera. + +```js +console.log(braces('a/{b,c}/d', { maxLength: 3 })); //=> throws an error +``` + +### options.expand + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Generate an "expanded" brace pattern (alternatively you can use the `braces.expand()` method, which does the same thing). + +```js +console.log(braces('a/{b,c}/d', { expand: true })); +//=> [ 'a/b/d', 'a/c/d' ] +``` + +### options.nodupes + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Remove duplicates from the returned array. + +### options.rangeLimit + +**Type**: `Number` + +**Default**: `1000` + +**Description**: To prevent malicious patterns from being passed by users, an error is thrown when `braces.expand()` is used or `options.expand` is true and the generated range will exceed the `rangeLimit`. + +You can customize `options.rangeLimit` or set it to `Inifinity` to disable this altogether. + +**Examples** + +```js +// pattern exceeds the "rangeLimit", so it's optimized automatically +console.log(braces.expand('{1..1000}')); +//=> ['([1-9]|[1-9][0-9]{1,2}|1000)'] + +// pattern does not exceed "rangeLimit", so it's NOT optimized +console.log(braces.expand('{1..100}')); +//=> ['1', '2', '3', '4', '5', '6', '7', '8', '9', '10', '11', '12', '13', '14', '15', '16', '17', '18', '19', '20', '21', '22', '23', '24', '25', '26', '27', '28', '29', '30', '31', '32', '33', '34', '35', '36', '37', '38', '39', '40', '41', '42', '43', '44', '45', '46', '47', '48', '49', '50', '51', '52', '53', '54', '55', '56', '57', '58', '59', '60', '61', '62', '63', '64', '65', '66', '67', '68', '69', '70', '71', '72', '73', '74', '75', '76', '77', '78', '79', '80', '81', '82', '83', '84', '85', '86', '87', '88', '89', '90', '91', '92', '93', '94', '95', '96', '97', '98', '99', '100'] +``` + +### options.transform + +**Type**: `Function` + +**Default**: `undefined` + +**Description**: Customize range expansion. + +**Example: Transforming non-numeric values** + +```js +const alpha = braces.expand('x/{a..e}/y', { + transform(value, index) { + // When non-numeric values are passed, "value" is a character code. + return 'foo/' + String.fromCharCode(value) + '-' + index; + }, +}); +console.log(alpha); +//=> [ 'x/foo/a-0/y', 'x/foo/b-1/y', 'x/foo/c-2/y', 'x/foo/d-3/y', 'x/foo/e-4/y' ] +``` + +**Example: Transforming numeric values** + +```js +const numeric = braces.expand('{1..5}', { + transform(value) { + // when numeric values are passed, "value" is a number + return 'foo/' + value * 2; + }, +}); +console.log(numeric); +//=> [ 'foo/2', 'foo/4', 'foo/6', 'foo/8', 'foo/10' ] +``` + +### options.quantifiers + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: In regular expressions, quanitifiers can be used to specify how many times a token can be repeated. For example, `a{1,3}` will match the letter `a` one to three times. + +Unfortunately, regex quantifiers happen to share the same syntax as [Bash lists](#lists) + +The `quantifiers` option tells braces to detect when [regex quantifiers](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/RegExp#quantifiers) are defined in the given pattern, and not to try to expand them as lists. + +**Examples** + +```js +const braces = require('braces'); +console.log(braces('a/b{1,3}/{x,y,z}')); +//=> [ 'a/b(1|3)/(x|y|z)' ] +console.log(braces('a/b{1,3}/{x,y,z}', { quantifiers: true })); +//=> [ 'a/b{1,3}/(x|y|z)' ] +console.log(braces('a/b{1,3}/{x,y,z}', { quantifiers: true, expand: true })); +//=> [ 'a/b{1,3}/x', 'a/b{1,3}/y', 'a/b{1,3}/z' ] +``` + +### options.keepEscaping + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Do not strip backslashes that were used for escaping from the result. + +## What is "brace expansion"? + +Brace expansion is a type of parameter expansion that was made popular by unix shells for generating lists of strings, as well as regex-like matching when used alongside wildcards (globs). + +In addition to "expansion", braces are also used for matching. In other words: + +- [brace expansion](#brace-expansion) is for generating new lists +- [brace matching](#brace-matching) is for filtering existing lists + +
+More about brace expansion (click to expand) + +There are two main types of brace expansion: + +1. **lists**: which are defined using comma-separated values inside curly braces: `{a,b,c}` +2. **sequences**: which are defined using a starting value and an ending value, separated by two dots: `a{1..3}b`. Optionally, a third argument may be passed to define a "step" or increment to use: `a{1..100..10}b`. These are also sometimes referred to as "ranges". + +Here are some example brace patterns to illustrate how they work: + +**Sets** + +``` +{a,b,c} => a b c +{a,b,c}{1,2} => a1 a2 b1 b2 c1 c2 +``` + +**Sequences** + +``` +{1..9} => 1 2 3 4 5 6 7 8 9 +{4..-4} => 4 3 2 1 0 -1 -2 -3 -4 +{1..20..3} => 1 4 7 10 13 16 19 +{a..j} => a b c d e f g h i j +{j..a} => j i h g f e d c b a +{a..z..3} => a d g j m p s v y +``` + +**Combination** + +Sets and sequences can be mixed together or used along with any other strings. + +``` +{a,b,c}{1..3} => a1 a2 a3 b1 b2 b3 c1 c2 c3 +foo/{a,b,c}/bar => foo/a/bar foo/b/bar foo/c/bar +``` + +The fact that braces can be "expanded" from relatively simple patterns makes them ideal for quickly generating test fixtures, file paths, and similar use cases. + +## Brace matching + +In addition to _expansion_, brace patterns are also useful for performing regular-expression-like matching. + +For example, the pattern `foo/{1..3}/bar` would match any of following strings: + +``` +foo/1/bar +foo/2/bar +foo/3/bar +``` + +But not: + +``` +baz/1/qux +baz/2/qux +baz/3/qux +``` + +Braces can also be combined with [glob patterns](https://github.com/jonschlinkert/micromatch) to perform more advanced wildcard matching. For example, the pattern `*/{1..3}/*` would match any of following strings: + +``` +foo/1/bar +foo/2/bar +foo/3/bar +baz/1/qux +baz/2/qux +baz/3/qux +``` + +## Brace matching pitfalls + +Although brace patterns offer a user-friendly way of matching ranges or sets of strings, there are also some major disadvantages and potential risks you should be aware of. + +### tldr + +**"brace bombs"** + +- brace expansion can eat up a huge amount of processing resources +- as brace patterns increase _linearly in size_, the system resources required to expand the pattern increase exponentially +- users can accidentally (or intentially) exhaust your system's resources resulting in the equivalent of a DoS attack (bonus: no programming knowledge is required!) + +For a more detailed explanation with examples, see the [geometric complexity](#geometric-complexity) section. + +### The solution + +Jump to the [performance section](#performance) to see how Braces solves this problem in comparison to other libraries. + +### Geometric complexity + +At minimum, brace patterns with sets limited to two elements have quadradic or `O(n^2)` complexity. But the complexity of the algorithm increases exponentially as the number of sets, _and elements per set_, increases, which is `O(n^c)`. + +For example, the following sets demonstrate quadratic (`O(n^2)`) complexity: + +``` +{1,2}{3,4} => (2X2) => 13 14 23 24 +{1,2}{3,4}{5,6} => (2X2X2) => 135 136 145 146 235 236 245 246 +``` + +But add an element to a set, and we get a n-fold Cartesian product with `O(n^c)` complexity: + +``` +{1,2,3}{4,5,6}{7,8,9} => (3X3X3) => 147 148 149 157 158 159 167 168 169 247 248 + 249 257 258 259 267 268 269 347 348 349 357 + 358 359 367 368 369 +``` + +Now, imagine how this complexity grows given that each element is a n-tuple: + +``` +{1..100}{1..100} => (100X100) => 10,000 elements (38.4 kB) +{1..100}{1..100}{1..100} => (100X100X100) => 1,000,000 elements (5.76 MB) +``` + +Although these examples are clearly contrived, they demonstrate how brace patterns can quickly grow out of control. + +**More information** + +Interested in learning more about brace expansion? + +- [linuxjournal/bash-brace-expansion](http://www.linuxjournal.com/content/bash-brace-expansion) +- [rosettacode/Brace_expansion](https://rosettacode.org/wiki/Brace_expansion) +- [cartesian product](https://en.wikipedia.org/wiki/Cartesian_product) + +
+ +## Performance + +Braces is not only screaming fast, it's also more accurate the other brace expansion libraries. + +### Better algorithms + +Fortunately there is a solution to the ["brace bomb" problem](#brace-matching-pitfalls): _don't expand brace patterns into an array when they're used for matching_. + +Instead, convert the pattern into an optimized regular expression. This is easier said than done, and braces is the only library that does this currently. + +**The proof is in the numbers** + +Minimatch gets exponentially slower as patterns increase in complexity, braces does not. The following results were generated using `braces()` and `minimatch.braceExpand()`, respectively. + +| **Pattern** | **braces** | **[minimatch][]** | +| --------------------------- | ------------------- | ---------------------------- | +| `{1..9007199254740991}`[^1] | `298 B` (5ms 459μs) | N/A (freezes) | +| `{1..1000000000000000}` | `41 B` (1ms 15μs) | N/A (freezes) | +| `{1..100000000000000}` | `40 B` (890μs) | N/A (freezes) | +| `{1..10000000000000}` | `39 B` (2ms 49μs) | N/A (freezes) | +| `{1..1000000000000}` | `38 B` (608μs) | N/A (freezes) | +| `{1..100000000000}` | `37 B` (397μs) | N/A (freezes) | +| `{1..10000000000}` | `35 B` (983μs) | N/A (freezes) | +| `{1..1000000000}` | `34 B` (798μs) | N/A (freezes) | +| `{1..100000000}` | `33 B` (733μs) | N/A (freezes) | +| `{1..10000000}` | `32 B` (5ms 632μs) | `78.89 MB` (16s 388ms 569μs) | +| `{1..1000000}` | `31 B` (1ms 381μs) | `6.89 MB` (1s 496ms 887μs) | +| `{1..100000}` | `30 B` (950μs) | `588.89 kB` (146ms 921μs) | +| `{1..10000}` | `29 B` (1ms 114μs) | `48.89 kB` (14ms 187μs) | +| `{1..1000}` | `28 B` (760μs) | `3.89 kB` (1ms 453μs) | +| `{1..100}` | `22 B` (345μs) | `291 B` (196μs) | +| `{1..10}` | `10 B` (533μs) | `20 B` (37μs) | +| `{1..3}` | `7 B` (190μs) | `5 B` (27μs) | + +### Faster algorithms + +When you need expansion, braces is still much faster. + +_(the following results were generated using `braces.expand()` and `minimatch.braceExpand()`, respectively)_ + +| **Pattern** | **braces** | **[minimatch][]** | +| --------------- | --------------------------- | ---------------------------- | +| `{1..10000000}` | `78.89 MB` (2s 698ms 642μs) | `78.89 MB` (18s 601ms 974μs) | +| `{1..1000000}` | `6.89 MB` (458ms 576μs) | `6.89 MB` (1s 491ms 621μs) | +| `{1..100000}` | `588.89 kB` (20ms 728μs) | `588.89 kB` (156ms 919μs) | +| `{1..10000}` | `48.89 kB` (2ms 202μs) | `48.89 kB` (13ms 641μs) | +| `{1..1000}` | `3.89 kB` (1ms 796μs) | `3.89 kB` (1ms 958μs) | +| `{1..100}` | `291 B` (424μs) | `291 B` (211μs) | +| `{1..10}` | `20 B` (487μs) | `20 B` (72μs) | +| `{1..3}` | `5 B` (166μs) | `5 B` (27μs) | + +If you'd like to run these comparisons yourself, see [test/support/generate.js](test/support/generate.js). + +## Benchmarks + +### Running benchmarks + +Install dev dependencies: + +```bash +npm i -d && npm benchmark +``` + +### Latest results + +Braces is more accurate, without sacrificing performance. + +```bash +● expand - range (expanded) + braces x 53,167 ops/sec ±0.12% (102 runs sampled) + minimatch x 11,378 ops/sec ±0.10% (102 runs sampled) +● expand - range (optimized for regex) + braces x 373,442 ops/sec ±0.04% (100 runs sampled) + minimatch x 3,262 ops/sec ±0.18% (100 runs sampled) +● expand - nested ranges (expanded) + braces x 33,921 ops/sec ±0.09% (99 runs sampled) + minimatch x 10,855 ops/sec ±0.28% (100 runs sampled) +● expand - nested ranges (optimized for regex) + braces x 287,479 ops/sec ±0.52% (98 runs sampled) + minimatch x 3,219 ops/sec ±0.28% (101 runs sampled) +● expand - set (expanded) + braces x 238,243 ops/sec ±0.19% (97 runs sampled) + minimatch x 538,268 ops/sec ±0.31% (96 runs sampled) +● expand - set (optimized for regex) + braces x 321,844 ops/sec ±0.10% (97 runs sampled) + minimatch x 140,600 ops/sec ±0.15% (100 runs sampled) +● expand - nested sets (expanded) + braces x 165,371 ops/sec ±0.42% (96 runs sampled) + minimatch x 337,720 ops/sec ±0.28% (100 runs sampled) +● expand - nested sets (optimized for regex) + braces x 242,948 ops/sec ±0.12% (99 runs sampled) + minimatch x 87,403 ops/sec ±0.79% (96 runs sampled) +``` + +## About + +
+Contributing + +Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new). + +
+ +
+Running Tests + +Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command: + +```sh +$ npm install && npm test +``` + +
+ +
+Building docs + +_(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_ + +To generate the readme, run the following command: + +```sh +$ npm install -g verbose/verb#dev verb-generate-readme && verb +``` + +
+ +### Contributors + +| **Commits** | **Contributor** | +| ----------- | ------------------------------------------------------------- | +| 197 | [jonschlinkert](https://github.com/jonschlinkert) | +| 4 | [doowb](https://github.com/doowb) | +| 1 | [es128](https://github.com/es128) | +| 1 | [eush77](https://github.com/eush77) | +| 1 | [hemanth](https://github.com/hemanth) | +| 1 | [wtgtybhertgeghgtwtg](https://github.com/wtgtybhertgeghgtwtg) | + +### Author + +**Jon Schlinkert** + +- [GitHub Profile](https://github.com/jonschlinkert) +- [Twitter Profile](https://twitter.com/jonschlinkert) +- [LinkedIn Profile](https://linkedin.com/in/jonschlinkert) + +### License + +Copyright © 2019, [Jon Schlinkert](https://github.com/jonschlinkert). +Released under the [MIT License](LICENSE). + +--- + +_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.8.0, on April 08, 2019._ diff --git a/tunestats/app/api/node_modules/braces/index.js b/tunestats/app/api/node_modules/braces/index.js new file mode 100644 index 0000000..d222c13 --- /dev/null +++ b/tunestats/app/api/node_modules/braces/index.js @@ -0,0 +1,170 @@ +'use strict'; + +const stringify = require('./lib/stringify'); +const compile = require('./lib/compile'); +const expand = require('./lib/expand'); +const parse = require('./lib/parse'); + +/** + * Expand the given pattern or create a regex-compatible string. + * + * ```js + * const braces = require('braces'); + * console.log(braces('{a,b,c}', { compile: true })); //=> ['(a|b|c)'] + * console.log(braces('{a,b,c}')); //=> ['a', 'b', 'c'] + * ``` + * @param {String} `str` + * @param {Object} `options` + * @return {String} + * @api public + */ + +const braces = (input, options = {}) => { + let output = []; + + if (Array.isArray(input)) { + for (const pattern of input) { + const result = braces.create(pattern, options); + if (Array.isArray(result)) { + output.push(...result); + } else { + output.push(result); + } + } + } else { + output = [].concat(braces.create(input, options)); + } + + if (options && options.expand === true && options.nodupes === true) { + output = [...new Set(output)]; + } + return output; +}; + +/** + * Parse the given `str` with the given `options`. + * + * ```js + * // braces.parse(pattern, [, options]); + * const ast = braces.parse('a/{b,c}/d'); + * console.log(ast); + * ``` + * @param {String} pattern Brace pattern to parse + * @param {Object} options + * @return {Object} Returns an AST + * @api public + */ + +braces.parse = (input, options = {}) => parse(input, options); + +/** + * Creates a braces string from an AST, or an AST node. + * + * ```js + * const braces = require('braces'); + * let ast = braces.parse('foo/{a,b}/bar'); + * console.log(stringify(ast.nodes[2])); //=> '{a,b}' + * ``` + * @param {String} `input` Brace pattern or AST. + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.stringify = (input, options = {}) => { + if (typeof input === 'string') { + return stringify(braces.parse(input, options), options); + } + return stringify(input, options); +}; + +/** + * Compiles a brace pattern into a regex-compatible, optimized string. + * This method is called by the main [braces](#braces) function by default. + * + * ```js + * const braces = require('braces'); + * console.log(braces.compile('a/{b,c}/d')); + * //=> ['a/(b|c)/d'] + * ``` + * @param {String} `input` Brace pattern or AST. + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.compile = (input, options = {}) => { + if (typeof input === 'string') { + input = braces.parse(input, options); + } + return compile(input, options); +}; + +/** + * Expands a brace pattern into an array. This method is called by the + * main [braces](#braces) function when `options.expand` is true. Before + * using this method it's recommended that you read the [performance notes](#performance)) + * and advantages of using [.compile](#compile) instead. + * + * ```js + * const braces = require('braces'); + * console.log(braces.expand('a/{b,c}/d')); + * //=> ['a/b/d', 'a/c/d']; + * ``` + * @param {String} `pattern` Brace pattern + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.expand = (input, options = {}) => { + if (typeof input === 'string') { + input = braces.parse(input, options); + } + + let result = expand(input, options); + + // filter out empty strings if specified + if (options.noempty === true) { + result = result.filter(Boolean); + } + + // filter out duplicates if specified + if (options.nodupes === true) { + result = [...new Set(result)]; + } + + return result; +}; + +/** + * Processes a brace pattern and returns either an expanded array + * (if `options.expand` is true), a highly optimized regex-compatible string. + * This method is called by the main [braces](#braces) function. + * + * ```js + * const braces = require('braces'); + * console.log(braces.create('user-{200..300}/project-{a,b,c}-{1..10}')) + * //=> 'user-(20[0-9]|2[1-9][0-9]|300)/project-(a|b|c)-([1-9]|10)' + * ``` + * @param {String} `pattern` Brace pattern + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.create = (input, options = {}) => { + if (input === '' || input.length < 3) { + return [input]; + } + + return options.expand !== true + ? braces.compile(input, options) + : braces.expand(input, options); +}; + +/** + * Expose "braces" + */ + +module.exports = braces; diff --git a/tunestats/app/api/node_modules/braces/lib/compile.js b/tunestats/app/api/node_modules/braces/lib/compile.js new file mode 100644 index 0000000..dce69be --- /dev/null +++ b/tunestats/app/api/node_modules/braces/lib/compile.js @@ -0,0 +1,60 @@ +'use strict'; + +const fill = require('fill-range'); +const utils = require('./utils'); + +const compile = (ast, options = {}) => { + const walk = (node, parent = {}) => { + const invalidBlock = utils.isInvalidBrace(parent); + const invalidNode = node.invalid === true && options.escapeInvalid === true; + const invalid = invalidBlock === true || invalidNode === true; + const prefix = options.escapeInvalid === true ? '\\' : ''; + let output = ''; + + if (node.isOpen === true) { + return prefix + node.value; + } + + if (node.isClose === true) { + console.log('node.isClose', prefix, node.value); + return prefix + node.value; + } + + if (node.type === 'open') { + return invalid ? prefix + node.value : '('; + } + + if (node.type === 'close') { + return invalid ? prefix + node.value : ')'; + } + + if (node.type === 'comma') { + return node.prev.type === 'comma' ? '' : invalid ? node.value : '|'; + } + + if (node.value) { + return node.value; + } + + if (node.nodes && node.ranges > 0) { + const args = utils.reduce(node.nodes); + const range = fill(...args, { ...options, wrap: false, toRegex: true, strictZeros: true }); + + if (range.length !== 0) { + return args.length > 1 && range.length > 1 ? `(${range})` : range; + } + } + + if (node.nodes) { + for (const child of node.nodes) { + output += walk(child, node); + } + } + + return output; + }; + + return walk(ast); +}; + +module.exports = compile; diff --git a/tunestats/app/api/node_modules/braces/lib/constants.js b/tunestats/app/api/node_modules/braces/lib/constants.js new file mode 100644 index 0000000..2bb3b88 --- /dev/null +++ b/tunestats/app/api/node_modules/braces/lib/constants.js @@ -0,0 +1,57 @@ +'use strict'; + +module.exports = { + MAX_LENGTH: 10000, + + // Digits + CHAR_0: '0', /* 0 */ + CHAR_9: '9', /* 9 */ + + // Alphabet chars. + CHAR_UPPERCASE_A: 'A', /* A */ + CHAR_LOWERCASE_A: 'a', /* a */ + CHAR_UPPERCASE_Z: 'Z', /* Z */ + CHAR_LOWERCASE_Z: 'z', /* z */ + + CHAR_LEFT_PARENTHESES: '(', /* ( */ + CHAR_RIGHT_PARENTHESES: ')', /* ) */ + + CHAR_ASTERISK: '*', /* * */ + + // Non-alphabetic chars. + CHAR_AMPERSAND: '&', /* & */ + CHAR_AT: '@', /* @ */ + CHAR_BACKSLASH: '\\', /* \ */ + CHAR_BACKTICK: '`', /* ` */ + CHAR_CARRIAGE_RETURN: '\r', /* \r */ + CHAR_CIRCUMFLEX_ACCENT: '^', /* ^ */ + CHAR_COLON: ':', /* : */ + CHAR_COMMA: ',', /* , */ + CHAR_DOLLAR: '$', /* . */ + CHAR_DOT: '.', /* . */ + CHAR_DOUBLE_QUOTE: '"', /* " */ + CHAR_EQUAL: '=', /* = */ + CHAR_EXCLAMATION_MARK: '!', /* ! */ + CHAR_FORM_FEED: '\f', /* \f */ + CHAR_FORWARD_SLASH: '/', /* / */ + CHAR_HASH: '#', /* # */ + CHAR_HYPHEN_MINUS: '-', /* - */ + CHAR_LEFT_ANGLE_BRACKET: '<', /* < */ + CHAR_LEFT_CURLY_BRACE: '{', /* { */ + CHAR_LEFT_SQUARE_BRACKET: '[', /* [ */ + CHAR_LINE_FEED: '\n', /* \n */ + CHAR_NO_BREAK_SPACE: '\u00A0', /* \u00A0 */ + CHAR_PERCENT: '%', /* % */ + CHAR_PLUS: '+', /* + */ + CHAR_QUESTION_MARK: '?', /* ? */ + CHAR_RIGHT_ANGLE_BRACKET: '>', /* > */ + CHAR_RIGHT_CURLY_BRACE: '}', /* } */ + CHAR_RIGHT_SQUARE_BRACKET: ']', /* ] */ + CHAR_SEMICOLON: ';', /* ; */ + CHAR_SINGLE_QUOTE: '\'', /* ' */ + CHAR_SPACE: ' ', /* */ + CHAR_TAB: '\t', /* \t */ + CHAR_UNDERSCORE: '_', /* _ */ + CHAR_VERTICAL_LINE: '|', /* | */ + CHAR_ZERO_WIDTH_NOBREAK_SPACE: '\uFEFF' /* \uFEFF */ +}; diff --git a/tunestats/app/api/node_modules/braces/lib/expand.js b/tunestats/app/api/node_modules/braces/lib/expand.js new file mode 100644 index 0000000..35b2c41 --- /dev/null +++ b/tunestats/app/api/node_modules/braces/lib/expand.js @@ -0,0 +1,113 @@ +'use strict'; + +const fill = require('fill-range'); +const stringify = require('./stringify'); +const utils = require('./utils'); + +const append = (queue = '', stash = '', enclose = false) => { + const result = []; + + queue = [].concat(queue); + stash = [].concat(stash); + + if (!stash.length) return queue; + if (!queue.length) { + return enclose ? utils.flatten(stash).map(ele => `{${ele}}`) : stash; + } + + for (const item of queue) { + if (Array.isArray(item)) { + for (const value of item) { + result.push(append(value, stash, enclose)); + } + } else { + for (let ele of stash) { + if (enclose === true && typeof ele === 'string') ele = `{${ele}}`; + result.push(Array.isArray(ele) ? append(item, ele, enclose) : item + ele); + } + } + } + return utils.flatten(result); +}; + +const expand = (ast, options = {}) => { + const rangeLimit = options.rangeLimit === undefined ? 1000 : options.rangeLimit; + + const walk = (node, parent = {}) => { + node.queue = []; + + let p = parent; + let q = parent.queue; + + while (p.type !== 'brace' && p.type !== 'root' && p.parent) { + p = p.parent; + q = p.queue; + } + + if (node.invalid || node.dollar) { + q.push(append(q.pop(), stringify(node, options))); + return; + } + + if (node.type === 'brace' && node.invalid !== true && node.nodes.length === 2) { + q.push(append(q.pop(), ['{}'])); + return; + } + + if (node.nodes && node.ranges > 0) { + const args = utils.reduce(node.nodes); + + if (utils.exceedsLimit(...args, options.step, rangeLimit)) { + throw new RangeError('expanded array length exceeds range limit. Use options.rangeLimit to increase or disable the limit.'); + } + + let range = fill(...args, options); + if (range.length === 0) { + range = stringify(node, options); + } + + q.push(append(q.pop(), range)); + node.nodes = []; + return; + } + + const enclose = utils.encloseBrace(node); + let queue = node.queue; + let block = node; + + while (block.type !== 'brace' && block.type !== 'root' && block.parent) { + block = block.parent; + queue = block.queue; + } + + for (let i = 0; i < node.nodes.length; i++) { + const child = node.nodes[i]; + + if (child.type === 'comma' && node.type === 'brace') { + if (i === 1) queue.push(''); + queue.push(''); + continue; + } + + if (child.type === 'close') { + q.push(append(q.pop(), queue, enclose)); + continue; + } + + if (child.value && child.type !== 'open') { + queue.push(append(queue.pop(), child.value)); + continue; + } + + if (child.nodes) { + walk(child, node); + } + } + + return queue; + }; + + return utils.flatten(walk(ast)); +}; + +module.exports = expand; diff --git a/tunestats/app/api/node_modules/braces/lib/parse.js b/tunestats/app/api/node_modules/braces/lib/parse.js new file mode 100644 index 0000000..3a6988e --- /dev/null +++ b/tunestats/app/api/node_modules/braces/lib/parse.js @@ -0,0 +1,331 @@ +'use strict'; + +const stringify = require('./stringify'); + +/** + * Constants + */ + +const { + MAX_LENGTH, + CHAR_BACKSLASH, /* \ */ + CHAR_BACKTICK, /* ` */ + CHAR_COMMA, /* , */ + CHAR_DOT, /* . */ + CHAR_LEFT_PARENTHESES, /* ( */ + CHAR_RIGHT_PARENTHESES, /* ) */ + CHAR_LEFT_CURLY_BRACE, /* { */ + CHAR_RIGHT_CURLY_BRACE, /* } */ + CHAR_LEFT_SQUARE_BRACKET, /* [ */ + CHAR_RIGHT_SQUARE_BRACKET, /* ] */ + CHAR_DOUBLE_QUOTE, /* " */ + CHAR_SINGLE_QUOTE, /* ' */ + CHAR_NO_BREAK_SPACE, + CHAR_ZERO_WIDTH_NOBREAK_SPACE +} = require('./constants'); + +/** + * parse + */ + +const parse = (input, options = {}) => { + if (typeof input !== 'string') { + throw new TypeError('Expected a string'); + } + + const opts = options || {}; + const max = typeof opts.maxLength === 'number' ? Math.min(MAX_LENGTH, opts.maxLength) : MAX_LENGTH; + if (input.length > max) { + throw new SyntaxError(`Input length (${input.length}), exceeds max characters (${max})`); + } + + const ast = { type: 'root', input, nodes: [] }; + const stack = [ast]; + let block = ast; + let prev = ast; + let brackets = 0; + const length = input.length; + let index = 0; + let depth = 0; + let value; + + /** + * Helpers + */ + + const advance = () => input[index++]; + const push = node => { + if (node.type === 'text' && prev.type === 'dot') { + prev.type = 'text'; + } + + if (prev && prev.type === 'text' && node.type === 'text') { + prev.value += node.value; + return; + } + + block.nodes.push(node); + node.parent = block; + node.prev = prev; + prev = node; + return node; + }; + + push({ type: 'bos' }); + + while (index < length) { + block = stack[stack.length - 1]; + value = advance(); + + /** + * Invalid chars + */ + + if (value === CHAR_ZERO_WIDTH_NOBREAK_SPACE || value === CHAR_NO_BREAK_SPACE) { + continue; + } + + /** + * Escaped chars + */ + + if (value === CHAR_BACKSLASH) { + push({ type: 'text', value: (options.keepEscaping ? value : '') + advance() }); + continue; + } + + /** + * Right square bracket (literal): ']' + */ + + if (value === CHAR_RIGHT_SQUARE_BRACKET) { + push({ type: 'text', value: '\\' + value }); + continue; + } + + /** + * Left square bracket: '[' + */ + + if (value === CHAR_LEFT_SQUARE_BRACKET) { + brackets++; + + let next; + + while (index < length && (next = advance())) { + value += next; + + if (next === CHAR_LEFT_SQUARE_BRACKET) { + brackets++; + continue; + } + + if (next === CHAR_BACKSLASH) { + value += advance(); + continue; + } + + if (next === CHAR_RIGHT_SQUARE_BRACKET) { + brackets--; + + if (brackets === 0) { + break; + } + } + } + + push({ type: 'text', value }); + continue; + } + + /** + * Parentheses + */ + + if (value === CHAR_LEFT_PARENTHESES) { + block = push({ type: 'paren', nodes: [] }); + stack.push(block); + push({ type: 'text', value }); + continue; + } + + if (value === CHAR_RIGHT_PARENTHESES) { + if (block.type !== 'paren') { + push({ type: 'text', value }); + continue; + } + block = stack.pop(); + push({ type: 'text', value }); + block = stack[stack.length - 1]; + continue; + } + + /** + * Quotes: '|"|` + */ + + if (value === CHAR_DOUBLE_QUOTE || value === CHAR_SINGLE_QUOTE || value === CHAR_BACKTICK) { + const open = value; + let next; + + if (options.keepQuotes !== true) { + value = ''; + } + + while (index < length && (next = advance())) { + if (next === CHAR_BACKSLASH) { + value += next + advance(); + continue; + } + + if (next === open) { + if (options.keepQuotes === true) value += next; + break; + } + + value += next; + } + + push({ type: 'text', value }); + continue; + } + + /** + * Left curly brace: '{' + */ + + if (value === CHAR_LEFT_CURLY_BRACE) { + depth++; + + const dollar = prev.value && prev.value.slice(-1) === '$' || block.dollar === true; + const brace = { + type: 'brace', + open: true, + close: false, + dollar, + depth, + commas: 0, + ranges: 0, + nodes: [] + }; + + block = push(brace); + stack.push(block); + push({ type: 'open', value }); + continue; + } + + /** + * Right curly brace: '}' + */ + + if (value === CHAR_RIGHT_CURLY_BRACE) { + if (block.type !== 'brace') { + push({ type: 'text', value }); + continue; + } + + const type = 'close'; + block = stack.pop(); + block.close = true; + + push({ type, value }); + depth--; + + block = stack[stack.length - 1]; + continue; + } + + /** + * Comma: ',' + */ + + if (value === CHAR_COMMA && depth > 0) { + if (block.ranges > 0) { + block.ranges = 0; + const open = block.nodes.shift(); + block.nodes = [open, { type: 'text', value: stringify(block) }]; + } + + push({ type: 'comma', value }); + block.commas++; + continue; + } + + /** + * Dot: '.' + */ + + if (value === CHAR_DOT && depth > 0 && block.commas === 0) { + const siblings = block.nodes; + + if (depth === 0 || siblings.length === 0) { + push({ type: 'text', value }); + continue; + } + + if (prev.type === 'dot') { + block.range = []; + prev.value += value; + prev.type = 'range'; + + if (block.nodes.length !== 3 && block.nodes.length !== 5) { + block.invalid = true; + block.ranges = 0; + prev.type = 'text'; + continue; + } + + block.ranges++; + block.args = []; + continue; + } + + if (prev.type === 'range') { + siblings.pop(); + + const before = siblings[siblings.length - 1]; + before.value += prev.value + value; + prev = before; + block.ranges--; + continue; + } + + push({ type: 'dot', value }); + continue; + } + + /** + * Text + */ + + push({ type: 'text', value }); + } + + // Mark imbalanced braces and brackets as invalid + do { + block = stack.pop(); + + if (block.type !== 'root') { + block.nodes.forEach(node => { + if (!node.nodes) { + if (node.type === 'open') node.isOpen = true; + if (node.type === 'close') node.isClose = true; + if (!node.nodes) node.type = 'text'; + node.invalid = true; + } + }); + + // get the location of the block on parent.nodes (block's siblings) + const parent = stack[stack.length - 1]; + const index = parent.nodes.indexOf(block); + // replace the (invalid) block with it's nodes + parent.nodes.splice(index, 1, ...block.nodes); + } + } while (stack.length > 0); + + push({ type: 'eos' }); + return ast; +}; + +module.exports = parse; diff --git a/tunestats/app/api/node_modules/braces/lib/stringify.js b/tunestats/app/api/node_modules/braces/lib/stringify.js new file mode 100644 index 0000000..8bcf872 --- /dev/null +++ b/tunestats/app/api/node_modules/braces/lib/stringify.js @@ -0,0 +1,32 @@ +'use strict'; + +const utils = require('./utils'); + +module.exports = (ast, options = {}) => { + const stringify = (node, parent = {}) => { + const invalidBlock = options.escapeInvalid && utils.isInvalidBrace(parent); + const invalidNode = node.invalid === true && options.escapeInvalid === true; + let output = ''; + + if (node.value) { + if ((invalidBlock || invalidNode) && utils.isOpenOrClose(node)) { + return '\\' + node.value; + } + return node.value; + } + + if (node.value) { + return node.value; + } + + if (node.nodes) { + for (const child of node.nodes) { + output += stringify(child); + } + } + return output; + }; + + return stringify(ast); +}; + diff --git a/tunestats/app/api/node_modules/braces/lib/utils.js b/tunestats/app/api/node_modules/braces/lib/utils.js new file mode 100644 index 0000000..d19311f --- /dev/null +++ b/tunestats/app/api/node_modules/braces/lib/utils.js @@ -0,0 +1,122 @@ +'use strict'; + +exports.isInteger = num => { + if (typeof num === 'number') { + return Number.isInteger(num); + } + if (typeof num === 'string' && num.trim() !== '') { + return Number.isInteger(Number(num)); + } + return false; +}; + +/** + * Find a node of the given type + */ + +exports.find = (node, type) => node.nodes.find(node => node.type === type); + +/** + * Find a node of the given type + */ + +exports.exceedsLimit = (min, max, step = 1, limit) => { + if (limit === false) return false; + if (!exports.isInteger(min) || !exports.isInteger(max)) return false; + return ((Number(max) - Number(min)) / Number(step)) >= limit; +}; + +/** + * Escape the given node with '\\' before node.value + */ + +exports.escapeNode = (block, n = 0, type) => { + const node = block.nodes[n]; + if (!node) return; + + if ((type && node.type === type) || node.type === 'open' || node.type === 'close') { + if (node.escaped !== true) { + node.value = '\\' + node.value; + node.escaped = true; + } + } +}; + +/** + * Returns true if the given brace node should be enclosed in literal braces + */ + +exports.encloseBrace = node => { + if (node.type !== 'brace') return false; + if ((node.commas >> 0 + node.ranges >> 0) === 0) { + node.invalid = true; + return true; + } + return false; +}; + +/** + * Returns true if a brace node is invalid. + */ + +exports.isInvalidBrace = block => { + if (block.type !== 'brace') return false; + if (block.invalid === true || block.dollar) return true; + if ((block.commas >> 0 + block.ranges >> 0) === 0) { + block.invalid = true; + return true; + } + if (block.open !== true || block.close !== true) { + block.invalid = true; + return true; + } + return false; +}; + +/** + * Returns true if a node is an open or close node + */ + +exports.isOpenOrClose = node => { + if (node.type === 'open' || node.type === 'close') { + return true; + } + return node.open === true || node.close === true; +}; + +/** + * Reduce an array of text nodes. + */ + +exports.reduce = nodes => nodes.reduce((acc, node) => { + if (node.type === 'text') acc.push(node.value); + if (node.type === 'range') node.type = 'text'; + return acc; +}, []); + +/** + * Flatten an array + */ + +exports.flatten = (...args) => { + const result = []; + + const flat = arr => { + for (let i = 0; i < arr.length; i++) { + const ele = arr[i]; + + if (Array.isArray(ele)) { + flat(ele); + continue; + } + + if (ele !== undefined) { + result.push(ele); + } + } + return result; + }; + + flat(args); + return result; +}; diff --git a/tunestats/app/api/node_modules/braces/package.json b/tunestats/app/api/node_modules/braces/package.json new file mode 100644 index 0000000..c3c056e --- /dev/null +++ b/tunestats/app/api/node_modules/braces/package.json @@ -0,0 +1,77 @@ +{ + "name": "braces", + "description": "Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed.", + "version": "3.0.3", + "homepage": "https://github.com/micromatch/braces", + "author": "Jon Schlinkert (https://github.com/jonschlinkert)", + "contributors": [ + "Brian Woodward (https://twitter.com/doowb)", + "Elan Shanker (https://github.com/es128)", + "Eugene Sharygin (https://github.com/eush77)", + "hemanth.hm (http://h3manth.com)", + "Jon Schlinkert (http://twitter.com/jonschlinkert)" + ], + "repository": "micromatch/braces", + "bugs": { + "url": "https://github.com/micromatch/braces/issues" + }, + "license": "MIT", + "files": [ + "index.js", + "lib" + ], + "main": "index.js", + "engines": { + "node": ">=8" + }, + "scripts": { + "test": "mocha", + "benchmark": "node benchmark" + }, + "dependencies": { + "fill-range": "^7.1.1" + }, + "devDependencies": { + "ansi-colors": "^3.2.4", + "bash-path": "^2.0.1", + "gulp-format-md": "^2.0.0", + "mocha": "^6.1.1" + }, + "keywords": [ + "alpha", + "alphabetical", + "bash", + "brace", + "braces", + "expand", + "expansion", + "filepath", + "fill", + "fs", + "glob", + "globbing", + "letter", + "match", + "matches", + "matching", + "number", + "numerical", + "path", + "range", + "ranges", + "sh" + ], + "verb": { + "toc": false, + "layout": "default", + "tasks": [ + "readme" + ], + "lint": { + "reflinks": true + }, + "plugins": [ + "gulp-format-md" + ] + } +} diff --git a/tunestats/app/api/node_modules/bytes/History.md b/tunestats/app/api/node_modules/bytes/History.md new file mode 100644 index 0000000..d60ce0e --- /dev/null +++ b/tunestats/app/api/node_modules/bytes/History.md @@ -0,0 +1,97 @@ +3.1.2 / 2022-01-27 +================== + + * Fix return value for un-parsable strings + +3.1.1 / 2021-11-15 +================== + + * Fix "thousandsSeparator" incorrecting formatting fractional part + +3.1.0 / 2019-01-22 +================== + + * Add petabyte (`pb`) support + +3.0.0 / 2017-08-31 +================== + + * Change "kB" to "KB" in format output + * Remove support for Node.js 0.6 + * Remove support for ComponentJS + +2.5.0 / 2017-03-24 +================== + + * Add option "unit" + +2.4.0 / 2016-06-01 +================== + + * Add option "unitSeparator" + +2.3.0 / 2016-02-15 +================== + + * Drop partial bytes on all parsed units + * Fix non-finite numbers to `.format` to return `null` + * Fix parsing byte string that looks like hex + * perf: hoist regular expressions + +2.2.0 / 2015-11-13 +================== + + * add option "decimalPlaces" + * add option "fixedDecimals" + +2.1.0 / 2015-05-21 +================== + + * add `.format` export + * add `.parse` export + +2.0.2 / 2015-05-20 +================== + + * remove map recreation + * remove unnecessary object construction + +2.0.1 / 2015-05-07 +================== + + * fix browserify require + * remove node.extend dependency + +2.0.0 / 2015-04-12 +================== + + * add option "case" + * add option "thousandsSeparator" + * return "null" on invalid parse input + * support proper round-trip: bytes(bytes(num)) === num + * units no longer case sensitive when parsing + +1.0.0 / 2014-05-05 +================== + + * add negative support. fixes #6 + +0.3.0 / 2014-03-19 +================== + + * added terabyte support + +0.2.1 / 2013-04-01 +================== + + * add .component + +0.2.0 / 2012-10-28 +================== + + * bytes(200).should.eql('200b') + +0.1.0 / 2012-07-04 +================== + + * add bytes to string conversion [yields] diff --git a/tunestats/app/api/node_modules/bytes/LICENSE b/tunestats/app/api/node_modules/bytes/LICENSE new file mode 100644 index 0000000..63e95a9 --- /dev/null +++ b/tunestats/app/api/node_modules/bytes/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015 Jed Watson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/bytes/Readme.md b/tunestats/app/api/node_modules/bytes/Readme.md new file mode 100644 index 0000000..5790e23 --- /dev/null +++ b/tunestats/app/api/node_modules/bytes/Readme.md @@ -0,0 +1,152 @@ +# Bytes utility + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install bytes +``` + +## Usage + +```js +var bytes = require('bytes'); +``` + +#### bytes(number｜string value, [options]): number｜string｜null + +Default export function. Delegates to either `bytes.format` or `bytes.parse` based on the type of `value`. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number`｜`string` | Number value to format or string value to parse | +| options | `Object` | Conversion options for `format` | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`｜`number`｜`null` | Return null upon error. Numeric value in bytes, or string value otherwise. | + +**Example** + +```js +bytes(1024); +// output: '1KB' + +bytes('1KB'); +// output: 1024 +``` + +#### bytes.format(number value, [options]): string｜null + +Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is + rounded. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number` | Value in bytes | +| options | `Object` | Conversion options | + +**Options** + +| Property | Type | Description | +|-------------------|--------|-----------------------------------------------------------------------------------------| +| decimalPlaces | `number`｜`null` | Maximum number of decimal places to include in output. Default value to `2`. | +| fixedDecimals | `boolean`｜`null` | Whether to always display the maximum number of decimal places. Default value to `false` | +| thousandsSeparator | `string`｜`null` | Example of values: `' '`, `','` and `'.'`... Default value to `''`. | +| unit | `string`｜`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). | +| unitSeparator | `string`｜`null` | Separator to use between number and unit. Default value to `''`. | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`｜`null` | Return null upon error. String value otherwise. | + +**Example** + +```js +bytes.format(1024); +// output: '1KB' + +bytes.format(1000); +// output: '1000B' + +bytes.format(1000, {thousandsSeparator: ' '}); +// output: '1 000B' + +bytes.format(1024 * 1.7, {decimalPlaces: 0}); +// output: '2KB' + +bytes.format(1024, {unitSeparator: ' '}); +// output: '1 KB' +``` + +#### bytes.parse(string｜number value): number｜null + +Parse the string value into an integer in bytes. If no unit is given, or `value` +is a number, it is assumed the value is in bytes. + +Supported units and abbreviations are as follows and are case-insensitive: + + * `b` for bytes + * `kb` for kilobytes + * `mb` for megabytes + * `gb` for gigabytes + * `tb` for terabytes + * `pb` for petabytes + +The units are in powers of two, not ten. This means 1kb = 1024b according to this parser. + +**Arguments** + +| Name | Type | Description | +|---------------|--------|--------------------| +| value | `string`｜`number` | String to parse, or number in bytes. | + +**Returns** + +| Name | Type | Description | +|---------|-------------|-------------------------| +| results | `number`｜`null` | Return null upon error. Value in bytes otherwise. | + +**Example** + +```js +bytes.parse('1KB'); +// output: 1024 + +bytes.parse('1024'); +// output: 1024 + +bytes.parse(1024); +// output: 1024 +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/visionmedia/bytes.js/master?label=ci +[ci-url]: https://github.com/visionmedia/bytes.js/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master +[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master +[downloads-image]: https://badgen.net/npm/dm/bytes +[downloads-url]: https://npmjs.org/package/bytes +[npm-image]: https://badgen.net/npm/v/bytes +[npm-url]: https://npmjs.org/package/bytes diff --git a/tunestats/app/api/node_modules/bytes/index.js b/tunestats/app/api/node_modules/bytes/index.js new file mode 100644 index 0000000..6f2d0f8 --- /dev/null +++ b/tunestats/app/api/node_modules/bytes/index.js @@ -0,0 +1,170 @@ +/*! + * bytes + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015 Jed Watson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = bytes; +module.exports.format = format; +module.exports.parse = parse; + +/** + * Module variables. + * @private + */ + +var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g; + +var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/; + +var map = { + b: 1, + kb: 1 << 10, + mb: 1 << 20, + gb: 1 << 30, + tb: Math.pow(1024, 4), + pb: Math.pow(1024, 5), +}; + +var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i; + +/** + * Convert the given value in bytes into a string or parse to string to an integer in bytes. + * + * @param {string|number} value + * @param {{ + * case: [string], + * decimalPlaces: [number] + * fixedDecimals: [boolean] + * thousandsSeparator: [string] + * unitSeparator: [string] + * }} [options] bytes options. + * + * @returns {string|number|null} + */ + +function bytes(value, options) { + if (typeof value === 'string') { + return parse(value); + } + + if (typeof value === 'number') { + return format(value, options); + } + + return null; +} + +/** + * Format the given value in bytes into a string. + * + * If the value is negative, it is kept as such. If it is a float, + * it is rounded. + * + * @param {number} value + * @param {object} [options] + * @param {number} [options.decimalPlaces=2] + * @param {number} [options.fixedDecimals=false] + * @param {string} [options.thousandsSeparator=] + * @param {string} [options.unit=] + * @param {string} [options.unitSeparator=] + * + * @returns {string|null} + * @public + */ + +function format(value, options) { + if (!Number.isFinite(value)) { + return null; + } + + var mag = Math.abs(value); + var thousandsSeparator = (options && options.thousandsSeparator) || ''; + var unitSeparator = (options && options.unitSeparator) || ''; + var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2; + var fixedDecimals = Boolean(options && options.fixedDecimals); + var unit = (options && options.unit) || ''; + + if (!unit || !map[unit.toLowerCase()]) { + if (mag >= map.pb) { + unit = 'PB'; + } else if (mag >= map.tb) { + unit = 'TB'; + } else if (mag >= map.gb) { + unit = 'GB'; + } else if (mag >= map.mb) { + unit = 'MB'; + } else if (mag >= map.kb) { + unit = 'KB'; + } else { + unit = 'B'; + } + } + + var val = value / map[unit.toLowerCase()]; + var str = val.toFixed(decimalPlaces); + + if (!fixedDecimals) { + str = str.replace(formatDecimalsRegExp, '$1'); + } + + if (thousandsSeparator) { + str = str.split('.').map(function (s, i) { + return i === 0 + ? s.replace(formatThousandsRegExp, thousandsSeparator) + : s + }).join('.'); + } + + return str + unitSeparator + unit; +} + +/** + * Parse the string value into an integer in bytes. + * + * If no unit is given, it is assumed the value is in bytes. + * + * @param {number|string} val + * + * @returns {number|null} + * @public + */ + +function parse(val) { + if (typeof val === 'number' && !isNaN(val)) { + return val; + } + + if (typeof val !== 'string') { + return null; + } + + // Test if the string passed is valid + var results = parseRegExp.exec(val); + var floatValue; + var unit = 'b'; + + if (!results) { + // Nothing could be extracted from the given string + floatValue = parseInt(val, 10); + unit = 'b' + } else { + // Retrieve the value and the unit + floatValue = parseFloat(results[1]); + unit = results[4].toLowerCase(); + } + + if (isNaN(floatValue)) { + return null; + } + + return Math.floor(map[unit] * floatValue); +} diff --git a/tunestats/app/api/node_modules/bytes/package.json b/tunestats/app/api/node_modules/bytes/package.json new file mode 100644 index 0000000..f2b6a8b --- /dev/null +++ b/tunestats/app/api/node_modules/bytes/package.json @@ -0,0 +1,42 @@ +{ + "name": "bytes", + "description": "Utility to parse a string bytes to bytes and vice-versa", + "version": "3.1.2", + "author": "TJ Holowaychuk (http://tjholowaychuk.com)", + "contributors": [ + "Jed Watson ", + "Théo FIDRY " + ], + "license": "MIT", + "keywords": [ + "byte", + "bytes", + "utility", + "parse", + "parser", + "convert", + "converter" + ], + "repository": "visionmedia/bytes.js", + "devDependencies": { + "eslint": "7.32.0", + "eslint-plugin-markdown": "2.2.1", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "files": [ + "History.md", + "LICENSE", + "Readme.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --check-leaks --reporter spec", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/tunestats/app/api/node_modules/call-bind/.eslintignore b/tunestats/app/api/node_modules/call-bind/.eslintignore new file mode 100644 index 0000000..404abb2 --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/.eslintignore @@ -0,0 +1 @@ +coverage/ diff --git a/tunestats/app/api/node_modules/call-bind/.eslintrc b/tunestats/app/api/node_modules/call-bind/.eslintrc new file mode 100644 index 0000000..dfa9a6c --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/.eslintrc @@ -0,0 +1,16 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "func-name-matching": 0, + "id-length": 0, + "new-cap": [2, { + "capIsNewExceptions": [ + "GetIntrinsic", + ], + }], + "no-magic-numbers": 0, + }, +} diff --git a/tunestats/app/api/node_modules/call-bind/.github/FUNDING.yml b/tunestats/app/api/node_modules/call-bind/.github/FUNDING.yml new file mode 100644 index 0000000..c70c2ec --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: [ljharb] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: npm/call-bind +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/tunestats/app/api/node_modules/call-bind/.nycrc b/tunestats/app/api/node_modules/call-bind/.nycrc new file mode 100644 index 0000000..bdd626c --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/.nycrc @@ -0,0 +1,9 @@ +{ + "all": true, + "check-coverage": false, + "reporter": ["text-summary", "text", "html", "json"], + "exclude": [ + "coverage", + "test" + ] +} diff --git a/tunestats/app/api/node_modules/call-bind/CHANGELOG.md b/tunestats/app/api/node_modules/call-bind/CHANGELOG.md new file mode 100644 index 0000000..c653f70 --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/CHANGELOG.md @@ -0,0 +1,93 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [v1.0.7](https://github.com/ljharb/call-bind/compare/v1.0.6...v1.0.7) - 2024-02-12 + +### Commits + +- [Refactor] use `es-define-property` [`09b76a0`](https://github.com/ljharb/call-bind/commit/09b76a01634440461d44a80c9924ec4b500f3b03) +- [Deps] update `get-intrinsic`, `set-function-length` [`ad5136d`](https://github.com/ljharb/call-bind/commit/ad5136ddda2a45c590959829ad3dce0c9f4e3590) + +## [v1.0.6](https://github.com/ljharb/call-bind/compare/v1.0.5...v1.0.6) - 2024-02-05 + +### Commits + +- [Dev Deps] update `aud`, `npmignore`, `tape` [`d564d5c`](https://github.com/ljharb/call-bind/commit/d564d5ce3e06a19df4d499c77f8d1a9da44e77aa) +- [Deps] update `get-intrinsic`, `set-function-length` [`cfc2bdc`](https://github.com/ljharb/call-bind/commit/cfc2bdca7b633df0e0e689e6b637f668f1c6792e) +- [Refactor] use `es-errors`, so things that only need those do not need `get-intrinsic` [`64cd289`](https://github.com/ljharb/call-bind/commit/64cd289ae5862c250a4ca80aa8d461047c166af5) +- [meta] add missing `engines.node` [`32a4038`](https://github.com/ljharb/call-bind/commit/32a4038857b62179f7f9b7b3df2c5260036be582) + +## [v1.0.5](https://github.com/ljharb/call-bind/compare/v1.0.4...v1.0.5) - 2023-10-19 + +### Commits + +- [Fix] throw an error on non-functions as early as possible [`f262408`](https://github.com/ljharb/call-bind/commit/f262408f822c840fbc268080f3ad7c429611066d) +- [Deps] update `set-function-length` [`3fff271`](https://github.com/ljharb/call-bind/commit/3fff27145a1e3a76a5b74f1d7c3c43d0fa3b9871) + +## [v1.0.4](https://github.com/ljharb/call-bind/compare/v1.0.3...v1.0.4) - 2023-10-19 + +## [v1.0.3](https://github.com/ljharb/call-bind/compare/v1.0.2...v1.0.3) - 2023-10-19 + +### Commits + +- [actions] reuse common workflows [`a994df6`](https://github.com/ljharb/call-bind/commit/a994df69f401f4bf735a4ccd77029b85d1549453) +- [meta] use `npmignore` to autogenerate an npmignore file [`eef3ef2`](https://github.com/ljharb/call-bind/commit/eef3ef21e1f002790837fedb8af2679c761fbdf5) +- [readme] flesh out content [`1845ccf`](https://github.com/ljharb/call-bind/commit/1845ccfd9976a607884cfc7157c93192cc16cf22) +- [actions] use `node/install` instead of `node/run`; use `codecov` action [`5b47d53`](https://github.com/ljharb/call-bind/commit/5b47d53d2fd74af5ea0a44f1d51e503cd42f7a90) +- [Refactor] use `set-function-length` [`a0e165c`](https://github.com/ljharb/call-bind/commit/a0e165c5dc61db781cbc919b586b1c2b8da0b150) +- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`9c50103`](https://github.com/ljharb/call-bind/commit/9c50103f44137279a817317cf6cc421a658f85b4) +- [meta] simplify "exports" [`019c6d0`](https://github.com/ljharb/call-bind/commit/019c6d06b0e1246ceed8e579f57e44441cbbf6d9) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `safe-publish-latest`, `tape` [`23bd718`](https://github.com/ljharb/call-bind/commit/23bd718a288d3b03042062b4ef5153b3cea83f11) +- [actions] update codecov uploader [`62552d7`](https://github.com/ljharb/call-bind/commit/62552d79cc79e05825e99aaba134ae5b37f33da5) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `tape` [`ec81665`](https://github.com/ljharb/call-bind/commit/ec81665b300f87eabff597afdc8b8092adfa7afd) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `safe-publish-latest`, `tape` [`35d67fc`](https://github.com/ljharb/call-bind/commit/35d67fcea883e686650f736f61da5ddca2592de8) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`0266d8d`](https://github.com/ljharb/call-bind/commit/0266d8d2a45086a922db366d0c2932fa463662ff) +- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`43a5b28`](https://github.com/ljharb/call-bind/commit/43a5b28a444e710e1bbf92adb8afb5cf7523a223) +- [Deps] update `define-data-property`, `function-bind`, `get-intrinsic` [`780eb36`](https://github.com/ljharb/call-bind/commit/780eb36552514f8cc99c70821ce698697c2726a5) +- [Dev Deps] update `aud`, `tape` [`90d50ad`](https://github.com/ljharb/call-bind/commit/90d50ad03b061e0268b3380b0065fcaec183dc05) +- [meta] use `prepublishOnly` script for npm 7+ [`44c5433`](https://github.com/ljharb/call-bind/commit/44c5433b7980e02b4870007046407cf6fc543329) +- [Deps] update `get-intrinsic` [`86bfbfc`](https://github.com/ljharb/call-bind/commit/86bfbfcf34afdc6eabc93ce3d408548d0e27d958) +- [Deps] update `get-intrinsic` [`5c53354`](https://github.com/ljharb/call-bind/commit/5c5335489be0294c18cd7a8bb6e08226ee019ff5) +- [actions] update checkout action [`4c393a8`](https://github.com/ljharb/call-bind/commit/4c393a8173b3c8e5b30d5b3297b3b94d48bf87f3) +- [Deps] update `get-intrinsic` [`4e70bde`](https://github.com/ljharb/call-bind/commit/4e70bdec0626acb11616d66250fc14565e716e91) +- [Deps] update `get-intrinsic` [`55ae803`](https://github.com/ljharb/call-bind/commit/55ae803a920bd93c369cd798c20de31f91e9fc60) + +## [v1.0.2](https://github.com/ljharb/call-bind/compare/v1.0.1...v1.0.2) - 2021-01-11 + +### Commits + +- [Fix] properly include the receiver in the bound length [`dbae7bc`](https://github.com/ljharb/call-bind/commit/dbae7bc676c079a0d33c0a43e9ef92cb7b01345d) + +## [v1.0.1](https://github.com/ljharb/call-bind/compare/v1.0.0...v1.0.1) - 2021-01-08 + +### Commits + +- [Tests] migrate tests to Github Actions [`b6db284`](https://github.com/ljharb/call-bind/commit/b6db284c36f8ccd195b88a6764fe84b7223a0da1) +- [meta] do not publish github action workflow files [`ec7fe46`](https://github.com/ljharb/call-bind/commit/ec7fe46e60cfa4764ee943d2755f5e5a366e578e) +- [Fix] preserve original function’s length when possible [`adbceaa`](https://github.com/ljharb/call-bind/commit/adbceaa3cac4b41ea78bb19d7ccdbaaf7e0bdadb) +- [Tests] gather coverage data on every job [`d69e23c`](https://github.com/ljharb/call-bind/commit/d69e23cc65f101ba1d4c19bb07fa8eb0ec624be8) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`2fd3586`](https://github.com/ljharb/call-bind/commit/2fd3586c5d47b335364c14293114c6b625ae1f71) +- [Deps] update `get-intrinsic` [`f23e931`](https://github.com/ljharb/call-bind/commit/f23e9318cc271c2add8bb38cfded85ee7baf8eee) +- [Deps] update `get-intrinsic` [`72d9f44`](https://github.com/ljharb/call-bind/commit/72d9f44e184465ba8dd3fb48260bbcff234985f2) +- [meta] fix FUNDING.yml [`e723573`](https://github.com/ljharb/call-bind/commit/e723573438c5a68dcec31fb5d96ea6b7e4a93be8) +- [eslint] ignore coverage output [`15e76d2`](https://github.com/ljharb/call-bind/commit/15e76d28a5f43e504696401e5b31ebb78ee1b532) +- [meta] add Automatic Rebase and Require Allow Edits workflows [`8fa4dab`](https://github.com/ljharb/call-bind/commit/8fa4dabb23ba3dd7bb92c9571c1241c08b56e4b6) + +## v1.0.0 - 2020-10-30 + +### Commits + +- Initial commit [`306cf98`](https://github.com/ljharb/call-bind/commit/306cf98c7ec9e7ef66b653ec152277ac1381eb50) +- Tests [`e10d0bb`](https://github.com/ljharb/call-bind/commit/e10d0bbdadc7a10ecedc9a1c035112d3e368b8df) +- Implementation [`43852ed`](https://github.com/ljharb/call-bind/commit/43852eda0f187327b7fad2423ca972149a52bd65) +- npm init [`408f860`](https://github.com/ljharb/call-bind/commit/408f860b773a2f610805fd3613d0d71bac1b6249) +- [meta] add Automatic Rebase and Require Allow Edits workflows [`fb349b2`](https://github.com/ljharb/call-bind/commit/fb349b2e48defbec8b5ec8a8395cc8f69f220b13) +- [meta] add `auto-changelog` [`c4001fc`](https://github.com/ljharb/call-bind/commit/c4001fc43031799ef908211c98d3b0fb2b60fde4) +- [meta] add "funding"; create `FUNDING.yml` [`d4d6d29`](https://github.com/ljharb/call-bind/commit/d4d6d2974a14bc2e98830468eda7fe6d6a776717) +- [Tests] add `npm run lint` [`dedfb98`](https://github.com/ljharb/call-bind/commit/dedfb98bd0ecefb08ddb9a94061bd10cde4332af) +- Only apps should have lockfiles [`54ac776`](https://github.com/ljharb/call-bind/commit/54ac77653db45a7361dc153d2f478e743f110650) +- [meta] add `safe-publish-latest` [`9ea8e43`](https://github.com/ljharb/call-bind/commit/9ea8e435b950ce9b705559cd651039f9bf40140f) diff --git a/tunestats/app/api/node_modules/call-bind/LICENSE b/tunestats/app/api/node_modules/call-bind/LICENSE new file mode 100644 index 0000000..48f05d0 --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2020 Jordan Harband + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/tunestats/app/api/node_modules/call-bind/README.md b/tunestats/app/api/node_modules/call-bind/README.md new file mode 100644 index 0000000..48e9047 --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/README.md @@ -0,0 +1,64 @@ +# call-bind [![Version Badge][npm-version-svg]][package-url] + +[![github actions][actions-image]][actions-url] +[![coverage][codecov-image]][codecov-url] +[![dependency status][deps-svg]][deps-url] +[![dev dependency status][dev-deps-svg]][dev-deps-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +[![npm badge][npm-badge-png]][package-url] + +Robustly `.call.bind()` a function. + +## Getting started + +```sh +npm install --save call-bind +``` + +## Usage/Examples + +```js +const assert = require('assert'); +const callBind = require('call-bind'); +const callBound = require('call-bind/callBound'); + +function f(a, b) { + assert.equal(this, 1); + assert.equal(a, 2); + assert.equal(b, 3); + assert.equal(arguments.length, 2); +} + +const fBound = callBind(f); + +const slice = callBound('Array.prototype.slice'); + +delete Function.prototype.call; +delete Function.prototype.bind; + +fBound(1, 2, 3); + +assert.deepEqual(slice([1, 2, 3, 4], 1, -1), [2, 3]); +``` + +## Tests + +Clone the repo, `npm install`, and run `npm test` + +[package-url]: https://npmjs.org/package/call-bind +[npm-version-svg]: https://versionbadg.es/ljharb/call-bind.svg +[deps-svg]: https://david-dm.org/ljharb/call-bind.svg +[deps-url]: https://david-dm.org/ljharb/call-bind +[dev-deps-svg]: https://david-dm.org/ljharb/call-bind/dev-status.svg +[dev-deps-url]: https://david-dm.org/ljharb/call-bind#info=devDependencies +[npm-badge-png]: https://nodei.co/npm/call-bind.png?downloads=true&stars=true +[license-image]: https://img.shields.io/npm/l/call-bind.svg +[license-url]: LICENSE +[downloads-image]: https://img.shields.io/npm/dm/call-bind.svg +[downloads-url]: https://npm-stat.com/charts.html?package=call-bind +[codecov-image]: https://codecov.io/gh/ljharb/call-bind/branch/main/graphs/badge.svg +[codecov-url]: https://app.codecov.io/gh/ljharb/call-bind/ +[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/call-bind +[actions-url]: https://github.com/ljharb/call-bind/actions diff --git a/tunestats/app/api/node_modules/call-bind/callBound.js b/tunestats/app/api/node_modules/call-bind/callBound.js new file mode 100644 index 0000000..8374adf --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/callBound.js @@ -0,0 +1,15 @@ +'use strict'; + +var GetIntrinsic = require('get-intrinsic'); + +var callBind = require('./'); + +var $indexOf = callBind(GetIntrinsic('String.prototype.indexOf')); + +module.exports = function callBoundIntrinsic(name, allowMissing) { + var intrinsic = GetIntrinsic(name, !!allowMissing); + if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.') > -1) { + return callBind(intrinsic); + } + return intrinsic; +}; diff --git a/tunestats/app/api/node_modules/call-bind/index.js b/tunestats/app/api/node_modules/call-bind/index.js new file mode 100644 index 0000000..01c5b3d --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/index.js @@ -0,0 +1,35 @@ +'use strict'; + +var bind = require('function-bind'); +var GetIntrinsic = require('get-intrinsic'); +var setFunctionLength = require('set-function-length'); + +var $TypeError = require('es-errors/type'); +var $apply = GetIntrinsic('%Function.prototype.apply%'); +var $call = GetIntrinsic('%Function.prototype.call%'); +var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply); + +var $defineProperty = require('es-define-property'); +var $max = GetIntrinsic('%Math.max%'); + +module.exports = function callBind(originalFunction) { + if (typeof originalFunction !== 'function') { + throw new $TypeError('a function is required'); + } + var func = $reflectApply(bind, $call, arguments); + return setFunctionLength( + func, + 1 + $max(0, originalFunction.length - (arguments.length - 1)), + true + ); +}; + +var applyBind = function applyBind() { + return $reflectApply(bind, $apply, arguments); +}; + +if ($defineProperty) { + $defineProperty(module.exports, 'apply', { value: applyBind }); +} else { + module.exports.apply = applyBind; +} diff --git a/tunestats/app/api/node_modules/call-bind/package.json b/tunestats/app/api/node_modules/call-bind/package.json new file mode 100644 index 0000000..5ba88ff --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/package.json @@ -0,0 +1,95 @@ +{ + "name": "call-bind", + "version": "1.0.7", + "description": "Robustly `.call.bind()` a function", + "main": "index.js", + "exports": { + ".": "./index.js", + "./callBound": "./callBound.js", + "./package.json": "./package.json" + }, + "scripts": { + "prepack": "npmignore --auto --commentLines=auto", + "prepublish": "not-in-publish || npm run prepublishOnly", + "prepublishOnly": "safe-publish-latest", + "lint": "eslint --ext=.js,.mjs .", + "postlint": "evalmd README.md", + "pretest": "npm run lint", + "tests-only": "nyc tape 'test/**/*.js'", + "test": "npm run tests-only", + "posttest": "aud --production", + "version": "auto-changelog && git add CHANGELOG.md", + "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\"" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/call-bind.git" + }, + "keywords": [ + "javascript", + "ecmascript", + "es", + "js", + "callbind", + "callbound", + "call", + "bind", + "bound", + "call-bind", + "call-bound", + "function", + "es-abstract" + ], + "author": "Jordan Harband ", + "funding": { + "url": "https://github.com/sponsors/ljharb" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/ljharb/call-bind/issues" + }, + "homepage": "https://github.com/ljharb/call-bind#readme", + "devDependencies": { + "@ljharb/eslint-config": "^21.1.0", + "aud": "^2.0.4", + "auto-changelog": "^2.4.0", + "es-value-fixtures": "^1.4.2", + "eslint": "=8.8.0", + "evalmd": "^0.0.19", + "for-each": "^0.3.3", + "gopd": "^1.0.1", + "has-strict-mode": "^1.0.1", + "in-publish": "^2.0.1", + "npmignore": "^0.3.1", + "nyc": "^10.3.2", + "object-inspect": "^1.13.1", + "safe-publish-latest": "^2.0.0", + "tape": "^5.7.4" + }, + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.4", + "set-function-length": "^1.2.1" + }, + "testling": { + "files": "test/index.js" + }, + "auto-changelog": { + "output": "CHANGELOG.md", + "template": "keepachangelog", + "unreleased": false, + "commitLimit": false, + "backfillLimit": false, + "hideCredit": true + }, + "publishConfig": { + "ignore": [ + ".github/workflows" + ] + }, + "engines": { + "node": ">= 0.4" + } +} diff --git a/tunestats/app/api/node_modules/call-bind/test/callBound.js b/tunestats/app/api/node_modules/call-bind/test/callBound.js new file mode 100644 index 0000000..c32319d --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/test/callBound.js @@ -0,0 +1,54 @@ +'use strict'; + +var test = require('tape'); + +var callBound = require('../callBound'); + +test('callBound', function (t) { + // static primitive + t.equal(callBound('Array.length'), Array.length, 'Array.length yields itself'); + t.equal(callBound('%Array.length%'), Array.length, '%Array.length% yields itself'); + + // static non-function object + t.equal(callBound('Array.prototype'), Array.prototype, 'Array.prototype yields itself'); + t.equal(callBound('%Array.prototype%'), Array.prototype, '%Array.prototype% yields itself'); + t.equal(callBound('Array.constructor'), Array.constructor, 'Array.constructor yields itself'); + t.equal(callBound('%Array.constructor%'), Array.constructor, '%Array.constructor% yields itself'); + + // static function + t.equal(callBound('Date.parse'), Date.parse, 'Date.parse yields itself'); + t.equal(callBound('%Date.parse%'), Date.parse, '%Date.parse% yields itself'); + + // prototype primitive + t.equal(callBound('Error.prototype.message'), Error.prototype.message, 'Error.prototype.message yields itself'); + t.equal(callBound('%Error.prototype.message%'), Error.prototype.message, '%Error.prototype.message% yields itself'); + + // prototype function + t.notEqual(callBound('Object.prototype.toString'), Object.prototype.toString, 'Object.prototype.toString does not yield itself'); + t.notEqual(callBound('%Object.prototype.toString%'), Object.prototype.toString, '%Object.prototype.toString% does not yield itself'); + t.equal(callBound('Object.prototype.toString')(true), Object.prototype.toString.call(true), 'call-bound Object.prototype.toString calls into the original'); + t.equal(callBound('%Object.prototype.toString%')(true), Object.prototype.toString.call(true), 'call-bound %Object.prototype.toString% calls into the original'); + + t['throws']( + function () { callBound('does not exist'); }, + SyntaxError, + 'nonexistent intrinsic throws' + ); + t['throws']( + function () { callBound('does not exist', true); }, + SyntaxError, + 'allowMissing arg still throws for unknown intrinsic' + ); + + t.test('real but absent intrinsic', { skip: typeof WeakRef !== 'undefined' }, function (st) { + st['throws']( + function () { callBound('WeakRef'); }, + TypeError, + 'real but absent intrinsic throws' + ); + st.equal(callBound('WeakRef', true), undefined, 'allowMissing arg avoids exception'); + st.end(); + }); + + t.end(); +}); diff --git a/tunestats/app/api/node_modules/call-bind/test/index.js b/tunestats/app/api/node_modules/call-bind/test/index.js new file mode 100644 index 0000000..1fd4668 --- /dev/null +++ b/tunestats/app/api/node_modules/call-bind/test/index.js @@ -0,0 +1,80 @@ +'use strict'; + +var callBind = require('../'); +var bind = require('function-bind'); +var gOPD = require('gopd'); +var hasStrictMode = require('has-strict-mode')(); +var forEach = require('for-each'); +var inspect = require('object-inspect'); +var v = require('es-value-fixtures'); + +var test = require('tape'); + +/* + * older engines have length nonconfigurable + * in io.js v3, it is configurable except on bound functions, hence the .bind() + */ +var functionsHaveConfigurableLengths = !!( + gOPD + && Object.getOwnPropertyDescriptor + && Object.getOwnPropertyDescriptor(bind.call(function () {}), 'length').configurable +); + +test('callBind', function (t) { + forEach(v.nonFunctions, function (nonFunction) { + t['throws']( + function () { callBind(nonFunction); }, + TypeError, + inspect(nonFunction) + ' is not a function' + ); + }); + + var sentinel = { sentinel: true }; + var func = function (a, b) { + // eslint-disable-next-line no-invalid-this + return [!hasStrictMode && this === global ? undefined : this, a, b]; + }; + t.equal(func.length, 2, 'original function length is 2'); + t.deepEqual(func(), [undefined, undefined, undefined], 'unbound func with too few args'); + t.deepEqual(func(1, 2), [undefined, 1, 2], 'unbound func with right args'); + t.deepEqual(func(1, 2, 3), [undefined, 1, 2], 'unbound func with too many args'); + + var bound = callBind(func); + t.equal(bound.length, func.length + 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(bound(), [undefined, undefined, undefined], 'bound func with too few args'); + t.deepEqual(bound(1, 2), [hasStrictMode ? 1 : Object(1), 2, undefined], 'bound func with right args'); + t.deepEqual(bound(1, 2, 3), [hasStrictMode ? 1 : Object(1), 2, 3], 'bound func with too many args'); + + var boundR = callBind(func, sentinel); + t.equal(boundR.length, func.length, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(boundR(), [sentinel, undefined, undefined], 'bound func with receiver, with too few args'); + t.deepEqual(boundR(1, 2), [sentinel, 1, 2], 'bound func with receiver, with right args'); + t.deepEqual(boundR(1, 2, 3), [sentinel, 1, 2], 'bound func with receiver, with too many args'); + + var boundArg = callBind(func, sentinel, 1); + t.equal(boundArg.length, func.length - 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(boundArg(), [sentinel, 1, undefined], 'bound func with receiver and arg, with too few args'); + t.deepEqual(boundArg(2), [sentinel, 1, 2], 'bound func with receiver and arg, with right arg'); + t.deepEqual(boundArg(2, 3), [sentinel, 1, 2], 'bound func with receiver and arg, with too many args'); + + t.test('callBind.apply', function (st) { + var aBound = callBind.apply(func); + st.deepEqual(aBound(sentinel), [sentinel, undefined, undefined], 'apply-bound func with no args'); + st.deepEqual(aBound(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args'); + st.deepEqual(aBound(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args'); + + var aBoundArg = callBind.apply(func); + st.deepEqual(aBoundArg(sentinel, [1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with too many args'); + st.deepEqual(aBoundArg(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args'); + st.deepEqual(aBoundArg(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args'); + + var aBoundR = callBind.apply(func, sentinel); + st.deepEqual(aBoundR([1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with receiver and too many args'); + st.deepEqual(aBoundR([1, 2], 4), [sentinel, 1, 2], 'apply-bound func with receiver and right args'); + st.deepEqual(aBoundR([1], 4), [sentinel, 1, undefined], 'apply-bound func with receiver and too few args'); + + st.end(); + }); + + t.end(); +}); diff --git a/tunestats/app/api/node_modules/caseless/LICENSE b/tunestats/app/api/node_modules/caseless/LICENSE new file mode 100644 index 0000000..61789f4 --- /dev/null +++ b/tunestats/app/api/node_modules/caseless/LICENSE @@ -0,0 +1,28 @@ +Apache License +Version 2.0, January 2004 +http://www.apache.org/licenses/ +TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION +1. Definitions. +"License" shall mean the terms and conditions for use, reproduction, and distribution as defined by Sections 1 through 9 of this document. +"Licensor" shall mean the copyright owner or entity authorized by the copyright owner that is granting the License. +"Legal Entity" shall mean the union of the acting entity and all other entities that control, are controlled by, or are under common control with that entity. For the purposes of this definition, "control" means (i) the power, direct or indirect, to cause the direction or management of such entity, whether by contract or otherwise, or (ii) ownership of fifty percent (50%) or more of the outstanding shares, or (iii) beneficial ownership of such entity. +"You" (or "Your") shall mean an individual or Legal Entity exercising permissions granted by this License. +"Source" form shall mean the preferred form for making modifications, including but not limited to software source code, documentation source, and configuration files. +"Object" form shall mean any form resulting from mechanical transformation or translation of a Source form, including but not limited to compiled object code, generated documentation, and conversions to other media types. +"Work" shall mean the work of authorship, whether in Source or Object form, made available under the License, as indicated by a copyright notice that is included in or attached to the work (an example is provided in the Appendix below). +"Derivative Works" shall mean any work, whether in Source or Object form, that is based on (or derived from) the Work and for which the editorial revisions, annotations, elaborations, or other modifications represent, as a whole, an original work of authorship. For the purposes of this License, Derivative Works shall not include works that remain separable from, or merely link (or bind by name) to the interfaces of, the Work and Derivative Works thereof. +"Contribution" shall mean any work of authorship, including the original version of the Work and any modifications or additions to that Work or Derivative Works thereof, that is intentionally submitted to Licensor for inclusion in the Work by the copyright owner or by an individual or Legal Entity authorized to submit on behalf of the copyright owner. For the purposes of this definition, "submitted" means any form of electronic, verbal, or written communication sent to the Licensor or its representatives, including but not limited to communication on electronic mailing lists, source code control systems, and issue tracking systems that are managed by, or on behalf of, the Licensor for the purpose of discussing and improving the Work, but excluding communication that is conspicuously marked or otherwise designated in writing by the copyright owner as "Not a Contribution." +"Contributor" shall mean Licensor and any individual or Legal Entity on behalf of whom a Contribution has been received by Licensor and subsequently incorporated within the Work. +2. Grant of Copyright License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable copyright license to reproduce, prepare Derivative Works of, publicly display, publicly perform, sublicense, and distribute the Work and such Derivative Works in Source or Object form. +3. Grant of Patent License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable (except as stated in this section) patent license to make, have made, use, offer to sell, sell, import, and otherwise transfer the Work, where such license applies only to those patent claims licensable by such Contributor that are necessarily infringed by their Contribution(s) alone or by combination of their Contribution(s) with the Work to which such Contribution(s) was submitted. If You institute patent litigation against any entity (including a cross-claim or counterclaim in a lawsuit) alleging that the Work or a Contribution incorporated within the Work constitutes direct or contributory patent infringement, then any patent licenses granted to You under this License for that Work shall terminate as of the date such litigation is filed. +4. Redistribution. You may reproduce and distribute copies of the Work or Derivative Works thereof in any medium, with or without modifications, and in Source or Object form, provided that You meet the following conditions: +You must give any other recipients of the Work or Derivative Works a copy of this License; and +You must cause any modified files to carry prominent notices stating that You changed the files; and +You must retain, in the Source form of any Derivative Works that You distribute, all copyright, patent, trademark, and attribution notices from the Source form of the Work, excluding those notices that do not pertain to any part of the Derivative Works; and +If the Work includes a "NOTICE" text file as part of its distribution, then any Derivative Works that You distribute must include a readable copy of the attribution notices contained within such NOTICE file, excluding those notices that do not pertain to any part of the Derivative Works, in at least one of the following places: within a NOTICE text file distributed as part of the Derivative Works; within the Source form or documentation, if provided along with the Derivative Works; or, within a display generated by the Derivative Works, if and wherever such third-party notices normally appear. The contents of the NOTICE file are for informational purposes only and do not modify the License. You may add Your own attribution notices within Derivative Works that You distribute, alongside or as an addendum to the NOTICE text from the Work, provided that such additional attribution notices cannot be construed as modifying the License. You may add Your own copyright statement to Your modifications and may provide additional or different license terms and conditions for use, reproduction, or distribution of Your modifications, or for any such Derivative Works as a whole, provided Your use, reproduction, and distribution of the Work otherwise complies with the conditions stated in this License. +5. Submission of Contributions. Unless You explicitly state otherwise, any Contribution intentionally submitted for inclusion in the Work by You to the Licensor shall be under the terms and conditions of this License, without any additional terms or conditions. Notwithstanding the above, nothing herein shall supersede or modify the terms of any separate license agreement you may have executed with Licensor regarding such Contributions. +6. Trademarks. This License does not grant permission to use the trade names, trademarks, service marks, or product names of the Licensor, except as required for reasonable and customary use in describing the origin of the Work and reproducing the content of the NOTICE file. +7. Disclaimer of Warranty. Unless required by applicable law or agreed to in writing, Licensor provides the Work (and each Contributor provides its Contributions) on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied, including, without limitation, any warranties or conditions of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A PARTICULAR PURPOSE. You are solely responsible for determining the appropriateness of using or redistributing the Work and assume any risks associated with Your exercise of permissions under this License. +8. Limitation of Liability. In no event and under no legal theory, whether in tort (including negligence), contract, or otherwise, unless required by applicable law (such as deliberate and grossly negligent acts) or agreed to in writing, shall any Contributor be liable to You for damages, including any direct, indirect, special, incidental, or consequential damages of any character arising as a result of this License or out of the use or inability to use the Work (including but not limited to damages for loss of goodwill, work stoppage, computer failure or malfunction, or any and all other commercial damages or losses), even if such Contributor has been advised of the possibility of such damages. +9. Accepting Warranty or Additional Liability. While redistributing the Work or Derivative Works thereof, You may choose to offer, and charge a fee for, acceptance of support, warranty, indemnity, or other liability obligations and/or rights consistent with this License. However, in accepting such obligations, You may act only on Your own behalf and on Your sole responsibility, not on behalf of any other Contributor, and only if You agree to indemnify, defend, and hold each Contributor harmless for any liability incurred by, or claims asserted against, such Contributor by reason of your accepting any such warranty or additional liability. +END OF TERMS AND CONDITIONS \ No newline at end of file diff --git a/tunestats/app/api/node_modules/caseless/README.md b/tunestats/app/api/node_modules/caseless/README.md new file mode 100644 index 0000000..e5077a2 --- /dev/null +++ b/tunestats/app/api/node_modules/caseless/README.md @@ -0,0 +1,45 @@ +## Caseless -- wrap an object to set and get property with caseless semantics but also preserve caseing. + +This library is incredibly useful when working with HTTP headers. It allows you to get/set/check for headers in a caseless manner while also preserving the caseing of headers the first time they are set. + +## Usage + +```javascript +var headers = {} + , c = caseless(headers) + ; +c.set('a-Header', 'asdf') +c.get('a-header') === 'asdf' +``` + +## has(key) + +Has takes a name and if it finds a matching header will return that header name with the preserved caseing it was set with. + +```javascript +c.has('a-header') === 'a-Header' +``` + +## set(key, value[, clobber=true]) + +Set is fairly straight forward except that if the header exists and clobber is disabled it will add `','+value` to the existing header. + +```javascript +c.set('a-Header', 'fdas') +c.set('a-HEADER', 'more', false) +c.get('a-header') === 'fdsa,more' +``` + +## swap(key) + +Swaps the casing of a header with the new one that is passed in. + +```javascript +var headers = {} + , c = caseless(headers) + ; +c.set('a-Header', 'fdas') +c.swap('a-HEADER') +c.has('a-header') === 'a-HEADER' +headers === {'a-HEADER': 'fdas'} +``` diff --git a/tunestats/app/api/node_modules/caseless/index.js b/tunestats/app/api/node_modules/caseless/index.js new file mode 100644 index 0000000..b194734 --- /dev/null +++ b/tunestats/app/api/node_modules/caseless/index.js @@ -0,0 +1,67 @@ +function Caseless (dict) { + this.dict = dict || {} +} +Caseless.prototype.set = function (name, value, clobber) { + if (typeof name === 'object') { + for (var i in name) { + this.set(i, name[i], value) + } + } else { + if (typeof clobber === 'undefined') clobber = true + var has = this.has(name) + + if (!clobber && has) this.dict[has] = this.dict[has] + ',' + value + else this.dict[has || name] = value + return has + } +} +Caseless.prototype.has = function (name) { + var keys = Object.keys(this.dict) + , name = name.toLowerCase() + ; + for (var i=0;i", + "license": "Apache-2.0", + "bugs": { + "url": "https://github.com/mikeal/caseless/issues" + }, + "devDependencies": { + "tape": "^2.10.2" + } +} diff --git a/tunestats/app/api/node_modules/caseless/test.js b/tunestats/app/api/node_modules/caseless/test.js new file mode 100644 index 0000000..f55196c --- /dev/null +++ b/tunestats/app/api/node_modules/caseless/test.js @@ -0,0 +1,67 @@ +var tape = require('tape') + , caseless = require('./') + ; + +tape('set get has', function (t) { + var headers = {} + , c = caseless(headers) + ; + t.plan(17) + c.set('a-Header', 'asdf') + t.equal(c.get('a-header'), 'asdf') + t.equal(c.has('a-header'), 'a-Header') + t.ok(!c.has('nothing')) + // old bug where we used the wrong regex + t.ok(!c.has('a-hea')) + c.set('a-header', 'fdsa') + t.equal(c.get('a-header'), 'fdsa') + t.equal(c.get('a-Header'), 'fdsa') + c.set('a-HEADER', 'more', false) + t.equal(c.get('a-header'), 'fdsa,more') + + t.deepEqual(headers, {'a-Header': 'fdsa,more'}) + c.swap('a-HEADER') + t.deepEqual(headers, {'a-HEADER': 'fdsa,more'}) + + c.set('deleteme', 'foobar') + t.ok(c.has('deleteme')) + t.ok(c.del('deleteme')) + t.notOk(c.has('deleteme')) + t.notOk(c.has('idonotexist')) + t.ok(c.del('idonotexist')) + + c.set('tva', 'test1') + c.set('tva-header', 'test2') + t.equal(c.has('tva'), 'tva') + t.notOk(c.has('header')) + + t.equal(c.get('tva'), 'test1') + +}) + +tape('swap', function (t) { + var headers = {} + , c = caseless(headers) + ; + t.plan(4) + // No Header to Swap. + t.throws(function () { + c.swap('content-type') + }) + // Set Header. + c.set('content-type', 'application/json') + // Swap Header With Itself. + c.swap('content-type') + // Does Not Delete Itself. + t.ok(c.has('content-type')) + // Swap Header With a Different Header. + c.swap('Content-Type') + // Still Has Header. + t.ok(c.has('Content-Type')) + // Delete Header. + c.del('Content-Type') + // No Header to Swap. + t.throws(function () { + c.swap('content-type') + }) +}) diff --git a/tunestats/app/api/node_modules/chokidar/LICENSE b/tunestats/app/api/node_modules/chokidar/LICENSE new file mode 100644 index 0000000..fa9162b --- /dev/null +++ b/tunestats/app/api/node_modules/chokidar/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2012-2019 Paul Miller (https://paulmillr.com), Elan Shanker + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the “Software”), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED “AS IS”, WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/chokidar/README.md b/tunestats/app/api/node_modules/chokidar/README.md new file mode 100644 index 0000000..8e25dec --- /dev/null +++ b/tunestats/app/api/node_modules/chokidar/README.md @@ -0,0 +1,308 @@ +# Chokidar [![Weekly downloads](https://img.shields.io/npm/dw/chokidar.svg)](https://github.com/paulmillr/chokidar) [![Yearly downloads](https://img.shields.io/npm/dy/chokidar.svg)](https://github.com/paulmillr/chokidar) + +> Minimal and efficient cross-platform file watching library + +[![NPM](https://nodei.co/npm/chokidar.png)](https://www.npmjs.com/package/chokidar) + +## Why? + +Node.js `fs.watch`: + +* Doesn't report filenames on MacOS. +* Doesn't report events at all when using editors like Sublime on MacOS. +* Often reports events twice. +* Emits most changes as `rename`. +* Does not provide an easy way to recursively watch file trees. +* Does not support recursive watching on Linux. + +Node.js `fs.watchFile`: + +* Almost as bad at event handling. +* Also does not provide any recursive watching. +* Results in high CPU utilization. + +Chokidar resolves these problems. + +Initially made for **[Brunch](https://brunch.io/)** (an ultra-swift web app build tool), it is now used in +[Microsoft's Visual Studio Code](https://github.com/microsoft/vscode), +[gulp](https://github.com/gulpjs/gulp/), +[karma](https://karma-runner.github.io/), +[PM2](https://github.com/Unitech/PM2), +[browserify](http://browserify.org/), +[webpack](https://webpack.github.io/), +[BrowserSync](https://www.browsersync.io/), +and [many others](https://www.npmjs.com/browse/depended/chokidar). +It has proven itself in production environments. + +Version 3 is out! Check out our blog post about it: [Chokidar 3: How to save 32TB of traffic every week](https://paulmillr.com/posts/chokidar-3-save-32tb-of-traffic/) + +## How? + +Chokidar does still rely on the Node.js core `fs` module, but when using +`fs.watch` and `fs.watchFile` for watching, it normalizes the events it +receives, often checking for truth by getting file stats and/or dir contents. + +On MacOS, chokidar by default uses a native extension exposing the Darwin +`FSEvents` API. This provides very efficient recursive watching compared with +implementations like `kqueue` available on most \*nix platforms. Chokidar still +does have to do some work to normalize the events received that way as well. + +On most other platforms, the `fs.watch`-based implementation is the default, which +avoids polling and keeps CPU usage down. Be advised that chokidar will initiate +watchers recursively for everything within scope of the paths that have been +specified, so be judicious about not wasting system resources by watching much +more than needed. + +## Getting started + +Install with npm: + +```sh +npm install chokidar +``` + +Then `require` and use it in your code: + +```javascript +const chokidar = require('chokidar'); + +// One-liner for current directory +chokidar.watch('.').on('all', (event, path) => { + console.log(event, path); +}); +``` + +## API + +```javascript +// Example of a more typical implementation structure + +// Initialize watcher. +const watcher = chokidar.watch('file, dir, glob, or array', { + ignored: /(^|[\/\\])\../, // ignore dotfiles + persistent: true +}); + +// Something to use when events are received. +const log = console.log.bind(console); +// Add event listeners. +watcher + .on('add', path => log(`File ${path} has been added`)) + .on('change', path => log(`File ${path} has been changed`)) + .on('unlink', path => log(`File ${path} has been removed`)); + +// More possible events. +watcher + .on('addDir', path => log(`Directory ${path} has been added`)) + .on('unlinkDir', path => log(`Directory ${path} has been removed`)) + .on('error', error => log(`Watcher error: ${error}`)) + .on('ready', () => log('Initial scan complete. Ready for changes')) + .on('raw', (event, path, details) => { // internal + log('Raw event info:', event, path, details); + }); + +// 'add', 'addDir' and 'change' events also receive stat() results as second +// argument when available: https://nodejs.org/api/fs.html#fs_class_fs_stats +watcher.on('change', (path, stats) => { + if (stats) console.log(`File ${path} changed size to ${stats.size}`); +}); + +// Watch new files. +watcher.add('new-file'); +watcher.add(['new-file-2', 'new-file-3', '**/other-file*']); + +// Get list of actual paths being watched on the filesystem +var watchedPaths = watcher.getWatched(); + +// Un-watch some files. +await watcher.unwatch('new-file*'); + +// Stop watching. +// The method is async! +watcher.close().then(() => console.log('closed')); + +// Full list of options. See below for descriptions. +// Do not use this example! +chokidar.watch('file', { + persistent: true, + + ignored: '*.txt', + ignoreInitial: false, + followSymlinks: true, + cwd: '.', + disableGlobbing: false, + + usePolling: false, + interval: 100, + binaryInterval: 300, + alwaysStat: false, + depth: 99, + awaitWriteFinish: { + stabilityThreshold: 2000, + pollInterval: 100 + }, + + ignorePermissionErrors: false, + atomic: true // or a custom 'atomicity delay', in milliseconds (default 100) +}); + +``` + +`chokidar.watch(paths, [options])` + +* `paths` (string or array of strings). Paths to files, dirs to be watched +recursively, or glob patterns. + - Note: globs must not contain windows separators (`\`), + because that's how they work by the standard — + you'll need to replace them with forward slashes (`/`). + - Note 2: for additional glob documentation, check out low-level + library: [picomatch](https://github.com/micromatch/picomatch). +* `options` (object) Options object as defined below: + +#### Persistence + +* `persistent` (default: `true`). Indicates whether the process +should continue to run as long as files are being watched. If set to +`false` when using `fsevents` to watch, no more events will be emitted +after `ready`, even if the process continues to run. + +#### Path filtering + +* `ignored` ([anymatch](https://github.com/es128/anymatch)-compatible definition) +Defines files/paths to be ignored. The whole relative or absolute path is +tested, not just filename. If a function with two arguments is provided, it +gets called twice per path - once with a single argument (the path), second +time with two arguments (the path and the +[`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) +object of that path). +* `ignoreInitial` (default: `false`). If set to `false` then `add`/`addDir` events are also emitted for matching paths while +instantiating the watching as chokidar discovers these file paths (before the `ready` event). +* `followSymlinks` (default: `true`). When `false`, only the +symlinks themselves will be watched for changes instead of following +the link references and bubbling events through the link's path. +* `cwd` (no default). The base directory from which watch `paths` are to be +derived. Paths emitted with events will be relative to this. +* `disableGlobbing` (default: `false`). If set to `true` then the strings passed to `.watch()` and `.add()` are treated as +literal path names, even if they look like globs. + +#### Performance + +* `usePolling` (default: `false`). +Whether to use fs.watchFile (backed by polling), or fs.watch. If polling +leads to high CPU utilization, consider setting this to `false`. It is +typically necessary to **set this to `true` to successfully watch files over +a network**, and it may be necessary to successfully watch files in other +non-standard situations. Setting to `true` explicitly on MacOS overrides the +`useFsEvents` default. You may also set the CHOKIDAR_USEPOLLING env variable +to true (1) or false (0) in order to override this option. +* _Polling-specific settings_ (effective when `usePolling: true`) + * `interval` (default: `100`). Interval of file system polling, in milliseconds. You may also + set the CHOKIDAR_INTERVAL env variable to override this option. + * `binaryInterval` (default: `300`). Interval of file system + polling for binary files. + ([see list of binary extensions](https://github.com/sindresorhus/binary-extensions/blob/master/binary-extensions.json)) +* `useFsEvents` (default: `true` on MacOS). Whether to use the +`fsevents` watching interface if available. When set to `true` explicitly +and `fsevents` is available this supercedes the `usePolling` setting. When +set to `false` on MacOS, `usePolling: true` becomes the default. +* `alwaysStat` (default: `false`). If relying upon the +[`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) +object that may get passed with `add`, `addDir`, and `change` events, set +this to `true` to ensure it is provided even in cases where it wasn't +already available from the underlying watch events. +* `depth` (default: `undefined`). If set, limits how many levels of +subdirectories will be traversed. +* `awaitWriteFinish` (default: `false`). +By default, the `add` event will fire when a file first appears on disk, before +the entire file has been written. Furthermore, in some cases some `change` +events will be emitted while the file is being written. In some cases, +especially when watching for large files there will be a need to wait for the +write operation to finish before responding to a file creation or modification. +Setting `awaitWriteFinish` to `true` (or a truthy value) will poll file size, +holding its `add` and `change` events until the size does not change for a +configurable amount of time. The appropriate duration setting is heavily +dependent on the OS and hardware. For accurate detection this parameter should +be relatively high, making file watching much less responsive. +Use with caution. + * *`options.awaitWriteFinish` can be set to an object in order to adjust + timing params:* + * `awaitWriteFinish.stabilityThreshold` (default: 2000). Amount of time in + milliseconds for a file size to remain constant before emitting its event. + * `awaitWriteFinish.pollInterval` (default: 100). File size polling interval, in milliseconds. + +#### Errors + +* `ignorePermissionErrors` (default: `false`). Indicates whether to watch files +that don't have read permissions if possible. If watching fails due to `EPERM` +or `EACCES` with this set to `true`, the errors will be suppressed silently. +* `atomic` (default: `true` if `useFsEvents` and `usePolling` are `false`). +Automatically filters out artifacts that occur when using editors that use +"atomic writes" instead of writing directly to the source file. If a file is +re-added within 100 ms of being deleted, Chokidar emits a `change` event +rather than `unlink` then `add`. If the default of 100 ms does not work well +for you, you can override it by setting `atomic` to a custom value, in +milliseconds. + +### Methods & Events + +`chokidar.watch()` produces an instance of `FSWatcher`. Methods of `FSWatcher`: + +* `.add(path / paths)`: Add files, directories, or glob patterns for tracking. +Takes an array of strings or just one string. +* `.on(event, callback)`: Listen for an FS event. +Available events: `add`, `addDir`, `change`, `unlink`, `unlinkDir`, `ready`, +`raw`, `error`. +Additionally `all` is available which gets emitted with the underlying event +name and path for every event other than `ready`, `raw`, and `error`. `raw` is internal, use it carefully. +* `.unwatch(path / paths)`: Stop watching files, directories, or glob patterns. +Takes an array of strings or just one string. +* `.close()`: **async** Removes all listeners from watched files. Asynchronous, returns Promise. Use with `await` to ensure bugs don't happen. +* `.getWatched()`: Returns an object representing all the paths on the file +system being watched by this `FSWatcher` instance. The object's keys are all the +directories (using absolute paths unless the `cwd` option was used), and the +values are arrays of the names of the items contained in each directory. + +## CLI + +If you need a CLI interface for your file watching, check out +[chokidar-cli](https://github.com/open-cli-tools/chokidar-cli), allowing you to +execute a command on each change, or get a stdio stream of change events. + +## Install Troubleshooting + +* `npm WARN optional dep failed, continuing fsevents@n.n.n` + * This message is normal part of how `npm` handles optional dependencies and is + not indicative of a problem. Even if accompanied by other related error messages, + Chokidar should function properly. + +* `TypeError: fsevents is not a constructor` + * Update chokidar by doing `rm -rf node_modules package-lock.json yarn.lock && npm install`, or update your dependency that uses chokidar. + +* Chokidar is producing `ENOSP` error on Linux, like this: + * `bash: cannot set terminal process group (-1): Inappropriate ioctl for device bash: no job control in this shell` + `Error: watch /home/ ENOSPC` + * This means Chokidar ran out of file handles and you'll need to increase their count by executing the following command in Terminal: + `echo fs.inotify.max_user_watches=524288 | sudo tee -a /etc/sysctl.conf && sudo sysctl -p` + +## Changelog + +For more detailed changelog, see [`full_changelog.md`](.github/full_changelog.md). +- **v3.5 (Jan 6, 2021):** Support for ARM Macs with Apple Silicon. Fixes for deleted symlinks. +- **v3.4 (Apr 26, 2020):** Support for directory-based symlinks. Fixes for macos file replacement. +- **v3.3 (Nov 2, 2019):** `FSWatcher#close()` method became async. That fixes IO race conditions related to close method. +- **v3.2 (Oct 1, 2019):** Improve Linux RAM usage by 50%. Race condition fixes. Windows glob fixes. Improve stability by using tight range of dependency versions. +- **v3.1 (Sep 16, 2019):** dotfiles are no longer filtered out by default. Use `ignored` option if needed. Improve initial Linux scan time by 50%. +- **v3 (Apr 30, 2019):** massive CPU & RAM consumption improvements; reduces deps / package size by a factor of 17x and bumps Node.js requirement to v8.16 and higher. +- **v2 (Dec 29, 2017):** Globs are now posix-style-only; without windows support. Tons of bugfixes. +- **v1 (Apr 7, 2015):** Glob support, symlink support, tons of bugfixes. Node 0.8+ is supported +- **v0.1 (Apr 20, 2012):** Initial release, extracted from [Brunch](https://github.com/brunch/brunch/blob/9847a065aea300da99bd0753f90354cde9de1261/src/helpers.coffee#L66) + +## Also + +Why was chokidar named this way? What's the meaning behind it? + +>Chowkidar is a transliteration of a Hindi word meaning 'watchman, gatekeeper', चौकीदार. This ultimately comes from Sanskrit _ चतुष्क_ (crossway, quadrangle, consisting-of-four). This word is also used in other languages like Urdu as (چوکیدار) which is widely used in Pakistan and India. + +## License + +MIT (c) Paul Miller (), see [LICENSE](LICENSE) file. diff --git a/tunestats/app/api/node_modules/chokidar/index.js b/tunestats/app/api/node_modules/chokidar/index.js new file mode 100644 index 0000000..8752893 --- /dev/null +++ b/tunestats/app/api/node_modules/chokidar/index.js @@ -0,0 +1,973 @@ +'use strict'; + +const { EventEmitter } = require('events'); +const fs = require('fs'); +const sysPath = require('path'); +const { promisify } = require('util'); +const readdirp = require('readdirp'); +const anymatch = require('anymatch').default; +const globParent = require('glob-parent'); +const isGlob = require('is-glob'); +const braces = require('braces'); +const normalizePath = require('normalize-path'); + +const NodeFsHandler = require('./lib/nodefs-handler'); +const FsEventsHandler = require('./lib/fsevents-handler'); +const { + EV_ALL, + EV_READY, + EV_ADD, + EV_CHANGE, + EV_UNLINK, + EV_ADD_DIR, + EV_UNLINK_DIR, + EV_RAW, + EV_ERROR, + + STR_CLOSE, + STR_END, + + BACK_SLASH_RE, + DOUBLE_SLASH_RE, + SLASH_OR_BACK_SLASH_RE, + DOT_RE, + REPLACER_RE, + + SLASH, + SLASH_SLASH, + BRACE_START, + BANG, + ONE_DOT, + TWO_DOTS, + GLOBSTAR, + SLASH_GLOBSTAR, + ANYMATCH_OPTS, + STRING_TYPE, + FUNCTION_TYPE, + EMPTY_STR, + EMPTY_FN, + + isWindows, + isMacos, + isIBMi +} = require('./lib/constants'); + +const stat = promisify(fs.stat); +const readdir = promisify(fs.readdir); + +/** + * @typedef {String} Path + * @typedef {'all'|'add'|'addDir'|'change'|'unlink'|'unlinkDir'|'raw'|'error'|'ready'} EventName + * @typedef {'readdir'|'watch'|'add'|'remove'|'change'} ThrottleType + */ + +/** + * + * @typedef {Object} WatchHelpers + * @property {Boolean} followSymlinks + * @property {'stat'|'lstat'} statMethod + * @property {Path} path + * @property {Path} watchPath + * @property {Function} entryPath + * @property {Boolean} hasGlob + * @property {Object} globFilter + * @property {Function} filterPath + * @property {Function} filterDir + */ + +const arrify = (value = []) => Array.isArray(value) ? value : [value]; +const flatten = (list, result = []) => { + list.forEach(item => { + if (Array.isArray(item)) { + flatten(item, result); + } else { + result.push(item); + } + }); + return result; +}; + +const unifyPaths = (paths_) => { + /** + * @type {Array} + */ + const paths = flatten(arrify(paths_)); + if (!paths.every(p => typeof p === STRING_TYPE)) { + throw new TypeError(`Non-string provided as watch path: ${paths}`); + } + return paths.map(normalizePathToUnix); +}; + +// If SLASH_SLASH occurs at the beginning of path, it is not replaced +// because "//StoragePC/DrivePool/Movies" is a valid network path +const toUnix = (string) => { + let str = string.replace(BACK_SLASH_RE, SLASH); + let prepend = false; + if (str.startsWith(SLASH_SLASH)) { + prepend = true; + } + while (str.match(DOUBLE_SLASH_RE)) { + str = str.replace(DOUBLE_SLASH_RE, SLASH); + } + if (prepend) { + str = SLASH + str; + } + return str; +}; + +// Our version of upath.normalize +// TODO: this is not equal to path-normalize module - investigate why +const normalizePathToUnix = (path) => toUnix(sysPath.normalize(toUnix(path))); + +const normalizeIgnored = (cwd = EMPTY_STR) => (path) => { + if (typeof path !== STRING_TYPE) return path; + return normalizePathToUnix(sysPath.isAbsolute(path) ? path : sysPath.join(cwd, path)); +}; + +const getAbsolutePath = (path, cwd) => { + if (sysPath.isAbsolute(path)) { + return path; + } + if (path.startsWith(BANG)) { + return BANG + sysPath.join(cwd, path.slice(1)); + } + return sysPath.join(cwd, path); +}; + +const undef = (opts, key) => opts[key] === undefined; + +/** + * Directory entry. + * @property {Path} path + * @property {Set} items + */ +class DirEntry { + /** + * @param {Path} dir + * @param {Function} removeWatcher + */ + constructor(dir, removeWatcher) { + this.path = dir; + this._removeWatcher = removeWatcher; + /** @type {Set} */ + this.items = new Set(); + } + + add(item) { + const {items} = this; + if (!items) return; + if (item !== ONE_DOT && item !== TWO_DOTS) items.add(item); + } + + async remove(item) { + const {items} = this; + if (!items) return; + items.delete(item); + if (items.size > 0) return; + + const dir = this.path; + try { + await readdir(dir); + } catch (err) { + if (this._removeWatcher) { + this._removeWatcher(sysPath.dirname(dir), sysPath.basename(dir)); + } + } + } + + has(item) { + const {items} = this; + if (!items) return; + return items.has(item); + } + + /** + * @returns {Array} + */ + getChildren() { + const {items} = this; + if (!items) return; + return [...items.values()]; + } + + dispose() { + this.items.clear(); + delete this.path; + delete this._removeWatcher; + delete this.items; + Object.freeze(this); + } +} + +const STAT_METHOD_F = 'stat'; +const STAT_METHOD_L = 'lstat'; +class WatchHelper { + constructor(path, watchPath, follow, fsw) { + this.fsw = fsw; + this.path = path = path.replace(REPLACER_RE, EMPTY_STR); + this.watchPath = watchPath; + this.fullWatchPath = sysPath.resolve(watchPath); + this.hasGlob = watchPath !== path; + /** @type {object|boolean} */ + if (path === EMPTY_STR) this.hasGlob = false; + this.globSymlink = this.hasGlob && follow ? undefined : false; + this.globFilter = this.hasGlob ? anymatch(path, undefined, ANYMATCH_OPTS) : false; + this.dirParts = this.getDirParts(path); + this.dirParts.forEach((parts) => { + if (parts.length > 1) parts.pop(); + }); + this.followSymlinks = follow; + this.statMethod = follow ? STAT_METHOD_F : STAT_METHOD_L; + } + + checkGlobSymlink(entry) { + // only need to resolve once + // first entry should always have entry.parentDir === EMPTY_STR + if (this.globSymlink === undefined) { + this.globSymlink = entry.fullParentDir === this.fullWatchPath ? + false : {realPath: entry.fullParentDir, linkPath: this.fullWatchPath}; + } + + if (this.globSymlink) { + return entry.fullPath.replace(this.globSymlink.realPath, this.globSymlink.linkPath); + } + + return entry.fullPath; + } + + entryPath(entry) { + return sysPath.join(this.watchPath, + sysPath.relative(this.watchPath, this.checkGlobSymlink(entry)) + ); + } + + filterPath(entry) { + const {stats} = entry; + if (stats && stats.isSymbolicLink()) return this.filterDir(entry); + const resolvedPath = this.entryPath(entry); + const matchesGlob = this.hasGlob && typeof this.globFilter === FUNCTION_TYPE ? + this.globFilter(resolvedPath) : true; + return matchesGlob && + this.fsw._isntIgnored(resolvedPath, stats) && + this.fsw._hasReadPermissions(stats); + } + + getDirParts(path) { + if (!this.hasGlob) return []; + const parts = []; + const expandedPath = path.includes(BRACE_START) ? braces.expand(path) : [path]; + expandedPath.forEach((path) => { + parts.push(sysPath.relative(this.watchPath, path).split(SLASH_OR_BACK_SLASH_RE)); + }); + return parts; + } + + filterDir(entry) { + if (this.hasGlob) { + const entryParts = this.getDirParts(this.checkGlobSymlink(entry)); + let globstar = false; + this.unmatchedGlob = !this.dirParts.some((parts) => { + return parts.every((part, i) => { + if (part === GLOBSTAR) globstar = true; + return globstar || !entryParts[0][i] || anymatch(part, entryParts[0][i], ANYMATCH_OPTS); + }); + }); + } + return !this.unmatchedGlob && this.fsw._isntIgnored(this.entryPath(entry), entry.stats); + } +} + +/** + * Watches files & directories for changes. Emitted events: + * `add`, `addDir`, `change`, `unlink`, `unlinkDir`, `all`, `error` + * + * new FSWatcher() + * .add(directories) + * .on('add', path => log('File', path, 'was added')) + */ +class FSWatcher extends EventEmitter { +// Not indenting methods for history sake; for now. +constructor(_opts) { + super(); + + const opts = {}; + if (_opts) Object.assign(opts, _opts); // for frozen objects + + /** @type {Map} */ + this._watched = new Map(); + /** @type {Map} */ + this._closers = new Map(); + /** @type {Set} */ + this._ignoredPaths = new Set(); + + /** @type {Map} */ + this._throttled = new Map(); + + /** @type {Map} */ + this._symlinkPaths = new Map(); + + this._streams = new Set(); + this.closed = false; + + // Set up default options. + if (undef(opts, 'persistent')) opts.persistent = true; + if (undef(opts, 'ignoreInitial')) opts.ignoreInitial = false; + if (undef(opts, 'ignorePermissionErrors')) opts.ignorePermissionErrors = false; + if (undef(opts, 'interval')) opts.interval = 100; + if (undef(opts, 'binaryInterval')) opts.binaryInterval = 300; + if (undef(opts, 'disableGlobbing')) opts.disableGlobbing = false; + opts.enableBinaryInterval = opts.binaryInterval !== opts.interval; + + // Enable fsevents on OS X when polling isn't explicitly enabled. + if (undef(opts, 'useFsEvents')) opts.useFsEvents = !opts.usePolling; + + // If we can't use fsevents, ensure the options reflect it's disabled. + const canUseFsEvents = FsEventsHandler.canUse(); + if (!canUseFsEvents) opts.useFsEvents = false; + + // Use polling on Mac if not using fsevents. + // Other platforms use non-polling fs_watch. + if (undef(opts, 'usePolling') && !opts.useFsEvents) { + opts.usePolling = isMacos; + } + + // Always default to polling on IBM i because fs.watch() is not available on IBM i. + if(isIBMi) { + opts.usePolling = true; + } + + // Global override (useful for end-developers that need to force polling for all + // instances of chokidar, regardless of usage/dependency depth) + const envPoll = process.env.CHOKIDAR_USEPOLLING; + if (envPoll !== undefined) { + const envLower = envPoll.toLowerCase(); + + if (envLower === 'false' || envLower === '0') { + opts.usePolling = false; + } else if (envLower === 'true' || envLower === '1') { + opts.usePolling = true; + } else { + opts.usePolling = !!envLower; + } + } + const envInterval = process.env.CHOKIDAR_INTERVAL; + if (envInterval) { + opts.interval = Number.parseInt(envInterval, 10); + } + + // Editor atomic write normalization enabled by default with fs.watch + if (undef(opts, 'atomic')) opts.atomic = !opts.usePolling && !opts.useFsEvents; + if (opts.atomic) this._pendingUnlinks = new Map(); + + if (undef(opts, 'followSymlinks')) opts.followSymlinks = true; + + if (undef(opts, 'awaitWriteFinish')) opts.awaitWriteFinish = false; + if (opts.awaitWriteFinish === true) opts.awaitWriteFinish = {}; + const awf = opts.awaitWriteFinish; + if (awf) { + if (!awf.stabilityThreshold) awf.stabilityThreshold = 2000; + if (!awf.pollInterval) awf.pollInterval = 100; + this._pendingWrites = new Map(); + } + if (opts.ignored) opts.ignored = arrify(opts.ignored); + + let readyCalls = 0; + this._emitReady = () => { + readyCalls++; + if (readyCalls >= this._readyCount) { + this._emitReady = EMPTY_FN; + this._readyEmitted = true; + // use process.nextTick to allow time for listener to be bound + process.nextTick(() => this.emit(EV_READY)); + } + }; + this._emitRaw = (...args) => this.emit(EV_RAW, ...args); + this._readyEmitted = false; + this.options = opts; + + // Initialize with proper watcher. + if (opts.useFsEvents) { + this._fsEventsHandler = new FsEventsHandler(this); + } else { + this._nodeFsHandler = new NodeFsHandler(this); + } + + // You’re frozen when your heart’s not open. + Object.freeze(opts); +} + +// Public methods + +/** + * Adds paths to be watched on an existing FSWatcher instance + * @param {Path|Array} paths_ + * @param {String=} _origAdd private; for handling non-existent paths to be watched + * @param {Boolean=} _internal private; indicates a non-user add + * @returns {FSWatcher} for chaining + */ +add(paths_, _origAdd, _internal) { + const {cwd, disableGlobbing} = this.options; + this.closed = false; + let paths = unifyPaths(paths_); + if (cwd) { + paths = paths.map((path) => { + const absPath = getAbsolutePath(path, cwd); + + // Check `path` instead of `absPath` because the cwd portion can't be a glob + if (disableGlobbing || !isGlob(path)) { + return absPath; + } + return normalizePath(absPath); + }); + } + + // set aside negated glob strings + paths = paths.filter((path) => { + if (path.startsWith(BANG)) { + this._ignoredPaths.add(path.slice(1)); + return false; + } + + // if a path is being added that was previously ignored, stop ignoring it + this._ignoredPaths.delete(path); + this._ignoredPaths.delete(path + SLASH_GLOBSTAR); + + // reset the cached userIgnored anymatch fn + // to make ignoredPaths changes effective + this._userIgnored = undefined; + + return true; + }); + + if (this.options.useFsEvents && this._fsEventsHandler) { + if (!this._readyCount) this._readyCount = paths.length; + if (this.options.persistent) this._readyCount += paths.length; + paths.forEach((path) => this._fsEventsHandler._addToFsEvents(path)); + } else { + if (!this._readyCount) this._readyCount = 0; + this._readyCount += paths.length; + Promise.all( + paths.map(async path => { + const res = await this._nodeFsHandler._addToNodeFs(path, !_internal, 0, 0, _origAdd); + if (res) this._emitReady(); + return res; + }) + ).then(results => { + if (this.closed) return; + results.filter(item => item).forEach(item => { + this.add(sysPath.dirname(item), sysPath.basename(_origAdd || item)); + }); + }); + } + + return this; +} + +/** + * Close watchers or start ignoring events from specified paths. + * @param {Path|Array} paths_ - string or array of strings, file/directory paths and/or globs + * @returns {FSWatcher} for chaining +*/ +unwatch(paths_) { + if (this.closed) return this; + const paths = unifyPaths(paths_); + const {cwd} = this.options; + + paths.forEach((path) => { + // convert to absolute path unless relative path already matches + if (!sysPath.isAbsolute(path) && !this._closers.has(path)) { + if (cwd) path = sysPath.join(cwd, path); + path = sysPath.resolve(path); + } + + this._closePath(path); + + this._ignoredPaths.add(path); + if (this._watched.has(path)) { + this._ignoredPaths.add(path + SLASH_GLOBSTAR); + } + + // reset the cached userIgnored anymatch fn + // to make ignoredPaths changes effective + this._userIgnored = undefined; + }); + + return this; +} + +/** + * Close watchers and remove all listeners from watched paths. + * @returns {Promise}. +*/ +close() { + if (this.closed) return this._closePromise; + this.closed = true; + + // Memory management. + this.removeAllListeners(); + const closers = []; + this._closers.forEach(closerList => closerList.forEach(closer => { + const promise = closer(); + if (promise instanceof Promise) closers.push(promise); + })); + this._streams.forEach(stream => stream.destroy()); + this._userIgnored = undefined; + this._readyCount = 0; + this._readyEmitted = false; + this._watched.forEach(dirent => dirent.dispose()); + ['closers', 'watched', 'streams', 'symlinkPaths', 'throttled'].forEach(key => { + this[`_${key}`].clear(); + }); + + this._closePromise = closers.length ? Promise.all(closers).then(() => undefined) : Promise.resolve(); + return this._closePromise; +} + +/** + * Expose list of watched paths + * @returns {Object} for chaining +*/ +getWatched() { + const watchList = {}; + this._watched.forEach((entry, dir) => { + const key = this.options.cwd ? sysPath.relative(this.options.cwd, dir) : dir; + watchList[key || ONE_DOT] = entry.getChildren().sort(); + }); + return watchList; +} + +emitWithAll(event, args) { + this.emit(...args); + if (event !== EV_ERROR) this.emit(EV_ALL, ...args); +} + +// Common helpers +// -------------- + +/** + * Normalize and emit events. + * Calling _emit DOES NOT MEAN emit() would be called! + * @param {EventName} event Type of event + * @param {Path} path File or directory path + * @param {*=} val1 arguments to be passed with event + * @param {*=} val2 + * @param {*=} val3 + * @returns the error if defined, otherwise the value of the FSWatcher instance's `closed` flag + */ +async _emit(event, path, val1, val2, val3) { + if (this.closed) return; + + const opts = this.options; + if (isWindows) path = sysPath.normalize(path); + if (opts.cwd) path = sysPath.relative(opts.cwd, path); + /** @type Array */ + const args = [event, path]; + if (val3 !== undefined) args.push(val1, val2, val3); + else if (val2 !== undefined) args.push(val1, val2); + else if (val1 !== undefined) args.push(val1); + + const awf = opts.awaitWriteFinish; + let pw; + if (awf && (pw = this._pendingWrites.get(path))) { + pw.lastChange = new Date(); + return this; + } + + if (opts.atomic) { + if (event === EV_UNLINK) { + this._pendingUnlinks.set(path, args); + setTimeout(() => { + this._pendingUnlinks.forEach((entry, path) => { + this.emit(...entry); + this.emit(EV_ALL, ...entry); + this._pendingUnlinks.delete(path); + }); + }, typeof opts.atomic === 'number' ? opts.atomic : 100); + return this; + } + if (event === EV_ADD && this._pendingUnlinks.has(path)) { + event = args[0] = EV_CHANGE; + this._pendingUnlinks.delete(path); + } + } + + if (awf && (event === EV_ADD || event === EV_CHANGE) && this._readyEmitted) { + const awfEmit = (err, stats) => { + if (err) { + event = args[0] = EV_ERROR; + args[1] = err; + this.emitWithAll(event, args); + } else if (stats) { + // if stats doesn't exist the file must have been deleted + if (args.length > 2) { + args[2] = stats; + } else { + args.push(stats); + } + this.emitWithAll(event, args); + } + }; + + this._awaitWriteFinish(path, awf.stabilityThreshold, event, awfEmit); + return this; + } + + if (event === EV_CHANGE) { + const isThrottled = !this._throttle(EV_CHANGE, path, 50); + if (isThrottled) return this; + } + + if (opts.alwaysStat && val1 === undefined && + (event === EV_ADD || event === EV_ADD_DIR || event === EV_CHANGE) + ) { + const fullPath = opts.cwd ? sysPath.join(opts.cwd, path) : path; + let stats; + try { + stats = await stat(fullPath); + } catch (err) {} + // Suppress event when fs_stat fails, to avoid sending undefined 'stat' + if (!stats || this.closed) return; + args.push(stats); + } + this.emitWithAll(event, args); + + return this; +} + +/** + * Common handler for errors + * @param {Error} error + * @returns {Error|Boolean} The error if defined, otherwise the value of the FSWatcher instance's `closed` flag + */ +_handleError(error) { + const code = error && error.code; + if (error && code !== 'ENOENT' && code !== 'ENOTDIR' && + (!this.options.ignorePermissionErrors || (code !== 'EPERM' && code !== 'EACCES')) + ) { + this.emit(EV_ERROR, error); + } + return error || this.closed; +} + +/** + * Helper utility for throttling + * @param {ThrottleType} actionType type being throttled + * @param {Path} path being acted upon + * @param {Number} timeout duration of time to suppress duplicate actions + * @returns {Object|false} tracking object or false if action should be suppressed + */ +_throttle(actionType, path, timeout) { + if (!this._throttled.has(actionType)) { + this._throttled.set(actionType, new Map()); + } + + /** @type {Map} */ + const action = this._throttled.get(actionType); + /** @type {Object} */ + const actionPath = action.get(path); + + if (actionPath) { + actionPath.count++; + return false; + } + + let timeoutObject; + const clear = () => { + const item = action.get(path); + const count = item ? item.count : 0; + action.delete(path); + clearTimeout(timeoutObject); + if (item) clearTimeout(item.timeoutObject); + return count; + }; + timeoutObject = setTimeout(clear, timeout); + const thr = {timeoutObject, clear, count: 0}; + action.set(path, thr); + return thr; +} + +_incrReadyCount() { + return this._readyCount++; +} + +/** + * Awaits write operation to finish. + * Polls a newly created file for size variations. When files size does not change for 'threshold' milliseconds calls callback. + * @param {Path} path being acted upon + * @param {Number} threshold Time in milliseconds a file size must be fixed before acknowledging write OP is finished + * @param {EventName} event + * @param {Function} awfEmit Callback to be called when ready for event to be emitted. + */ +_awaitWriteFinish(path, threshold, event, awfEmit) { + let timeoutHandler; + + let fullPath = path; + if (this.options.cwd && !sysPath.isAbsolute(path)) { + fullPath = sysPath.join(this.options.cwd, path); + } + + const now = new Date(); + + const awaitWriteFinish = (prevStat) => { + fs.stat(fullPath, (err, curStat) => { + if (err || !this._pendingWrites.has(path)) { + if (err && err.code !== 'ENOENT') awfEmit(err); + return; + } + + const now = Number(new Date()); + + if (prevStat && curStat.size !== prevStat.size) { + this._pendingWrites.get(path).lastChange = now; + } + const pw = this._pendingWrites.get(path); + const df = now - pw.lastChange; + + if (df >= threshold) { + this._pendingWrites.delete(path); + awfEmit(undefined, curStat); + } else { + timeoutHandler = setTimeout( + awaitWriteFinish, + this.options.awaitWriteFinish.pollInterval, + curStat + ); + } + }); + }; + + if (!this._pendingWrites.has(path)) { + this._pendingWrites.set(path, { + lastChange: now, + cancelWait: () => { + this._pendingWrites.delete(path); + clearTimeout(timeoutHandler); + return event; + } + }); + timeoutHandler = setTimeout( + awaitWriteFinish, + this.options.awaitWriteFinish.pollInterval + ); + } +} + +_getGlobIgnored() { + return [...this._ignoredPaths.values()]; +} + +/** + * Determines whether user has asked to ignore this path. + * @param {Path} path filepath or dir + * @param {fs.Stats=} stats result of fs.stat + * @returns {Boolean} + */ +_isIgnored(path, stats) { + if (this.options.atomic && DOT_RE.test(path)) return true; + if (!this._userIgnored) { + const {cwd} = this.options; + const ign = this.options.ignored; + + const ignored = ign && ign.map(normalizeIgnored(cwd)); + const paths = arrify(ignored) + .filter((path) => typeof path === STRING_TYPE && !isGlob(path)) + .map((path) => path + SLASH_GLOBSTAR); + const list = this._getGlobIgnored().map(normalizeIgnored(cwd)).concat(ignored, paths); + this._userIgnored = anymatch(list, undefined, ANYMATCH_OPTS); + } + + return this._userIgnored([path, stats]); +} + +_isntIgnored(path, stat) { + return !this._isIgnored(path, stat); +} + +/** + * Provides a set of common helpers and properties relating to symlink and glob handling. + * @param {Path} path file, directory, or glob pattern being watched + * @param {Number=} depth at any depth > 0, this isn't a glob + * @returns {WatchHelper} object containing helpers for this path + */ +_getWatchHelpers(path, depth) { + const watchPath = depth || this.options.disableGlobbing || !isGlob(path) ? path : globParent(path); + const follow = this.options.followSymlinks; + + return new WatchHelper(path, watchPath, follow, this); +} + +// Directory helpers +// ----------------- + +/** + * Provides directory tracking objects + * @param {String} directory path of the directory + * @returns {DirEntry} the directory's tracking object + */ +_getWatchedDir(directory) { + if (!this._boundRemove) this._boundRemove = this._remove.bind(this); + const dir = sysPath.resolve(directory); + if (!this._watched.has(dir)) this._watched.set(dir, new DirEntry(dir, this._boundRemove)); + return this._watched.get(dir); +} + +// File helpers +// ------------ + +/** + * Check for read permissions. + * Based on this answer on SO: https://stackoverflow.com/a/11781404/1358405 + * @param {fs.Stats} stats - object, result of fs_stat + * @returns {Boolean} indicates whether the file can be read +*/ +_hasReadPermissions(stats) { + if (this.options.ignorePermissionErrors) return true; + + // stats.mode may be bigint + const md = stats && Number.parseInt(stats.mode, 10); + const st = md & 0o777; + const it = Number.parseInt(st.toString(8)[0], 10); + return Boolean(4 & it); +} + +/** + * Handles emitting unlink events for + * files and directories, and via recursion, for + * files and directories within directories that are unlinked + * @param {String} directory within which the following item is located + * @param {String} item base path of item/directory + * @returns {void} +*/ +_remove(directory, item, isDirectory) { + // if what is being deleted is a directory, get that directory's paths + // for recursive deleting and cleaning of watched object + // if it is not a directory, nestedDirectoryChildren will be empty array + const path = sysPath.join(directory, item); + const fullPath = sysPath.resolve(path); + isDirectory = isDirectory != null + ? isDirectory + : this._watched.has(path) || this._watched.has(fullPath); + + // prevent duplicate handling in case of arriving here nearly simultaneously + // via multiple paths (such as _handleFile and _handleDir) + if (!this._throttle('remove', path, 100)) return; + + // if the only watched file is removed, watch for its return + if (!isDirectory && !this.options.useFsEvents && this._watched.size === 1) { + this.add(directory, item, true); + } + + // This will create a new entry in the watched object in either case + // so we got to do the directory check beforehand + const wp = this._getWatchedDir(path); + const nestedDirectoryChildren = wp.getChildren(); + + // Recursively remove children directories / files. + nestedDirectoryChildren.forEach(nested => this._remove(path, nested)); + + // Check if item was on the watched list and remove it + const parent = this._getWatchedDir(directory); + const wasTracked = parent.has(item); + parent.remove(item); + + // Fixes issue #1042 -> Relative paths were detected and added as symlinks + // (https://github.com/paulmillr/chokidar/blob/e1753ddbc9571bdc33b4a4af172d52cb6e611c10/lib/nodefs-handler.js#L612), + // but never removed from the map in case the path was deleted. + // This leads to an incorrect state if the path was recreated: + // https://github.com/paulmillr/chokidar/blob/e1753ddbc9571bdc33b4a4af172d52cb6e611c10/lib/nodefs-handler.js#L553 + if (this._symlinkPaths.has(fullPath)) { + this._symlinkPaths.delete(fullPath); + } + + // If we wait for this file to be fully written, cancel the wait. + let relPath = path; + if (this.options.cwd) relPath = sysPath.relative(this.options.cwd, path); + if (this.options.awaitWriteFinish && this._pendingWrites.has(relPath)) { + const event = this._pendingWrites.get(relPath).cancelWait(); + if (event === EV_ADD) return; + } + + // The Entry will either be a directory that just got removed + // or a bogus entry to a file, in either case we have to remove it + this._watched.delete(path); + this._watched.delete(fullPath); + const eventName = isDirectory ? EV_UNLINK_DIR : EV_UNLINK; + if (wasTracked && !this._isIgnored(path)) this._emit(eventName, path); + + // Avoid conflicts if we later create another file with the same name + if (!this.options.useFsEvents) { + this._closePath(path); + } +} + +/** + * Closes all watchers for a path + * @param {Path} path + */ +_closePath(path) { + this._closeFile(path) + const dir = sysPath.dirname(path); + this._getWatchedDir(dir).remove(sysPath.basename(path)); +} + +/** + * Closes only file-specific watchers + * @param {Path} path + */ +_closeFile(path) { + const closers = this._closers.get(path); + if (!closers) return; + closers.forEach(closer => closer()); + this._closers.delete(path); +} + +/** + * + * @param {Path} path + * @param {Function} closer + */ +_addPathCloser(path, closer) { + if (!closer) return; + let list = this._closers.get(path); + if (!list) { + list = []; + this._closers.set(path, list); + } + list.push(closer); +} + +_readdirp(root, opts) { + if (this.closed) return; + const options = {type: EV_ALL, alwaysStat: true, lstat: true, ...opts}; + let stream = readdirp(root, options); + this._streams.add(stream); + stream.once(STR_CLOSE, () => { + stream = undefined; + }); + stream.once(STR_END, () => { + if (stream) { + this._streams.delete(stream); + stream = undefined; + } + }); + return stream; +} + +} + +// Export FSWatcher class +exports.FSWatcher = FSWatcher; + +/** + * Instantiates watcher with paths to be tracked. + * @param {String|Array} paths file/directory paths and/or globs + * @param {Object=} options chokidar opts + * @returns an instance of FSWatcher for chaining. + */ +const watch = (paths, options) => { + const watcher = new FSWatcher(options); + watcher.add(paths); + return watcher; +}; + +exports.watch = watch; diff --git a/tunestats/app/api/node_modules/chokidar/lib/constants.js b/tunestats/app/api/node_modules/chokidar/lib/constants.js new file mode 100644 index 0000000..4743865 --- /dev/null +++ b/tunestats/app/api/node_modules/chokidar/lib/constants.js @@ -0,0 +1,66 @@ +'use strict'; + +const {sep} = require('path'); +const {platform} = process; +const os = require('os'); + +exports.EV_ALL = 'all'; +exports.EV_READY = 'ready'; +exports.EV_ADD = 'add'; +exports.EV_CHANGE = 'change'; +exports.EV_ADD_DIR = 'addDir'; +exports.EV_UNLINK = 'unlink'; +exports.EV_UNLINK_DIR = 'unlinkDir'; +exports.EV_RAW = 'raw'; +exports.EV_ERROR = 'error'; + +exports.STR_DATA = 'data'; +exports.STR_END = 'end'; +exports.STR_CLOSE = 'close'; + +exports.FSEVENT_CREATED = 'created'; +exports.FSEVENT_MODIFIED = 'modified'; +exports.FSEVENT_DELETED = 'deleted'; +exports.FSEVENT_MOVED = 'moved'; +exports.FSEVENT_CLONED = 'cloned'; +exports.FSEVENT_UNKNOWN = 'unknown'; +exports.FSEVENT_FLAG_MUST_SCAN_SUBDIRS = 1; +exports.FSEVENT_TYPE_FILE = 'file'; +exports.FSEVENT_TYPE_DIRECTORY = 'directory'; +exports.FSEVENT_TYPE_SYMLINK = 'symlink'; + +exports.KEY_LISTENERS = 'listeners'; +exports.KEY_ERR = 'errHandlers'; +exports.KEY_RAW = 'rawEmitters'; +exports.HANDLER_KEYS = [exports.KEY_LISTENERS, exports.KEY_ERR, exports.KEY_RAW]; + +exports.DOT_SLASH = `.${sep}`; + +exports.BACK_SLASH_RE = /\\/g; +exports.DOUBLE_SLASH_RE = /\/\//; +exports.SLASH_OR_BACK_SLASH_RE = /[/\\]/; +exports.DOT_RE = /\..*\.(sw[px])$|~$|\.subl.*\.tmp/; +exports.REPLACER_RE = /^\.[/\\]/; + +exports.SLASH = '/'; +exports.SLASH_SLASH = '//'; +exports.BRACE_START = '{'; +exports.BANG = '!'; +exports.ONE_DOT = '.'; +exports.TWO_DOTS = '..'; +exports.STAR = '*'; +exports.GLOBSTAR = '**'; +exports.ROOT_GLOBSTAR = '/**/*'; +exports.SLASH_GLOBSTAR = '/**'; +exports.DIR_SUFFIX = 'Dir'; +exports.ANYMATCH_OPTS = {dot: true}; +exports.STRING_TYPE = 'string'; +exports.FUNCTION_TYPE = 'function'; +exports.EMPTY_STR = ''; +exports.EMPTY_FN = () => {}; +exports.IDENTITY_FN = val => val; + +exports.isWindows = platform === 'win32'; +exports.isMacos = platform === 'darwin'; +exports.isLinux = platform === 'linux'; +exports.isIBMi = os.type() === 'OS400'; diff --git a/tunestats/app/api/node_modules/chokidar/lib/fsevents-handler.js b/tunestats/app/api/node_modules/chokidar/lib/fsevents-handler.js new file mode 100644 index 0000000..fe29393 --- /dev/null +++ b/tunestats/app/api/node_modules/chokidar/lib/fsevents-handler.js @@ -0,0 +1,526 @@ +'use strict'; + +const fs = require('fs'); +const sysPath = require('path'); +const { promisify } = require('util'); + +let fsevents; +try { + fsevents = require('fsevents'); +} catch (error) { + if (process.env.CHOKIDAR_PRINT_FSEVENTS_REQUIRE_ERROR) console.error(error); +} + +if (fsevents) { + // TODO: real check + const mtch = process.version.match(/v(\d+)\.(\d+)/); + if (mtch && mtch[1] && mtch[2]) { + const maj = Number.parseInt(mtch[1], 10); + const min = Number.parseInt(mtch[2], 10); + if (maj === 8 && min < 16) { + fsevents = undefined; + } + } +} + +const { + EV_ADD, + EV_CHANGE, + EV_ADD_DIR, + EV_UNLINK, + EV_ERROR, + STR_DATA, + STR_END, + FSEVENT_CREATED, + FSEVENT_MODIFIED, + FSEVENT_DELETED, + FSEVENT_MOVED, + // FSEVENT_CLONED, + FSEVENT_UNKNOWN, + FSEVENT_FLAG_MUST_SCAN_SUBDIRS, + FSEVENT_TYPE_FILE, + FSEVENT_TYPE_DIRECTORY, + FSEVENT_TYPE_SYMLINK, + + ROOT_GLOBSTAR, + DIR_SUFFIX, + DOT_SLASH, + FUNCTION_TYPE, + EMPTY_FN, + IDENTITY_FN +} = require('./constants'); + +const Depth = (value) => isNaN(value) ? {} : {depth: value}; + +const stat = promisify(fs.stat); +const lstat = promisify(fs.lstat); +const realpath = promisify(fs.realpath); + +const statMethods = { stat, lstat }; + +/** + * @typedef {String} Path + */ + +/** + * @typedef {Object} FsEventsWatchContainer + * @property {Set} listeners + * @property {Function} rawEmitter + * @property {{stop: Function}} watcher + */ + +// fsevents instance helper functions +/** + * Object to hold per-process fsevents instances (may be shared across chokidar FSWatcher instances) + * @type {Map} + */ +const FSEventsWatchers = new Map(); + +// Threshold of duplicate path prefixes at which to start +// consolidating going forward +const consolidateThreshhold = 10; + +const wrongEventFlags = new Set([ + 69888, 70400, 71424, 72704, 73472, 131328, 131840, 262912 +]); + +/** + * Instantiates the fsevents interface + * @param {Path} path path to be watched + * @param {Function} callback called when fsevents is bound and ready + * @returns {{stop: Function}} new fsevents instance + */ +const createFSEventsInstance = (path, callback) => { + const stop = fsevents.watch(path, callback); + return {stop}; +}; + +/** + * Instantiates the fsevents interface or binds listeners to an existing one covering + * the same file tree. + * @param {Path} path - to be watched + * @param {Path} realPath - real path for symlinks + * @param {Function} listener - called when fsevents emits events + * @param {Function} rawEmitter - passes data to listeners of the 'raw' event + * @returns {Function} closer + */ +function setFSEventsListener(path, realPath, listener, rawEmitter) { + let watchPath = sysPath.extname(realPath) ? sysPath.dirname(realPath) : realPath; + + const parentPath = sysPath.dirname(watchPath); + let cont = FSEventsWatchers.get(watchPath); + + // If we've accumulated a substantial number of paths that + // could have been consolidated by watching one directory + // above the current one, create a watcher on the parent + // path instead, so that we do consolidate going forward. + if (couldConsolidate(parentPath)) { + watchPath = parentPath; + } + + const resolvedPath = sysPath.resolve(path); + const hasSymlink = resolvedPath !== realPath; + + const filteredListener = (fullPath, flags, info) => { + if (hasSymlink) fullPath = fullPath.replace(realPath, resolvedPath); + if ( + fullPath === resolvedPath || + !fullPath.indexOf(resolvedPath + sysPath.sep) + ) listener(fullPath, flags, info); + }; + + // check if there is already a watcher on a parent path + // modifies `watchPath` to the parent path when it finds a match + let watchedParent = false; + for (const watchedPath of FSEventsWatchers.keys()) { + if (realPath.indexOf(sysPath.resolve(watchedPath) + sysPath.sep) === 0) { + watchPath = watchedPath; + cont = FSEventsWatchers.get(watchPath); + watchedParent = true; + break; + } + } + + if (cont || watchedParent) { + cont.listeners.add(filteredListener); + } else { + cont = { + listeners: new Set([filteredListener]), + rawEmitter, + watcher: createFSEventsInstance(watchPath, (fullPath, flags) => { + if (!cont.listeners.size) return; + if (flags & FSEVENT_FLAG_MUST_SCAN_SUBDIRS) return; + const info = fsevents.getInfo(fullPath, flags); + cont.listeners.forEach(list => { + list(fullPath, flags, info); + }); + + cont.rawEmitter(info.event, fullPath, info); + }) + }; + FSEventsWatchers.set(watchPath, cont); + } + + // removes this instance's listeners and closes the underlying fsevents + // instance if there are no more listeners left + return () => { + const lst = cont.listeners; + + lst.delete(filteredListener); + if (!lst.size) { + FSEventsWatchers.delete(watchPath); + if (cont.watcher) return cont.watcher.stop().then(() => { + cont.rawEmitter = cont.watcher = undefined; + Object.freeze(cont); + }); + } + }; +} + +// Decide whether or not we should start a new higher-level +// parent watcher +const couldConsolidate = (path) => { + let count = 0; + for (const watchPath of FSEventsWatchers.keys()) { + if (watchPath.indexOf(path) === 0) { + count++; + if (count >= consolidateThreshhold) { + return true; + } + } + } + + return false; +}; + +// returns boolean indicating whether fsevents can be used +const canUse = () => fsevents && FSEventsWatchers.size < 128; + +// determines subdirectory traversal levels from root to path +const calcDepth = (path, root) => { + let i = 0; + while (!path.indexOf(root) && (path = sysPath.dirname(path)) !== root) i++; + return i; +}; + +// returns boolean indicating whether the fsevents' event info has the same type +// as the one returned by fs.stat +const sameTypes = (info, stats) => ( + info.type === FSEVENT_TYPE_DIRECTORY && stats.isDirectory() || + info.type === FSEVENT_TYPE_SYMLINK && stats.isSymbolicLink() || + info.type === FSEVENT_TYPE_FILE && stats.isFile() +) + +/** + * @mixin + */ +class FsEventsHandler { + +/** + * @param {import('../index').FSWatcher} fsw + */ +constructor(fsw) { + this.fsw = fsw; +} +checkIgnored(path, stats) { + const ipaths = this.fsw._ignoredPaths; + if (this.fsw._isIgnored(path, stats)) { + ipaths.add(path); + if (stats && stats.isDirectory()) { + ipaths.add(path + ROOT_GLOBSTAR); + } + return true; + } + + ipaths.delete(path); + ipaths.delete(path + ROOT_GLOBSTAR); +} + +addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts) { + const event = watchedDir.has(item) ? EV_CHANGE : EV_ADD; + this.handleEvent(event, path, fullPath, realPath, parent, watchedDir, item, info, opts); +} + +async checkExists(path, fullPath, realPath, parent, watchedDir, item, info, opts) { + try { + const stats = await stat(path) + if (this.fsw.closed) return; + if (sameTypes(info, stats)) { + this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } else { + this.handleEvent(EV_UNLINK, path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } catch (error) { + if (error.code === 'EACCES') { + this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } else { + this.handleEvent(EV_UNLINK, path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } +} + +handleEvent(event, path, fullPath, realPath, parent, watchedDir, item, info, opts) { + if (this.fsw.closed || this.checkIgnored(path)) return; + + if (event === EV_UNLINK) { + const isDirectory = info.type === FSEVENT_TYPE_DIRECTORY + // suppress unlink events on never before seen files + if (isDirectory || watchedDir.has(item)) { + this.fsw._remove(parent, item, isDirectory); + } + } else { + if (event === EV_ADD) { + // track new directories + if (info.type === FSEVENT_TYPE_DIRECTORY) this.fsw._getWatchedDir(path); + + if (info.type === FSEVENT_TYPE_SYMLINK && opts.followSymlinks) { + // push symlinks back to the top of the stack to get handled + const curDepth = opts.depth === undefined ? + undefined : calcDepth(fullPath, realPath) + 1; + return this._addToFsEvents(path, false, true, curDepth); + } + + // track new paths + // (other than symlinks being followed, which will be tracked soon) + this.fsw._getWatchedDir(parent).add(item); + } + /** + * @type {'add'|'addDir'|'unlink'|'unlinkDir'} + */ + const eventName = info.type === FSEVENT_TYPE_DIRECTORY ? event + DIR_SUFFIX : event; + this.fsw._emit(eventName, path); + if (eventName === EV_ADD_DIR) this._addToFsEvents(path, false, true); + } +} + +/** + * Handle symlinks encountered during directory scan + * @param {String} watchPath - file/dir path to be watched with fsevents + * @param {String} realPath - real path (in case of symlinks) + * @param {Function} transform - path transformer + * @param {Function} globFilter - path filter in case a glob pattern was provided + * @returns {Function} closer for the watcher instance +*/ +_watchWithFsEvents(watchPath, realPath, transform, globFilter) { + if (this.fsw.closed || this.fsw._isIgnored(watchPath)) return; + const opts = this.fsw.options; + const watchCallback = async (fullPath, flags, info) => { + if (this.fsw.closed) return; + if ( + opts.depth !== undefined && + calcDepth(fullPath, realPath) > opts.depth + ) return; + const path = transform(sysPath.join( + watchPath, sysPath.relative(watchPath, fullPath) + )); + if (globFilter && !globFilter(path)) return; + // ensure directories are tracked + const parent = sysPath.dirname(path); + const item = sysPath.basename(path); + const watchedDir = this.fsw._getWatchedDir( + info.type === FSEVENT_TYPE_DIRECTORY ? path : parent + ); + + // correct for wrong events emitted + if (wrongEventFlags.has(flags) || info.event === FSEVENT_UNKNOWN) { + if (typeof opts.ignored === FUNCTION_TYPE) { + let stats; + try { + stats = await stat(path); + } catch (error) {} + if (this.fsw.closed) return; + if (this.checkIgnored(path, stats)) return; + if (sameTypes(info, stats)) { + this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } else { + this.handleEvent(EV_UNLINK, path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } else { + this.checkExists(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } else { + switch (info.event) { + case FSEVENT_CREATED: + case FSEVENT_MODIFIED: + return this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts); + case FSEVENT_DELETED: + case FSEVENT_MOVED: + return this.checkExists(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } + }; + + const closer = setFSEventsListener( + watchPath, + realPath, + watchCallback, + this.fsw._emitRaw + ); + + this.fsw._emitReady(); + return closer; +} + +/** + * Handle symlinks encountered during directory scan + * @param {String} linkPath path to symlink + * @param {String} fullPath absolute path to the symlink + * @param {Function} transform pre-existing path transformer + * @param {Number} curDepth level of subdirectories traversed to where symlink is + * @returns {Promise} + */ +async _handleFsEventsSymlink(linkPath, fullPath, transform, curDepth) { + // don't follow the same symlink more than once + if (this.fsw.closed || this.fsw._symlinkPaths.has(fullPath)) return; + + this.fsw._symlinkPaths.set(fullPath, true); + this.fsw._incrReadyCount(); + + try { + const linkTarget = await realpath(linkPath); + if (this.fsw.closed) return; + if (this.fsw._isIgnored(linkTarget)) { + return this.fsw._emitReady(); + } + + this.fsw._incrReadyCount(); + + // add the linkTarget for watching with a wrapper for transform + // that causes emitted paths to incorporate the link's path + this._addToFsEvents(linkTarget || linkPath, (path) => { + let aliasedPath = linkPath; + if (linkTarget && linkTarget !== DOT_SLASH) { + aliasedPath = path.replace(linkTarget, linkPath); + } else if (path !== DOT_SLASH) { + aliasedPath = sysPath.join(linkPath, path); + } + return transform(aliasedPath); + }, false, curDepth); + } catch(error) { + if (this.fsw._handleError(error)) { + return this.fsw._emitReady(); + } + } +} + +/** + * + * @param {Path} newPath + * @param {fs.Stats} stats + */ +emitAdd(newPath, stats, processPath, opts, forceAdd) { + const pp = processPath(newPath); + const isDir = stats.isDirectory(); + const dirObj = this.fsw._getWatchedDir(sysPath.dirname(pp)); + const base = sysPath.basename(pp); + + // ensure empty dirs get tracked + if (isDir) this.fsw._getWatchedDir(pp); + if (dirObj.has(base)) return; + dirObj.add(base); + + if (!opts.ignoreInitial || forceAdd === true) { + this.fsw._emit(isDir ? EV_ADD_DIR : EV_ADD, pp, stats); + } +} + +initWatch(realPath, path, wh, processPath) { + if (this.fsw.closed) return; + const closer = this._watchWithFsEvents( + wh.watchPath, + sysPath.resolve(realPath || wh.watchPath), + processPath, + wh.globFilter + ); + this.fsw._addPathCloser(path, closer); +} + +/** + * Handle added path with fsevents + * @param {String} path file/dir path or glob pattern + * @param {Function|Boolean=} transform converts working path to what the user expects + * @param {Boolean=} forceAdd ensure add is emitted + * @param {Number=} priorDepth Level of subdirectories already traversed. + * @returns {Promise} + */ +async _addToFsEvents(path, transform, forceAdd, priorDepth) { + if (this.fsw.closed) { + return; + } + const opts = this.fsw.options; + const processPath = typeof transform === FUNCTION_TYPE ? transform : IDENTITY_FN; + + const wh = this.fsw._getWatchHelpers(path); + + // evaluate what is at the path we're being asked to watch + try { + const stats = await statMethods[wh.statMethod](wh.watchPath); + if (this.fsw.closed) return; + if (this.fsw._isIgnored(wh.watchPath, stats)) { + throw null; + } + if (stats.isDirectory()) { + // emit addDir unless this is a glob parent + if (!wh.globFilter) this.emitAdd(processPath(path), stats, processPath, opts, forceAdd); + + // don't recurse further if it would exceed depth setting + if (priorDepth && priorDepth > opts.depth) return; + + // scan the contents of the dir + this.fsw._readdirp(wh.watchPath, { + fileFilter: entry => wh.filterPath(entry), + directoryFilter: entry => wh.filterDir(entry), + ...Depth(opts.depth - (priorDepth || 0)) + }).on(STR_DATA, (entry) => { + // need to check filterPath on dirs b/c filterDir is less restrictive + if (this.fsw.closed) { + return; + } + if (entry.stats.isDirectory() && !wh.filterPath(entry)) return; + + const joinedPath = sysPath.join(wh.watchPath, entry.path); + const {fullPath} = entry; + + if (wh.followSymlinks && entry.stats.isSymbolicLink()) { + // preserve the current depth here since it can't be derived from + // real paths past the symlink + const curDepth = opts.depth === undefined ? + undefined : calcDepth(joinedPath, sysPath.resolve(wh.watchPath)) + 1; + + this._handleFsEventsSymlink(joinedPath, fullPath, processPath, curDepth); + } else { + this.emitAdd(joinedPath, entry.stats, processPath, opts, forceAdd); + } + }).on(EV_ERROR, EMPTY_FN).on(STR_END, () => { + this.fsw._emitReady(); + }); + } else { + this.emitAdd(wh.watchPath, stats, processPath, opts, forceAdd); + this.fsw._emitReady(); + } + } catch (error) { + if (!error || this.fsw._handleError(error)) { + // TODO: Strange thing: "should not choke on an ignored watch path" will be failed without 2 ready calls -__- + this.fsw._emitReady(); + this.fsw._emitReady(); + } + } + + if (opts.persistent && forceAdd !== true) { + if (typeof transform === FUNCTION_TYPE) { + // realpath has already been resolved + this.initWatch(undefined, path, wh, processPath); + } else { + let realPath; + try { + realPath = await realpath(wh.watchPath); + } catch (e) {} + this.initWatch(realPath, path, wh, processPath); + } + } +} + +} + +module.exports = FsEventsHandler; +module.exports.canUse = canUse; diff --git a/tunestats/app/api/node_modules/chokidar/lib/nodefs-handler.js b/tunestats/app/api/node_modules/chokidar/lib/nodefs-handler.js new file mode 100644 index 0000000..199cfe9 --- /dev/null +++ b/tunestats/app/api/node_modules/chokidar/lib/nodefs-handler.js @@ -0,0 +1,654 @@ +'use strict'; + +const fs = require('fs'); +const sysPath = require('path'); +const { promisify } = require('util'); +const isBinaryPath = require('is-binary-path'); +const { + isWindows, + isLinux, + EMPTY_FN, + EMPTY_STR, + KEY_LISTENERS, + KEY_ERR, + KEY_RAW, + HANDLER_KEYS, + EV_CHANGE, + EV_ADD, + EV_ADD_DIR, + EV_ERROR, + STR_DATA, + STR_END, + BRACE_START, + STAR +} = require('./constants'); + +const THROTTLE_MODE_WATCH = 'watch'; + +const open = promisify(fs.open); +const stat = promisify(fs.stat); +const lstat = promisify(fs.lstat); +const close = promisify(fs.close); +const fsrealpath = promisify(fs.realpath); + +const statMethods = { lstat, stat }; + +// TODO: emit errors properly. Example: EMFILE on Macos. +const foreach = (val, fn) => { + if (val instanceof Set) { + val.forEach(fn); + } else { + fn(val); + } +}; + +const addAndConvert = (main, prop, item) => { + let container = main[prop]; + if (!(container instanceof Set)) { + main[prop] = container = new Set([container]); + } + container.add(item); +}; + +const clearItem = cont => key => { + const set = cont[key]; + if (set instanceof Set) { + set.clear(); + } else { + delete cont[key]; + } +}; + +const delFromSet = (main, prop, item) => { + const container = main[prop]; + if (container instanceof Set) { + container.delete(item); + } else if (container === item) { + delete main[prop]; + } +}; + +const isEmptySet = (val) => val instanceof Set ? val.size === 0 : !val; + +/** + * @typedef {String} Path + */ + +// fs_watch helpers + +// object to hold per-process fs_watch instances +// (may be shared across chokidar FSWatcher instances) + +/** + * @typedef {Object} FsWatchContainer + * @property {Set} listeners + * @property {Set} errHandlers + * @property {Set} rawEmitters + * @property {fs.FSWatcher=} watcher + * @property {Boolean=} watcherUnusable + */ + +/** + * @type {Map} + */ +const FsWatchInstances = new Map(); + +/** + * Instantiates the fs_watch interface + * @param {String} path to be watched + * @param {Object} options to be passed to fs_watch + * @param {Function} listener main event handler + * @param {Function} errHandler emits info about errors + * @param {Function} emitRaw emits raw event data + * @returns {fs.FSWatcher} new fsevents instance + */ +function createFsWatchInstance(path, options, listener, errHandler, emitRaw) { + const handleEvent = (rawEvent, evPath) => { + listener(path); + emitRaw(rawEvent, evPath, {watchedPath: path}); + + // emit based on events occurring for files from a directory's watcher in + // case the file's watcher misses it (and rely on throttling to de-dupe) + if (evPath && path !== evPath) { + fsWatchBroadcast( + sysPath.resolve(path, evPath), KEY_LISTENERS, sysPath.join(path, evPath) + ); + } + }; + try { + return fs.watch(path, options, handleEvent); + } catch (error) { + errHandler(error); + } +} + +/** + * Helper for passing fs_watch event data to a collection of listeners + * @param {Path} fullPath absolute path bound to fs_watch instance + * @param {String} type listener type + * @param {*=} val1 arguments to be passed to listeners + * @param {*=} val2 + * @param {*=} val3 + */ +const fsWatchBroadcast = (fullPath, type, val1, val2, val3) => { + const cont = FsWatchInstances.get(fullPath); + if (!cont) return; + foreach(cont[type], (listener) => { + listener(val1, val2, val3); + }); +}; + +/** + * Instantiates the fs_watch interface or binds listeners + * to an existing one covering the same file system entry + * @param {String} path + * @param {String} fullPath absolute path + * @param {Object} options to be passed to fs_watch + * @param {Object} handlers container for event listener functions + */ +const setFsWatchListener = (path, fullPath, options, handlers) => { + const {listener, errHandler, rawEmitter} = handlers; + let cont = FsWatchInstances.get(fullPath); + + /** @type {fs.FSWatcher=} */ + let watcher; + if (!options.persistent) { + watcher = createFsWatchInstance( + path, options, listener, errHandler, rawEmitter + ); + return watcher.close.bind(watcher); + } + if (cont) { + addAndConvert(cont, KEY_LISTENERS, listener); + addAndConvert(cont, KEY_ERR, errHandler); + addAndConvert(cont, KEY_RAW, rawEmitter); + } else { + watcher = createFsWatchInstance( + path, + options, + fsWatchBroadcast.bind(null, fullPath, KEY_LISTENERS), + errHandler, // no need to use broadcast here + fsWatchBroadcast.bind(null, fullPath, KEY_RAW) + ); + if (!watcher) return; + watcher.on(EV_ERROR, async (error) => { + const broadcastErr = fsWatchBroadcast.bind(null, fullPath, KEY_ERR); + cont.watcherUnusable = true; // documented since Node 10.4.1 + // Workaround for https://github.com/joyent/node/issues/4337 + if (isWindows && error.code === 'EPERM') { + try { + const fd = await open(path, 'r'); + await close(fd); + broadcastErr(error); + } catch (err) {} + } else { + broadcastErr(error); + } + }); + cont = { + listeners: listener, + errHandlers: errHandler, + rawEmitters: rawEmitter, + watcher + }; + FsWatchInstances.set(fullPath, cont); + } + // const index = cont.listeners.indexOf(listener); + + // removes this instance's listeners and closes the underlying fs_watch + // instance if there are no more listeners left + return () => { + delFromSet(cont, KEY_LISTENERS, listener); + delFromSet(cont, KEY_ERR, errHandler); + delFromSet(cont, KEY_RAW, rawEmitter); + if (isEmptySet(cont.listeners)) { + // Check to protect against issue gh-730. + // if (cont.watcherUnusable) { + cont.watcher.close(); + // } + FsWatchInstances.delete(fullPath); + HANDLER_KEYS.forEach(clearItem(cont)); + cont.watcher = undefined; + Object.freeze(cont); + } + }; +}; + +// fs_watchFile helpers + +// object to hold per-process fs_watchFile instances +// (may be shared across chokidar FSWatcher instances) +const FsWatchFileInstances = new Map(); + +/** + * Instantiates the fs_watchFile interface or binds listeners + * to an existing one covering the same file system entry + * @param {String} path to be watched + * @param {String} fullPath absolute path + * @param {Object} options options to be passed to fs_watchFile + * @param {Object} handlers container for event listener functions + * @returns {Function} closer + */ +const setFsWatchFileListener = (path, fullPath, options, handlers) => { + const {listener, rawEmitter} = handlers; + let cont = FsWatchFileInstances.get(fullPath); + + /* eslint-disable no-unused-vars, prefer-destructuring */ + let listeners = new Set(); + let rawEmitters = new Set(); + + const copts = cont && cont.options; + if (copts && (copts.persistent < options.persistent || copts.interval > options.interval)) { + // "Upgrade" the watcher to persistence or a quicker interval. + // This creates some unlikely edge case issues if the user mixes + // settings in a very weird way, but solving for those cases + // doesn't seem worthwhile for the added complexity. + listeners = cont.listeners; + rawEmitters = cont.rawEmitters; + fs.unwatchFile(fullPath); + cont = undefined; + } + + /* eslint-enable no-unused-vars, prefer-destructuring */ + + if (cont) { + addAndConvert(cont, KEY_LISTENERS, listener); + addAndConvert(cont, KEY_RAW, rawEmitter); + } else { + // TODO + // listeners.add(listener); + // rawEmitters.add(rawEmitter); + cont = { + listeners: listener, + rawEmitters: rawEmitter, + options, + watcher: fs.watchFile(fullPath, options, (curr, prev) => { + foreach(cont.rawEmitters, (rawEmitter) => { + rawEmitter(EV_CHANGE, fullPath, {curr, prev}); + }); + const currmtime = curr.mtimeMs; + if (curr.size !== prev.size || currmtime > prev.mtimeMs || currmtime === 0) { + foreach(cont.listeners, (listener) => listener(path, curr)); + } + }) + }; + FsWatchFileInstances.set(fullPath, cont); + } + // const index = cont.listeners.indexOf(listener); + + // Removes this instance's listeners and closes the underlying fs_watchFile + // instance if there are no more listeners left. + return () => { + delFromSet(cont, KEY_LISTENERS, listener); + delFromSet(cont, KEY_RAW, rawEmitter); + if (isEmptySet(cont.listeners)) { + FsWatchFileInstances.delete(fullPath); + fs.unwatchFile(fullPath); + cont.options = cont.watcher = undefined; + Object.freeze(cont); + } + }; +}; + +/** + * @mixin + */ +class NodeFsHandler { + +/** + * @param {import("../index").FSWatcher} fsW + */ +constructor(fsW) { + this.fsw = fsW; + this._boundHandleError = (error) => fsW._handleError(error); +} + +/** + * Watch file for changes with fs_watchFile or fs_watch. + * @param {String} path to file or dir + * @param {Function} listener on fs change + * @returns {Function} closer for the watcher instance + */ +_watchWithNodeFs(path, listener) { + const opts = this.fsw.options; + const directory = sysPath.dirname(path); + const basename = sysPath.basename(path); + const parent = this.fsw._getWatchedDir(directory); + parent.add(basename); + const absolutePath = sysPath.resolve(path); + const options = {persistent: opts.persistent}; + if (!listener) listener = EMPTY_FN; + + let closer; + if (opts.usePolling) { + options.interval = opts.enableBinaryInterval && isBinaryPath(basename) ? + opts.binaryInterval : opts.interval; + closer = setFsWatchFileListener(path, absolutePath, options, { + listener, + rawEmitter: this.fsw._emitRaw + }); + } else { + closer = setFsWatchListener(path, absolutePath, options, { + listener, + errHandler: this._boundHandleError, + rawEmitter: this.fsw._emitRaw + }); + } + return closer; +} + +/** + * Watch a file and emit add event if warranted. + * @param {Path} file Path + * @param {fs.Stats} stats result of fs_stat + * @param {Boolean} initialAdd was the file added at watch instantiation? + * @returns {Function} closer for the watcher instance + */ +_handleFile(file, stats, initialAdd) { + if (this.fsw.closed) { + return; + } + const dirname = sysPath.dirname(file); + const basename = sysPath.basename(file); + const parent = this.fsw._getWatchedDir(dirname); + // stats is always present + let prevStats = stats; + + // if the file is already being watched, do nothing + if (parent.has(basename)) return; + + const listener = async (path, newStats) => { + if (!this.fsw._throttle(THROTTLE_MODE_WATCH, file, 5)) return; + if (!newStats || newStats.mtimeMs === 0) { + try { + const newStats = await stat(file); + if (this.fsw.closed) return; + // Check that change event was not fired because of changed only accessTime. + const at = newStats.atimeMs; + const mt = newStats.mtimeMs; + if (!at || at <= mt || mt !== prevStats.mtimeMs) { + this.fsw._emit(EV_CHANGE, file, newStats); + } + if (isLinux && prevStats.ino !== newStats.ino) { + this.fsw._closeFile(path) + prevStats = newStats; + this.fsw._addPathCloser(path, this._watchWithNodeFs(file, listener)); + } else { + prevStats = newStats; + } + } catch (error) { + // Fix issues where mtime is null but file is still present + this.fsw._remove(dirname, basename); + } + // add is about to be emitted if file not already tracked in parent + } else if (parent.has(basename)) { + // Check that change event was not fired because of changed only accessTime. + const at = newStats.atimeMs; + const mt = newStats.mtimeMs; + if (!at || at <= mt || mt !== prevStats.mtimeMs) { + this.fsw._emit(EV_CHANGE, file, newStats); + } + prevStats = newStats; + } + } + // kick off the watcher + const closer = this._watchWithNodeFs(file, listener); + + // emit an add event if we're supposed to + if (!(initialAdd && this.fsw.options.ignoreInitial) && this.fsw._isntIgnored(file)) { + if (!this.fsw._throttle(EV_ADD, file, 0)) return; + this.fsw._emit(EV_ADD, file, stats); + } + + return closer; +} + +/** + * Handle symlinks encountered while reading a dir. + * @param {Object} entry returned by readdirp + * @param {String} directory path of dir being read + * @param {String} path of this item + * @param {String} item basename of this item + * @returns {Promise} true if no more processing is needed for this entry. + */ +async _handleSymlink(entry, directory, path, item) { + if (this.fsw.closed) { + return; + } + const full = entry.fullPath; + const dir = this.fsw._getWatchedDir(directory); + + if (!this.fsw.options.followSymlinks) { + // watch symlink directly (don't follow) and detect changes + this.fsw._incrReadyCount(); + + let linkPath; + try { + linkPath = await fsrealpath(path); + } catch (e) { + this.fsw._emitReady(); + return true; + } + + if (this.fsw.closed) return; + if (dir.has(item)) { + if (this.fsw._symlinkPaths.get(full) !== linkPath) { + this.fsw._symlinkPaths.set(full, linkPath); + this.fsw._emit(EV_CHANGE, path, entry.stats); + } + } else { + dir.add(item); + this.fsw._symlinkPaths.set(full, linkPath); + this.fsw._emit(EV_ADD, path, entry.stats); + } + this.fsw._emitReady(); + return true; + } + + // don't follow the same symlink more than once + if (this.fsw._symlinkPaths.has(full)) { + return true; + } + + this.fsw._symlinkPaths.set(full, true); +} + +_handleRead(directory, initialAdd, wh, target, dir, depth, throttler) { + // Normalize the directory name on Windows + directory = sysPath.join(directory, EMPTY_STR); + + if (!wh.hasGlob) { + throttler = this.fsw._throttle('readdir', directory, 1000); + if (!throttler) return; + } + + const previous = this.fsw._getWatchedDir(wh.path); + const current = new Set(); + + let stream = this.fsw._readdirp(directory, { + fileFilter: entry => wh.filterPath(entry), + directoryFilter: entry => wh.filterDir(entry), + depth: 0 + }).on(STR_DATA, async (entry) => { + if (this.fsw.closed) { + stream = undefined; + return; + } + const item = entry.path; + let path = sysPath.join(directory, item); + current.add(item); + + if (entry.stats.isSymbolicLink() && await this._handleSymlink(entry, directory, path, item)) { + return; + } + + if (this.fsw.closed) { + stream = undefined; + return; + } + // Files that present in current directory snapshot + // but absent in previous are added to watch list and + // emit `add` event. + if (item === target || !target && !previous.has(item)) { + this.fsw._incrReadyCount(); + + // ensure relativeness of path is preserved in case of watcher reuse + path = sysPath.join(dir, sysPath.relative(dir, path)); + + this._addToNodeFs(path, initialAdd, wh, depth + 1); + } + }).on(EV_ERROR, this._boundHandleError); + + return new Promise(resolve => + stream.once(STR_END, () => { + if (this.fsw.closed) { + stream = undefined; + return; + } + const wasThrottled = throttler ? throttler.clear() : false; + + resolve(); + + // Files that absent in current directory snapshot + // but present in previous emit `remove` event + // and are removed from @watched[directory]. + previous.getChildren().filter((item) => { + return item !== directory && + !current.has(item) && + // in case of intersecting globs; + // a path may have been filtered out of this readdir, but + // shouldn't be removed because it matches a different glob + (!wh.hasGlob || wh.filterPath({ + fullPath: sysPath.resolve(directory, item) + })); + }).forEach((item) => { + this.fsw._remove(directory, item); + }); + + stream = undefined; + + // one more time for any missed in case changes came in extremely quickly + if (wasThrottled) this._handleRead(directory, false, wh, target, dir, depth, throttler); + }) + ); +} + +/** + * Read directory to add / remove files from `@watched` list and re-read it on change. + * @param {String} dir fs path + * @param {fs.Stats} stats + * @param {Boolean} initialAdd + * @param {Number} depth relative to user-supplied path + * @param {String} target child path targeted for watch + * @param {Object} wh Common watch helpers for this path + * @param {String} realpath + * @returns {Promise} closer for the watcher instance. + */ +async _handleDir(dir, stats, initialAdd, depth, target, wh, realpath) { + const parentDir = this.fsw._getWatchedDir(sysPath.dirname(dir)); + const tracked = parentDir.has(sysPath.basename(dir)); + if (!(initialAdd && this.fsw.options.ignoreInitial) && !target && !tracked) { + if (!wh.hasGlob || wh.globFilter(dir)) this.fsw._emit(EV_ADD_DIR, dir, stats); + } + + // ensure dir is tracked (harmless if redundant) + parentDir.add(sysPath.basename(dir)); + this.fsw._getWatchedDir(dir); + let throttler; + let closer; + + const oDepth = this.fsw.options.depth; + if ((oDepth == null || depth <= oDepth) && !this.fsw._symlinkPaths.has(realpath)) { + if (!target) { + await this._handleRead(dir, initialAdd, wh, target, dir, depth, throttler); + if (this.fsw.closed) return; + } + + closer = this._watchWithNodeFs(dir, (dirPath, stats) => { + // if current directory is removed, do nothing + if (stats && stats.mtimeMs === 0) return; + + this._handleRead(dirPath, false, wh, target, dir, depth, throttler); + }); + } + return closer; +} + +/** + * Handle added file, directory, or glob pattern. + * Delegates call to _handleFile / _handleDir after checks. + * @param {String} path to file or ir + * @param {Boolean} initialAdd was the file added at watch instantiation? + * @param {Object} priorWh depth relative to user-supplied path + * @param {Number} depth Child path actually targeted for watch + * @param {String=} target Child path actually targeted for watch + * @returns {Promise} + */ +async _addToNodeFs(path, initialAdd, priorWh, depth, target) { + const ready = this.fsw._emitReady; + if (this.fsw._isIgnored(path) || this.fsw.closed) { + ready(); + return false; + } + + const wh = this.fsw._getWatchHelpers(path, depth); + if (!wh.hasGlob && priorWh) { + wh.hasGlob = priorWh.hasGlob; + wh.globFilter = priorWh.globFilter; + wh.filterPath = entry => priorWh.filterPath(entry); + wh.filterDir = entry => priorWh.filterDir(entry); + } + + // evaluate what is at the path we're being asked to watch + try { + const stats = await statMethods[wh.statMethod](wh.watchPath); + if (this.fsw.closed) return; + if (this.fsw._isIgnored(wh.watchPath, stats)) { + ready(); + return false; + } + + const follow = this.fsw.options.followSymlinks && !path.includes(STAR) && !path.includes(BRACE_START); + let closer; + if (stats.isDirectory()) { + const absPath = sysPath.resolve(path); + const targetPath = follow ? await fsrealpath(path) : path; + if (this.fsw.closed) return; + closer = await this._handleDir(wh.watchPath, stats, initialAdd, depth, target, wh, targetPath); + if (this.fsw.closed) return; + // preserve this symlink's target path + if (absPath !== targetPath && targetPath !== undefined) { + this.fsw._symlinkPaths.set(absPath, targetPath); + } + } else if (stats.isSymbolicLink()) { + const targetPath = follow ? await fsrealpath(path) : path; + if (this.fsw.closed) return; + const parent = sysPath.dirname(wh.watchPath); + this.fsw._getWatchedDir(parent).add(wh.watchPath); + this.fsw._emit(EV_ADD, wh.watchPath, stats); + closer = await this._handleDir(parent, stats, initialAdd, depth, path, wh, targetPath); + if (this.fsw.closed) return; + + // preserve this symlink's target path + if (targetPath !== undefined) { + this.fsw._symlinkPaths.set(sysPath.resolve(path), targetPath); + } + } else { + closer = this._handleFile(wh.watchPath, stats, initialAdd); + } + ready(); + + this.fsw._addPathCloser(path, closer); + return false; + + } catch (error) { + if (this.fsw._handleError(error)) { + ready(); + return path; + } + } +} + +} + +module.exports = NodeFsHandler; diff --git a/tunestats/app/api/node_modules/chokidar/package.json b/tunestats/app/api/node_modules/chokidar/package.json new file mode 100644 index 0000000..e8f8b3d --- /dev/null +++ b/tunestats/app/api/node_modules/chokidar/package.json @@ -0,0 +1,70 @@ +{ + "name": "chokidar", + "description": "Minimal and efficient cross-platform file watching library", + "version": "3.6.0", + "homepage": "https://github.com/paulmillr/chokidar", + "author": "Paul Miller (https://paulmillr.com)", + "contributors": [ + "Paul Miller (https://paulmillr.com)", + "Elan Shanker" + ], + "engines": { + "node": ">= 8.10.0" + }, + "main": "index.js", + "types": "./types/index.d.ts", + "dependencies": { + "anymatch": "~3.1.2", + "braces": "~3.0.2", + "glob-parent": "~5.1.2", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.6.0" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + }, + "devDependencies": { + "@types/node": "^14", + "chai": "^4.3", + "dtslint": "^3.3.0", + "eslint": "^7.0.0", + "mocha": "^7.0.0", + "rimraf": "^3.0.0", + "sinon": "^9.0.1", + "sinon-chai": "^3.3.0", + "typescript": "^4.4.3", + "upath": "^1.2.0" + }, + "files": [ + "index.js", + "lib/*.js", + "types/index.d.ts" + ], + "repository": { + "type": "git", + "url": "git+https://github.com/paulmillr/chokidar.git" + }, + "bugs": { + "url": "https://github.com/paulmillr/chokidar/issues" + }, + "license": "MIT", + "scripts": { + "dtslint": "dtslint types", + "lint": "eslint --report-unused-disable-directives --ignore-path .gitignore .", + "build": "npm ls", + "mocha": "mocha --exit --timeout 90000", + "test": "npm run lint && npm run mocha" + }, + "keywords": [ + "fs", + "watch", + "watchFile", + "watcher", + "watching", + "file", + "fsevents" + ], + "funding": "https://paulmillr.com/funding/" +} diff --git a/tunestats/app/api/node_modules/chokidar/types/index.d.ts b/tunestats/app/api/node_modules/chokidar/types/index.d.ts new file mode 100644 index 0000000..4558066 --- /dev/null +++ b/tunestats/app/api/node_modules/chokidar/types/index.d.ts @@ -0,0 +1,192 @@ +// TypeScript Version: 3.0 + +/// + +import * as fs from "fs"; +import { EventEmitter } from "events"; +import { Matcher } from 'anymatch'; + +export class FSWatcher extends EventEmitter implements fs.FSWatcher { + options: WatchOptions; + + /** + * Constructs a new FSWatcher instance with optional WatchOptions parameter. + */ + constructor(options?: WatchOptions); + + /** + * Add files, directories, or glob patterns for tracking. Takes an array of strings or just one + * string. + */ + add(paths: string | ReadonlyArray): this; + + /** + * Stop watching files, directories, or glob patterns. Takes an array of strings or just one + * string. + */ + unwatch(paths: string | ReadonlyArray): this; + + /** + * Returns an object representing all the paths on the file system being watched by this + * `FSWatcher` instance. The object's keys are all the directories (using absolute paths unless + * the `cwd` option was used), and the values are arrays of the names of the items contained in + * each directory. + */ + getWatched(): { + [directory: string]: string[]; + }; + + /** + * Removes all listeners from watched files. + */ + close(): Promise; + + on(event: 'add'|'addDir'|'change', listener: (path: string, stats?: fs.Stats) => void): this; + + on(event: 'all', listener: (eventName: 'add'|'addDir'|'change'|'unlink'|'unlinkDir', path: string, stats?: fs.Stats) => void): this; + + /** + * Error occurred + */ + on(event: 'error', listener: (error: Error) => void): this; + + /** + * Exposes the native Node `fs.FSWatcher events` + */ + on(event: 'raw', listener: (eventName: string, path: string, details: any) => void): this; + + /** + * Fires when the initial scan is complete + */ + on(event: 'ready', listener: () => void): this; + + on(event: 'unlink'|'unlinkDir', listener: (path: string) => void): this; + + on(event: string, listener: (...args: any[]) => void): this; + + ref(): this; + + unref(): this; +} + +export interface WatchOptions { + /** + * Indicates whether the process should continue to run as long as files are being watched. If + * set to `false` when using `fsevents` to watch, no more events will be emitted after `ready`, + * even if the process continues to run. + */ + persistent?: boolean; + + /** + * ([anymatch](https://github.com/micromatch/anymatch)-compatible definition) Defines files/paths to + * be ignored. The whole relative or absolute path is tested, not just filename. If a function + * with two arguments is provided, it gets called twice per path - once with a single argument + * (the path), second time with two arguments (the path and the + * [`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) object of that path). + */ + ignored?: Matcher; + + /** + * If set to `false` then `add`/`addDir` events are also emitted for matching paths while + * instantiating the watching as chokidar discovers these file paths (before the `ready` event). + */ + ignoreInitial?: boolean; + + /** + * When `false`, only the symlinks themselves will be watched for changes instead of following + * the link references and bubbling events through the link's path. + */ + followSymlinks?: boolean; + + /** + * The base directory from which watch `paths` are to be derived. Paths emitted with events will + * be relative to this. + */ + cwd?: string; + + /** + * If set to true then the strings passed to .watch() and .add() are treated as literal path + * names, even if they look like globs. Default: false. + */ + disableGlobbing?: boolean; + + /** + * Whether to use fs.watchFile (backed by polling), or fs.watch. If polling leads to high CPU + * utilization, consider setting this to `false`. It is typically necessary to **set this to + * `true` to successfully watch files over a network**, and it may be necessary to successfully + * watch files in other non-standard situations. Setting to `true` explicitly on OS X overrides + * the `useFsEvents` default. + */ + usePolling?: boolean; + + /** + * Whether to use the `fsevents` watching interface if available. When set to `true` explicitly + * and `fsevents` is available this supercedes the `usePolling` setting. When set to `false` on + * OS X, `usePolling: true` becomes the default. + */ + useFsEvents?: boolean; + + /** + * If relying upon the [`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) object that + * may get passed with `add`, `addDir`, and `change` events, set this to `true` to ensure it is + * provided even in cases where it wasn't already available from the underlying watch events. + */ + alwaysStat?: boolean; + + /** + * If set, limits how many levels of subdirectories will be traversed. + */ + depth?: number; + + /** + * Interval of file system polling. + */ + interval?: number; + + /** + * Interval of file system polling for binary files. ([see list of binary extensions](https://gi + * thub.com/sindresorhus/binary-extensions/blob/master/binary-extensions.json)) + */ + binaryInterval?: number; + + /** + * Indicates whether to watch files that don't have read permissions if possible. If watching + * fails due to `EPERM` or `EACCES` with this set to `true`, the errors will be suppressed + * silently. + */ + ignorePermissionErrors?: boolean; + + /** + * `true` if `useFsEvents` and `usePolling` are `false`). Automatically filters out artifacts + * that occur when using editors that use "atomic writes" instead of writing directly to the + * source file. If a file is re-added within 100 ms of being deleted, Chokidar emits a `change` + * event rather than `unlink` then `add`. If the default of 100 ms does not work well for you, + * you can override it by setting `atomic` to a custom value, in milliseconds. + */ + atomic?: boolean | number; + + /** + * can be set to an object in order to adjust timing params: + */ + awaitWriteFinish?: AwaitWriteFinishOptions | boolean; +} + +export interface AwaitWriteFinishOptions { + /** + * Amount of time in milliseconds for a file size to remain constant before emitting its event. + */ + stabilityThreshold?: number; + + /** + * File size polling interval. + */ + pollInterval?: number; +} + +/** + * produces an instance of `FSWatcher`. + */ +export function watch( + paths: string | ReadonlyArray, + options?: WatchOptions +): FSWatcher; diff --git a/tunestats/app/api/node_modules/combined-stream/License b/tunestats/app/api/node_modules/combined-stream/License new file mode 100644 index 0000000..4804b7a --- /dev/null +++ b/tunestats/app/api/node_modules/combined-stream/License @@ -0,0 +1,19 @@ +Copyright (c) 2011 Debuggable Limited + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/combined-stream/Readme.md b/tunestats/app/api/node_modules/combined-stream/Readme.md new file mode 100644 index 0000000..9e367b5 --- /dev/null +++ b/tunestats/app/api/node_modules/combined-stream/Readme.md @@ -0,0 +1,138 @@ +# combined-stream + +A stream that emits multiple other streams one after another. + +**NB** Currently `combined-stream` works with streams version 1 only. There is ongoing effort to switch this library to streams version 2. Any help is welcome. :) Meanwhile you can explore other libraries that provide streams2 support with more or less compatibility with `combined-stream`. + +- [combined-stream2](https://www.npmjs.com/package/combined-stream2): A drop-in streams2-compatible replacement for the combined-stream module. + +- [multistream](https://www.npmjs.com/package/multistream): A stream that emits multiple other streams one after another. + +## Installation + +``` bash +npm install combined-stream +``` + +## Usage + +Here is a simple example that shows how you can use combined-stream to combine +two files into one: + +``` javascript +var CombinedStream = require('combined-stream'); +var fs = require('fs'); + +var combinedStream = CombinedStream.create(); +combinedStream.append(fs.createReadStream('file1.txt')); +combinedStream.append(fs.createReadStream('file2.txt')); + +combinedStream.pipe(fs.createWriteStream('combined.txt')); +``` + +While the example above works great, it will pause all source streams until +they are needed. If you don't want that to happen, you can set `pauseStreams` +to `false`: + +``` javascript +var CombinedStream = require('combined-stream'); +var fs = require('fs'); + +var combinedStream = CombinedStream.create({pauseStreams: false}); +combinedStream.append(fs.createReadStream('file1.txt')); +combinedStream.append(fs.createReadStream('file2.txt')); + +combinedStream.pipe(fs.createWriteStream('combined.txt')); +``` + +However, what if you don't have all the source streams yet, or you don't want +to allocate the resources (file descriptors, memory, etc.) for them right away? +Well, in that case you can simply provide a callback that supplies the stream +by calling a `next()` function: + +``` javascript +var CombinedStream = require('combined-stream'); +var fs = require('fs'); + +var combinedStream = CombinedStream.create(); +combinedStream.append(function(next) { + next(fs.createReadStream('file1.txt')); +}); +combinedStream.append(function(next) { + next(fs.createReadStream('file2.txt')); +}); + +combinedStream.pipe(fs.createWriteStream('combined.txt')); +``` + +## API + +### CombinedStream.create([options]) + +Returns a new combined stream object. Available options are: + +* `maxDataSize` +* `pauseStreams` + +The effect of those options is described below. + +### combinedStream.pauseStreams = `true` + +Whether to apply back pressure to the underlaying streams. If set to `false`, +the underlaying streams will never be paused. If set to `true`, the +underlaying streams will be paused right after being appended, as well as when +`delayedStream.pipe()` wants to throttle. + +### combinedStream.maxDataSize = `2 * 1024 * 1024` + +The maximum amount of bytes (or characters) to buffer for all source streams. +If this value is exceeded, `combinedStream` emits an `'error'` event. + +### combinedStream.dataSize = `0` + +The amount of bytes (or characters) currently buffered by `combinedStream`. + +### combinedStream.append(stream) + +Appends the given `stream` to the combinedStream object. If `pauseStreams` is +set to `true, this stream will also be paused right away. + +`streams` can also be a function that takes one parameter called `next`. `next` +is a function that must be invoked in order to provide the `next` stream, see +example above. + +Regardless of how the `stream` is appended, combined-stream always attaches an +`'error'` listener to it, so you don't have to do that manually. + +Special case: `stream` can also be a String or Buffer. + +### combinedStream.write(data) + +You should not call this, `combinedStream` takes care of piping the appended +streams into itself for you. + +### combinedStream.resume() + +Causes `combinedStream` to start drain the streams it manages. The function is +idempotent, and also emits a `'resume'` event each time which usually goes to +the stream that is currently being drained. + +### combinedStream.pause(); + +If `combinedStream.pauseStreams` is set to `false`, this does nothing. +Otherwise a `'pause'` event is emitted, this goes to the stream that is +currently being drained, so you can use it to apply back pressure. + +### combinedStream.end(); + +Sets `combinedStream.writable` to false, emits an `'end'` event, and removes +all streams from the queue. + +### combinedStream.destroy(); + +Same as `combinedStream.end()`, except it emits a `'close'` event instead of +`'end'`. + +## License + +combined-stream is licensed under the MIT license. diff --git a/tunestats/app/api/node_modules/combined-stream/lib/combined_stream.js b/tunestats/app/api/node_modules/combined-stream/lib/combined_stream.js new file mode 100644 index 0000000..125f097 --- /dev/null +++ b/tunestats/app/api/node_modules/combined-stream/lib/combined_stream.js @@ -0,0 +1,208 @@ +var util = require('util'); +var Stream = require('stream').Stream; +var DelayedStream = require('delayed-stream'); + +module.exports = CombinedStream; +function CombinedStream() { + this.writable = false; + this.readable = true; + this.dataSize = 0; + this.maxDataSize = 2 * 1024 * 1024; + this.pauseStreams = true; + + this._released = false; + this._streams = []; + this._currentStream = null; + this._insideLoop = false; + this._pendingNext = false; +} +util.inherits(CombinedStream, Stream); + +CombinedStream.create = function(options) { + var combinedStream = new this(); + + options = options || {}; + for (var option in options) { + combinedStream[option] = options[option]; + } + + return combinedStream; +}; + +CombinedStream.isStreamLike = function(stream) { + return (typeof stream !== 'function') + && (typeof stream !== 'string') + && (typeof stream !== 'boolean') + && (typeof stream !== 'number') + && (!Buffer.isBuffer(stream)); +}; + +CombinedStream.prototype.append = function(stream) { + var isStreamLike = CombinedStream.isStreamLike(stream); + + if (isStreamLike) { + if (!(stream instanceof DelayedStream)) { + var newStream = DelayedStream.create(stream, { + maxDataSize: Infinity, + pauseStream: this.pauseStreams, + }); + stream.on('data', this._checkDataSize.bind(this)); + stream = newStream; + } + + this._handleErrors(stream); + + if (this.pauseStreams) { + stream.pause(); + } + } + + this._streams.push(stream); + return this; +}; + +CombinedStream.prototype.pipe = function(dest, options) { + Stream.prototype.pipe.call(this, dest, options); + this.resume(); + return dest; +}; + +CombinedStream.prototype._getNext = function() { + this._currentStream = null; + + if (this._insideLoop) { + this._pendingNext = true; + return; // defer call + } + + this._insideLoop = true; + try { + do { + this._pendingNext = false; + this._realGetNext(); + } while (this._pendingNext); + } finally { + this._insideLoop = false; + } +}; + +CombinedStream.prototype._realGetNext = function() { + var stream = this._streams.shift(); + + + if (typeof stream == 'undefined') { + this.end(); + return; + } + + if (typeof stream !== 'function') { + this._pipeNext(stream); + return; + } + + var getStream = stream; + getStream(function(stream) { + var isStreamLike = CombinedStream.isStreamLike(stream); + if (isStreamLike) { + stream.on('data', this._checkDataSize.bind(this)); + this._handleErrors(stream); + } + + this._pipeNext(stream); + }.bind(this)); +}; + +CombinedStream.prototype._pipeNext = function(stream) { + this._currentStream = stream; + + var isStreamLike = CombinedStream.isStreamLike(stream); + if (isStreamLike) { + stream.on('end', this._getNext.bind(this)); + stream.pipe(this, {end: false}); + return; + } + + var value = stream; + this.write(value); + this._getNext(); +}; + +CombinedStream.prototype._handleErrors = function(stream) { + var self = this; + stream.on('error', function(err) { + self._emitError(err); + }); +}; + +CombinedStream.prototype.write = function(data) { + this.emit('data', data); +}; + +CombinedStream.prototype.pause = function() { + if (!this.pauseStreams) { + return; + } + + if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause(); + this.emit('pause'); +}; + +CombinedStream.prototype.resume = function() { + if (!this._released) { + this._released = true; + this.writable = true; + this._getNext(); + } + + if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume(); + this.emit('resume'); +}; + +CombinedStream.prototype.end = function() { + this._reset(); + this.emit('end'); +}; + +CombinedStream.prototype.destroy = function() { + this._reset(); + this.emit('close'); +}; + +CombinedStream.prototype._reset = function() { + this.writable = false; + this._streams = []; + this._currentStream = null; +}; + +CombinedStream.prototype._checkDataSize = function() { + this._updateDataSize(); + if (this.dataSize <= this.maxDataSize) { + return; + } + + var message = + 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'; + this._emitError(new Error(message)); +}; + +CombinedStream.prototype._updateDataSize = function() { + this.dataSize = 0; + + var self = this; + this._streams.forEach(function(stream) { + if (!stream.dataSize) { + return; + } + + self.dataSize += stream.dataSize; + }); + + if (this._currentStream && this._currentStream.dataSize) { + this.dataSize += this._currentStream.dataSize; + } +}; + +CombinedStream.prototype._emitError = function(err) { + this._reset(); + this.emit('error', err); +}; diff --git a/tunestats/app/api/node_modules/combined-stream/package.json b/tunestats/app/api/node_modules/combined-stream/package.json new file mode 100644 index 0000000..6982b6d --- /dev/null +++ b/tunestats/app/api/node_modules/combined-stream/package.json @@ -0,0 +1,25 @@ +{ + "author": "Felix Geisendörfer (http://debuggable.com/)", + "name": "combined-stream", + "description": "A stream that emits multiple other streams one after another.", + "version": "1.0.8", + "homepage": "https://github.com/felixge/node-combined-stream", + "repository": { + "type": "git", + "url": "git://github.com/felixge/node-combined-stream.git" + }, + "main": "./lib/combined_stream", + "scripts": { + "test": "node test/run.js" + }, + "engines": { + "node": ">= 0.8" + }, + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "devDependencies": { + "far": "~0.0.7" + }, + "license": "MIT" +} diff --git a/tunestats/app/api/node_modules/combined-stream/yarn.lock b/tunestats/app/api/node_modules/combined-stream/yarn.lock new file mode 100644 index 0000000..7edf418 --- /dev/null +++ b/tunestats/app/api/node_modules/combined-stream/yarn.lock @@ -0,0 +1,17 @@ +# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. +# yarn lockfile v1 + + +delayed-stream@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619" + +far@~0.0.7: + version "0.0.7" + resolved "https://registry.yarnpkg.com/far/-/far-0.0.7.tgz#01c1fd362bcd26ce9cf161af3938aa34619f79a7" + dependencies: + oop "0.0.3" + +oop@0.0.3: + version "0.0.3" + resolved "https://registry.yarnpkg.com/oop/-/oop-0.0.3.tgz#70fa405a5650891a194fdc82ca68dad6dabf4401" diff --git a/tunestats/app/api/node_modules/concat-map/.travis.yml b/tunestats/app/api/node_modules/concat-map/.travis.yml new file mode 100644 index 0000000..f1d0f13 --- /dev/null +++ b/tunestats/app/api/node_modules/concat-map/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.4 + - 0.6 diff --git a/tunestats/app/api/node_modules/concat-map/LICENSE b/tunestats/app/api/node_modules/concat-map/LICENSE new file mode 100644 index 0000000..ee27ba4 --- /dev/null +++ b/tunestats/app/api/node_modules/concat-map/LICENSE @@ -0,0 +1,18 @@ +This software is released under the MIT license: + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/concat-map/README.markdown b/tunestats/app/api/node_modules/concat-map/README.markdown new file mode 100644 index 0000000..408f70a --- /dev/null +++ b/tunestats/app/api/node_modules/concat-map/README.markdown @@ -0,0 +1,62 @@ +concat-map +========== + +Concatenative mapdashery. + +[![browser support](http://ci.testling.com/substack/node-concat-map.png)](http://ci.testling.com/substack/node-concat-map) + +[![build status](https://secure.travis-ci.org/substack/node-concat-map.png)](http://travis-ci.org/substack/node-concat-map) + +example +======= + +``` js +var concatMap = require('concat-map'); +var xs = [ 1, 2, 3, 4, 5, 6 ]; +var ys = concatMap(xs, function (x) { + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; +}); +console.dir(ys); +``` + +*** + +``` +[ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ] +``` + +methods +======= + +``` js +var concatMap = require('concat-map') +``` + +concatMap(xs, fn) +----------------- + +Return an array of concatenated elements by calling `fn(x, i)` for each element +`x` and each index `i` in the array `xs`. + +When `fn(x, i)` returns an array, its result will be concatenated with the +result array. If `fn(x, i)` returns anything else, that value will be pushed +onto the end of the result array. + +install +======= + +With [npm](http://npmjs.org) do: + +``` +npm install concat-map +``` + +license +======= + +MIT + +notes +===== + +This module was written while sitting high above the ground in a tree. diff --git a/tunestats/app/api/node_modules/concat-map/example/map.js b/tunestats/app/api/node_modules/concat-map/example/map.js new file mode 100644 index 0000000..3365621 --- /dev/null +++ b/tunestats/app/api/node_modules/concat-map/example/map.js @@ -0,0 +1,6 @@ +var concatMap = require('../'); +var xs = [ 1, 2, 3, 4, 5, 6 ]; +var ys = concatMap(xs, function (x) { + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; +}); +console.dir(ys); diff --git a/tunestats/app/api/node_modules/concat-map/index.js b/tunestats/app/api/node_modules/concat-map/index.js new file mode 100644 index 0000000..b29a781 --- /dev/null +++ b/tunestats/app/api/node_modules/concat-map/index.js @@ -0,0 +1,13 @@ +module.exports = function (xs, fn) { + var res = []; + for (var i = 0; i < xs.length; i++) { + var x = fn(xs[i], i); + if (isArray(x)) res.push.apply(res, x); + else res.push(x); + } + return res; +}; + +var isArray = Array.isArray || function (xs) { + return Object.prototype.toString.call(xs) === '[object Array]'; +}; diff --git a/tunestats/app/api/node_modules/concat-map/package.json b/tunestats/app/api/node_modules/concat-map/package.json new file mode 100644 index 0000000..d3640e6 --- /dev/null +++ b/tunestats/app/api/node_modules/concat-map/package.json @@ -0,0 +1,43 @@ +{ + "name" : "concat-map", + "description" : "concatenative mapdashery", + "version" : "0.0.1", + "repository" : { + "type" : "git", + "url" : "git://github.com/substack/node-concat-map.git" + }, + "main" : "index.js", + "keywords" : [ + "concat", + "concatMap", + "map", + "functional", + "higher-order" + ], + "directories" : { + "example" : "example", + "test" : "test" + }, + "scripts" : { + "test" : "tape test/*.js" + }, + "devDependencies" : { + "tape" : "~2.4.0" + }, + "license" : "MIT", + "author" : { + "name" : "James Halliday", + "email" : "mail@substack.net", + "url" : "http://substack.net" + }, + "testling" : { + "files" : "test/*.js", + "browsers" : { + "ie" : [ 6, 7, 8, 9 ], + "ff" : [ 3.5, 10, 15.0 ], + "chrome" : [ 10, 22 ], + "safari" : [ 5.1 ], + "opera" : [ 12 ] + } + } +} diff --git a/tunestats/app/api/node_modules/concat-map/test/map.js b/tunestats/app/api/node_modules/concat-map/test/map.js new file mode 100644 index 0000000..fdbd702 --- /dev/null +++ b/tunestats/app/api/node_modules/concat-map/test/map.js @@ -0,0 +1,39 @@ +var concatMap = require('../'); +var test = require('tape'); + +test('empty or not', function (t) { + var xs = [ 1, 2, 3, 4, 5, 6 ]; + var ixes = []; + var ys = concatMap(xs, function (x, ix) { + ixes.push(ix); + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; + }); + t.same(ys, [ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ]); + t.same(ixes, [ 0, 1, 2, 3, 4, 5 ]); + t.end(); +}); + +test('always something', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function (x) { + return x === 'b' ? [ 'B', 'B', 'B' ] : [ x ]; + }); + t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]); + t.end(); +}); + +test('scalars', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function (x) { + return x === 'b' ? [ 'B', 'B', 'B' ] : x; + }); + t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]); + t.end(); +}); + +test('undefs', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function () {}); + t.same(ys, [ undefined, undefined, undefined, undefined ]); + t.end(); +}); diff --git a/tunestats/app/api/node_modules/content-disposition/HISTORY.md b/tunestats/app/api/node_modules/content-disposition/HISTORY.md new file mode 100644 index 0000000..488effa --- /dev/null +++ b/tunestats/app/api/node_modules/content-disposition/HISTORY.md @@ -0,0 +1,60 @@ +0.5.4 / 2021-12-10 +================== + + * deps: safe-buffer@5.2.1 + +0.5.3 / 2018-12-17 +================== + + * Use `safe-buffer` for improved Buffer API + +0.5.2 / 2016-12-08 +================== + + * Fix `parse` to accept any linear whitespace character + +0.5.1 / 2016-01-17 +================== + + * perf: enable strict mode + +0.5.0 / 2014-10-11 +================== + + * Add `parse` function + +0.4.0 / 2014-09-21 +================== + + * Expand non-Unicode `filename` to the full ISO-8859-1 charset + +0.3.0 / 2014-09-20 +================== + + * Add `fallback` option + * Add `type` option + +0.2.0 / 2014-09-19 +================== + + * Reduce ambiguity of file names with hex escape in buggy browsers + +0.1.2 / 2014-09-19 +================== + + * Fix periodic invalid Unicode filename header + +0.1.1 / 2014-09-19 +================== + + * Fix invalid characters appearing in `filename*` parameter + +0.1.0 / 2014-09-18 +================== + + * Make the `filename` argument optional + +0.0.0 / 2014-09-18 +================== + + * Initial release diff --git a/tunestats/app/api/node_modules/content-disposition/LICENSE b/tunestats/app/api/node_modules/content-disposition/LICENSE new file mode 100644 index 0000000..84441fb --- /dev/null +++ b/tunestats/app/api/node_modules/content-disposition/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/content-disposition/README.md b/tunestats/app/api/node_modules/content-disposition/README.md new file mode 100644 index 0000000..3a0bb05 --- /dev/null +++ b/tunestats/app/api/node_modules/content-disposition/README.md @@ -0,0 +1,142 @@ +# content-disposition + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP `Content-Disposition` header + +## Installation + +```sh +$ npm install content-disposition +``` + +## API + +```js +var contentDisposition = require('content-disposition') +``` + +### contentDisposition(filename, options) + +Create an attachment `Content-Disposition` header value using the given file name, +if supplied. The `filename` is optional and if no file name is desired, but you +want to specify `options`, set `filename` to `undefined`. + +```js +res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf')) +``` + +**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this +header through a means different from `setHeader` in Node.js, you'll want to specify +the `'binary'` encoding in Node.js. + +#### Options + +`contentDisposition` accepts these properties in the options object. + +##### fallback + +If the `filename` option is outside ISO-8859-1, then the file name is actually +stored in a supplemental field for clients that support Unicode file names and +a ISO-8859-1 version of the file name is automatically generated. + +This specifies the ISO-8859-1 file name to override the automatic generation or +disables the generation all together, defaults to `true`. + + - A string will specify the ISO-8859-1 file name to use in place of automatic + generation. + - `false` will disable including a ISO-8859-1 file name and only include the + Unicode version (unless the file name is already ISO-8859-1). + - `true` will enable automatic generation if the file name is outside ISO-8859-1. + +If the `filename` option is ISO-8859-1 and this option is specified and has a +different value, then the `filename` option is encoded in the extended field +and this set as the fallback field, even though they are both ISO-8859-1. + +##### type + +Specifies the disposition type, defaults to `"attachment"`. This can also be +`"inline"`, or any other value (all values except inline are treated like +`attachment`, but can convey additional information if both parties agree to +it). The type is normalized to lower-case. + +### contentDisposition.parse(string) + +```js +var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt') +``` + +Parse a `Content-Disposition` header string. This automatically handles extended +("Unicode") parameters by decoding them and providing them under the standard +parameter name. This will return an object with the following properties (examples +are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`): + + - `type`: The disposition type (always lower case). Example: `'attachment'` + + - `parameters`: An object of the parameters in the disposition (name of parameter + always lower case and extended versions replace non-extended versions). Example: + `{filename: "€ rates.txt"}` + +## Examples + +### Send a file for download + +```js +var contentDisposition = require('content-disposition') +var destroy = require('destroy') +var fs = require('fs') +var http = require('http') +var onFinished = require('on-finished') + +var filePath = '/path/to/public/plans.pdf' + +http.createServer(function onRequest (req, res) { + // set headers + res.setHeader('Content-Type', 'application/pdf') + res.setHeader('Content-Disposition', contentDisposition(filePath)) + + // send file + var stream = fs.createReadStream(filePath) + stream.pipe(res) + onFinished(res, function () { + destroy(stream) + }) +}) +``` + +## Testing + +```sh +$ npm test +``` + +## References + +- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616] +- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987] +- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266] +- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231] + +[rfc-2616]: https://tools.ietf.org/html/rfc2616 +[rfc-5987]: https://tools.ietf.org/html/rfc5987 +[rfc-6266]: https://tools.ietf.org/html/rfc6266 +[tc-2231]: http://greenbytes.de/tech/tc2231/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-disposition.svg +[npm-url]: https://npmjs.org/package/content-disposition +[node-version-image]: https://img.shields.io/node/v/content-disposition.svg +[node-version-url]: https://nodejs.org/en/download +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg +[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master +[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg +[downloads-url]: https://npmjs.org/package/content-disposition +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/content-disposition/ci/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/content-disposition?query=workflow%3Aci diff --git a/tunestats/app/api/node_modules/content-disposition/index.js b/tunestats/app/api/node_modules/content-disposition/index.js new file mode 100644 index 0000000..ecec899 --- /dev/null +++ b/tunestats/app/api/node_modules/content-disposition/index.js @@ -0,0 +1,458 @@ +/*! + * content-disposition + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = contentDisposition +module.exports.parse = parse + +/** + * Module dependencies. + * @private + */ + +var basename = require('path').basename +var Buffer = require('safe-buffer').Buffer + +/** + * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%") + * @private + */ + +var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex + +/** + * RegExp to match percent encoding escape. + * @private + */ + +var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/ +var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g + +/** + * RegExp to match non-latin1 characters. + * @private + */ + +var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = + * @private + */ + +var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + * @private + */ + +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp for various RFC 2616 grammar + * + * parameter = token "=" ( token | quoted-string ) + * token = 1* + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = > + * quoted-pair = "\" CHAR + * CHAR = + * TEXT = + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = + * LF = + * SP = + * HT = + * CTL = + * OCTET = + * @private + */ + +var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/ +var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/ + +/** + * RegExp for various RFC 5987 grammar + * + * ext-value = charset "'" [ language ] "'" value-chars + * charset = "UTF-8" / "ISO-8859-1" / mime-charset + * mime-charset = 1*mime-charsetc + * mime-charsetc = ALPHA / DIGIT + * / "!" / "#" / "$" / "%" / "&" + * / "+" / "-" / "^" / "_" / "`" + * / "{" / "}" / "~" + * language = ( 2*3ALPHA [ extlang ] ) + * / 4ALPHA + * / 5*8ALPHA + * extlang = *3( "-" 3ALPHA ) + * value-chars = *( pct-encoded / attr-char ) + * pct-encoded = "%" HEXDIG HEXDIG + * attr-char = ALPHA / DIGIT + * / "!" / "#" / "$" / "&" / "+" / "-" / "." + * / "^" / "_" / "`" / "|" / "~" + * @private + */ + +var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/ + +/** + * RegExp for various RFC 6266 grammar + * + * disposition-type = "inline" | "attachment" | disp-ext-type + * disp-ext-type = token + * disposition-parm = filename-parm | disp-ext-parm + * filename-parm = "filename" "=" value + * | "filename*" "=" ext-value + * disp-ext-parm = token "=" value + * | ext-token "=" ext-value + * ext-token = + * @private + */ + +var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex + +/** + * Create an attachment Content-Disposition header. + * + * @param {string} [filename] + * @param {object} [options] + * @param {string} [options.type=attachment] + * @param {string|boolean} [options.fallback=true] + * @return {string} + * @public + */ + +function contentDisposition (filename, options) { + var opts = options || {} + + // get type + var type = opts.type || 'attachment' + + // get parameters + var params = createparams(filename, opts.fallback) + + // format into string + return format(new ContentDisposition(type, params)) +} + +/** + * Create parameters object from filename and fallback. + * + * @param {string} [filename] + * @param {string|boolean} [fallback=true] + * @return {object} + * @private + */ + +function createparams (filename, fallback) { + if (filename === undefined) { + return + } + + var params = {} + + if (typeof filename !== 'string') { + throw new TypeError('filename must be a string') + } + + // fallback defaults to true + if (fallback === undefined) { + fallback = true + } + + if (typeof fallback !== 'string' && typeof fallback !== 'boolean') { + throw new TypeError('fallback must be a string or boolean') + } + + if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) { + throw new TypeError('fallback must be ISO-8859-1 string') + } + + // restrict to file base name + var name = basename(filename) + + // determine if name is suitable for quoted string + var isQuotedString = TEXT_REGEXP.test(name) + + // generate fallback name + var fallbackName = typeof fallback !== 'string' + ? fallback && getlatin1(name) + : basename(fallback) + var hasFallback = typeof fallbackName === 'string' && fallbackName !== name + + // set extended filename parameter + if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) { + params['filename*'] = name + } + + // set filename parameter + if (isQuotedString || hasFallback) { + params.filename = hasFallback + ? fallbackName + : name + } + + return params +} + +/** + * Format object to Content-Disposition header. + * + * @param {object} obj + * @param {string} obj.type + * @param {object} [obj.parameters] + * @return {string} + * @private + */ + +function format (obj) { + var parameters = obj.parameters + var type = obj.type + + if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + // start with normalized type + var string = String(type).toLowerCase() + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + var val = param.substr(-1) === '*' + ? ustring(parameters[param]) + : qstring(parameters[param]) + + string += '; ' + param + '=' + val + } + } + + return string +} + +/** + * Decode a RFC 5987 field value (gracefully). + * + * @param {string} str + * @return {string} + * @private + */ + +function decodefield (str) { + var match = EXT_VALUE_REGEXP.exec(str) + + if (!match) { + throw new TypeError('invalid extended field value') + } + + var charset = match[1].toLowerCase() + var encoded = match[2] + var value + + // to binary string + var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode) + + switch (charset) { + case 'iso-8859-1': + value = getlatin1(binary) + break + case 'utf-8': + value = Buffer.from(binary, 'binary').toString('utf8') + break + default: + throw new TypeError('unsupported charset in extended field') + } + + return value +} + +/** + * Get ISO-8859-1 version of string. + * + * @param {string} val + * @return {string} + * @private + */ + +function getlatin1 (val) { + // simple Unicode -> ISO-8859-1 transformation + return String(val).replace(NON_LATIN1_REGEXP, '?') +} + +/** + * Parse Content-Disposition header string. + * + * @param {string} string + * @return {object} + * @public + */ + +function parse (string) { + if (!string || typeof string !== 'string') { + throw new TypeError('argument string is required') + } + + var match = DISPOSITION_TYPE_REGEXP.exec(string) + + if (!match) { + throw new TypeError('invalid type format') + } + + // normalize type + var index = match[0].length + var type = match[1].toLowerCase() + + var key + var names = [] + var params = {} + var value + + // calculate index to start at + index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';' + ? index - 1 + : index + + // match parameters + while ((match = PARAM_REGEXP.exec(string))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (names.indexOf(key) !== -1) { + throw new TypeError('invalid duplicate parameter') + } + + names.push(key) + + if (key.indexOf('*') + 1 === key.length) { + // decode extended value + key = key.slice(0, -1) + value = decodefield(value) + + // overwrite existing value + params[key] = value + continue + } + + if (typeof params[key] === 'string') { + continue + } + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(QESC_REGEXP, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + return new ContentDisposition(type, params) +} + +/** + * Percent decode a single character. + * + * @param {string} str + * @param {string} hex + * @return {string} + * @private + */ + +function pdecode (str, hex) { + return String.fromCharCode(parseInt(hex, 16)) +} + +/** + * Percent encode a single character. + * + * @param {string} char + * @return {string} + * @private + */ + +function pencode (char) { + return '%' + String(char) + .charCodeAt(0) + .toString(16) + .toUpperCase() +} + +/** + * Quote a string for HTTP. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Encode a Unicode string for HTTP (RFC 5987). + * + * @param {string} val + * @return {string} + * @private + */ + +function ustring (val) { + var str = String(val) + + // percent encode as UTF-8 + var encoded = encodeURIComponent(str) + .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode) + + return 'UTF-8\'\'' + encoded +} + +/** + * Class for parsed Content-Disposition header for v8 optimization + * + * @public + * @param {string} type + * @param {object} parameters + * @constructor + */ + +function ContentDisposition (type, parameters) { + this.type = type + this.parameters = parameters +} diff --git a/tunestats/app/api/node_modules/content-disposition/package.json b/tunestats/app/api/node_modules/content-disposition/package.json new file mode 100644 index 0000000..43c70ce --- /dev/null +++ b/tunestats/app/api/node_modules/content-disposition/package.json @@ -0,0 +1,44 @@ +{ + "name": "content-disposition", + "description": "Create and parse Content-Disposition header", + "version": "0.5.4", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "content-disposition", + "http", + "rfc6266", + "res" + ], + "repository": "jshttp/content-disposition", + "dependencies": { + "safe-buffer": "5.2.1" + }, + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "7.32.0", + "eslint-config-standard": "13.0.1", + "eslint-plugin-import": "2.25.3", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "istanbul": "0.4.5", + "mocha": "9.1.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + } +} diff --git a/tunestats/app/api/node_modules/content-type/HISTORY.md b/tunestats/app/api/node_modules/content-type/HISTORY.md new file mode 100644 index 0000000..4583671 --- /dev/null +++ b/tunestats/app/api/node_modules/content-type/HISTORY.md @@ -0,0 +1,29 @@ +1.0.5 / 2023-01-29 +================== + + * perf: skip value escaping when unnecessary + +1.0.4 / 2017-09-11 +================== + + * perf: skip parameter parsing when no parameters + +1.0.3 / 2017-09-10 +================== + + * perf: remove argument reassignment + +1.0.2 / 2016-05-09 +================== + + * perf: enable strict mode + +1.0.1 / 2015-02-13 +================== + + * Improve missing `Content-Type` header error message + +1.0.0 / 2015-02-01 +================== + + * Initial implementation, derived from `media-typer@0.3.0` diff --git a/tunestats/app/api/node_modules/content-type/LICENSE b/tunestats/app/api/node_modules/content-type/LICENSE new file mode 100644 index 0000000..34b1a2d --- /dev/null +++ b/tunestats/app/api/node_modules/content-type/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/content-type/README.md b/tunestats/app/api/node_modules/content-type/README.md new file mode 100644 index 0000000..c1a922a --- /dev/null +++ b/tunestats/app/api/node_modules/content-type/README.md @@ -0,0 +1,94 @@ +# content-type + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Create and parse HTTP Content-Type header according to RFC 7231 + +## Installation + +```sh +$ npm install content-type +``` + +## API + +```js +var contentType = require('content-type') +``` + +### contentType.parse(string) + +```js +var obj = contentType.parse('image/svg+xml; charset=utf-8') +``` + +Parse a `Content-Type` header. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (the type and subtype, always lower case). + Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter + always lower case). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the string is missing or invalid. + +### contentType.parse(req) + +```js +var obj = contentType.parse(req) +``` + +Parse the `Content-Type` header from the given `req`. Short-cut for +`contentType.parse(req.headers['content-type'])`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.parse(res) + +```js +var obj = contentType.parse(res) +``` + +Parse the `Content-Type` header set on the given `res`. Short-cut for +`contentType.parse(res.getHeader('content-type'))`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.format(obj) + +```js +var str = contentType.format({ + type: 'image/svg+xml', + parameters: { charset: 'utf-8' } +}) +``` + +Format an object into a `Content-Type` header. This will return a string of the +content type for the given object with the following properties (examples are +shown that produce the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of the + parameter will be lower-cased). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the object contains an invalid type or parameter names. + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/content-type/master?label=ci +[ci-url]: https://github.com/jshttp/content-type/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/content-type/master +[coveralls-url]: https://coveralls.io/r/jshttp/content-type?branch=master +[node-image]: https://badgen.net/npm/node/content-type +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/content-type +[npm-url]: https://npmjs.org/package/content-type +[npm-version-image]: https://badgen.net/npm/v/content-type diff --git a/tunestats/app/api/node_modules/content-type/index.js b/tunestats/app/api/node_modules/content-type/index.js new file mode 100644 index 0000000..41840e7 --- /dev/null +++ b/tunestats/app/api/node_modules/content-type/index.js @@ -0,0 +1,225 @@ +/*! + * content-type + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1 + * + * parameter = token "=" ( token / quoted-string ) + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE + * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text + * obs-text = %x80-FF + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + */ +var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ // eslint-disable-line no-control-regex +var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * RegExp to match quoted-pair in RFC 7230 sec 3.2.6 + * + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + * obs-text = %x80-FF + */ +var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g // eslint-disable-line no-control-regex + +/** + * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6 + */ +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp to match type in RFC 7231 sec 3.1.1.1 + * + * media-type = type "/" subtype + * type = token + * subtype = token + */ +var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * Module exports. + * @public + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @public + */ + +function format (obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var type = obj.type + + if (!type || !TYPE_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + var string = type + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!TOKEN_REGEXP.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @public + */ + +function parse (string) { + if (!string) { + throw new TypeError('argument string is required') + } + + // support req/res-like objects as argument + var header = typeof string === 'object' + ? getcontenttype(string) + : string + + if (typeof header !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = header.indexOf(';') + var type = index !== -1 + ? header.slice(0, index).trim() + : header.trim() + + if (!TYPE_REGEXP.test(type)) { + throw new TypeError('invalid media type') + } + + var obj = new ContentType(type.toLowerCase()) + + // parse parameters + if (index !== -1) { + var key + var match + var value + + PARAM_REGEXP.lastIndex = index + + while ((match = PARAM_REGEXP.exec(header))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value.charCodeAt(0) === 0x22 /* " */) { + // remove quotes + value = value.slice(1, -1) + + // remove escapes + if (value.indexOf('\\') !== -1) { + value = value.replace(QESC_REGEXP, '$1') + } + } + + obj.parameters[key] = value + } + + if (index !== header.length) { + throw new TypeError('invalid parameter format') + } + } + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @private + */ + +function getcontenttype (obj) { + var header + + if (typeof obj.getHeader === 'function') { + // res-like + header = obj.getHeader('content-type') + } else if (typeof obj.headers === 'object') { + // req-like + header = obj.headers && obj.headers['content-type'] + } + + if (typeof header !== 'string') { + throw new TypeError('content-type header is missing from object') + } + + return header +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + // no need to quote tokens + if (TOKEN_REGEXP.test(str)) { + return str + } + + if (str.length > 0 && !TEXT_REGEXP.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Class to represent a content type. + * @private + */ +function ContentType (type) { + this.parameters = Object.create(null) + this.type = type +} diff --git a/tunestats/app/api/node_modules/content-type/package.json b/tunestats/app/api/node_modules/content-type/package.json new file mode 100644 index 0000000..9db19f6 --- /dev/null +++ b/tunestats/app/api/node_modules/content-type/package.json @@ -0,0 +1,42 @@ +{ + "name": "content-type", + "description": "Create and parse HTTP Content-Type header", + "version": "1.0.5", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "content-type", + "http", + "req", + "res", + "rfc7231" + ], + "repository": "jshttp/content-type", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "8.32.0", + "eslint-config-standard": "15.0.1", + "eslint-plugin-import": "2.27.5", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.1.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "10.2.0", + "nyc": "15.1.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/tunestats/app/api/node_modules/cookie-parser/HISTORY.md b/tunestats/app/api/node_modules/cookie-parser/HISTORY.md new file mode 100644 index 0000000..e4073d5 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-parser/HISTORY.md @@ -0,0 +1,100 @@ +1.4.6 / 2021-11-16 +================== + + * deps: cookie@0.4.1 + +1.4.5 / 2020-03-14 +================== + + * deps: cookie@0.4.0 + +1.4.4 / 2019-02-12 +================== + + * perf: normalize `secret` argument only once + +1.4.3 / 2016-05-26 +================== + + * deps: cookie@0.3.1 + - perf: use for loop in parse + +1.4.2 / 2016-05-20 +================== + + * deps: cookie@0.2.4 + - perf: enable strict mode + - perf: use for loop in parse + - perf: use string concatenation for serialization + +1.4.1 / 2016-01-11 +================== + + * deps: cookie@0.2.3 + * perf: enable strict mode + +1.4.0 / 2015-09-18 +================== + + * Accept array of secrets in addition to a single secret + * Fix `JSONCookie` to return `undefined` for non-string arguments + * Fix `signedCookie` to return `undefined` for non-string arguments + * deps: cookie@0.2.2 + +1.3.5 / 2015-05-19 +================== + + * deps: cookie@0.1.3 + - Slight optimizations + +1.3.4 / 2015-02-15 +================== + + * deps: cookie-signature@1.0.6 + +1.3.3 / 2014-09-05 +================== + + * deps: cookie-signature@1.0.5 + +1.3.2 / 2014-06-26 +================== + + * deps: cookie-signature@1.0.4 + - fix for timing attacks + +1.3.1 / 2014-06-17 +================== + + * actually export `signedCookie` + +1.3.0 / 2014-06-17 +================== + + * add `signedCookie` export for single cookie unsigning + +1.2.0 / 2014-06-17 +================== + + * export parsing functions + * `req.cookies` and `req.signedCookies` are now plain objects + * slightly faster parsing of many cookies + +1.1.0 / 2014-05-12 +================== + + * Support for NodeJS version 0.8 + * deps: cookie@0.1.2 + - Fix for maxAge == 0 + - made compat with expires field + - tweak maxAge NaN error message + +1.0.1 / 2014-02-20 +================== + + * add missing dependencies + +1.0.0 / 2014-02-15 +================== + + * Genesis from `connect` diff --git a/tunestats/app/api/node_modules/cookie-parser/LICENSE b/tunestats/app/api/node_modules/cookie-parser/LICENSE new file mode 100644 index 0000000..343f2ad --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/cookie-parser/README.md b/tunestats/app/api/node_modules/cookie-parser/README.md new file mode 100644 index 0000000..b8ecd7b --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-parser/README.md @@ -0,0 +1,119 @@ +# cookie-parser + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Parse `Cookie` header and populate `req.cookies` with an object keyed by the +cookie names. Optionally you may enable signed cookie support by passing a +`secret` string, which assigns `req.secret` so it may be used by other +middleware. + +## Installation + +```sh +$ npm install cookie-parser +``` + +## API + +```js +var cookieParser = require('cookie-parser') +``` + +### cookieParser(secret, options) + +Create a new cookie parser middleware function using the given `secret` and +`options`. + +- `secret` a string or array used for signing cookies. This is optional and if + not specified, will not parse signed cookies. If a string is provided, this + is used as the secret. If an array is provided, an attempt will be made to + unsign the cookie with each secret in order. +- `options` an object that is passed to `cookie.parse` as the second option. See + [cookie](https://www.npmjs.org/package/cookie) for more information. + - `decode` a function to decode the value of the cookie + +The middleware will parse the `Cookie` header on the request and expose the +cookie data as the property `req.cookies` and, if a `secret` was provided, as +the property `req.signedCookies`. These properties are name value pairs of the +cookie name to cookie value. + +When `secret` is provided, this module will unsign and validate any signed cookie +values and move those name value pairs from `req.cookies` into `req.signedCookies`. +A signed cookie is a cookie that has a value prefixed with `s:`. Signed cookies +that fail signature validation will have the value `false` instead of the tampered +value. + +In addition, this module supports special "JSON cookies". These are cookie where +the value is prefixed with `j:`. When these values are encountered, the value will +be exposed as the result of `JSON.parse`. If parsing fails, the original value will +remain. + +### cookieParser.JSONCookie(str) + +Parse a cookie value as a JSON cookie. This will return the parsed JSON value +if it was a JSON cookie, otherwise, it will return the passed value. + +### cookieParser.JSONCookies(cookies) + +Given an object, this will iterate over the keys and call `JSONCookie` on each +value, replacing the original value with the parsed value. This returns the +same object that was passed in. + +### cookieParser.signedCookie(str, secret) + +Parse a cookie value as a signed cookie. This will return the parsed unsigned +value if it was a signed cookie and the signature was valid. If the value was +not signed, the original value is returned. If the value was signed but the +signature could not be validated, `false` is returned. + +The `secret` argument can be an array or string. If a string is provided, this +is used as the secret. If an array is provided, an attempt will be made to +unsign the cookie with each secret in order. + +### cookieParser.signedCookies(cookies, secret) + +Given an object, this will iterate over the keys and check if any value is a +signed cookie. If it is a signed cookie and the signature is valid, the key +will be deleted from the object and added to the new object that is returned. + +The `secret` argument can be an array or string. If a string is provided, this +is used as the secret. If an array is provided, an attempt will be made to +unsign the cookie with each secret in order. + +## Example + +```js +var express = require('express') +var cookieParser = require('cookie-parser') + +var app = express() +app.use(cookieParser()) + +app.get('/', function (req, res) { + // Cookies that have not been signed + console.log('Cookies: ', req.cookies) + + // Cookies that have been signed + console.log('Signed Cookies: ', req.signedCookies) +}) + +app.listen(8080) + +// curl command that sends an HTTP request with two cookies +// curl http://127.0.0.1:8080 --cookie "Cho=Kim;Greet=Hello" +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/expressjs/cookie-parser/master?label=ci +[ci-url]: https://github.com/expressjs/cookie-parser/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/cookie-parser/master +[coveralls-url]: https://coveralls.io/r/expressjs/cookie-parser?branch=master +[npm-downloads-image]: https://badgen.net/npm/dm/cookie-parser +[npm-url]: https://npmjs.org/package/cookie-parser +[npm-version-image]: https://badgen.net/npm/v/cookie-parser diff --git a/tunestats/app/api/node_modules/cookie-parser/index.js b/tunestats/app/api/node_modules/cookie-parser/index.js new file mode 100644 index 0000000..dd6d479 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-parser/index.js @@ -0,0 +1,182 @@ +/*! + * cookie-parser + * Copyright(c) 2014 TJ Holowaychuk + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var cookie = require('cookie') +var signature = require('cookie-signature') + +/** + * Module exports. + * @public + */ + +module.exports = cookieParser +module.exports.JSONCookie = JSONCookie +module.exports.JSONCookies = JSONCookies +module.exports.signedCookie = signedCookie +module.exports.signedCookies = signedCookies + +/** + * Parse Cookie header and populate `req.cookies` + * with an object keyed by the cookie names. + * + * @param {string|array} [secret] A string (or array of strings) representing cookie signing secret(s). + * @param {Object} [options] + * @return {Function} + * @public + */ + +function cookieParser (secret, options) { + var secrets = !secret || Array.isArray(secret) + ? (secret || []) + : [secret] + + return function cookieParser (req, res, next) { + if (req.cookies) { + return next() + } + + var cookies = req.headers.cookie + + req.secret = secrets[0] + req.cookies = Object.create(null) + req.signedCookies = Object.create(null) + + // no cookies + if (!cookies) { + return next() + } + + req.cookies = cookie.parse(cookies, options) + + // parse signed cookies + if (secrets.length !== 0) { + req.signedCookies = signedCookies(req.cookies, secrets) + req.signedCookies = JSONCookies(req.signedCookies) + } + + // parse JSON cookies + req.cookies = JSONCookies(req.cookies) + + next() + } +} + +/** + * Parse JSON cookie string. + * + * @param {String} str + * @return {Object} Parsed object or undefined if not json cookie + * @public + */ + +function JSONCookie (str) { + if (typeof str !== 'string' || str.substr(0, 2) !== 'j:') { + return undefined + } + + try { + return JSON.parse(str.slice(2)) + } catch (err) { + return undefined + } +} + +/** + * Parse JSON cookies. + * + * @param {Object} obj + * @return {Object} + * @public + */ + +function JSONCookies (obj) { + var cookies = Object.keys(obj) + var key + var val + + for (var i = 0; i < cookies.length; i++) { + key = cookies[i] + val = JSONCookie(obj[key]) + + if (val) { + obj[key] = val + } + } + + return obj +} + +/** + * Parse a signed cookie string, return the decoded value. + * + * @param {String} str signed cookie string + * @param {string|array} secret + * @return {String} decoded value + * @public + */ + +function signedCookie (str, secret) { + if (typeof str !== 'string') { + return undefined + } + + if (str.substr(0, 2) !== 's:') { + return str + } + + var secrets = !secret || Array.isArray(secret) + ? (secret || []) + : [secret] + + for (var i = 0; i < secrets.length; i++) { + var val = signature.unsign(str.slice(2), secrets[i]) + + if (val !== false) { + return val + } + } + + return false +} + +/** + * Parse signed cookies, returning an object containing the decoded key/value + * pairs, while removing the signed key from obj. + * + * @param {Object} obj + * @param {string|array} secret + * @return {Object} + * @public + */ + +function signedCookies (obj, secret) { + var cookies = Object.keys(obj) + var dec + var key + var ret = Object.create(null) + var val + + for (var i = 0; i < cookies.length; i++) { + key = cookies[i] + val = obj[key] + dec = signedCookie(val, secret) + + if (val !== dec) { + ret[key] = dec + delete obj[key] + } + } + + return ret +} diff --git a/tunestats/app/api/node_modules/cookie-parser/package.json b/tunestats/app/api/node_modules/cookie-parser/package.json new file mode 100644 index 0000000..4efac17 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-parser/package.json @@ -0,0 +1,45 @@ +{ + "name": "cookie-parser", + "description": "Parse HTTP request cookies", + "version": "1.4.6", + "author": "TJ Holowaychuk (http://tjholowaychuk.com)", + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "repository": "expressjs/cookie-parser", + "keywords": [ + "cookie", + "middleware" + ], + "dependencies": { + "cookie": "0.4.1", + "cookie-signature": "1.0.6" + }, + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.2", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.3.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.1.3", + "nyc": "15.1.0", + "supertest": "6.1.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "engines": { + "node": ">= 0.8.0" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/tunestats/app/api/node_modules/cookie-signature/.npmignore b/tunestats/app/api/node_modules/cookie-signature/.npmignore new file mode 100644 index 0000000..f1250e5 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-signature/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/tunestats/app/api/node_modules/cookie-signature/History.md b/tunestats/app/api/node_modules/cookie-signature/History.md new file mode 100644 index 0000000..78513cc --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-signature/History.md @@ -0,0 +1,38 @@ +1.0.6 / 2015-02-03 +================== + +* use `npm test` instead of `make test` to run tests +* clearer assertion messages when checking input + + +1.0.5 / 2014-09-05 +================== + +* add license to package.json + +1.0.4 / 2014-06-25 +================== + + * corrected avoidance of timing attacks (thanks @tenbits!) + +1.0.3 / 2014-01-28 +================== + + * [incorrect] fix for timing attacks + +1.0.2 / 2014-01-28 +================== + + * fix missing repository warning + * fix typo in test + +1.0.1 / 2013-04-15 +================== + + * Revert "Changed underlying HMAC algo. to sha512." + * Revert "Fix for timing attacks on MAC verification." + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/tunestats/app/api/node_modules/cookie-signature/Readme.md b/tunestats/app/api/node_modules/cookie-signature/Readme.md new file mode 100644 index 0000000..2559e84 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-signature/Readme.md @@ -0,0 +1,42 @@ + +# cookie-signature + + Sign and unsign cookies. + +## Example + +```js +var cookie = require('cookie-signature'); + +var val = cookie.sign('hello', 'tobiiscool'); +val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI'); + +var val = cookie.sign('hello', 'tobiiscool'); +cookie.unsign(val, 'tobiiscool').should.equal('hello'); +cookie.unsign(val, 'luna').should.be.false; +``` + +## License + +(The MIT License) + +Copyright (c) 2012 LearnBoost <tj@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/tunestats/app/api/node_modules/cookie-signature/index.js b/tunestats/app/api/node_modules/cookie-signature/index.js new file mode 100644 index 0000000..b8c9463 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-signature/index.js @@ -0,0 +1,51 @@ +/** + * Module dependencies. + */ + +var crypto = require('crypto'); + +/** + * Sign the given `val` with `secret`. + * + * @param {String} val + * @param {String} secret + * @return {String} + * @api private + */ + +exports.sign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + return val + '.' + crypto + .createHmac('sha256', secret) + .update(val) + .digest('base64') + .replace(/\=+$/, ''); +}; + +/** + * Unsign and decode the given `val` with `secret`, + * returning `false` if the signature is invalid. + * + * @param {String} val + * @param {String} secret + * @return {String|Boolean} + * @api private + */ + +exports.unsign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + var str = val.slice(0, val.lastIndexOf('.')) + , mac = exports.sign(str, secret); + + return sha1(mac) == sha1(val) ? str : false; +}; + +/** + * Private + */ + +function sha1(str){ + return crypto.createHash('sha1').update(str).digest('hex'); +} diff --git a/tunestats/app/api/node_modules/cookie-signature/package.json b/tunestats/app/api/node_modules/cookie-signature/package.json new file mode 100644 index 0000000..29c4498 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie-signature/package.json @@ -0,0 +1,18 @@ +{ + "name": "cookie-signature", + "version": "1.0.6", + "description": "Sign and unsign cookies", + "keywords": ["cookie", "sign", "unsign"], + "author": "TJ Holowaychuk ", + "license": "MIT", + "repository": { "type": "git", "url": "https://github.com/visionmedia/node-cookie-signature.git"}, + "dependencies": {}, + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "scripts": { + "test": "mocha --require should --reporter spec" + }, + "main": "index" +} diff --git a/tunestats/app/api/node_modules/cookie/HISTORY.md b/tunestats/app/api/node_modules/cookie/HISTORY.md new file mode 100644 index 0000000..ce080e0 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie/HISTORY.md @@ -0,0 +1,128 @@ +0.4.1 / 2020-04-21 +================== + + * Fix `maxAge` option to reject invalid values + +0.4.0 / 2019-05-15 +================== + + * Add `SameSite=None` support + +0.3.1 / 2016-05-26 +================== + + * Fix `sameSite: true` to work with draft-7 clients + - `true` now sends `SameSite=Strict` instead of `SameSite` + +0.3.0 / 2016-05-26 +================== + + * Add `sameSite` option + - Replaces `firstPartyOnly` option, never implemented by browsers + * Improve error message when `encode` is not a function + * Improve error message when `expires` is not a `Date` + +0.2.4 / 2016-05-20 +================== + + * perf: enable strict mode + * perf: use for loop in parse + * perf: use string concatination for serialization + +0.2.3 / 2015-10-25 +================== + + * Fix cookie `Max-Age` to never be a floating point number + +0.2.2 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.2.1 / 2015-09-17 +================== + + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.2.0 / 2015-08-13 +================== + + * Add `firstPartyOnly` option + * Throw better error for invalid argument to parse + * perf: hoist regular expression + +0.1.5 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.1.4 / 2015-09-17 +================== + + * Throw better error for invalid argument to parse + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.1.3 / 2015-05-19 +================== + + * Reduce the scope of try-catch deopt + * Remove argument reassignments + +0.1.2 / 2014-04-16 +================== + + * Remove unnecessary files from npm package + +0.1.1 / 2014-02-23 +================== + + * Fix bad parse when cookie value contained a comma + * Fix support for `maxAge` of `0` + +0.1.0 / 2013-05-01 +================== + + * Add `decode` option + * Add `encode` option + +0.0.6 / 2013-04-08 +================== + + * Ignore cookie parts missing `=` + +0.0.5 / 2012-10-29 +================== + + * Return raw cookie value if value unescape errors + +0.0.4 / 2012-06-21 +================== + + * Use encode/decodeURIComponent for cookie encoding/decoding + - Improve server/client interoperability + +0.0.3 / 2012-06-06 +================== + + * Only escape special characters per the cookie RFC + +0.0.2 / 2012-06-01 +================== + + * Fix `maxAge` option to not throw error + +0.0.1 / 2012-05-28 +================== + + * Add more tests + +0.0.0 / 2012-05-28 +================== + + * Initial release diff --git a/tunestats/app/api/node_modules/cookie/LICENSE b/tunestats/app/api/node_modules/cookie/LICENSE new file mode 100644 index 0000000..058b6b4 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/tunestats/app/api/node_modules/cookie/README.md b/tunestats/app/api/node_modules/cookie/README.md new file mode 100644 index 0000000..18b2c2c --- /dev/null +++ b/tunestats/app/api/node_modules/cookie/README.md @@ -0,0 +1,257 @@ +# cookie + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `encodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path +is considered the ["default path"][rfc-6265-5.1.4]. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-03-4.1.2.7]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in +[the specification][rfc-6265bis-03-4.1.2.7]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('

Welcome back, ' + escapeHtml(name) + '!

'); + } else { + res.write('

Hello, new visitor!

'); + } + + res.write('
'); + res.write(' '); + res.end('
'); +} + +http.createServer(onRequest).listen(3000); +``` + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +``` +$ npm run bench + +> cookie@0.3.1 bench cookie +> node benchmark/index.js + + http_parser@2.8.0 + node@6.14.2 + v8@5.1.281.111 + uv@1.16.1 + zlib@1.2.11 + ares@1.10.1-DEV + icu@58.2 + modules@48 + napi@3 + openssl@1.0.2o + +> node benchmark/parse.js + + cookie.parse + + 6 tests completed. + + simple x 1,200,691 ops/sec ±1.12% (189 runs sampled) + decode x 1,012,994 ops/sec ±0.97% (186 runs sampled) + unquote x 1,074,174 ops/sec ±2.43% (186 runs sampled) + duplicates x 438,424 ops/sec ±2.17% (184 runs sampled) + 10 cookies x 147,154 ops/sec ±1.01% (186 runs sampled) + 100 cookies x 14,274 ops/sec ±1.07% (187 runs sampled) +``` + +## References + +- [RFC 6265: HTTP State Management Mechanism][rfc-6265] +- [Same-site Cookies][rfc-6265bis-03-4.1.2.7] + +[rfc-6265bis-03-4.1.2.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-03#section-4.1.2.7 +[rfc-6265]: https://tools.ietf.org/html/rfc6265 +[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4 +[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1 +[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2 +[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3 +[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4 +[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5 +[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6 +[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3 + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master +[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master +[node-version-image]: https://badgen.net/npm/node/cookie +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/cookie +[npm-url]: https://npmjs.org/package/cookie +[npm-version-image]: https://badgen.net/npm/v/cookie +[travis-image]: https://badgen.net/travis/jshttp/cookie/master +[travis-url]: https://travis-ci.org/jshttp/cookie diff --git a/tunestats/app/api/node_modules/cookie/index.js b/tunestats/app/api/node_modules/cookie/index.js new file mode 100644 index 0000000..760f32e --- /dev/null +++ b/tunestats/app/api/node_modules/cookie/index.js @@ -0,0 +1,202 @@ +/*! + * cookie + * Copyright(c) 2012-2014 Roman Shtylman + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +exports.parse = parse; +exports.serialize = serialize; + +/** + * Module variables. + * @private + */ + +var decode = decodeURIComponent; +var encode = encodeURIComponent; +var pairSplitRegExp = /; */; + +/** + * RegExp to match field-content in RFC 7230 sec 3.2 + * + * field-content = field-vchar [ 1*( SP / HTAB ) field-vchar ] + * field-vchar = VCHAR / obs-text + * obs-text = %x80-FF + */ + +var fieldContentRegExp = /^[\u0009\u0020-\u007e\u0080-\u00ff]+$/; + +/** + * Parse a cookie header. + * + * Parse the given cookie header string into an object + * The object has the various cookies as keys(names) => values + * + * @param {string} str + * @param {object} [options] + * @return {object} + * @public + */ + +function parse(str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string'); + } + + var obj = {} + var opt = options || {}; + var pairs = str.split(pairSplitRegExp); + var dec = opt.decode || decode; + + for (var i = 0; i < pairs.length; i++) { + var pair = pairs[i]; + var eq_idx = pair.indexOf('='); + + // skip things that don't look like key=value + if (eq_idx < 0) { + continue; + } + + var key = pair.substr(0, eq_idx).trim() + var val = pair.substr(++eq_idx, pair.length).trim(); + + // quoted values + if ('"' == val[0]) { + val = val.slice(1, -1); + } + + // only assign once + if (undefined == obj[key]) { + obj[key] = tryDecode(val, dec); + } + } + + return obj; +} + +/** + * Serialize data into a cookie header. + * + * Serialize the a name value pair into a cookie string suitable for + * http headers. An optional options object specified cookie parameters. + * + * serialize('foo', 'bar', { httpOnly: true }) + * => "foo=bar; httpOnly" + * + * @param {string} name + * @param {string} val + * @param {object} [options] + * @return {string} + * @public + */ + +function serialize(name, val, options) { + var opt = options || {}; + var enc = opt.encode || encode; + + if (typeof enc !== 'function') { + throw new TypeError('option encode is invalid'); + } + + if (!fieldContentRegExp.test(name)) { + throw new TypeError('argument name is invalid'); + } + + var value = enc(val); + + if (value && !fieldContentRegExp.test(value)) { + throw new TypeError('argument val is invalid'); + } + + var str = name + '=' + value; + + if (null != opt.maxAge) { + var maxAge = opt.maxAge - 0; + + if (isNaN(maxAge) || !isFinite(maxAge)) { + throw new TypeError('option maxAge is invalid') + } + + str += '; Max-Age=' + Math.floor(maxAge); + } + + if (opt.domain) { + if (!fieldContentRegExp.test(opt.domain)) { + throw new TypeError('option domain is invalid'); + } + + str += '; Domain=' + opt.domain; + } + + if (opt.path) { + if (!fieldContentRegExp.test(opt.path)) { + throw new TypeError('option path is invalid'); + } + + str += '; Path=' + opt.path; + } + + if (opt.expires) { + if (typeof opt.expires.toUTCString !== 'function') { + throw new TypeError('option expires is invalid'); + } + + str += '; Expires=' + opt.expires.toUTCString(); + } + + if (opt.httpOnly) { + str += '; HttpOnly'; + } + + if (opt.secure) { + str += '; Secure'; + } + + if (opt.sameSite) { + var sameSite = typeof opt.sameSite === 'string' + ? opt.sameSite.toLowerCase() : opt.sameSite; + + switch (sameSite) { + case true: + str += '; SameSite=Strict'; + break; + case 'lax': + str += '; SameSite=Lax'; + break; + case 'strict': + str += '; SameSite=Strict'; + break; + case 'none': + str += '; SameSite=None'; + break; + default: + throw new TypeError('option sameSite is invalid'); + } + } + + return str; +} + +/** + * Try decoding a string using a decoding function. + * + * @param {string} str + * @param {function} decode + * @private + */ + +function tryDecode(str, decode) { + try { + return decode(str); + } catch (e) { + return str; + } +} diff --git a/tunestats/app/api/node_modules/cookie/package.json b/tunestats/app/api/node_modules/cookie/package.json new file mode 100644 index 0000000..1ae8eb6 --- /dev/null +++ b/tunestats/app/api/node_modules/cookie/package.json @@ -0,0 +1,40 @@ +{ + "name": "cookie", + "description": "HTTP server cookie parsing and serialization", + "version": "0.4.1", + "author": "Roman Shtylman ", + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "keywords": [ + "cookie", + "cookies" + ], + "repository": "jshttp/cookie", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "6.8.0", + "eslint-plugin-markdown": "1.0.2", + "mocha": "7.1.1", + "nyc": "15.0.1" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks --ui qunit test/", + "test-ci": "nyc --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/tunestats/app/api/node_modules/core-util-is/LICENSE b/tunestats/app/api/node_modules/core-util-is/LICENSE new file mode 100644 index 0000000..d8d7f94 --- /dev/null +++ b/tunestats/app/api/node_modules/core-util-is/LICENSE @@ -0,0 +1,19 @@ +Copyright Node.js contributors. All rights reserved. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to +deal in the Software without restriction, including without limitation the +rights to use, copy, modify, merge, publish, distribute, sublicense, and/or +sell copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS +IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/core-util-is/README.md b/tunestats/app/api/node_modules/core-util-is/README.md new file mode 100644 index 0000000..5a76b41 --- /dev/null +++ b/tunestats/app/api/node_modules/core-util-is/README.md @@ -0,0 +1,3 @@ +# core-util-is + +The `util.is*` functions introduced in Node v0.12. diff --git a/tunestats/app/api/node_modules/core-util-is/float.patch b/tunestats/app/api/node_modules/core-util-is/float.patch new file mode 100644 index 0000000..a06d5c0 --- /dev/null +++ b/tunestats/app/api/node_modules/core-util-is/float.patch @@ -0,0 +1,604 @@ +diff --git a/lib/util.js b/lib/util.js +index a03e874..9074e8e 100644 +--- a/lib/util.js ++++ b/lib/util.js +@@ -19,430 +19,6 @@ + // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE + // USE OR OTHER DEALINGS IN THE SOFTWARE. + +-var formatRegExp = /%[sdj%]/g; +-exports.format = function(f) { +- if (!isString(f)) { +- var objects = []; +- for (var i = 0; i < arguments.length; i++) { +- objects.push(inspect(arguments[i])); +- } +- return objects.join(' '); +- } +- +- var i = 1; +- var args = arguments; +- var len = args.length; +- var str = String(f).replace(formatRegExp, function(x) { +- if (x === '%%') return '%'; +- if (i >= len) return x; +- switch (x) { +- case '%s': return String(args[i++]); +- case '%d': return Number(args[i++]); +- case '%j': +- try { +- return JSON.stringify(args[i++]); +- } catch (_) { +- return '[Circular]'; +- } +- default: +- return x; +- } +- }); +- for (var x = args[i]; i < len; x = args[++i]) { +- if (isNull(x) || !isObject(x)) { +- str += ' ' + x; +- } else { +- str += ' ' + inspect(x); +- } +- } +- return str; +-}; +- +- +-// Mark that a method should not be used. +-// Returns a modified function which warns once by default. +-// If --no-deprecation is set, then it is a no-op. +-exports.deprecate = function(fn, msg) { +- // Allow for deprecating things in the process of starting up. +- if (isUndefined(global.process)) { +- return function() { +- return exports.deprecate(fn, msg).apply(this, arguments); +- }; +- } +- +- if (process.noDeprecation === true) { +- return fn; +- } +- +- var warned = false; +- function deprecated() { +- if (!warned) { +- if (process.throwDeprecation) { +- throw new Error(msg); +- } else if (process.traceDeprecation) { +- console.trace(msg); +- } else { +- console.error(msg); +- } +- warned = true; +- } +- return fn.apply(this, arguments); +- } +- +- return deprecated; +-}; +- +- +-var debugs = {}; +-var debugEnviron; +-exports.debuglog = function(set) { +- if (isUndefined(debugEnviron)) +- debugEnviron = process.env.NODE_DEBUG || ''; +- set = set.toUpperCase(); +- if (!debugs[set]) { +- if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) { +- var pid = process.pid; +- debugs[set] = function() { +- var msg = exports.format.apply(exports, arguments); +- console.error('%s %d: %s', set, pid, msg); +- }; +- } else { +- debugs[set] = function() {}; +- } +- } +- return debugs[set]; +-}; +- +- +-/** +- * Echos the value of a value. Trys to print the value out +- * in the best way possible given the different types. +- * +- * @param {Object} obj The object to print out. +- * @param {Object} opts Optional options object that alters the output. +- */ +-/* legacy: obj, showHidden, depth, colors*/ +-function inspect(obj, opts) { +- // default options +- var ctx = { +- seen: [], +- stylize: stylizeNoColor +- }; +- // legacy... +- if (arguments.length >= 3) ctx.depth = arguments[2]; +- if (arguments.length >= 4) ctx.colors = arguments[3]; +- if (isBoolean(opts)) { +- // legacy... +- ctx.showHidden = opts; +- } else if (opts) { +- // got an "options" object +- exports._extend(ctx, opts); +- } +- // set default options +- if (isUndefined(ctx.showHidden)) ctx.showHidden = false; +- if (isUndefined(ctx.depth)) ctx.depth = 2; +- if (isUndefined(ctx.colors)) ctx.colors = false; +- if (isUndefined(ctx.customInspect)) ctx.customInspect = true; +- if (ctx.colors) ctx.stylize = stylizeWithColor; +- return formatValue(ctx, obj, ctx.depth); +-} +-exports.inspect = inspect; +- +- +-// http://en.wikipedia.org/wiki/ANSI_escape_code#graphics +-inspect.colors = { +- 'bold' : [1, 22], +- 'italic' : [3, 23], +- 'underline' : [4, 24], +- 'inverse' : [7, 27], +- 'white' : [37, 39], +- 'grey' : [90, 39], +- 'black' : [30, 39], +- 'blue' : [34, 39], +- 'cyan' : [36, 39], +- 'green' : [32, 39], +- 'magenta' : [35, 39], +- 'red' : [31, 39], +- 'yellow' : [33, 39] +-}; +- +-// Don't use 'blue' not visible on cmd.exe +-inspect.styles = { +- 'special': 'cyan', +- 'number': 'yellow', +- 'boolean': 'yellow', +- 'undefined': 'grey', +- 'null': 'bold', +- 'string': 'green', +- 'date': 'magenta', +- // "name": intentionally not styling +- 'regexp': 'red' +-}; +- +- +-function stylizeWithColor(str, styleType) { +- var style = inspect.styles[styleType]; +- +- if (style) { +- return '\u001b[' + inspect.colors[style][0] + 'm' + str + +- '\u001b[' + inspect.colors[style][1] + 'm'; +- } else { +- return str; +- } +-} +- +- +-function stylizeNoColor(str, styleType) { +- return str; +-} +- +- +-function arrayToHash(array) { +- var hash = {}; +- +- array.forEach(function(val, idx) { +- hash[val] = true; +- }); +- +- return hash; +-} +- +- +-function formatValue(ctx, value, recurseTimes) { +- // Provide a hook for user-specified inspect functions. +- // Check that value is an object with an inspect function on it +- if (ctx.customInspect && +- value && +- isFunction(value.inspect) && +- // Filter out the util module, it's inspect function is special +- value.inspect !== exports.inspect && +- // Also filter out any prototype objects using the circular check. +- !(value.constructor && value.constructor.prototype === value)) { +- var ret = value.inspect(recurseTimes, ctx); +- if (!isString(ret)) { +- ret = formatValue(ctx, ret, recurseTimes); +- } +- return ret; +- } +- +- // Primitive types cannot have properties +- var primitive = formatPrimitive(ctx, value); +- if (primitive) { +- return primitive; +- } +- +- // Look up the keys of the object. +- var keys = Object.keys(value); +- var visibleKeys = arrayToHash(keys); +- +- if (ctx.showHidden) { +- keys = Object.getOwnPropertyNames(value); +- } +- +- // Some type of object without properties can be shortcutted. +- if (keys.length === 0) { +- if (isFunction(value)) { +- var name = value.name ? ': ' + value.name : ''; +- return ctx.stylize('[Function' + name + ']', 'special'); +- } +- if (isRegExp(value)) { +- return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); +- } +- if (isDate(value)) { +- return ctx.stylize(Date.prototype.toString.call(value), 'date'); +- } +- if (isError(value)) { +- return formatError(value); +- } +- } +- +- var base = '', array = false, braces = ['{', '}']; +- +- // Make Array say that they are Array +- if (isArray(value)) { +- array = true; +- braces = ['[', ']']; +- } +- +- // Make functions say that they are functions +- if (isFunction(value)) { +- var n = value.name ? ': ' + value.name : ''; +- base = ' [Function' + n + ']'; +- } +- +- // Make RegExps say that they are RegExps +- if (isRegExp(value)) { +- base = ' ' + RegExp.prototype.toString.call(value); +- } +- +- // Make dates with properties first say the date +- if (isDate(value)) { +- base = ' ' + Date.prototype.toUTCString.call(value); +- } +- +- // Make error with message first say the error +- if (isError(value)) { +- base = ' ' + formatError(value); +- } +- +- if (keys.length === 0 && (!array || value.length == 0)) { +- return braces[0] + base + braces[1]; +- } +- +- if (recurseTimes < 0) { +- if (isRegExp(value)) { +- return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); +- } else { +- return ctx.stylize('[Object]', 'special'); +- } +- } +- +- ctx.seen.push(value); +- +- var output; +- if (array) { +- output = formatArray(ctx, value, recurseTimes, visibleKeys, keys); +- } else { +- output = keys.map(function(key) { +- return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array); +- }); +- } +- +- ctx.seen.pop(); +- +- return reduceToSingleString(output, base, braces); +-} +- +- +-function formatPrimitive(ctx, value) { +- if (isUndefined(value)) +- return ctx.stylize('undefined', 'undefined'); +- if (isString(value)) { +- var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '') +- .replace(/'/g, "\\'") +- .replace(/\\"/g, '"') + '\''; +- return ctx.stylize(simple, 'string'); +- } +- if (isNumber(value)) { +- // Format -0 as '-0'. Strict equality won't distinguish 0 from -0, +- // so instead we use the fact that 1 / -0 < 0 whereas 1 / 0 > 0 . +- if (value === 0 && 1 / value < 0) +- return ctx.stylize('-0', 'number'); +- return ctx.stylize('' + value, 'number'); +- } +- if (isBoolean(value)) +- return ctx.stylize('' + value, 'boolean'); +- // For some reason typeof null is "object", so special case here. +- if (isNull(value)) +- return ctx.stylize('null', 'null'); +-} +- +- +-function formatError(value) { +- return '[' + Error.prototype.toString.call(value) + ']'; +-} +- +- +-function formatArray(ctx, value, recurseTimes, visibleKeys, keys) { +- var output = []; +- for (var i = 0, l = value.length; i < l; ++i) { +- if (hasOwnProperty(value, String(i))) { +- output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, +- String(i), true)); +- } else { +- output.push(''); +- } +- } +- keys.forEach(function(key) { +- if (!key.match(/^\d+$/)) { +- output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, +- key, true)); +- } +- }); +- return output; +-} +- +- +-function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) { +- var name, str, desc; +- desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] }; +- if (desc.get) { +- if (desc.set) { +- str = ctx.stylize('[Getter/Setter]', 'special'); +- } else { +- str = ctx.stylize('[Getter]', 'special'); +- } +- } else { +- if (desc.set) { +- str = ctx.stylize('[Setter]', 'special'); +- } +- } +- if (!hasOwnProperty(visibleKeys, key)) { +- name = '[' + key + ']'; +- } +- if (!str) { +- if (ctx.seen.indexOf(desc.value) < 0) { +- if (isNull(recurseTimes)) { +- str = formatValue(ctx, desc.value, null); +- } else { +- str = formatValue(ctx, desc.value, recurseTimes - 1); +- } +- if (str.indexOf('\n') > -1) { +- if (array) { +- str = str.split('\n').map(function(line) { +- return ' ' + line; +- }).join('\n').substr(2); +- } else { +- str = '\n' + str.split('\n').map(function(line) { +- return ' ' + line; +- }).join('\n'); +- } +- } +- } else { +- str = ctx.stylize('[Circular]', 'special'); +- } +- } +- if (isUndefined(name)) { +- if (array && key.match(/^\d+$/)) { +- return str; +- } +- name = JSON.stringify('' + key); +- if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) { +- name = name.substr(1, name.length - 2); +- name = ctx.stylize(name, 'name'); +- } else { +- name = name.replace(/'/g, "\\'") +- .replace(/\\"/g, '"') +- .replace(/(^"|"$)/g, "'"); +- name = ctx.stylize(name, 'string'); +- } +- } +- +- return name + ': ' + str; +-} +- +- +-function reduceToSingleString(output, base, braces) { +- var numLinesEst = 0; +- var length = output.reduce(function(prev, cur) { +- numLinesEst++; +- if (cur.indexOf('\n') >= 0) numLinesEst++; +- return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1; +- }, 0); +- +- if (length > 60) { +- return braces[0] + +- (base === '' ? '' : base + '\n ') + +- ' ' + +- output.join(',\n ') + +- ' ' + +- braces[1]; +- } +- +- return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1]; +-} +- +- + // NOTE: These type checking functions intentionally don't use `instanceof` + // because it is fragile and can be easily faked with `Object.create()`. + function isArray(ar) { +@@ -522,166 +98,10 @@ function isPrimitive(arg) { + exports.isPrimitive = isPrimitive; + + function isBuffer(arg) { +- return arg instanceof Buffer; ++ return Buffer.isBuffer(arg); + } + exports.isBuffer = isBuffer; + + function objectToString(o) { + return Object.prototype.toString.call(o); +-} +- +- +-function pad(n) { +- return n < 10 ? '0' + n.toString(10) : n.toString(10); +-} +- +- +-var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', +- 'Oct', 'Nov', 'Dec']; +- +-// 26 Feb 16:19:34 +-function timestamp() { +- var d = new Date(); +- var time = [pad(d.getHours()), +- pad(d.getMinutes()), +- pad(d.getSeconds())].join(':'); +- return [d.getDate(), months[d.getMonth()], time].join(' '); +-} +- +- +-// log is just a thin wrapper to console.log that prepends a timestamp +-exports.log = function() { +- console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments)); +-}; +- +- +-/** +- * Inherit the prototype methods from one constructor into another. +- * +- * The Function.prototype.inherits from lang.js rewritten as a standalone +- * function (not on Function.prototype). NOTE: If this file is to be loaded +- * during bootstrapping this function needs to be rewritten using some native +- * functions as prototype setup using normal JavaScript does not work as +- * expected during bootstrapping (see mirror.js in r114903). +- * +- * @param {function} ctor Constructor function which needs to inherit the +- * prototype. +- * @param {function} superCtor Constructor function to inherit prototype from. +- */ +-exports.inherits = function(ctor, superCtor) { +- ctor.super_ = superCtor; +- ctor.prototype = Object.create(superCtor.prototype, { +- constructor: { +- value: ctor, +- enumerable: false, +- writable: true, +- configurable: true +- } +- }); +-}; +- +-exports._extend = function(origin, add) { +- // Don't do anything if add isn't an object +- if (!add || !isObject(add)) return origin; +- +- var keys = Object.keys(add); +- var i = keys.length; +- while (i--) { +- origin[keys[i]] = add[keys[i]]; +- } +- return origin; +-}; +- +-function hasOwnProperty(obj, prop) { +- return Object.prototype.hasOwnProperty.call(obj, prop); +-} +- +- +-// Deprecated old stuff. +- +-exports.p = exports.deprecate(function() { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- console.error(exports.inspect(arguments[i])); +- } +-}, 'util.p: Use console.error() instead'); +- +- +-exports.exec = exports.deprecate(function() { +- return require('child_process').exec.apply(this, arguments); +-}, 'util.exec is now called `child_process.exec`.'); +- +- +-exports.print = exports.deprecate(function() { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- process.stdout.write(String(arguments[i])); +- } +-}, 'util.print: Use console.log instead'); +- +- +-exports.puts = exports.deprecate(function() { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- process.stdout.write(arguments[i] + '\n'); +- } +-}, 'util.puts: Use console.log instead'); +- +- +-exports.debug = exports.deprecate(function(x) { +- process.stderr.write('DEBUG: ' + x + '\n'); +-}, 'util.debug: Use console.error instead'); +- +- +-exports.error = exports.deprecate(function(x) { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- process.stderr.write(arguments[i] + '\n'); +- } +-}, 'util.error: Use console.error instead'); +- +- +-exports.pump = exports.deprecate(function(readStream, writeStream, callback) { +- var callbackCalled = false; +- +- function call(a, b, c) { +- if (callback && !callbackCalled) { +- callback(a, b, c); +- callbackCalled = true; +- } +- } +- +- readStream.addListener('data', function(chunk) { +- if (writeStream.write(chunk) === false) readStream.pause(); +- }); +- +- writeStream.addListener('drain', function() { +- readStream.resume(); +- }); +- +- readStream.addListener('end', function() { +- writeStream.end(); +- }); +- +- readStream.addListener('close', function() { +- call(); +- }); +- +- readStream.addListener('error', function(err) { +- writeStream.end(); +- call(err); +- }); +- +- writeStream.addListener('error', function(err) { +- readStream.destroy(); +- call(err); +- }); +-}, 'util.pump(): Use readableStream.pipe() instead'); +- +- +-var uv; +-exports._errnoException = function(err, syscall) { +- if (isUndefined(uv)) uv = process.binding('uv'); +- var errname = uv.errname(err); +- var e = new Error(syscall + ' ' + errname); +- e.code = errname; +- e.errno = errname; +- e.syscall = syscall; +- return e; +-}; ++} \ No newline at end of file diff --git a/tunestats/app/api/node_modules/core-util-is/lib/util.js b/tunestats/app/api/node_modules/core-util-is/lib/util.js new file mode 100644 index 0000000..ff4c851 --- /dev/null +++ b/tunestats/app/api/node_modules/core-util-is/lib/util.js @@ -0,0 +1,107 @@ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// NOTE: These type checking functions intentionally don't use `instanceof` +// because it is fragile and can be easily faked with `Object.create()`. + +function isArray(arg) { + if (Array.isArray) { + return Array.isArray(arg); + } + return objectToString(arg) === '[object Array]'; +} +exports.isArray = isArray; + +function isBoolean(arg) { + return typeof arg === 'boolean'; +} +exports.isBoolean = isBoolean; + +function isNull(arg) { + return arg === null; +} +exports.isNull = isNull; + +function isNullOrUndefined(arg) { + return arg == null; +} +exports.isNullOrUndefined = isNullOrUndefined; + +function isNumber(arg) { + return typeof arg === 'number'; +} +exports.isNumber = isNumber; + +function isString(arg) { + return typeof arg === 'string'; +} +exports.isString = isString; + +function isSymbol(arg) { + return typeof arg === 'symbol'; +} +exports.isSymbol = isSymbol; + +function isUndefined(arg) { + return arg === void 0; +} +exports.isUndefined = isUndefined; + +function isRegExp(re) { + return objectToString(re) === '[object RegExp]'; +} +exports.isRegExp = isRegExp; + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} +exports.isObject = isObject; + +function isDate(d) { + return objectToString(d) === '[object Date]'; +} +exports.isDate = isDate; + +function isError(e) { + return (objectToString(e) === '[object Error]' || e instanceof Error); +} +exports.isError = isError; + +function isFunction(arg) { + return typeof arg === 'function'; +} +exports.isFunction = isFunction; + +function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; +} +exports.isPrimitive = isPrimitive; + +exports.isBuffer = Buffer.isBuffer; + +function objectToString(o) { + return Object.prototype.toString.call(o); +} diff --git a/tunestats/app/api/node_modules/core-util-is/package.json b/tunestats/app/api/node_modules/core-util-is/package.json new file mode 100644 index 0000000..3368e95 --- /dev/null +++ b/tunestats/app/api/node_modules/core-util-is/package.json @@ -0,0 +1,32 @@ +{ + "name": "core-util-is", + "version": "1.0.2", + "description": "The `util.is*` functions introduced in Node v0.12.", + "main": "lib/util.js", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/core-util-is" + }, + "keywords": [ + "util", + "isBuffer", + "isArray", + "isNumber", + "isString", + "isRegExp", + "isThis", + "isThat", + "polyfill" + ], + "author": "Isaac Z. Schlueter (http://blog.izs.me/)", + "license": "MIT", + "bugs": { + "url": "https://github.com/isaacs/core-util-is/issues" + }, + "scripts": { + "test": "tap test.js" + }, + "devDependencies": { + "tap": "^2.3.0" + } +} diff --git a/tunestats/app/api/node_modules/core-util-is/test.js b/tunestats/app/api/node_modules/core-util-is/test.js new file mode 100644 index 0000000..1a490c6 --- /dev/null +++ b/tunestats/app/api/node_modules/core-util-is/test.js @@ -0,0 +1,68 @@ +var assert = require('tap'); + +var t = require('./lib/util'); + +assert.equal(t.isArray([]), true); +assert.equal(t.isArray({}), false); + +assert.equal(t.isBoolean(null), false); +assert.equal(t.isBoolean(true), true); +assert.equal(t.isBoolean(false), true); + +assert.equal(t.isNull(null), true); +assert.equal(t.isNull(undefined), false); +assert.equal(t.isNull(false), false); +assert.equal(t.isNull(), false); + +assert.equal(t.isNullOrUndefined(null), true); +assert.equal(t.isNullOrUndefined(undefined), true); +assert.equal(t.isNullOrUndefined(false), false); +assert.equal(t.isNullOrUndefined(), true); + +assert.equal(t.isNumber(null), false); +assert.equal(t.isNumber('1'), false); +assert.equal(t.isNumber(1), true); + +assert.equal(t.isString(null), false); +assert.equal(t.isString('1'), true); +assert.equal(t.isString(1), false); + +assert.equal(t.isSymbol(null), false); +assert.equal(t.isSymbol('1'), false); +assert.equal(t.isSymbol(1), false); +assert.equal(t.isSymbol(Symbol()), true); + +assert.equal(t.isUndefined(null), false); +assert.equal(t.isUndefined(undefined), true); +assert.equal(t.isUndefined(false), false); +assert.equal(t.isUndefined(), true); + +assert.equal(t.isRegExp(null), false); +assert.equal(t.isRegExp('1'), false); +assert.equal(t.isRegExp(new RegExp()), true); + +assert.equal(t.isObject({}), true); +assert.equal(t.isObject([]), true); +assert.equal(t.isObject(new RegExp()), true); +assert.equal(t.isObject(new Date()), true); + +assert.equal(t.isDate(null), false); +assert.equal(t.isDate('1'), false); +assert.equal(t.isDate(new Date()), true); + +assert.equal(t.isError(null), false); +assert.equal(t.isError({ err: true }), false); +assert.equal(t.isError(new Error()), true); + +assert.equal(t.isFunction(null), false); +assert.equal(t.isFunction({ }), false); +assert.equal(t.isFunction(function() {}), true); + +assert.equal(t.isPrimitive(null), true); +assert.equal(t.isPrimitive(''), true); +assert.equal(t.isPrimitive(0), true); +assert.equal(t.isPrimitive(new Date()), false); + +assert.equal(t.isBuffer(null), false); +assert.equal(t.isBuffer({}), false); +assert.equal(t.isBuffer(new Buffer(0)), true); diff --git a/tunestats/app/api/node_modules/cors/CONTRIBUTING.md b/tunestats/app/api/node_modules/cors/CONTRIBUTING.md new file mode 100644 index 0000000..591b09a --- /dev/null +++ b/tunestats/app/api/node_modules/cors/CONTRIBUTING.md @@ -0,0 +1,33 @@ +# contributing to `cors` + +CORS is a node.js package for providing a [connect](http://www.senchalabs.org/connect/)/[express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options. Learn more about the project in [the README](README.md). + +## The CORS Spec + +[http://www.w3.org/TR/cors/](http://www.w3.org/TR/cors/) + +## Pull Requests Welcome + +* Include `'use strict';` in every javascript file. +* 2 space indentation. +* Please run the testing steps below before submitting. + +## Testing + +```bash +$ npm install +$ npm test +``` + +## Interactive Testing Harness + +[http://node-cors-client.herokuapp.com](http://node-cors-client.herokuapp.com) + +Related git repositories: + +* [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server) +* [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client) + +## License + +[MIT License](http://www.opensource.org/licenses/mit-license.php) diff --git a/tunestats/app/api/node_modules/cors/HISTORY.md b/tunestats/app/api/node_modules/cors/HISTORY.md new file mode 100644 index 0000000..5762bce --- /dev/null +++ b/tunestats/app/api/node_modules/cors/HISTORY.md @@ -0,0 +1,58 @@ +2.8.5 / 2018-11-04 +================== + + * Fix setting `maxAge` option to `0` + +2.8.4 / 2017-07-12 +================== + + * Work-around Safari bug in default pre-flight response + +2.8.3 / 2017-03-29 +================== + + * Fix error when options delegate missing `methods` option + +2.8.2 / 2017-03-28 +================== + + * Fix error when frozen options are passed + * Send "Vary: Origin" when using regular expressions + * Send "Vary: Access-Control-Request-Headers" when dynamic `allowedHeaders` + +2.8.1 / 2016-09-08 +================== + +This release only changed documentation. + +2.8.0 / 2016-08-23 +================== + + * Add `optionsSuccessStatus` option + +2.7.2 / 2016-08-23 +================== + + * Fix error when Node.js running in strict mode + +2.7.1 / 2015-05-28 +================== + + * Move module into expressjs organization + +2.7.0 / 2015-05-28 +================== + + * Allow array of matching condition as `origin` option + * Allow regular expression as `origin` option + +2.6.1 / 2015-05-28 +================== + + * Update `license` in package.json + +2.6.0 / 2015-04-27 +================== + + * Add `preflightContinue` option + * Fix "Vary: Origin" header added for "*" diff --git a/tunestats/app/api/node_modules/cors/LICENSE b/tunestats/app/api/node_modules/cors/LICENSE new file mode 100644 index 0000000..fd10c84 --- /dev/null +++ b/tunestats/app/api/node_modules/cors/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2013 Troy Goode + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/cors/README.md b/tunestats/app/api/node_modules/cors/README.md new file mode 100644 index 0000000..732b847 --- /dev/null +++ b/tunestats/app/api/node_modules/cors/README.md @@ -0,0 +1,243 @@ +# cors + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +CORS is a node.js package for providing a [Connect](http://www.senchalabs.org/connect/)/[Express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options. + +**[Follow me (@troygoode) on Twitter!](https://twitter.com/intent/user?screen_name=troygoode)** + +* [Installation](#installation) +* [Usage](#usage) + * [Simple Usage](#simple-usage-enable-all-cors-requests) + * [Enable CORS for a Single Route](#enable-cors-for-a-single-route) + * [Configuring CORS](#configuring-cors) + * [Configuring CORS Asynchronously](#configuring-cors-asynchronously) + * [Enabling CORS Pre-Flight](#enabling-cors-pre-flight) +* [Configuration Options](#configuration-options) +* [Demo](#demo) +* [License](#license) +* [Author](#author) + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install cors +``` + +## Usage + +### Simple Usage (Enable *All* CORS Requests) + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +app.use(cors()) + +app.get('/products/:id', function (req, res, next) { + res.json({msg: 'This is CORS-enabled for all origins!'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +### Enable CORS for a Single Route + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +app.get('/products/:id', cors(), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for a Single Route'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +### Configuring CORS + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +var corsOptions = { + origin: 'http://example.com', + optionsSuccessStatus: 200 // some legacy browsers (IE11, various SmartTVs) choke on 204 +} + +app.get('/products/:id', cors(corsOptions), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for only example.com.'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +### Configuring CORS w/ Dynamic Origin + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +var whitelist = ['http://example1.com', 'http://example2.com'] +var corsOptions = { + origin: function (origin, callback) { + if (whitelist.indexOf(origin) !== -1) { + callback(null, true) + } else { + callback(new Error('Not allowed by CORS')) + } + } +} + +app.get('/products/:id', cors(corsOptions), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for a whitelisted domain.'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +If you do not want to block REST tools or server-to-server requests, +add a `!origin` check in the origin function like so: + +```javascript +var corsOptions = { + origin: function (origin, callback) { + if (whitelist.indexOf(origin) !== -1 || !origin) { + callback(null, true) + } else { + callback(new Error('Not allowed by CORS')) + } + } +} +``` + +### Enabling CORS Pre-Flight + +Certain CORS requests are considered 'complex' and require an initial +`OPTIONS` request (called the "pre-flight request"). An example of a +'complex' CORS request is one that uses an HTTP verb other than +GET/HEAD/POST (such as DELETE) or that uses custom headers. To enable +pre-flighting, you must add a new OPTIONS handler for the route you want +to support: + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +app.options('/products/:id', cors()) // enable pre-flight request for DELETE request +app.del('/products/:id', cors(), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for all origins!'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +You can also enable pre-flight across-the-board like so: + +```javascript +app.options('*', cors()) // include before other routes +``` + +### Configuring CORS Asynchronously + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +var whitelist = ['http://example1.com', 'http://example2.com'] +var corsOptionsDelegate = function (req, callback) { + var corsOptions; + if (whitelist.indexOf(req.header('Origin')) !== -1) { + corsOptions = { origin: true } // reflect (enable) the requested origin in the CORS response + } else { + corsOptions = { origin: false } // disable CORS for this request + } + callback(null, corsOptions) // callback expects two parameters: error and options +} + +app.get('/products/:id', cors(corsOptionsDelegate), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for a whitelisted domain.'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +## Configuration Options + +* `origin`: Configures the **Access-Control-Allow-Origin** CORS header. Possible values: + - `Boolean` - set `origin` to `true` to reflect the [request origin](http://tools.ietf.org/html/draft-abarth-origin-09), as defined by `req.header('Origin')`, or set it to `false` to disable CORS. + - `String` - set `origin` to a specific origin. For example if you set it to `"http://example.com"` only requests from "http://example.com" will be allowed. + - `RegExp` - set `origin` to a regular expression pattern which will be used to test the request origin. If it's a match, the request origin will be reflected. For example the pattern `/example\.com$/` will reflect any request that is coming from an origin ending with "example.com". + - `Array` - set `origin` to an array of valid origins. Each origin can be a `String` or a `RegExp`. For example `["http://example1.com", /\.example2\.com$/]` will accept any request from "http://example1.com" or from a subdomain of "example2.com". + - `Function` - set `origin` to a function implementing some custom logic. The function takes the request origin as the first parameter and a callback (which expects the signature `err [object], allow [bool]`) as the second. +* `methods`: Configures the **Access-Control-Allow-Methods** CORS header. Expects a comma-delimited string (ex: 'GET,PUT,POST') or an array (ex: `['GET', 'PUT', 'POST']`). +* `allowedHeaders`: Configures the **Access-Control-Allow-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Type,Authorization') or an array (ex: `['Content-Type', 'Authorization']`). If not specified, defaults to reflecting the headers specified in the request's **Access-Control-Request-Headers** header. +* `exposedHeaders`: Configures the **Access-Control-Expose-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Range,X-Content-Range') or an array (ex: `['Content-Range', 'X-Content-Range']`). If not specified, no custom headers are exposed. +* `credentials`: Configures the **Access-Control-Allow-Credentials** CORS header. Set to `true` to pass the header, otherwise it is omitted. +* `maxAge`: Configures the **Access-Control-Max-Age** CORS header. Set to an integer to pass the header, otherwise it is omitted. +* `preflightContinue`: Pass the CORS preflight response to the next handler. +* `optionsSuccessStatus`: Provides a status code to use for successful `OPTIONS` requests, since some legacy browsers (IE11, various SmartTVs) choke on `204`. + +The default configuration is the equivalent of: + +```json +{ + "origin": "*", + "methods": "GET,HEAD,PUT,PATCH,POST,DELETE", + "preflightContinue": false, + "optionsSuccessStatus": 204 +} +``` + +For details on the effect of each CORS header, read [this](http://www.html5rocks.com/en/tutorials/cors/) article on HTML5 Rocks. + +## Demo + +A demo that illustrates CORS working (and not working) using jQuery is available here: [http://node-cors-client.herokuapp.com/](http://node-cors-client.herokuapp.com/) + +Code for that demo can be found here: + +* Client: [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client) +* Server: [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server) + +## License + +[MIT License](http://www.opensource.org/licenses/mit-license.php) + +## Author + +[Troy Goode](https://github.com/TroyGoode) ([troygoode@gmail.com](mailto:troygoode@gmail.com)) + +[coveralls-image]: https://img.shields.io/coveralls/expressjs/cors/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/cors?branch=master +[downloads-image]: https://img.shields.io/npm/dm/cors.svg +[downloads-url]: https://npmjs.org/package/cors +[npm-image]: https://img.shields.io/npm/v/cors.svg +[npm-url]: https://npmjs.org/package/cors +[travis-image]: https://img.shields.io/travis/expressjs/cors/master.svg +[travis-url]: https://travis-ci.org/expressjs/cors diff --git a/tunestats/app/api/node_modules/cors/lib/index.js b/tunestats/app/api/node_modules/cors/lib/index.js new file mode 100644 index 0000000..5475aec --- /dev/null +++ b/tunestats/app/api/node_modules/cors/lib/index.js @@ -0,0 +1,238 @@ +(function () { + + 'use strict'; + + var assign = require('object-assign'); + var vary = require('vary'); + + var defaults = { + origin: '*', + methods: 'GET,HEAD,PUT,PATCH,POST,DELETE', + preflightContinue: false, + optionsSuccessStatus: 204 + }; + + function isString(s) { + return typeof s === 'string' || s instanceof String; + } + + function isOriginAllowed(origin, allowedOrigin) { + if (Array.isArray(allowedOrigin)) { + for (var i = 0; i < allowedOrigin.length; ++i) { + if (isOriginAllowed(origin, allowedOrigin[i])) { + return true; + } + } + return false; + } else if (isString(allowedOrigin)) { + return origin === allowedOrigin; + } else if (allowedOrigin instanceof RegExp) { + return allowedOrigin.test(origin); + } else { + return !!allowedOrigin; + } + } + + function configureOrigin(options, req) { + var requestOrigin = req.headers.origin, + headers = [], + isAllowed; + + if (!options.origin || options.origin === '*') { + // allow any origin + headers.push([{ + key: 'Access-Control-Allow-Origin', + value: '*' + }]); + } else if (isString(options.origin)) { + // fixed origin + headers.push([{ + key: 'Access-Control-Allow-Origin', + value: options.origin + }]); + headers.push([{ + key: 'Vary', + value: 'Origin' + }]); + } else { + isAllowed = isOriginAllowed(requestOrigin, options.origin); + // reflect origin + headers.push([{ + key: 'Access-Control-Allow-Origin', + value: isAllowed ? requestOrigin : false + }]); + headers.push([{ + key: 'Vary', + value: 'Origin' + }]); + } + + return headers; + } + + function configureMethods(options) { + var methods = options.methods; + if (methods.join) { + methods = options.methods.join(','); // .methods is an array, so turn it into a string + } + return { + key: 'Access-Control-Allow-Methods', + value: methods + }; + } + + function configureCredentials(options) { + if (options.credentials === true) { + return { + key: 'Access-Control-Allow-Credentials', + value: 'true' + }; + } + return null; + } + + function configureAllowedHeaders(options, req) { + var allowedHeaders = options.allowedHeaders || options.headers; + var headers = []; + + if (!allowedHeaders) { + allowedHeaders = req.headers['access-control-request-headers']; // .headers wasn't specified, so reflect the request headers + headers.push([{ + key: 'Vary', + value: 'Access-Control-Request-Headers' + }]); + } else if (allowedHeaders.join) { + allowedHeaders = allowedHeaders.join(','); // .headers is an array, so turn it into a string + } + if (allowedHeaders && allowedHeaders.length) { + headers.push([{ + key: 'Access-Control-Allow-Headers', + value: allowedHeaders + }]); + } + + return headers; + } + + function configureExposedHeaders(options) { + var headers = options.exposedHeaders; + if (!headers) { + return null; + } else if (headers.join) { + headers = headers.join(','); // .headers is an array, so turn it into a string + } + if (headers && headers.length) { + return { + key: 'Access-Control-Expose-Headers', + value: headers + }; + } + return null; + } + + function configureMaxAge(options) { + var maxAge = (typeof options.maxAge === 'number' || options.maxAge) && options.maxAge.toString() + if (maxAge && maxAge.length) { + return { + key: 'Access-Control-Max-Age', + value: maxAge + }; + } + return null; + } + + function applyHeaders(headers, res) { + for (var i = 0, n = headers.length; i < n; i++) { + var header = headers[i]; + if (header) { + if (Array.isArray(header)) { + applyHeaders(header, res); + } else if (header.key === 'Vary' && header.value) { + vary(res, header.value); + } else if (header.value) { + res.setHeader(header.key, header.value); + } + } + } + } + + function cors(options, req, res, next) { + var headers = [], + method = req.method && req.method.toUpperCase && req.method.toUpperCase(); + + if (method === 'OPTIONS') { + // preflight + headers.push(configureOrigin(options, req)); + headers.push(configureCredentials(options, req)); + headers.push(configureMethods(options, req)); + headers.push(configureAllowedHeaders(options, req)); + headers.push(configureMaxAge(options, req)); + headers.push(configureExposedHeaders(options, req)); + applyHeaders(headers, res); + + if (options.preflightContinue) { + next(); + } else { + // Safari (and potentially other browsers) need content-length 0, + // for 204 or they just hang waiting for a body + res.statusCode = options.optionsSuccessStatus; + res.setHeader('Content-Length', '0'); + res.end(); + } + } else { + // actual response + headers.push(configureOrigin(options, req)); + headers.push(configureCredentials(options, req)); + headers.push(configureExposedHeaders(options, req)); + applyHeaders(headers, res); + next(); + } + } + + function middlewareWrapper(o) { + // if options are static (either via defaults or custom options passed in), wrap in a function + var optionsCallback = null; + if (typeof o === 'function') { + optionsCallback = o; + } else { + optionsCallback = function (req, cb) { + cb(null, o); + }; + } + + return function corsMiddleware(req, res, next) { + optionsCallback(req, function (err, options) { + if (err) { + next(err); + } else { + var corsOptions = assign({}, defaults, options); + var originCallback = null; + if (corsOptions.origin && typeof corsOptions.origin === 'function') { + originCallback = corsOptions.origin; + } else if (corsOptions.origin) { + originCallback = function (origin, cb) { + cb(null, corsOptions.origin); + }; + } + + if (originCallback) { + originCallback(req.headers.origin, function (err2, origin) { + if (err2 || !origin) { + next(err2); + } else { + corsOptions.origin = origin; + cors(corsOptions, req, res, next); + } + }); + } else { + next(); + } + } + }); + }; + } + + // can pass either an options hash, an options delegate, or nothing + module.exports = middlewareWrapper; + +}()); diff --git a/tunestats/app/api/node_modules/cors/package.json b/tunestats/app/api/node_modules/cors/package.json new file mode 100644 index 0000000..ff37d98 --- /dev/null +++ b/tunestats/app/api/node_modules/cors/package.json @@ -0,0 +1,41 @@ +{ + "name": "cors", + "description": "Node.js CORS middleware", + "version": "2.8.5", + "author": "Troy Goode (https://github.com/troygoode/)", + "license": "MIT", + "keywords": [ + "cors", + "express", + "connect", + "middleware" + ], + "repository": "expressjs/cors", + "main": "./lib/index.js", + "dependencies": { + "object-assign": "^4", + "vary": "^1" + }, + "devDependencies": { + "after": "0.8.2", + "eslint": "2.13.1", + "express": "4.16.3", + "mocha": "5.2.0", + "nyc": "13.1.0", + "supertest": "3.3.0" + }, + "files": [ + "lib/index.js", + "CONTRIBUTING.md", + "HISTORY.md", + "LICENSE", + "README.md" + ], + "engines": { + "node": ">= 0.10" + }, + "scripts": { + "test": "npm run lint && nyc --reporter=html --reporter=text mocha --require test/support/env", + "lint": "eslint lib test" + } +} diff --git a/tunestats/app/api/node_modules/dashdash/CHANGES.md b/tunestats/app/api/node_modules/dashdash/CHANGES.md new file mode 100644 index 0000000..d7c8f4e --- /dev/null +++ b/tunestats/app/api/node_modules/dashdash/CHANGES.md @@ -0,0 +1,364 @@ +# node-dashdash changelog + +## not yet released + +(nothing yet) + +## 1.14.1 + +- [issue #30] Change the output used by dashdash's Bash completion support to + indicate "there are no completions for this argument" to cope with different + sorting rules on different Bash/platforms. For example: + + $ triton -v -p test2 package get # before + ##-no -tritonpackage- completions-## + + $ triton -v -p test2 package get # after + ##-no-completion- -results-## + +## 1.14.0 + +- New `synopsisFromOpt(@trentmick +for updates to node-dashdash. + +# Install + + npm install dashdash + + +# Usage + +```javascript +var dashdash = require('dashdash'); + +// Specify the options. Minimally `name` (or `names`) and `type` +// must be given for each. +var options = [ + { + // `names` or a single `name`. First element is the `opts.KEY`. + names: ['help', 'h'], + // See "Option specs" below for types. + type: 'bool', + help: 'Print this help and exit.' + } +]; + +// Shortcut form. As called it infers `process.argv`. See below for +// the longer form to use methods like `.help()` on the Parser object. +var opts = dashdash.parse({options: options}); + +console.log("opts:", opts); +console.log("args:", opts._args); +``` + + +# Longer Example + +A more realistic [starter script "foo.js"](./examples/foo.js) is as follows. +This also shows using `parser.help()` for formatted option help. + +```javascript +var dashdash = require('./lib/dashdash'); + +var options = [ + { + name: 'version', + type: 'bool', + help: 'Print tool version and exit.' + }, + { + names: ['help', 'h'], + type: 'bool', + help: 'Print this help and exit.' + }, + { + names: ['verbose', 'v'], + type: 'arrayOfBool', + help: 'Verbose output. Use multiple times for more verbose.' + }, + { + names: ['file', 'f'], + type: 'string', + help: 'File to process', + helpArg: 'FILE' + } +]; + +var parser = dashdash.createParser({options: options}); +try { + var opts = parser.parse(process.argv); +} catch (e) { + console.error('foo: error: %s', e.message); + process.exit(1); +} + +console.log("# opts:", opts); +console.log("# args:", opts._args); + +// Use `parser.help()` for formatted options help. +if (opts.help) { + var help = parser.help({includeEnv: true}).trimRight(); + console.log('usage: node foo.js [OPTIONS]\n' + + 'options:\n' + + help); + process.exit(0); +} + +// ... +``` + + +Some example output from this script (foo.js): + +``` +$ node foo.js -h +# opts: { help: true, + _order: [ { name: 'help', value: true, from: 'argv' } ], + _args: [] } +# args: [] +usage: node foo.js [OPTIONS] +options: + --version Print tool version and exit. + -h, --help Print this help and exit. + -v, --verbose Verbose output. Use multiple times for more verbose. + -f FILE, --file=FILE File to process + +$ node foo.js -v +# opts: { verbose: [ true ], + _order: [ { name: 'verbose', value: true, from: 'argv' } ], + _args: [] } +# args: [] + +$ node foo.js --version arg1 +# opts: { version: true, + _order: [ { name: 'version', value: true, from: 'argv' } ], + _args: [ 'arg1' ] } +# args: [ 'arg1' ] + +$ node foo.js -f bar.txt +# opts: { file: 'bar.txt', + _order: [ { name: 'file', value: 'bar.txt', from: 'argv' } ], + _args: [] } +# args: [] + +$ node foo.js -vvv --file=blah +# opts: { verbose: [ true, true, true ], + file: 'blah', + _order: + [ { name: 'verbose', value: true, from: 'argv' }, + { name: 'verbose', value: true, from: 'argv' }, + { name: 'verbose', value: true, from: 'argv' }, + { name: 'file', value: 'blah', from: 'argv' } ], + _args: [] } +# args: [] +``` + + +See the ["examples"](examples/) dir for a number of starter examples using +some of dashdash's features. + + +# Environment variable integration + +If you want to allow environment variables to specify options to your tool, +dashdash makes this easy. We can change the 'verbose' option in the example +above to include an 'env' field: + +```javascript + { + names: ['verbose', 'v'], + type: 'arrayOfBool', + env: 'FOO_VERBOSE', // <--- add this line + help: 'Verbose output. Use multiple times for more verbose.' + }, +``` + +then the **"FOO_VERBOSE" environment variable** can be used to set this +option: + +```shell +$ FOO_VERBOSE=1 node foo.js +# opts: { verbose: [ true ], + _order: [ { name: 'verbose', value: true, from: 'env' } ], + _args: [] } +# args: [] +``` + +Boolean options will interpret the empty string as unset, '0' as false +and anything else as true. + +```shell +$ FOO_VERBOSE= node examples/foo.js # not set +# opts: { _order: [], _args: [] } +# args: [] + +$ FOO_VERBOSE=0 node examples/foo.js # '0' is false +# opts: { verbose: [ false ], + _order: [ { key: 'verbose', value: false, from: 'env' } ], + _args: [] } +# args: [] + +$ FOO_VERBOSE=1 node examples/foo.js # true +# opts: { verbose: [ true ], + _order: [ { key: 'verbose', value: true, from: 'env' } ], + _args: [] } +# args: [] + +$ FOO_VERBOSE=boogabooga node examples/foo.js # true +# opts: { verbose: [ true ], + _order: [ { key: 'verbose', value: true, from: 'env' } ], + _args: [] } +# args: [] +``` + +Non-booleans can be used as well. Strings: + +```shell +$ FOO_FILE=data.txt node examples/foo.js +# opts: { file: 'data.txt', + _order: [ { key: 'file', value: 'data.txt', from: 'env' } ], + _args: [] } +# args: [] +``` + +Numbers: + +```shell +$ FOO_TIMEOUT=5000 node examples/foo.js +# opts: { timeout: 5000, + _order: [ { key: 'timeout', value: 5000, from: 'env' } ], + _args: [] } +# args: [] + +$ FOO_TIMEOUT=blarg node examples/foo.js +foo: error: arg for "FOO_TIMEOUT" is not a positive integer: "blarg" +``` + +With the `includeEnv: true` config to `parser.help()` the environment +variable can also be included in **help output**: + + usage: node foo.js [OPTIONS] + options: + --version Print tool version and exit. + -h, --help Print this help and exit. + -v, --verbose Verbose output. Use multiple times for more verbose. + Environment: FOO_VERBOSE=1 + -f FILE, --file=FILE File to process + + +# Bash completion + +Dashdash provides a simple way to create a Bash completion file that you +can place in your "bash_completion.d" directory -- sometimes that is +"/usr/local/etc/bash_completion.d/"). Features: + +- Support for short and long opts +- Support for knowing which options take arguments +- Support for subcommands (e.g. 'git log ' to show just options for the + log subcommand). See + [node-cmdln](https://github.com/trentm/node-cmdln#bash-completion) for + how to integrate that. +- Does the right thing with "--" to stop options. +- Custom optarg and arg types for custom completions. + +Dashdash will return bash completion file content given a parser instance: + + var parser = dashdash.createParser({options: options}); + console.log( parser.bashCompletion({name: 'mycli'}) ); + +or directly from a `options` array of options specs: + + var code = dashdash.bashCompletionFromOptions({ + name: 'mycli', + options: OPTIONS + }); + +Write that content to "/usr/local/etc/bash_completion.d/mycli" and you will +have Bash completions for `mycli`. Alternatively you can write it to +any file (e.g. "~/.bashrc") and source it. + +You could add a `--completion` hidden option to your tool that emits the +completion content and document for your users to call that to install +Bash completions. + +See [examples/ddcompletion.js](examples/ddcompletion.js) for a complete +example, including how one can define bash functions for completion of custom +option types. Also see [node-cmdln](https://github.com/trentm/node-cmdln) for +how it uses this for Bash completion for full multi-subcommand tools. + +- TODO: document specExtra +- TODO: document includeHidden +- TODO: document custom types, `function complete\_FOO` guide, completionType +- TODO: document argtypes + + +# Parser config + +Parser construction (i.e. `dashdash.createParser(CONFIG)`) takes the +following fields: + +- `options` (Array of option specs). Required. See the + [Option specs](#option-specs) section below. + +- `interspersed` (Boolean). Optional. Default is true. If true this allows + interspersed arguments and options. I.e.: + + node ./tool.js -v arg1 arg2 -h # '-h' is after interspersed args + + Set it to false to have '-h' **not** get parsed as an option in the above + example. + +- `allowUnknown` (Boolean). Optional. Default is false. If false, this causes + unknown arguments to throw an error. I.e.: + + node ./tool.js -v arg1 --afe8asefksjefhas + + Set it to true to treat the unknown option as a positional + argument. + + **Caveat**: When a shortopt group, such as `-xaz` contains a mix of + known and unknown options, the *entire* group is passed through + unmolested as a positional argument. + + Consider if you have a known short option `-a`, and parse the + following command line: + + node ./tool.js -xaz + + where `-x` and `-z` are unknown. There are multiple ways to + interpret this: + + 1. `-x` takes a value: `{x: 'az'}` + 2. `-x` and `-z` are both booleans: `{x:true,a:true,z:true}` + + Since dashdash does not know what `-x` and `-z` are, it can't know + if you'd prefer to receive `{a:true,_args:['-x','-z']}` or + `{x:'az'}`, or `{_args:['-xaz']}`. Leaving the positional arg unprocessed + is the easiest mistake for the user to recover from. + + +# Option specs + +Example using all fields (required fields are noted): + +```javascript +{ + names: ['file', 'f'], // Required (one of `names` or `name`). + type: 'string', // Required. + completionType: 'filename', + env: 'MYTOOL_FILE', + help: 'Config file to load before running "mytool"', + helpArg: 'PATH', + helpWrap: false, + default: path.resolve(process.env.HOME, '.mytoolrc') +} +``` + +Each option spec in the `options` array must/can have the following fields: + +- `name` (String) or `names` (Array). Required. These give the option name + and aliases. The first name (if more than one given) is the key for the + parsed `opts` object. + +- `type` (String). Required. One of: + + - bool + - string + - number + - integer + - positiveInteger + - date (epoch seconds, e.g. 1396031701, or ISO 8601 format + `YYYY-MM-DD[THH:MM:SS[.sss][Z]]`, e.g. "2014-03-28T18:35:01.489Z") + - arrayOfBool + - arrayOfString + - arrayOfNumber + - arrayOfInteger + - arrayOfPositiveInteger + - arrayOfDate + + FWIW, these names attempt to match with asserts on + [assert-plus](https://github.com/mcavage/node-assert-plus). + You can add your own custom option types with `dashdash.addOptionType`. + See below. + +- `completionType` (String). Optional. This is used for [Bash + completion](#bash-completion) for an option argument. If not specified, + then the value of `type` is used. Any string may be specified, but only the + following values have meaning: + + - `none`: Provide no completions. + - `file`: Bash's default completion (i.e. `complete -o default`), which + includes filenames. + - *Any string FOO for which a `function complete_FOO` Bash function is + defined.* This is for custom completions for a given tool. Typically + these custom functions are provided in the `specExtra` argument to + `dashdash.bashCompletionFromOptions()`. See + ["examples/ddcompletion.js"](examples/ddcompletion.js) for an example. + +- `env` (String or Array of String). Optional. An environment variable name + (or names) that can be used as a fallback for this option. For example, + given a "foo.js" like this: + + var options = [{names: ['dry-run', 'n'], env: 'FOO_DRY_RUN'}]; + var opts = dashdash.parse({options: options}); + + Both `node foo.js --dry-run` and `FOO_DRY_RUN=1 node foo.js` would result + in `opts.dry_run = true`. + + An environment variable is only used as a fallback, i.e. it is ignored if + the associated option is given in `argv`. + +- `help` (String). Optional. Used for `parser.help()` output. + +- `helpArg` (String). Optional. Used in help output as the placeholder for + the option argument, e.g. the "PATH" in: + + ... + -f PATH, --file=PATH File to process + ... + +- `helpWrap` (Boolean). Optional, default true. Set this to `false` to have + that option's `help` *not* be text wrapped in `.help()` output. + +- `default`. Optional. A default value used for this option, if the + option isn't specified in argv. + +- `hidden` (Boolean). Optional, default false. If true, help output will not + include this option. See also the `includeHidden` option to + `bashCompletionFromOptions()` for [Bash completion](#bash-completion). + + +# Option group headings + +You can add headings between option specs in the `options` array. To do so, +simply add an object with only a `group` property -- the string to print as +the heading for the subsequent options in the array. For example: + +```javascript +var options = [ + { + group: 'Armament Options' + }, + { + names: [ 'weapon', 'w' ], + type: 'string' + }, + { + group: 'General Options' + }, + { + names: [ 'help', 'h' ], + type: 'bool' + } +]; +... +``` + +Note: You can use an empty string, `{group: ''}`, to get a blank line in help +output between groups of options. + + +# Help config + +The `parser.help(...)` function is configurable as follows: + + Options: + Armament Options: + ^^ -w WEAPON, --weapon=WEAPON Weapon with which to crush. One of: | + / sword, spear, maul | + / General Options: | + / -h, --help Print this help and exit. | + / ^^^^ ^ | + \ `-- indent `-- helpCol maxCol ---' + `-- headingIndent + +- `indent` (Number or String). Default 4. Set to a number (for that many + spaces) or a string for the literal indent. +- `headingIndent` (Number or String). Default half length of `indent`. Set to + a number (for that many spaces) or a string for the literal indent. This + indent applies to group heading lines, between normal option lines. +- `nameSort` (String). Default is 'length'. By default the names are + sorted to put the short opts first (i.e. '-h, --help' preferred + to '--help, -h'). Set to 'none' to not do this sorting. +- `maxCol` (Number). Default 80. Note that reflow is just done on whitespace + so a long token in the option help can overflow maxCol. +- `helpCol` (Number). If not set a reasonable value will be determined + between `minHelpCol` and `maxHelpCol`. +- `minHelpCol` (Number). Default 20. +- `maxHelpCol` (Number). Default 40. +- `helpWrap` (Boolean). Default true. Set to `false` to have option `help` + strings *not* be textwrapped to the helpCol..maxCol range. +- `includeEnv` (Boolean). Default false. If the option has associated + environment variables (via the `env` option spec attribute), then + append mentioned of those envvars to the help string. +- `includeDefault` (Boolean). Default false. If the option has a default value + (via the `default` option spec attribute, or a default on the option's type), + then a "Default: VALUE" string will be appended to the help string. + + +# Custom option types + +Dashdash includes a good starter set of option types that it will parse for +you. However, you can add your own via: + + var dashdash = require('dashdash'); + dashdash.addOptionType({ + name: '...', + takesArg: true, + helpArg: '...', + parseArg: function (option, optstr, arg) { + ... + }, + array: false, // optional + arrayFlatten: false, // optional + default: ..., // optional + completionType: ... // optional + }); + +For example, a simple option type that accepts 'yes', 'y', 'no' or 'n' as +a boolean argument would look like: + + var dashdash = require('dashdash'); + + function parseYesNo(option, optstr, arg) { + var argLower = arg.toLowerCase() + if (~['yes', 'y'].indexOf(argLower)) { + return true; + } else if (~['no', 'n'].indexOf(argLower)) { + return false; + } else { + throw new Error(format( + 'arg for "%s" is not "yes" or "no": "%s"', + optstr, arg)); + } + } + + dashdash.addOptionType({ + name: 'yesno' + takesArg: true, + helpArg: '', + parseArg: parseYesNo + }); + + var options = { + {names: ['answer', 'a'], type: 'yesno'} + }; + var opts = dashdash.parse({options: options}); + +See "examples/custom-option-\*.js" for other examples. +See the `addOptionType` block comment in "lib/dashdash.js" for more details. +Please let me know [with an +issue](https://github.com/trentm/node-dashdash/issues/new) if you write a +generally useful one. + + + +# Why + +Why another node.js option parsing lib? + +- `nopt` really is just for "tools like npm". Implicit opts (e.g. '--no-foo' + works for every '--foo'). Can't disable abbreviated opts. Can't do multiple + usages of same opt, e.g. '-vvv' (I think). Can't do grouped short opts. + +- `optimist` has surprise interpretation of options (at least to me). + Implicit opts mean ambiguities and poor error handling for fat-fingering. + `process.exit` calls makes it hard to use as a libary. + +- `optparse` Incomplete docs. Is this an attempted clone of Python's `optparse`. + Not clear. Some divergence. `parser.on("name", ...)` API is weird. + +- `argparse` Dep on underscore. No thanks just for option processing. + `find lib | wc -l` -> `26`. Overkill. + Argparse is a bit different anyway. Not sure I want that. + +- `posix-getopt` No type validation. Though that isn't a killer. AFAIK can't + have a long opt without a short alias. I.e. no `getopt_long` semantics. + Also, no whizbang features like generated help output. + +- ["commander.js"](https://github.com/visionmedia/commander.js): I wrote + [a critique](http://trentm.com/2014/01/a-critique-of-commander-for-nodejs.html) + a while back. It seems fine, but last I checked had + [an outstanding bug](https://github.com/visionmedia/commander.js/pull/121) + that would prevent me from using it. + + +# License + +MIT. See LICENSE.txt. diff --git a/tunestats/app/api/node_modules/dashdash/etc/dashdash.bash_completion.in b/tunestats/app/api/node_modules/dashdash/etc/dashdash.bash_completion.in new file mode 100644 index 0000000..dc33309 --- /dev/null +++ b/tunestats/app/api/node_modules/dashdash/etc/dashdash.bash_completion.in @@ -0,0 +1,389 @@ +#!/bin/bash +# +# Bash completion generated for '{{name}}' at {{date}}. +# +# The original template lives here: +# https://github.com/trentm/node-dashdash/blob/master/etc/dashdash.bash_completion.in +# + +# +# Copyright 2016 Trent Mick +# Copyright 2016 Joyent, Inc. +# +# +# A generic Bash completion driver script. +# +# This is meant to provide a re-usable chunk of Bash to use for +# "etc/bash_completion.d/" files for individual tools. Only the "Configuration" +# section with tool-specific info need differ. Features: +# +# - support for short and long opts +# - support for knowing which options take arguments +# - support for subcommands (e.g. 'git log ' to show just options for the +# log subcommand) +# - does the right thing with "--" to stop options +# - custom optarg and arg types for custom completions +# - (TODO) support for shells other than Bash (tcsh, zsh, fish?, etc.) +# +# +# Examples/design: +# +# 1. Bash "default" completion. By default Bash's 'complete -o default' is +# enabled. That means when there are no completions (e.g. if no opts match +# the current word), then you'll get Bash's default completion. Most notably +# that means you get filename completion. E.g.: +# $ tool ./ +# $ tool READ +# +# 2. all opts and subcmds: +# $ tool +# $ tool -v # assuming '-v' doesn't take an arg +# $ tool - # matching opts +# $ git lo # matching subcmds +# +# Long opt completions are given *without* the '=', i.e. we prefer space +# separated because that's easier for good completions. +# +# 3. long opt arg with '=' +# $ tool --file= +# $ tool --file=./d +# We maintain the "--file=" prefix. Limitation: With the attached prefix +# the 'complete -o filenames' doesn't know to do dirname '/' suffixing. Meh. +# +# 4. envvars: +# $ tool $ +# $ tool $P +# Limitation: Currently only getting exported vars, so we miss "PS1" and +# others. +# +# 5. Defer to other completion in a subshell: +# $ tool --file $(cat ./ +# We get this from 'complete -o default ...'. +# +# 6. Custom completion types from a provided bash function. +# $ tool --profile # complete available "profiles" +# +# +# Dev Notes: +# - compgen notes, from http://unix.stackexchange.com/questions/151118/understand-compgen-builtin-command +# - https://www.gnu.org/software/bash/manual/html_node/Programmable-Completion-Builtins.html +# + + +# Debugging this completion: +# 1. Uncomment the "_{{name}}_log_file=..." line. +# 2. 'tail -f /var/tmp/dashdash-completion.log' in one terminal. +# 3. Re-source this bash completion file. +#_{{name}}_log=/var/tmp/dashdash-completion.log + +function _{{name}}_completer { + + # ---- cmd definition + + {{spec}} + + + # ---- locals + + declare -a argv + + + # ---- support functions + + function trace { + [[ -n "$_{{name}}_log" ]] && echo "$*" >&2 + } + + function _dashdash_complete { + local idx context + idx=$1 + context=$2 + + local shortopts longopts optargs subcmds allsubcmds argtypes + shortopts="$(eval "echo \${cmd${context}_shortopts}")" + longopts="$(eval "echo \${cmd${context}_longopts}")" + optargs="$(eval "echo \${cmd${context}_optargs}")" + subcmds="$(eval "echo \${cmd${context}_subcmds}")" + allsubcmds="$(eval "echo \${cmd${context}_allsubcmds}")" + IFS=', ' read -r -a argtypes <<< "$(eval "echo \${cmd${context}_argtypes}")" + + trace "" + trace "_dashdash_complete(idx=$idx, context=$context)" + trace " shortopts: $shortopts" + trace " longopts: $longopts" + trace " optargs: $optargs" + trace " subcmds: $subcmds" + trace " allsubcmds: $allsubcmds" + + # Get 'state' of option parsing at this COMP_POINT. + # Copying "dashdash.js#parse()" behaviour here. + local state= + local nargs=0 + local i=$idx + local argtype + local optname + local prefix + local word + local dashdashseen= + while [[ $i -lt $len && $i -le $COMP_CWORD ]]; do + argtype= + optname= + prefix= + word= + + arg=${argv[$i]} + trace " consider argv[$i]: '$arg'" + + if [[ "$arg" == "--" && $i -lt $COMP_CWORD ]]; then + trace " dashdash seen" + dashdashseen=yes + state=arg + word=$arg + elif [[ -z "$dashdashseen" && "${arg:0:2}" == "--" ]]; then + arg=${arg:2} + if [[ "$arg" == *"="* ]]; then + optname=${arg%%=*} + val=${arg##*=} + trace " long opt: optname='$optname' val='$val'" + state=arg + argtype=$(echo "$optargs" | awk -F "-$optname=" '{print $2}' | cut -d' ' -f1) + word=$val + prefix="--$optname=" + else + optname=$arg + val= + trace " long opt: optname='$optname'" + state=longopt + word=--$optname + + if [[ "$optargs" == *"-$optname="* && $i -lt $COMP_CWORD ]]; then + i=$(( $i + 1 )) + state=arg + argtype=$(echo "$optargs" | awk -F "-$optname=" '{print $2}' | cut -d' ' -f1) + word=${argv[$i]} + trace " takes arg (consume argv[$i], word='$word')" + fi + fi + elif [[ -z "$dashdashseen" && "${arg:0:1}" == "-" ]]; then + trace " short opt group" + state=shortopt + word=$arg + + local j=1 + while [[ $j -lt ${#arg} ]]; do + optname=${arg:$j:1} + trace " consider index $j: optname '$optname'" + + if [[ "$optargs" == *"-$optname="* ]]; then + argtype=$(echo "$optargs" | awk -F "-$optname=" '{print $2}' | cut -d' ' -f1) + if [[ $(( $j + 1 )) -lt ${#arg} ]]; then + state=arg + word=${arg:$(( $j + 1 ))} + trace " takes arg (rest of this arg, word='$word', argtype='$argtype')" + elif [[ $i -lt $COMP_CWORD ]]; then + state=arg + i=$(( $i + 1 )) + word=${argv[$i]} + trace " takes arg (word='$word', argtype='$argtype')" + fi + break + fi + + j=$(( $j + 1 )) + done + elif [[ $i -lt $COMP_CWORD && -n "$arg" ]] && $(echo "$allsubcmds" | grep -w "$arg" >/dev/null); then + trace " complete subcmd: recurse _dashdash_complete" + _dashdash_complete $(( $i + 1 )) "${context}__${arg/-/_}" + return + else + trace " not an opt or a complete subcmd" + state=arg + word=$arg + nargs=$(( $nargs + 1 )) + if [[ ${#argtypes[@]} -gt 0 ]]; then + argtype="${argtypes[$(( $nargs - 1 ))]}" + if [[ -z "$argtype" ]]; then + # If we have more args than argtypes, we use the + # last type. + argtype="${argtypes[@]: -1:1}" + fi + fi + fi + + trace " state=$state prefix='$prefix' word='$word'" + i=$(( $i + 1 )) + done + + trace " parsed: state=$state optname='$optname' argtype='$argtype' prefix='$prefix' word='$word' dashdashseen=$dashdashseen" + local compgen_opts= + if [[ -n "$prefix" ]]; then + compgen_opts="$compgen_opts -P $prefix" + fi + + case $state in + shortopt) + compgen $compgen_opts -W "$shortopts $longopts" -- "$word" + ;; + longopt) + compgen $compgen_opts -W "$longopts" -- "$word" + ;; + arg) + # If we don't know what completion to do, then emit nothing. We + # expect that we are running with: + # complete -o default ... + # where "default" means: "Use Readline's default completion if + # the compspec generates no matches." This gives us the good filename + # completion, completion in subshells/backticks. + # + # We cannot support an argtype="directory" because + # compgen -S '/' -A directory -- "$word" + # doesn't give a satisfying result. It doesn't stop at the trailing '/' + # so you cannot descend into dirs. + if [[ "${word:0:1}" == '$' ]]; then + # By default, Bash will complete '$' to all envvars. Apparently + # 'complete -o default' does *not* give us that. The following + # gets *close* to the same completions: '-A export' misses envvars + # like "PS1". + trace " completing envvars" + compgen $compgen_opts -P '$' -A export -- "${word:1}" + elif [[ -z "$argtype" ]]; then + # Only include opts in completions if $word is not empty. + # This is to avoid completing the leading '-', which foils + # using 'default' completion. + if [[ -n "$dashdashseen" ]]; then + trace " completing subcmds, if any (no argtype, dashdash seen)" + compgen $compgen_opts -W "$subcmds" -- "$word" + elif [[ -z "$word" ]]; then + trace " completing subcmds, if any (no argtype, empty word)" + compgen $compgen_opts -W "$subcmds" -- "$word" + else + trace " completing opts & subcmds (no argtype)" + compgen $compgen_opts -W "$shortopts $longopts $subcmds" -- "$word" + fi + elif [[ $argtype == "none" ]]; then + # We want *no* completions, i.e. some way to get the active + # 'complete -o default' to not do filename completion. + trace " completing 'none' (hack to imply no completions)" + echo "##-no-completion- -results-##" + elif [[ $argtype == "file" ]]; then + # 'complete -o default' gives the best filename completion, at least + # on Mac. + trace " completing 'file' (let 'complete -o default' handle it)" + echo "" + elif ! type complete_$argtype 2>/dev/null >/dev/null; then + trace " completing '$argtype' (fallback to default b/c complete_$argtype is unknown)" + echo "" + else + trace " completing custom '$argtype'" + completions=$(complete_$argtype "$word") + if [[ -z "$completions" ]]; then + trace " no custom '$argtype' completions" + # These are in ascii and "dictionary" order so they sort + # correctly. + echo "##-no-completion- -results-##" + else + echo $completions + fi + fi + ;; + *) + trace " unknown state: $state" + ;; + esac + } + + + trace "" + trace "-- $(date)" + #trace "\$IFS: '$IFS'" + #trace "\$@: '$@'" + #trace "COMP_WORDBREAKS: '$COMP_WORDBREAKS'" + trace "COMP_CWORD: '$COMP_CWORD'" + trace "COMP_LINE: '$COMP_LINE'" + trace "COMP_POINT: $COMP_POINT" + + # Guard against negative COMP_CWORD. This is a Bash bug at least on + # Mac 10.10.4's bash. See + # . + if [[ $COMP_CWORD -lt 0 ]]; then + trace "abort on negative COMP_CWORD" + exit 1; + fi + + # I don't know how to do array manip on argv vars, + # so copy over to argv array to work on them. + shift # the leading '--' + i=0 + len=$# + while [[ $# -gt 0 ]]; do + argv[$i]=$1 + shift; + i=$(( $i + 1 )) + done + trace "argv: '${argv[@]}'" + trace "argv[COMP_CWORD-1]: '${argv[$(( $COMP_CWORD - 1 ))]}'" + trace "argv[COMP_CWORD]: '${argv[$COMP_CWORD]}'" + trace "argv len: '$len'" + + _dashdash_complete 1 "" +} + + +# ---- mainline + +# Note: This if-block to help work with 'compdef' and 'compctl' is +# adapted from 'npm completion'. +if type complete &>/dev/null; then + function _{{name}}_completion { + local _log_file=/dev/null + [[ -z "$_{{name}}_log" ]] || _log_file="$_{{name}}_log" + COMPREPLY=($(COMP_CWORD="$COMP_CWORD" \ + COMP_LINE="$COMP_LINE" \ + COMP_POINT="$COMP_POINT" \ + _{{name}}_completer -- "${COMP_WORDS[@]}" \ + 2>$_log_file)) || return $? + } + complete -o default -F _{{name}}_completion {{name}} +elif type compdef &>/dev/null; then + function _{{name}}_completion { + local _log_file=/dev/null + [[ -z "$_{{name}}_log" ]] || _log_file="$_{{name}}_log" + compadd -- $(COMP_CWORD=$((CURRENT-1)) \ + COMP_LINE=$BUFFER \ + COMP_POINT=0 \ + _{{name}}_completer -- "${words[@]}" \ + 2>$_log_file) + } + compdef _{{name}}_completion {{name}} +elif type compctl &>/dev/null; then + function _{{name}}_completion { + local cword line point words si + read -Ac words + read -cn cword + let cword-=1 + read -l line + read -ln point + local _log_file=/dev/null + [[ -z "$_{{name}}_log" ]] || _log_file="$_{{name}}_log" + reply=($(COMP_CWORD="$cword" \ + COMP_LINE="$line" \ + COMP_POINT="$point" \ + _{{name}}_completer -- "${words[@]}" \ + 2>$_log_file)) || return $? + } + compctl -K _{{name}}_completion {{name}} +fi + + +## +## This is a Bash completion file for the '{{name}}' command. You can install +## with either: +## +## cp FILE /usr/local/etc/bash_completion.d/{{name}} # Mac +## cp FILE /etc/bash_completion.d/{{name}} # Linux +## +## or: +## +## cp FILE > ~/.{{name}}.completion +## echo "source ~/.{{name}}.completion" >> ~/.bashrc +## \ No newline at end of file diff --git a/tunestats/app/api/node_modules/dashdash/lib/dashdash.js b/tunestats/app/api/node_modules/dashdash/lib/dashdash.js new file mode 100644 index 0000000..adb6f13 --- /dev/null +++ b/tunestats/app/api/node_modules/dashdash/lib/dashdash.js @@ -0,0 +1,1055 @@ +/** + * dashdash - A light, featureful and explicit option parsing library for + * node.js. + */ +// vim: set ts=4 sts=4 sw=4 et: + +var assert = require('assert-plus'); +var format = require('util').format; +var fs = require('fs'); +var path = require('path'); + + +var DEBUG = true; +if (DEBUG) { + var debug = console.warn; +} else { + var debug = function () {}; +} + + + +// ---- internal support stuff + +// Replace {{variable}} in `s` with the template data in `d`. +function renderTemplate(s, d) { + return s.replace(/{{([a-zA-Z]+)}}/g, function (match, key) { + return d.hasOwnProperty(key) ? d[key] : match; + }); +} + +/** + * Return a shallow copy of the given object; + */ +function shallowCopy(obj) { + if (!obj) { + return (obj); + } + var copy = {}; + Object.keys(obj).forEach(function (k) { + copy[k] = obj[k]; + }); + return (copy); +} + + +function space(n) { + var s = ''; + for (var i = 0; i < n; i++) { + s += ' '; + } + return s; +} + + +function makeIndent(arg, deflen, name) { + if (arg === null || arg === undefined) + return space(deflen); + else if (typeof (arg) === 'number') + return space(arg); + else if (typeof (arg) === 'string') + return arg; + else + assert.fail('invalid "' + name + '": not a string or number: ' + arg); +} + + +/** + * Return an array of lines wrapping the given text to the given width. + * This splits on whitespace. Single tokens longer than `width` are not + * broken up. + */ +function textwrap(s, width) { + var words = s.trim().split(/\s+/); + var lines = []; + var line = ''; + words.forEach(function (w) { + var newLength = line.length + w.length; + if (line.length > 0) + newLength += 1; + if (newLength > width) { + lines.push(line); + line = ''; + } + if (line.length > 0) + line += ' '; + line += w; + }); + lines.push(line); + return lines; +} + + +/** + * Transform an option name to a "key" that is used as the field + * on the `opts` object returned from `.parse()`. + * + * Transformations: + * - '-' -> '_': This allow one to use hyphen in option names (common) + * but not have to do silly things like `opt["dry-run"]` to access the + * parsed results. + */ +function optionKeyFromName(name) { + return name.replace(/-/g, '_'); +} + + + +// ---- Option types + +function parseBool(option, optstr, arg) { + return Boolean(arg); +} + +function parseString(option, optstr, arg) { + assert.string(arg, 'arg'); + return arg; +} + +function parseNumber(option, optstr, arg) { + assert.string(arg, 'arg'); + var num = Number(arg); + if (isNaN(num)) { + throw new Error(format('arg for "%s" is not a number: "%s"', + optstr, arg)); + } + return num; +} + +function parseInteger(option, optstr, arg) { + assert.string(arg, 'arg'); + var num = Number(arg); + if (!/^[0-9-]+$/.test(arg) || isNaN(num)) { + throw new Error(format('arg for "%s" is not an integer: "%s"', + optstr, arg)); + } + return num; +} + +function parsePositiveInteger(option, optstr, arg) { + assert.string(arg, 'arg'); + var num = Number(arg); + if (!/^[0-9]+$/.test(arg) || isNaN(num) || num === 0) { + throw new Error(format('arg for "%s" is not a positive integer: "%s"', + optstr, arg)); + } + return num; +} + +/** + * Supported date args: + * - epoch second times (e.g. 1396031701) + * - ISO 8601 format: YYYY-MM-DD[THH:MM:SS[.sss][Z]] + * 2014-03-28T18:35:01.489Z + * 2014-03-28T18:35:01.489 + * 2014-03-28T18:35:01Z + * 2014-03-28T18:35:01 + * 2014-03-28 + */ +function parseDate(option, optstr, arg) { + assert.string(arg, 'arg'); + var date; + if (/^\d+$/.test(arg)) { + // epoch seconds + date = new Date(Number(arg) * 1000); + /* JSSTYLED */ + } else if (/^\d{4}-\d{2}-\d{2}(T\d{2}:\d{2}:\d{2}(\.\d+)?Z?)?$/i.test(arg)) { + // ISO 8601 format + date = new Date(arg); + } else { + throw new Error(format('arg for "%s" is not a valid date format: "%s"', + optstr, arg)); + } + if (date.toString() === 'Invalid Date') { + throw new Error(format('arg for "%s" is an invalid date: "%s"', + optstr, arg)); + } + return date; +} + +var optionTypes = { + bool: { + takesArg: false, + parseArg: parseBool + }, + string: { + takesArg: true, + helpArg: 'ARG', + parseArg: parseString + }, + number: { + takesArg: true, + helpArg: 'NUM', + parseArg: parseNumber + }, + integer: { + takesArg: true, + helpArg: 'INT', + parseArg: parseInteger + }, + positiveInteger: { + takesArg: true, + helpArg: 'INT', + parseArg: parsePositiveInteger + }, + date: { + takesArg: true, + helpArg: 'DATE', + parseArg: parseDate + }, + arrayOfBool: { + takesArg: false, + array: true, + parseArg: parseBool + }, + arrayOfString: { + takesArg: true, + helpArg: 'ARG', + array: true, + parseArg: parseString + }, + arrayOfNumber: { + takesArg: true, + helpArg: 'NUM', + array: true, + parseArg: parseNumber + }, + arrayOfInteger: { + takesArg: true, + helpArg: 'INT', + array: true, + parseArg: parseInteger + }, + arrayOfPositiveInteger: { + takesArg: true, + helpArg: 'INT', + array: true, + parseArg: parsePositiveInteger + }, + arrayOfDate: { + takesArg: true, + helpArg: 'INT', + array: true, + parseArg: parseDate + }, +}; + + + +// ---- Parser + +/** + * Parser constructor. + * + * @param config {Object} The parser configuration + * - options {Array} Array of option specs. See the README for how to + * specify each option spec. + * - allowUnknown {Boolean} Default false. Whether to throw on unknown + * options. If false, then unknown args are included in the _args array. + * - interspersed {Boolean} Default true. Whether to allow interspersed + * arguments (non-options) and options. E.g.: + * node tool.js arg1 arg2 -v + * '-v' is after some args here. If `interspersed: false` then '-v' + * would not be parsed out. Note that regardless of `interspersed` + * the presence of '--' will stop option parsing, as all good + * option parsers should. + */ +function Parser(config) { + assert.object(config, 'config'); + assert.arrayOfObject(config.options, 'config.options'); + assert.optionalBool(config.interspersed, 'config.interspersed'); + var self = this; + + // Allow interspersed arguments (true by default). + this.interspersed = (config.interspersed !== undefined + ? config.interspersed : true); + + // Don't allow unknown flags (true by default). + this.allowUnknown = (config.allowUnknown !== undefined + ? config.allowUnknown : false); + + this.options = config.options.map(function (o) { return shallowCopy(o); }); + this.optionFromName = {}; + this.optionFromEnv = {}; + for (var i = 0; i < this.options.length; i++) { + var o = this.options[i]; + if (o.group !== undefined && o.group !== null) { + assert.optionalString(o.group, + format('config.options.%d.group', i)); + continue; + } + assert.ok(optionTypes[o.type], + format('invalid config.options.%d.type: "%s" in %j', + i, o.type, o)); + assert.optionalString(o.name, format('config.options.%d.name', i)); + assert.optionalArrayOfString(o.names, + format('config.options.%d.names', i)); + assert.ok((o.name || o.names) && !(o.name && o.names), + format('exactly one of "name" or "names" required: %j', o)); + assert.optionalString(o.help, format('config.options.%d.help', i)); + var env = o.env || []; + if (typeof (env) === 'string') { + env = [env]; + } + assert.optionalArrayOfString(env, format('config.options.%d.env', i)); + assert.optionalString(o.helpGroup, + format('config.options.%d.helpGroup', i)); + assert.optionalBool(o.helpWrap, + format('config.options.%d.helpWrap', i)); + assert.optionalBool(o.hidden, format('config.options.%d.hidden', i)); + + if (o.name) { + o.names = [o.name]; + } else { + assert.string(o.names[0], + format('config.options.%d.names is empty', i)); + } + o.key = optionKeyFromName(o.names[0]); + o.names.forEach(function (n) { + if (self.optionFromName[n]) { + throw new Error(format( + 'option name collision: "%s" used in %j and %j', + n, self.optionFromName[n], o)); + } + self.optionFromName[n] = o; + }); + env.forEach(function (n) { + if (self.optionFromEnv[n]) { + throw new Error(format( + 'option env collision: "%s" used in %j and %j', + n, self.optionFromEnv[n], o)); + } + self.optionFromEnv[n] = o; + }); + } +} + +Parser.prototype.optionTakesArg = function optionTakesArg(option) { + return optionTypes[option.type].takesArg; +}; + +/** + * Parse options from the given argv. + * + * @param inputs {Object} Optional. + * - argv {Array} Optional. The argv to parse. Defaults to + * `process.argv`. + * - slice {Number} The index into argv at which options/args begin. + * Default is 2, as appropriate for `process.argv`. + * - env {Object} Optional. The env to use for 'env' entries in the + * option specs. Defaults to `process.env`. + * @returns {Object} Parsed `opts`. It has special keys `_args` (the + * remaining args from `argv`) and `_order` (gives the order that + * options were specified). + */ +Parser.prototype.parse = function parse(inputs) { + var self = this; + + // Old API was `parse([argv, [slice]])` + if (Array.isArray(arguments[0])) { + inputs = {argv: arguments[0], slice: arguments[1]}; + } + + assert.optionalObject(inputs, 'inputs'); + if (!inputs) { + inputs = {}; + } + assert.optionalArrayOfString(inputs.argv, 'inputs.argv'); + //assert.optionalNumber(slice, 'slice'); + var argv = inputs.argv || process.argv; + var slice = inputs.slice !== undefined ? inputs.slice : 2; + var args = argv.slice(slice); + var env = inputs.env || process.env; + var opts = {}; + var _order = []; + + function addOpt(option, optstr, key, val, from) { + var type = optionTypes[option.type]; + var parsedVal = type.parseArg(option, optstr, val); + if (type.array) { + if (!opts[key]) { + opts[key] = []; + } + if (type.arrayFlatten && Array.isArray(parsedVal)) { + for (var i = 0; i < parsedVal.length; i++) { + opts[key].push(parsedVal[i]); + } + } else { + opts[key].push(parsedVal); + } + } else { + opts[key] = parsedVal; + } + var item = { key: key, value: parsedVal, from: from }; + _order.push(item); + } + + // Parse args. + var _args = []; + var i = 0; + outer: while (i < args.length) { + var arg = args[i]; + + // End of options marker. + if (arg === '--') { + i++; + break; + + // Long option + } else if (arg.slice(0, 2) === '--') { + var name = arg.slice(2); + var val = null; + var idx = name.indexOf('='); + if (idx !== -1) { + val = name.slice(idx + 1); + name = name.slice(0, idx); + } + var option = this.optionFromName[name]; + if (!option) { + if (!this.allowUnknown) + throw new Error(format('unknown option: "--%s"', name)); + else if (this.interspersed) + _args.push(arg); + else + break outer; + } else { + var takesArg = this.optionTakesArg(option); + if (val !== null && !takesArg) { + throw new Error(format('argument given to "--%s" option ' + + 'that does not take one: "%s"', name, arg)); + } + if (!takesArg) { + addOpt(option, '--'+name, option.key, true, 'argv'); + } else if (val !== null) { + addOpt(option, '--'+name, option.key, val, 'argv'); + } else if (i + 1 >= args.length) { + throw new Error(format('do not have enough args for "--%s" ' + + 'option', name)); + } else { + addOpt(option, '--'+name, option.key, args[i + 1], 'argv'); + i++; + } + } + + // Short option + } else if (arg[0] === '-' && arg.length > 1) { + var j = 1; + var allFound = true; + while (j < arg.length) { + var name = arg[j]; + var option = this.optionFromName[name]; + if (!option) { + allFound = false; + if (this.allowUnknown) { + if (this.interspersed) { + _args.push(arg); + break; + } else + break outer; + } else if (arg.length > 2) { + throw new Error(format( + 'unknown option: "-%s" in "%s" group', + name, arg)); + } else { + throw new Error(format('unknown option: "-%s"', name)); + } + } else if (this.optionTakesArg(option)) { + break; + } + j++; + } + + j = 1; + while (allFound && j < arg.length) { + var name = arg[j]; + var val = arg.slice(j + 1); // option val if it takes an arg + var option = this.optionFromName[name]; + var takesArg = this.optionTakesArg(option); + if (!takesArg) { + addOpt(option, '-'+name, option.key, true, 'argv'); + } else if (val) { + addOpt(option, '-'+name, option.key, val, 'argv'); + break; + } else { + if (i + 1 >= args.length) { + throw new Error(format('do not have enough args ' + + 'for "-%s" option', name)); + } + addOpt(option, '-'+name, option.key, args[i + 1], 'argv'); + i++; + break; + } + j++; + } + + // An interspersed arg + } else if (this.interspersed) { + _args.push(arg); + + // An arg and interspersed args are not allowed, so done options. + } else { + break outer; + } + i++; + } + _args = _args.concat(args.slice(i)); + + // Parse environment. + Object.keys(this.optionFromEnv).forEach(function (envname) { + var val = env[envname]; + if (val === undefined) + return; + var option = self.optionFromEnv[envname]; + if (opts[option.key] !== undefined) + return; + var takesArg = self.optionTakesArg(option); + if (takesArg) { + addOpt(option, envname, option.key, val, 'env'); + } else if (val !== '') { + // Boolean envvar handling: + // - VAR= not set (as if the VAR was not set) + // - VAR=0 false + // - anything else true + addOpt(option, envname, option.key, (val !== '0'), 'env'); + } + }); + + // Apply default values. + this.options.forEach(function (o) { + if (opts[o.key] === undefined) { + if (o.default !== undefined) { + opts[o.key] = o.default; + } else if (o.type && optionTypes[o.type].default !== undefined) { + opts[o.key] = optionTypes[o.type].default; + } + } + }); + + opts._order = _order; + opts._args = _args; + return opts; +}; + + +/** + * Return help output for the current options. + * + * E.g.: if the current options are: + * [{names: ['help', 'h'], type: 'bool', help: 'Show help and exit.'}] + * then this would return: + * ' -h, --help Show help and exit.\n' + * + * @param config {Object} Config for controlling the option help output. + * - indent {Number|String} Default 4. An indent/prefix to use for + * each option line. + * - nameSort {String} Default is 'length'. By default the names are + * sorted to put the short opts first (i.e. '-h, --help' preferred + * to '--help, -h'). Set to 'none' to not do this sorting. + * - maxCol {Number} Default 80. Note that long tokens in a help string + * can go past this. + * - helpCol {Number} Set to specify a specific column at which + * option help will be aligned. By default this is determined + * automatically. + * - minHelpCol {Number} Default 20. + * - maxHelpCol {Number} Default 40. + * - includeEnv {Boolean} Default false. If true, a note stating the `env` + * envvar (if specified for this option) will be appended to the help + * output. + * - includeDefault {Boolean} Default false. If true, a note stating + * the `default` for this option, if any, will be appended to the help + * output. + * - helpWrap {Boolean} Default true. Wrap help text in helpCol..maxCol + * bounds. + * @returns {String} + */ +Parser.prototype.help = function help(config) { + config = config || {}; + assert.object(config, 'config'); + + var indent = makeIndent(config.indent, 4, 'config.indent'); + var headingIndent = makeIndent(config.headingIndent, + Math.round(indent.length / 2), 'config.headingIndent'); + + assert.optionalString(config.nameSort, 'config.nameSort'); + var nameSort = config.nameSort || 'length'; + assert.ok(~['length', 'none'].indexOf(nameSort), + 'invalid "config.nameSort"'); + assert.optionalNumber(config.maxCol, 'config.maxCol'); + assert.optionalNumber(config.maxHelpCol, 'config.maxHelpCol'); + assert.optionalNumber(config.minHelpCol, 'config.minHelpCol'); + assert.optionalNumber(config.helpCol, 'config.helpCol'); + assert.optionalBool(config.includeEnv, 'config.includeEnv'); + assert.optionalBool(config.includeDefault, 'config.includeDefault'); + assert.optionalBool(config.helpWrap, 'config.helpWrap'); + var maxCol = config.maxCol || 80; + var minHelpCol = config.minHelpCol || 20; + var maxHelpCol = config.maxHelpCol || 40; + + var lines = []; + var maxWidth = 0; + this.options.forEach(function (o) { + if (o.hidden) { + return; + } + if (o.group !== undefined && o.group !== null) { + // We deal with groups in the next pass + lines.push(null); + return; + } + var type = optionTypes[o.type]; + var arg = o.helpArg || type.helpArg || 'ARG'; + var line = ''; + var names = o.names.slice(); + if (nameSort === 'length') { + names.sort(function (a, b) { + if (a.length < b.length) + return -1; + else if (b.length < a.length) + return 1; + else + return 0; + }) + } + names.forEach(function (name, i) { + if (i > 0) + line += ', '; + if (name.length === 1) { + line += '-' + name + if (type.takesArg) + line += ' ' + arg; + } else { + line += '--' + name + if (type.takesArg) + line += '=' + arg; + } + }); + maxWidth = Math.max(maxWidth, line.length); + lines.push(line); + }); + + // Add help strings. + var helpCol = config.helpCol; + if (!helpCol) { + helpCol = maxWidth + indent.length + 2; + helpCol = Math.min(Math.max(helpCol, minHelpCol), maxHelpCol); + } + var i = -1; + this.options.forEach(function (o) { + if (o.hidden) { + return; + } + i++; + + if (o.group !== undefined && o.group !== null) { + if (o.group === '') { + // Support a empty string "group" to have a blank line between + // sets of options. + lines[i] = ''; + } else { + // Render the group heading with the heading-specific indent. + lines[i] = (i === 0 ? '' : '\n') + headingIndent + + o.group + ':'; + } + return; + } + + var helpDefault; + if (config.includeDefault) { + if (o.default !== undefined) { + helpDefault = format('Default: %j', o.default); + } else if (o.type && optionTypes[o.type].default !== undefined) { + helpDefault = format('Default: %j', + optionTypes[o.type].default); + } + } + + var line = lines[i] = indent + lines[i]; + if (!o.help && !(config.includeEnv && o.env) && !helpDefault) { + return; + } + var n = helpCol - line.length; + if (n >= 0) { + line += space(n); + } else { + line += '\n' + space(helpCol); + } + + var helpEnv = ''; + if (o.env && o.env.length && config.includeEnv) { + helpEnv += 'Environment: '; + var type = optionTypes[o.type]; + var arg = o.helpArg || type.helpArg || 'ARG'; + var envs = (Array.isArray(o.env) ? o.env : [o.env]).map( + function (e) { + if (type.takesArg) { + return e + '=' + arg; + } else { + return e + '=1'; + } + } + ); + helpEnv += envs.join(', '); + } + var help = (o.help || '').trim(); + if (o.helpWrap !== false && config.helpWrap !== false) { + // Wrap help description normally. + if (help.length && !~'.!?"\''.indexOf(help.slice(-1))) { + help += '.'; + } + if (help.length) { + help += ' '; + } + help += helpEnv; + if (helpDefault) { + if (helpEnv) { + help += '. '; + } + help += helpDefault; + } + line += textwrap(help, maxCol - helpCol).join( + '\n' + space(helpCol)); + } else { + // Do not wrap help description, but indent newlines appropriately. + var helpLines = help.split('\n').filter( + function (ln) { return ln.length }); + if (helpEnv !== '') { + helpLines.push(helpEnv); + } + if (helpDefault) { + helpLines.push(helpDefault); + } + line += helpLines.join('\n' + space(helpCol)); + } + + lines[i] = line; + }); + + var rv = ''; + if (lines.length > 0) { + rv = lines.join('\n') + '\n'; + } + return rv; +}; + + +/** + * Return a string suitable for a Bash completion file for this tool. + * + * @param args.name {String} The tool name. + * @param args.specExtra {String} Optional. Extra Bash code content to add + * to the end of the "spec". Typically this is used to append Bash + * "complete_TYPE" functions for custom option types. See + * "examples/ddcompletion.js" for an example. + * @param args.argtypes {Array} Optional. Array of completion types for + * positional args (i.e. non-options). E.g. + * argtypes = ['fruit', 'veggie', 'file'] + * will result in completion of fruits for the first arg, veggies for the + * second, and filenames for the third and subsequent positional args. + * If not given, positional args will use Bash's 'default' completion. + * See `specExtra` for providing Bash `complete_TYPE` functions, e.g. + * `complete_fruit` and `complete_veggie` in this example. + */ +Parser.prototype.bashCompletion = function bashCompletion(args) { + assert.object(args, 'args'); + assert.string(args.name, 'args.name'); + assert.optionalString(args.specExtra, 'args.specExtra'); + assert.optionalArrayOfString(args.argtypes, 'args.argtypes'); + + return bashCompletionFromOptions({ + name: args.name, + specExtra: args.specExtra, + argtypes: args.argtypes, + options: this.options + }); +}; + + +// ---- Bash completion + +const BASH_COMPLETION_TEMPLATE_PATH = path.join( + __dirname, '../etc/dashdash.bash_completion.in'); + +/** + * Return the Bash completion "spec" (the string value for the "{{spec}}" + * var in the "dashdash.bash_completion.in" template) for this tool. + * + * The "spec" is Bash code that defines the CLI options and subcmds for + * the template's completion code. It looks something like this: + * + * local cmd_shortopts="-J ..." + * local cmd_longopts="--help ..." + * local cmd_optargs="-p=tritonprofile ..." + * + * @param args.options {Array} The array of dashdash option specs. + * @param args.context {String} Optional. A context string for the "local cmd*" + * vars in the spec. By default it is the empty string. When used to + * scope for completion on a *sub-command* (e.g. for "git log" on a "git" + * tool), then it would have a value (e.g. "__log"). See + * Bash completion for details. + * @param opts.includeHidden {Boolean} Optional. Default false. By default + * hidden options and subcmds are "excluded". Here excluded means they + * won't be offered as a completion, but if used, their argument type + * will be completed. "Hidden" options and subcmds are ones with the + * `hidden: true` attribute to exclude them from default help output. + * @param args.argtypes {Array} Optional. Array of completion types for + * positional args (i.e. non-options). E.g. + * argtypes = ['fruit', 'veggie', 'file'] + * will result in completion of fruits for the first arg, veggies for the + * second, and filenames for the third and subsequent positional args. + * If not given, positional args will use Bash's 'default' completion. + * See `specExtra` for providing Bash `complete_TYPE` functions, e.g. + * `complete_fruit` and `complete_veggie` in this example. + */ +function bashCompletionSpecFromOptions(args) { + assert.object(args, 'args'); + assert.object(args.options, 'args.options'); + assert.optionalString(args.context, 'args.context'); + assert.optionalBool(args.includeHidden, 'args.includeHidden'); + assert.optionalArrayOfString(args.argtypes, 'args.argtypes'); + + var context = args.context || ''; + var includeHidden = (args.includeHidden === undefined + ? false : args.includeHidden); + + var spec = []; + var shortopts = []; + var longopts = []; + var optargs = []; + (args.options || []).forEach(function (o) { + if (o.group !== undefined && o.group !== null) { + // Skip group headers. + return; + } + + var optNames = o.names || [o.name]; + var optType = getOptionType(o.type); + if (optType.takesArg) { + var completionType = o.completionType || + optType.completionType || o.type; + optNames.forEach(function (optName) { + if (optName.length === 1) { + if (includeHidden || !o.hidden) { + shortopts.push('-' + optName); + } + // Include even hidden options in `optargs` so that bash + // completion of its arg still works. + optargs.push('-' + optName + '=' + completionType); + } else { + if (includeHidden || !o.hidden) { + longopts.push('--' + optName); + } + optargs.push('--' + optName + '=' + completionType); + } + }); + } else { + optNames.forEach(function (optName) { + if (includeHidden || !o.hidden) { + if (optName.length === 1) { + shortopts.push('-' + optName); + } else { + longopts.push('--' + optName); + } + } + }); + } + }); + + spec.push(format('local cmd%s_shortopts="%s"', + context, shortopts.sort().join(' '))); + spec.push(format('local cmd%s_longopts="%s"', + context, longopts.sort().join(' '))); + spec.push(format('local cmd%s_optargs="%s"', + context, optargs.sort().join(' '))); + if (args.argtypes) { + spec.push(format('local cmd%s_argtypes="%s"', + context, args.argtypes.join(' '))); + } + return spec.join('\n'); +} + + +/** + * Return a string suitable for a Bash completion file for this tool. + * + * @param args.name {String} The tool name. + * @param args.options {Array} The array of dashdash option specs. + * @param args.specExtra {String} Optional. Extra Bash code content to add + * to the end of the "spec". Typically this is used to append Bash + * "complete_TYPE" functions for custom option types. See + * "examples/ddcompletion.js" for an example. + * @param args.argtypes {Array} Optional. Array of completion types for + * positional args (i.e. non-options). E.g. + * argtypes = ['fruit', 'veggie', 'file'] + * will result in completion of fruits for the first arg, veggies for the + * second, and filenames for the third and subsequent positional args. + * If not given, positional args will use Bash's 'default' completion. + * See `specExtra` for providing Bash `complete_TYPE` functions, e.g. + * `complete_fruit` and `complete_veggie` in this example. + */ +function bashCompletionFromOptions(args) { + assert.object(args, 'args'); + assert.object(args.options, 'args.options'); + assert.string(args.name, 'args.name'); + assert.optionalString(args.specExtra, 'args.specExtra'); + assert.optionalArrayOfString(args.argtypes, 'args.argtypes'); + + // Gather template data. + var data = { + name: args.name, + date: new Date(), + spec: bashCompletionSpecFromOptions({ + options: args.options, + argtypes: args.argtypes + }), + }; + if (args.specExtra) { + data.spec += '\n\n' + args.specExtra; + } + + // Render template. + var template = fs.readFileSync(BASH_COMPLETION_TEMPLATE_PATH, 'utf8'); + return renderTemplate(template, data); +} + + + +// ---- exports + +function createParser(config) { + return new Parser(config); +} + +/** + * Parse argv with the given options. + * + * @param config {Object} A merge of all the available fields from + * `dashdash.Parser` and `dashdash.Parser.parse`: options, interspersed, + * argv, env, slice. + */ +function parse(config) { + assert.object(config, 'config'); + assert.optionalArrayOfString(config.argv, 'config.argv'); + assert.optionalObject(config.env, 'config.env'); + var config = shallowCopy(config); + var argv = config.argv; + delete config.argv; + var env = config.env; + delete config.env; + + var parser = new Parser(config); + return parser.parse({argv: argv, env: env}); +} + + +/** + * Add a new option type. + * + * @params optionType {Object}: + * - name {String} Required. + * - takesArg {Boolean} Required. Whether this type of option takes an + * argument on process.argv. Typically this is true for all but the + * "bool" type. + * - helpArg {String} Required iff `takesArg === true`. The string to + * show in generated help for options of this type. + * - parseArg {Function} Require. `function (option, optstr, arg)` parser + * that takes a string argument and returns an instance of the + * appropriate type, or throws an error if the arg is invalid. + * - array {Boolean} Optional. Set to true if this is an 'arrayOf' type + * that collects multiple usages of the option in process.argv and + * puts results in an array. + * - arrayFlatten {Boolean} Optional. XXX + * - default Optional. Default value for options of this type, if no + * default is specified in the option type usage. + */ +function addOptionType(optionType) { + assert.object(optionType, 'optionType'); + assert.string(optionType.name, 'optionType.name'); + assert.bool(optionType.takesArg, 'optionType.takesArg'); + if (optionType.takesArg) { + assert.string(optionType.helpArg, 'optionType.helpArg'); + } + assert.func(optionType.parseArg, 'optionType.parseArg'); + assert.optionalBool(optionType.array, 'optionType.array'); + assert.optionalBool(optionType.arrayFlatten, 'optionType.arrayFlatten'); + + optionTypes[optionType.name] = { + takesArg: optionType.takesArg, + helpArg: optionType.helpArg, + parseArg: optionType.parseArg, + array: optionType.array, + arrayFlatten: optionType.arrayFlatten, + default: optionType.default + } +} + + +function getOptionType(name) { + assert.string(name, 'name'); + return optionTypes[name]; +} + + +/** + * Return a synopsis string for the given option spec. + * + * Examples: + * > synopsisFromOpt({names: ['help', 'h'], type: 'bool'}); + * '[ --help | -h ]' + * > synopsisFromOpt({name: 'file', type: 'string', helpArg: 'FILE'}); + * '[ --file=FILE ]' + */ +function synopsisFromOpt(o) { + assert.object(o, 'o'); + + if (o.hasOwnProperty('group')) { + return null; + } + var names = o.names || [o.name]; + // `type` here could be undefined if, for example, the command has a + // dashdash option spec with a bogus 'type'. + var type = getOptionType(o.type); + var helpArg = o.helpArg || (type && type.helpArg) || 'ARG'; + var parts = []; + names.forEach(function (name) { + var part = (name.length === 1 ? '-' : '--') + name; + if (type && type.takesArg) { + part += (name.length === 1 ? ' ' + helpArg : '=' + helpArg); + } + parts.push(part); + }); + return ('[ ' + parts.join(' | ') + ' ]'); +}; + + +module.exports = { + createParser: createParser, + Parser: Parser, + parse: parse, + addOptionType: addOptionType, + getOptionType: getOptionType, + synopsisFromOpt: synopsisFromOpt, + + // Bash completion-related exports + BASH_COMPLETION_TEMPLATE_PATH: BASH_COMPLETION_TEMPLATE_PATH, + bashCompletionFromOptions: bashCompletionFromOptions, + bashCompletionSpecFromOptions: bashCompletionSpecFromOptions, + + // Export the parseFoo parsers because they might be useful as primitives + // for custom option types. + parseBool: parseBool, + parseString: parseString, + parseNumber: parseNumber, + parseInteger: parseInteger, + parsePositiveInteger: parsePositiveInteger, + parseDate: parseDate +}; diff --git a/tunestats/app/api/node_modules/dashdash/package.json b/tunestats/app/api/node_modules/dashdash/package.json new file mode 100644 index 0000000..a11e1f5 --- /dev/null +++ b/tunestats/app/api/node_modules/dashdash/package.json @@ -0,0 +1,26 @@ +{ + "name": "dashdash", + "description": "A light, featureful and explicit option parsing library.", + "version": "1.14.1", + "author": "Trent Mick (http://trentm.com)", + "keywords": ["option", "parser", "parsing", "cli", "command", "args", + "bash", "completion"], + "repository": { + "type": "git", + "url": "git://github.com/trentm/node-dashdash.git" + }, + "main": "./lib/dashdash.js", + "dependencies": { + "assert-plus": "^1.0.0" + }, + "devDependencies": { + "nodeunit": "0.9.x" + }, + "engines": { + "node": ">=0.10" + }, + "scripts": { + "test": "nodeunit test/*.test.js" + }, + "license": "MIT" +} diff --git a/tunestats/app/api/node_modules/debug/.coveralls.yml b/tunestats/app/api/node_modules/debug/.coveralls.yml new file mode 100644 index 0000000..20a7068 --- /dev/null +++ b/tunestats/app/api/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/tunestats/app/api/node_modules/debug/.eslintrc b/tunestats/app/api/node_modules/debug/.eslintrc new file mode 100644 index 0000000..8a37ae2 --- /dev/null +++ b/tunestats/app/api/node_modules/debug/.eslintrc @@ -0,0 +1,11 @@ +{ + "env": { + "browser": true, + "node": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/tunestats/app/api/node_modules/debug/.npmignore b/tunestats/app/api/node_modules/debug/.npmignore new file mode 100644 index 0000000..5f60eec --- /dev/null +++ b/tunestats/app/api/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/tunestats/app/api/node_modules/debug/.travis.yml b/tunestats/app/api/node_modules/debug/.travis.yml new file mode 100644 index 0000000..6c6090c --- /dev/null +++ b/tunestats/app/api/node_modules/debug/.travis.yml @@ -0,0 +1,14 @@ + +language: node_js +node_js: + - "6" + - "5" + - "4" + +install: + - make node_modules + +script: + - make lint + - make test + - make coveralls diff --git a/tunestats/app/api/node_modules/debug/CHANGELOG.md b/tunestats/app/api/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000..eadaa18 --- /dev/null +++ b/tunestats/app/api/node_modules/debug/CHANGELOG.md @@ -0,0 +1,362 @@ + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/tunestats/app/api/node_modules/debug/LICENSE b/tunestats/app/api/node_modules/debug/LICENSE new file mode 100644 index 0000000..658c933 --- /dev/null +++ b/tunestats/app/api/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/tunestats/app/api/node_modules/debug/Makefile b/tunestats/app/api/node_modules/debug/Makefile new file mode 100644 index 0000000..584da8b --- /dev/null +++ b/tunestats/app/api/node_modules/debug/Makefile @@ -0,0 +1,50 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +.FORCE: + +install: node_modules + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +lint: .FORCE + eslint browser.js debug.js index.js node.js + +test-node: .FORCE + istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + +test-browser: .FORCE + mkdir -p dist + + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + + karma start --single-run + rimraf dist + +test: .FORCE + concurrently \ + "make test-node" \ + "make test-browser" + +coveralls: + cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +.PHONY: all install clean distclean diff --git a/tunestats/app/api/node_modules/debug/README.md b/tunestats/app/api/node_modules/debug/README.md new file mode 100644 index 0000000..f67be6b --- /dev/null +++ b/tunestats/app/api/node_modules/debug/README.md @@ -0,0 +1,312 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny node.js debugging utility modelled after node core's debugging technique. + +**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)** + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + + ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) + + ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + + Note that PowerShell uses different syntax to set environment variables. + + ```cmd + $env:DEBUG = "*,-not_this" + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + + ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Environment Variables + + When running through Node.js, you can set a few environment variables that will + change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + + __Note:__ The environment variables beginning with `DEBUG_` end up being + converted into an Options object that gets used with `%o`/`%O` formatters. + See the Node.js documentation for + [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) + for the complete list. + +## Formatters + + + Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + +### Custom formatters + + You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + +## Browser support + You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), + or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), + if you don't want to build it yourself. + + Debug's enable state is currently persisted by `localStorage`. + Consider the situation shown below where you have `worker:a` and `worker:b`, + and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + + ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/debug/component.json b/tunestats/app/api/node_modules/debug/component.json new file mode 100644 index 0000000..9de2641 --- /dev/null +++ b/tunestats/app/api/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.9", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/tunestats/app/api/node_modules/debug/karma.conf.js b/tunestats/app/api/node_modules/debug/karma.conf.js new file mode 100644 index 0000000..103a82d --- /dev/null +++ b/tunestats/app/api/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/tunestats/app/api/node_modules/debug/node.js b/tunestats/app/api/node_modules/debug/node.js new file mode 100644 index 0000000..7fc36fe --- /dev/null +++ b/tunestats/app/api/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/tunestats/app/api/node_modules/debug/package.json b/tunestats/app/api/node_modules/debug/package.json new file mode 100644 index 0000000..dc787ba --- /dev/null +++ b/tunestats/app/api/node_modules/debug/package.json @@ -0,0 +1,49 @@ +{ + "name": "debug", + "version": "2.6.9", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "description": "small debugging utility", + "keywords": [ + "debug", + "log", + "debugger" + ], + "author": "TJ Holowaychuk ", + "contributors": [ + "Nathan Rajlich (http://n8.io)", + "Andrew Rhyne " + ], + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + }, + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "main": "./src/index.js", + "browser": "./src/browser.js", + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + } +} diff --git a/tunestats/app/api/node_modules/debug/src/browser.js b/tunestats/app/api/node_modules/debug/src/browser.js new file mode 100644 index 0000000..7106924 --- /dev/null +++ b/tunestats/app/api/node_modules/debug/src/browser.js @@ -0,0 +1,185 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/tunestats/app/api/node_modules/debug/src/debug.js b/tunestats/app/api/node_modules/debug/src/debug.js new file mode 100644 index 0000000..6a5e3fc --- /dev/null +++ b/tunestats/app/api/node_modules/debug/src/debug.js @@ -0,0 +1,202 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + return debug; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/tunestats/app/api/node_modules/debug/src/index.js b/tunestats/app/api/node_modules/debug/src/index.js new file mode 100644 index 0000000..e12cf4d --- /dev/null +++ b/tunestats/app/api/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/tunestats/app/api/node_modules/debug/src/inspector-log.js b/tunestats/app/api/node_modules/debug/src/inspector-log.js new file mode 100644 index 0000000..60ea6c0 --- /dev/null +++ b/tunestats/app/api/node_modules/debug/src/inspector-log.js @@ -0,0 +1,15 @@ +module.exports = inspectorLog; + +// black hole +const nullStream = new (require('stream').Writable)(); +nullStream._write = () => {}; + +/** + * Outputs a `console.log()` to the Node.js Inspector console *only*. + */ +function inspectorLog() { + const stdout = console._stdout; + console._stdout = nullStream; + console.log.apply(console, arguments); + console._stdout = stdout; +} diff --git a/tunestats/app/api/node_modules/debug/src/node.js b/tunestats/app/api/node_modules/debug/src/node.js new file mode 100644 index 0000000..b15109c --- /dev/null +++ b/tunestats/app/api/node_modules/debug/src/node.js @@ -0,0 +1,248 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; + +if (1 !== fd && 2 !== fd) { + util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')() +} + +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to `stream`. + */ + +function log() { + return stream.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/tunestats/app/api/node_modules/define-data-property/.eslintrc b/tunestats/app/api/node_modules/define-data-property/.eslintrc new file mode 100644 index 0000000..75443e8 --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/.eslintrc @@ -0,0 +1,24 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "complexity": 0, + "id-length": 0, + "new-cap": ["error", { + "capIsNewExceptions": [ + "GetIntrinsic", + ], + }], + }, + + "overrides": [ + { + "files": "test/**", + "rules": { + "max-lines-per-function": "off", + }, + }, + ], +} diff --git a/tunestats/app/api/node_modules/define-data-property/.github/FUNDING.yml b/tunestats/app/api/node_modules/define-data-property/.github/FUNDING.yml new file mode 100644 index 0000000..3e17725 --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: [ljharb] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: npm/define-data-property +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/tunestats/app/api/node_modules/define-data-property/.nycrc b/tunestats/app/api/node_modules/define-data-property/.nycrc new file mode 100644 index 0000000..1826526 --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/.nycrc @@ -0,0 +1,13 @@ +{ + "all": true, + "check-coverage": false, + "reporter": ["text-summary", "text", "html", "json"], + "lines": 86, + "statements": 85.93, + "functions": 82.43, + "branches": 76.06, + "exclude": [ + "coverage", + "test" + ] +} diff --git a/tunestats/app/api/node_modules/define-data-property/CHANGELOG.md b/tunestats/app/api/node_modules/define-data-property/CHANGELOG.md new file mode 100644 index 0000000..4eed75e --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/CHANGELOG.md @@ -0,0 +1,70 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [v1.1.4](https://github.com/ljharb/define-data-property/compare/v1.1.3...v1.1.4) - 2024-02-13 + +### Commits + +- [Refactor] use `es-define-property` [`90f2f4c`](https://github.com/ljharb/define-data-property/commit/90f2f4cc20298401e71c28e1e08888db12021453) +- [Dev Deps] update `@types/object.getownpropertydescriptors` [`cd929d9`](https://github.com/ljharb/define-data-property/commit/cd929d9a04f5f2fdcfa9d5be140940b91a083153) + +## [v1.1.3](https://github.com/ljharb/define-data-property/compare/v1.1.2...v1.1.3) - 2024-02-12 + +### Commits + +- [types] hand-write d.ts instead of emitting it [`0cbc988`](https://github.com/ljharb/define-data-property/commit/0cbc988203c105f2d97948327c7167ebd33bd318) +- [meta] simplify `exports` [`690781e`](https://github.com/ljharb/define-data-property/commit/690781eed28bbf2d6766237efda0ba6dd591609e) +- [Dev Deps] update `hasown`; clean up DT packages [`6cdfd1c`](https://github.com/ljharb/define-data-property/commit/6cdfd1cb2d91d791bfd18cda5d5cab232fd5d8fc) +- [actions] cleanup [`3142bc6`](https://github.com/ljharb/define-data-property/commit/3142bc6a4bc406a51f5b04f31e98562a27f35ffd) +- [meta] add `funding` [`8474423`](https://github.com/ljharb/define-data-property/commit/847442391a79779af3e0f1bf0b5bb923552b7804) +- [Deps] update `get-intrinsic` [`3e9be00`](https://github.com/ljharb/define-data-property/commit/3e9be00e07784ba34e7c77d8bc0fdbc832ad61de) + +## [v1.1.2](https://github.com/ljharb/define-data-property/compare/v1.1.1...v1.1.2) - 2024-02-05 + +### Commits + +- [Dev Deps] update @types packages, `object-inspect`, `tape`, `typescript` [`df41bf8`](https://github.com/ljharb/define-data-property/commit/df41bf84ca3456be6226055caab44e38e3a7fd2f) +- [Dev Deps] update DT packages, `aud`, `npmignore`, `tape`, typescript` [`fab0e4e`](https://github.com/ljharb/define-data-property/commit/fab0e4ec709ee02b79f42d6db3ee5f26e0a34b8a) +- [Dev Deps] use `hasown` instead of `has` [`aa51ef9`](https://github.com/ljharb/define-data-property/commit/aa51ef93f6403d49d9bb72a807bcdb6e418978c0) +- [Refactor] use `es-errors`, so things that only need those do not need `get-intrinsic` [`d89be50`](https://github.com/ljharb/define-data-property/commit/d89be50571175888d391238605122679f7e65ffc) +- [Deps] update `has-property-descriptors` [`7af887c`](https://github.com/ljharb/define-data-property/commit/7af887c9083b59b195b0079e04815cfed9fcee2b) +- [Deps] update `get-intrinsic` [`bb8728e`](https://github.com/ljharb/define-data-property/commit/bb8728ec42cd998505a7157ae24853a560c20646) + +## [v1.1.1](https://github.com/ljharb/define-data-property/compare/v1.1.0...v1.1.1) - 2023-10-12 + +### Commits + +- [Tests] fix tests in ES3 engines [`5c6920e`](https://github.com/ljharb/define-data-property/commit/5c6920edd1f52f675b02f417e539c28135b43f94) +- [Dev Deps] update `@types/es-value-fixtures`, `@types/for-each`, `@types/gopd`, `@types/has-property-descriptors`, `tape`, `typescript` [`7d82dfc`](https://github.com/ljharb/define-data-property/commit/7d82dfc20f778b4465bba06335dd53f6f431aea3) +- [Fix] IE 8 has a broken `Object.defineProperty` [`0672e1a`](https://github.com/ljharb/define-data-property/commit/0672e1af2a9fcc787e7c23b96dea60d290df5548) +- [meta] emit types on prepack [`73acb1f`](https://github.com/ljharb/define-data-property/commit/73acb1f903c21b314ec7156bf10f73c7910530c0) +- [Dev Deps] update `tape`, `typescript` [`9489a77`](https://github.com/ljharb/define-data-property/commit/9489a7738bf2ecf0ac71d5b78ec4ca6ad7ba0142) + +## [v1.1.0](https://github.com/ljharb/define-data-property/compare/v1.0.1...v1.1.0) - 2023-09-13 + +### Commits + +- [New] add `loose` arg [`155235a`](https://github.com/ljharb/define-data-property/commit/155235a4c4d7741f6de01cd87c99599a56654b72) +- [New] allow `null` to be passed for the non* args [`7d2fa5f`](https://github.com/ljharb/define-data-property/commit/7d2fa5f06be0392736c13b126f7cd38979f34792) + +## [v1.0.1](https://github.com/ljharb/define-data-property/compare/v1.0.0...v1.0.1) - 2023-09-12 + +### Commits + +- [meta] add TS types [`43d763c`](https://github.com/ljharb/define-data-property/commit/43d763c6c883f652de1c9c02ef6216ee507ffa69) +- [Dev Deps] update `@types/tape`, `typescript` [`f444985`](https://github.com/ljharb/define-data-property/commit/f444985811c36f3e6448a03ad2f9b7898917f4c7) +- [meta] add `safe-publish-latest`, [`172bb10`](https://github.com/ljharb/define-data-property/commit/172bb10890896ebb160e64398f6ee55760107bee) + +## v1.0.0 - 2023-09-12 + +### Commits + +- Initial implementation, tests, readme [`5b43d6b`](https://github.com/ljharb/define-data-property/commit/5b43d6b44e675a904810467a7d4e0adb7efc3196) +- Initial commit [`35e577a`](https://github.com/ljharb/define-data-property/commit/35e577a6ba59a98befa97776d70d90f3bea9009d) +- npm init [`82a0a04`](https://github.com/ljharb/define-data-property/commit/82a0a04a321ca7de220af02d41e2745e8a9962ed) +- Only apps should have lockfiles [`96df244`](https://github.com/ljharb/define-data-property/commit/96df244a3c6f426f9a2437be825d1c6f5dd7158e) +- [meta] use `npmignore` to autogenerate an npmignore file [`a87ff18`](https://github.com/ljharb/define-data-property/commit/a87ff18cb79e14c2eb5720486c4759fd9a189375) diff --git a/tunestats/app/api/node_modules/define-data-property/LICENSE b/tunestats/app/api/node_modules/define-data-property/LICENSE new file mode 100644 index 0000000..b4213ac --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2023 Jordan Harband + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/tunestats/app/api/node_modules/define-data-property/README.md b/tunestats/app/api/node_modules/define-data-property/README.md new file mode 100644 index 0000000..f2304da --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/README.md @@ -0,0 +1,67 @@ +# define-data-property [![Version Badge][npm-version-svg]][package-url] + +[![github actions][actions-image]][actions-url] +[![coverage][codecov-image]][codecov-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +[![npm badge][npm-badge-png]][package-url] + +Define a data property on an object. Will fall back to assignment in an engine without descriptors. + +The three `non*` argument can also be passed `null`, which will use the existing state if available. + +The `loose` argument will mean that if you attempt to set a non-normal data property, in an environment without descriptor support, it will fall back to normal assignment. + +## Usage + +```javascript +var defineDataProperty = require('define-data-property'); +var assert = require('assert'); + +var obj = {}; +defineDataProperty(obj, 'key', 'value'); +defineDataProperty( + obj, + 'key2', + 'value', + true, // nonEnumerable, optional + false, // nonWritable, optional + true, // nonConfigurable, optional + false // loose, optional +); + +assert.deepEqual( + Object.getOwnPropertyDescriptors(obj), + { + key: { + configurable: true, + enumerable: true, + value: 'value', + writable: true, + }, + key2: { + configurable: false, + enumerable: false, + value: 'value', + writable: true, + }, + } +); +``` + +[package-url]: https://npmjs.org/package/define-data-property +[npm-version-svg]: https://versionbadg.es/ljharb/define-data-property.svg +[deps-svg]: https://david-dm.org/ljharb/define-data-property.svg +[deps-url]: https://david-dm.org/ljharb/define-data-property +[dev-deps-svg]: https://david-dm.org/ljharb/define-data-property/dev-status.svg +[dev-deps-url]: https://david-dm.org/ljharb/define-data-property#info=devDependencies +[npm-badge-png]: https://nodei.co/npm/define-data-property.png?downloads=true&stars=true +[license-image]: https://img.shields.io/npm/l/define-data-property.svg +[license-url]: LICENSE +[downloads-image]: https://img.shields.io/npm/dm/define-data-property.svg +[downloads-url]: https://npm-stat.com/charts.html?package=define-data-property +[codecov-image]: https://codecov.io/gh/ljharb/define-data-property/branch/main/graphs/badge.svg +[codecov-url]: https://app.codecov.io/gh/ljharb/define-data-property/ +[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/define-data-property +[actions-url]: https://github.com/ljharb/define-data-property/actions diff --git a/tunestats/app/api/node_modules/define-data-property/index.d.ts b/tunestats/app/api/node_modules/define-data-property/index.d.ts new file mode 100644 index 0000000..b56a77d --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/index.d.ts @@ -0,0 +1,12 @@ + +declare function defineDataProperty( + obj: Record, + property: keyof typeof obj, + value: typeof obj[typeof property], + nonEnumerable?: boolean | null, + nonWritable?: boolean | null, + nonConfigurable?: boolean | null, + loose?: boolean +): void; + +export = defineDataProperty; \ No newline at end of file diff --git a/tunestats/app/api/node_modules/define-data-property/index.js b/tunestats/app/api/node_modules/define-data-property/index.js new file mode 100644 index 0000000..e1a38c0 --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/index.js @@ -0,0 +1,56 @@ +'use strict'; + +var $defineProperty = require('es-define-property'); + +var $SyntaxError = require('es-errors/syntax'); +var $TypeError = require('es-errors/type'); + +var gopd = require('gopd'); + +/** @type {import('.')} */ +module.exports = function defineDataProperty( + obj, + property, + value +) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new $TypeError('`obj` must be an object or a function`'); + } + if (typeof property !== 'string' && typeof property !== 'symbol') { + throw new $TypeError('`property` must be a string or a symbol`'); + } + if (arguments.length > 3 && typeof arguments[3] !== 'boolean' && arguments[3] !== null) { + throw new $TypeError('`nonEnumerable`, if provided, must be a boolean or null'); + } + if (arguments.length > 4 && typeof arguments[4] !== 'boolean' && arguments[4] !== null) { + throw new $TypeError('`nonWritable`, if provided, must be a boolean or null'); + } + if (arguments.length > 5 && typeof arguments[5] !== 'boolean' && arguments[5] !== null) { + throw new $TypeError('`nonConfigurable`, if provided, must be a boolean or null'); + } + if (arguments.length > 6 && typeof arguments[6] !== 'boolean') { + throw new $TypeError('`loose`, if provided, must be a boolean'); + } + + var nonEnumerable = arguments.length > 3 ? arguments[3] : null; + var nonWritable = arguments.length > 4 ? arguments[4] : null; + var nonConfigurable = arguments.length > 5 ? arguments[5] : null; + var loose = arguments.length > 6 ? arguments[6] : false; + + /* @type {false | TypedPropertyDescriptor} */ + var desc = !!gopd && gopd(obj, property); + + if ($defineProperty) { + $defineProperty(obj, property, { + configurable: nonConfigurable === null && desc ? desc.configurable : !nonConfigurable, + enumerable: nonEnumerable === null && desc ? desc.enumerable : !nonEnumerable, + value: value, + writable: nonWritable === null && desc ? desc.writable : !nonWritable + }); + } else if (loose || (!nonEnumerable && !nonWritable && !nonConfigurable)) { + // must fall back to [[Set]], and was not explicitly asked to make non-enumerable, non-writable, or non-configurable + obj[property] = value; // eslint-disable-line no-param-reassign + } else { + throw new $SyntaxError('This environment does not support defining a property as non-configurable, non-writable, or non-enumerable.'); + } +}; diff --git a/tunestats/app/api/node_modules/define-data-property/package.json b/tunestats/app/api/node_modules/define-data-property/package.json new file mode 100644 index 0000000..eec4097 --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/package.json @@ -0,0 +1,106 @@ +{ + "name": "define-data-property", + "version": "1.1.4", + "description": "Define a data property on an object. Will fall back to assignment in an engine without descriptors.", + "main": "index.js", + "types": "./index.d.ts", + "exports": { + ".": "./index.js", + "./package.json": "./package.json" + }, + "sideEffects": false, + "scripts": { + "prepack": "npmignore --auto --commentLines=autogenerated", + "prepublish": "not-in-publish || npm run prepublishOnly", + "prepublishOnly": "safe-publish-latest", + "tsc": "tsc -p .", + "prelint": "evalmd README.md", + "lint": "eslint --ext=js,mjs .", + "postlint": "npm run tsc", + "pretest": "npm run lint", + "tests-only": "nyc tape 'test/**/*.js'", + "test": "npm run tests-only", + "posttest": "aud --production", + "version": "auto-changelog && git add CHANGELOG.md", + "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\"" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/define-data-property.git" + }, + "keywords": [ + "define", + "data", + "property", + "object", + "accessor", + "javascript", + "ecmascript", + "enumerable", + "configurable", + "writable" + ], + "author": "Jordan Harband ", + "funding": { + "url": "https://github.com/sponsors/ljharb" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/ljharb/define-data-property/issues" + }, + "homepage": "https://github.com/ljharb/define-data-property#readme", + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "gopd": "^1.0.1" + }, + "devDependencies": { + "@ljharb/eslint-config": "^21.1.0", + "@types/call-bind": "^1.0.5", + "@types/define-properties": "^1.1.5", + "@types/es-value-fixtures": "^1.4.4", + "@types/for-each": "^0.3.3", + "@types/get-intrinsic": "^1.2.2", + "@types/gopd": "^1.0.3", + "@types/has-property-descriptors": "^1.0.3", + "@types/object-inspect": "^1.8.4", + "@types/object.getownpropertydescriptors": "^2.1.4", + "@types/tape": "^5.6.4", + "aud": "^2.0.4", + "auto-changelog": "^2.4.0", + "es-value-fixtures": "^1.4.2", + "eslint": "=8.8.0", + "evalmd": "^0.0.19", + "for-each": "^0.3.3", + "hasown": "^2.0.1", + "in-publish": "^2.0.1", + "npmignore": "^0.3.1", + "nyc": "^10.3.2", + "object-inspect": "^1.13.1", + "object.getownpropertydescriptors": "^2.1.7", + "reflect.ownkeys": "^1.1.4", + "safe-publish-latest": "^2.0.0", + "tape": "^5.7.4", + "typescript": "next" + }, + "engines": { + "node": ">= 0.4" + }, + "testling": { + "files": "test/index.js" + }, + "auto-changelog": { + "output": "CHANGELOG.md", + "template": "keepachangelog", + "unreleased": false, + "commitLimit": false, + "backfillLimit": false, + "hideCredit": true + }, + "publishConfig": { + "ignore": [ + ".github/workflows", + "types/reflect.ownkeys" + ] + } +} diff --git a/tunestats/app/api/node_modules/define-data-property/test/index.js b/tunestats/app/api/node_modules/define-data-property/test/index.js new file mode 100644 index 0000000..68204c6 --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/test/index.js @@ -0,0 +1,392 @@ +'use strict'; + +var test = require('tape'); +var v = require('es-value-fixtures'); +var forEach = require('for-each'); +var inspect = require('object-inspect'); +var hasOwn = require('hasown'); +var hasPropertyDescriptors = require('has-property-descriptors')(); +var getOwnPropertyDescriptors = require('object.getownpropertydescriptors'); +var ownKeys = require('reflect.ownkeys'); + +var defineDataProperty = require('../'); + +test('defineDataProperty', function (t) { + t.test('argument validation', function (st) { + forEach(v.primitives, function (nonObject) { + st['throws']( + // @ts-expect-error + function () { defineDataProperty(nonObject, 'key', 'value'); }, + TypeError, + 'throws on non-object input: ' + inspect(nonObject) + ); + }); + + forEach(v.nonPropertyKeys, function (nonPropertyKey) { + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, nonPropertyKey, 'value'); }, + TypeError, + 'throws on non-PropertyKey input: ' + inspect(nonPropertyKey) + ); + }); + + forEach(v.nonBooleans, function (nonBoolean) { + if (nonBoolean !== null) { + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, 'key', 'value', nonBoolean); }, + TypeError, + 'throws on non-boolean nonEnumerable: ' + inspect(nonBoolean) + ); + + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, 'key', 'value', false, nonBoolean); }, + TypeError, + 'throws on non-boolean nonWritable: ' + inspect(nonBoolean) + ); + + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, 'key', 'value', false, false, nonBoolean); }, + TypeError, + 'throws on non-boolean nonConfigurable: ' + inspect(nonBoolean) + ); + } + }); + + st.end(); + }); + + t.test('normal data property', function (st) { + /** @type {Record} */ + var obj = { existing: 'existing property' }; + st.ok(hasOwn(obj, 'existing'), 'has initial own property'); + st.equal(obj.existing, 'existing property', 'has expected initial value'); + + var res = defineDataProperty(obj, 'added', 'added property'); + st.equal(res, void undefined, 'returns `undefined`'); + st.ok(hasOwn(obj, 'added'), 'has expected own property'); + st.equal(obj.added, 'added property', 'has expected value'); + + defineDataProperty(obj, 'existing', 'new value'); + st.ok(hasOwn(obj, 'existing'), 'still has expected own property'); + st.equal(obj.existing, 'new value', 'has new expected value'); + + defineDataProperty(obj, 'explicit1', 'new value', false); + st.ok(hasOwn(obj, 'explicit1'), 'has expected own property (explicit enumerable)'); + st.equal(obj.explicit1, 'new value', 'has new expected value (explicit enumerable)'); + + defineDataProperty(obj, 'explicit2', 'new value', false, false); + st.ok(hasOwn(obj, 'explicit2'), 'has expected own property (explicit writable)'); + st.equal(obj.explicit2, 'new value', 'has new expected value (explicit writable)'); + + defineDataProperty(obj, 'explicit3', 'new value', false, false, false); + st.ok(hasOwn(obj, 'explicit3'), 'has expected own property (explicit configurable)'); + st.equal(obj.explicit3, 'new value', 'has new expected value (explicit configurable)'); + + st.end(); + }); + + t.test('loose mode', { skip: !hasPropertyDescriptors }, function (st) { + var obj = { existing: 'existing property' }; + + defineDataProperty(obj, 'added', 'added value 1', true, null, null, true); + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + added: { + configurable: true, + enumerable: !hasPropertyDescriptors, + value: 'added value 1', + writable: true + } + }, + 'in loose mode, obj still adds property 1' + ); + + defineDataProperty(obj, 'added', 'added value 2', false, true, null, true); + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + added: { + configurable: true, + enumerable: true, + value: 'added value 2', + writable: !hasPropertyDescriptors + } + }, + 'in loose mode, obj still adds property 2' + ); + + defineDataProperty(obj, 'added', 'added value 3', false, false, true, true); + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + added: { + configurable: !hasPropertyDescriptors, + enumerable: true, + value: 'added value 3', + writable: true + } + }, + 'in loose mode, obj still adds property 3' + ); + + st.end(); + }); + + t.test('non-normal data property, ES3', { skip: hasPropertyDescriptors }, function (st) { + /** @type {Record} */ + var obj = { existing: 'existing property' }; + + st['throws']( + function () { defineDataProperty(obj, 'added', 'added value', true); }, + SyntaxError, + 'nonEnumerable throws a Syntax Error' + ); + + st['throws']( + function () { defineDataProperty(obj, 'added', 'added value', false, true); }, + SyntaxError, + 'nonWritable throws a Syntax Error' + ); + + st['throws']( + function () { defineDataProperty(obj, 'added', 'added value', false, false, true); }, + SyntaxError, + 'nonWritable throws a Syntax Error' + ); + + st.deepEqual( + ownKeys(obj), + ['existing'], + 'obj still has expected keys' + ); + st.equal(obj.existing, 'existing property', 'obj still has expected values'); + + st.end(); + }); + + t.test('new non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + /** @type {Record} */ + var obj = { existing: 'existing property' }; + + defineDataProperty(obj, 'nonEnum', null, true); + defineDataProperty(obj, 'nonWrit', null, false, true); + defineDataProperty(obj, 'nonConf', null, false, false, true); + + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + nonEnum: { + configurable: true, + enumerable: false, + value: null, + writable: true + }, + nonWrit: { + configurable: true, + enumerable: true, + value: null, + writable: false + }, + nonConf: { + configurable: false, + enumerable: true, + value: null, + writable: true + } + }, + 'obj has expected property descriptors' + ); + + st.end(); + }); + + t.test('existing non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + // test case changing an existing non-normal property + + /** @type {Record} */ + var obj = {}; + Object.defineProperty(obj, 'nonEnum', { configurable: true, enumerable: false, value: null, writable: true }); + Object.defineProperty(obj, 'nonWrit', { configurable: true, enumerable: true, value: null, writable: false }); + Object.defineProperty(obj, 'nonConf', { configurable: false, enumerable: true, value: null, writable: true }); + + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + nonEnum: { + configurable: true, + enumerable: false, + value: null, + writable: true + }, + nonWrit: { + configurable: true, + enumerable: true, + value: null, + writable: false + }, + nonConf: { + configurable: false, + enumerable: true, + value: null, + writable: true + } + }, + 'obj initially has expected property descriptors' + ); + + defineDataProperty(obj, 'nonEnum', 'new value', false); + defineDataProperty(obj, 'nonWrit', 'new value', false, false); + st['throws']( + function () { defineDataProperty(obj, 'nonConf', 'new value', false, false, false); }, + TypeError, + 'can not alter a nonconfigurable property' + ); + + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + nonEnum: { + configurable: true, + enumerable: true, + value: 'new value', + writable: true + }, + nonWrit: { + configurable: true, + enumerable: true, + value: 'new value', + writable: true + }, + nonConf: { + configurable: false, + enumerable: true, + value: null, + writable: true + } + }, + 'obj ends up with expected property descriptors' + ); + + st.end(); + }); + + t.test('frozen object, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + var frozen = Object.freeze({ existing: true }); + + st['throws']( + function () { defineDataProperty(frozen, 'existing', 'new value'); }, + TypeError, + 'frozen object can not modify an existing property' + ); + + st['throws']( + function () { defineDataProperty(frozen, 'new', 'new property'); }, + TypeError, + 'frozen object can not add a new property' + ); + + st.end(); + }); + + t.test('sealed object, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + var sealed = Object.seal({ existing: true }); + st.deepEqual( + Object.getOwnPropertyDescriptor(sealed, 'existing'), + { + configurable: false, + enumerable: true, + value: true, + writable: true + }, + 'existing value on sealed object has expected descriptor' + ); + + defineDataProperty(sealed, 'existing', 'new value'); + + st.deepEqual( + Object.getOwnPropertyDescriptor(sealed, 'existing'), + { + configurable: false, + enumerable: true, + value: 'new value', + writable: true + }, + 'existing value on sealed object has changed descriptor' + ); + + st['throws']( + function () { defineDataProperty(sealed, 'new', 'new property'); }, + TypeError, + 'sealed object can not add a new property' + ); + + st.end(); + }); + + t.test('nonextensible object, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + var nonExt = Object.preventExtensions({ existing: true }); + + st.deepEqual( + Object.getOwnPropertyDescriptor(nonExt, 'existing'), + { + configurable: true, + enumerable: true, + value: true, + writable: true + }, + 'existing value on non-extensible object has expected descriptor' + ); + + defineDataProperty(nonExt, 'existing', 'new value', true); + + st.deepEqual( + Object.getOwnPropertyDescriptor(nonExt, 'existing'), + { + configurable: true, + enumerable: false, + value: 'new value', + writable: true + }, + 'existing value on non-extensible object has changed descriptor' + ); + + st['throws']( + function () { defineDataProperty(nonExt, 'new', 'new property'); }, + TypeError, + 'non-extensible object can not add a new property' + ); + + st.end(); + }); + + t.end(); +}); diff --git a/tunestats/app/api/node_modules/define-data-property/tsconfig.json b/tunestats/app/api/node_modules/define-data-property/tsconfig.json new file mode 100644 index 0000000..69f060d --- /dev/null +++ b/tunestats/app/api/node_modules/define-data-property/tsconfig.json @@ -0,0 +1,59 @@ +{ + "compilerOptions": { + /* Visit https://aka.ms/tsconfig to read more about this file */ + + /* Projects */ + + /* Language and Environment */ + "target": "es2022", /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */ + // "lib": [], /* Specify a set of bundled library declaration files that describe the target runtime environment. */ + // "noLib": true, /* Disable including any library files, including the default lib.d.ts. */ + "useDefineForClassFields": true, /* Emit ECMAScript-standard-compliant class fields. */ + // "moduleDetection": "auto", /* Control what method is used to detect module-format JS files. */ + + /* Modules */ + "module": "commonjs", /* Specify what module code is generated. */ + // "rootDir": "./", /* Specify the root folder within your source files. */ + // "moduleResolution": "node10", /* Specify how TypeScript looks up a file from a given module specifier. */ + // "baseUrl": "./", /* Specify the base directory to resolve non-relative module names. */ + // "paths": {}, /* Specify a set of entries that re-map imports to additional lookup locations. */ + // "rootDirs": [], /* Allow multiple folders to be treated as one when resolving modules. */ + "typeRoots": ["types"], /* Specify multiple folders that act like './node_modules/@types'. */ + "resolveJsonModule": true, /* Enable importing .json files. */ + + /* JavaScript Support */ + "allowJs": true, /* Allow JavaScript files to be a part of your program. Use the 'checkJS' option to get errors from these files. */ + "checkJs": true, /* Enable error reporting in type-checked JavaScript files. */ + "maxNodeModuleJsDepth": 1, /* Specify the maximum folder depth used for checking JavaScript files from 'node_modules'. Only applicable with 'allowJs'. */ + + /* Emit */ + "declaration": true, /* Generate .d.ts files from TypeScript and JavaScript files in your project. */ + "declarationMap": true, /* Create sourcemaps for d.ts files. */ + // "emitDeclarationOnly": true, /* Only output d.ts files and not JavaScript files. */ + "noEmit": true, /* Disable emitting files from a compilation. */ + + /* Interop Constraints */ + "allowSyntheticDefaultImports": true, /* Allow 'import x from y' when a module doesn't have a default export. */ + "esModuleInterop": true, /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables 'allowSyntheticDefaultImports' for type compatibility. */ + "forceConsistentCasingInFileNames": true, /* Ensure that casing is correct in imports. */ + + /* Type Checking */ + "strict": true, /* Enable all strict type-checking options. */ + "noImplicitAny": true, /* Enable error reporting for expressions and declarations with an implied 'any' type. */ + "noImplicitThis": true, /* Enable error reporting when 'this' is given the type 'any'. */ + "useUnknownInCatchVariables": true, /* Default catch clause variables as 'unknown' instead of 'any'. */ + "noUnusedLocals": true, /* Enable error reporting when local variables aren't read. */ + "noUnusedParameters": true, /* Raise an error when a function parameter isn't read. */ + "noImplicitReturns": true, /* Enable error reporting for codepaths that do not explicitly return in a function. */ + "noFallthroughCasesInSwitch": true, /* Enable error reporting for fallthrough cases in switch statements. */ + "noUncheckedIndexedAccess": true, /* Add 'undefined' to a type when accessed using an index. */ + "noImplicitOverride": true, /* Ensure overriding members in derived classes are marked with an override modifier. */ + // "noPropertyAccessFromIndexSignature": true, /* Enforces using indexed accessors for keys declared using an indexed type. */ + + /* Completeness */ + // "skipLibCheck": true /* Skip type checking all .d.ts files. */ + }, + "exclude": [ + "coverage" + ] +} diff --git a/tunestats/app/api/node_modules/delayed-stream/.npmignore b/tunestats/app/api/node_modules/delayed-stream/.npmignore new file mode 100644 index 0000000..9daeafb --- /dev/null +++ b/tunestats/app/api/node_modules/delayed-stream/.npmignore @@ -0,0 +1 @@ +test diff --git a/tunestats/app/api/node_modules/delayed-stream/License b/tunestats/app/api/node_modules/delayed-stream/License new file mode 100644 index 0000000..4804b7a --- /dev/null +++ b/tunestats/app/api/node_modules/delayed-stream/License @@ -0,0 +1,19 @@ +Copyright (c) 2011 Debuggable Limited + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/delayed-stream/Makefile b/tunestats/app/api/node_modules/delayed-stream/Makefile new file mode 100644 index 0000000..b4ff85a --- /dev/null +++ b/tunestats/app/api/node_modules/delayed-stream/Makefile @@ -0,0 +1,7 @@ +SHELL := /bin/bash + +test: + @./test/run.js + +.PHONY: test + diff --git a/tunestats/app/api/node_modules/delayed-stream/Readme.md b/tunestats/app/api/node_modules/delayed-stream/Readme.md new file mode 100644 index 0000000..aca36f9 --- /dev/null +++ b/tunestats/app/api/node_modules/delayed-stream/Readme.md @@ -0,0 +1,141 @@ +# delayed-stream + +Buffers events from a stream until you are ready to handle them. + +## Installation + +``` bash +npm install delayed-stream +``` + +## Usage + +The following example shows how to write a http echo server that delays its +response by 1000 ms. + +``` javascript +var DelayedStream = require('delayed-stream'); +var http = require('http'); + +http.createServer(function(req, res) { + var delayed = DelayedStream.create(req); + + setTimeout(function() { + res.writeHead(200); + delayed.pipe(res); + }, 1000); +}); +``` + +If you are not using `Stream#pipe`, you can also manually release the buffered +events by calling `delayedStream.resume()`: + +``` javascript +var delayed = DelayedStream.create(req); + +setTimeout(function() { + // Emit all buffered events and resume underlaying source + delayed.resume(); +}, 1000); +``` + +## Implementation + +In order to use this meta stream properly, here are a few things you should +know about the implementation. + +### Event Buffering / Proxying + +All events of the `source` stream are hijacked by overwriting the `source.emit` +method. Until node implements a catch-all event listener, this is the only way. + +However, delayed-stream still continues to emit all events it captures on the +`source`, regardless of whether you have released the delayed stream yet or +not. + +Upon creation, delayed-stream captures all `source` events and stores them in +an internal event buffer. Once `delayedStream.release()` is called, all +buffered events are emitted on the `delayedStream`, and the event buffer is +cleared. After that, delayed-stream merely acts as a proxy for the underlaying +source. + +### Error handling + +Error events on `source` are buffered / proxied just like any other events. +However, `delayedStream.create` attaches a no-op `'error'` listener to the +`source`. This way you only have to handle errors on the `delayedStream` +object, rather than in two places. + +### Buffer limits + +delayed-stream provides a `maxDataSize` property that can be used to limit +the amount of data being buffered. In order to protect you from bad `source` +streams that don't react to `source.pause()`, this feature is enabled by +default. + +## API + +### DelayedStream.create(source, [options]) + +Returns a new `delayedStream`. Available options are: + +* `pauseStream` +* `maxDataSize` + +The description for those properties can be found below. + +### delayedStream.source + +The `source` stream managed by this object. This is useful if you are +passing your `delayedStream` around, and you still want to access properties +on the `source` object. + +### delayedStream.pauseStream = true + +Whether to pause the underlaying `source` when calling +`DelayedStream.create()`. Modifying this property afterwards has no effect. + +### delayedStream.maxDataSize = 1024 * 1024 + +The amount of data to buffer before emitting an `error`. + +If the underlaying source is emitting `Buffer` objects, the `maxDataSize` +refers to bytes. + +If the underlaying source is emitting JavaScript strings, the size refers to +characters. + +If you know what you are doing, you can set this property to `Infinity` to +disable this feature. You can also modify this property during runtime. + +### delayedStream.dataSize = 0 + +The amount of data buffered so far. + +### delayedStream.readable + +An ECMA5 getter that returns the value of `source.readable`. + +### delayedStream.resume() + +If the `delayedStream` has not been released so far, `delayedStream.release()` +is called. + +In either case, `source.resume()` is called. + +### delayedStream.pause() + +Calls `source.pause()`. + +### delayedStream.pipe(dest) + +Calls `delayedStream.resume()` and then proxies the arguments to `source.pipe`. + +### delayedStream.release() + +Emits and clears all events that have been buffered up so far. This does not +resume the underlaying source, use `delayedStream.resume()` instead. + +## License + +delayed-stream is licensed under the MIT license. diff --git a/tunestats/app/api/node_modules/delayed-stream/lib/delayed_stream.js b/tunestats/app/api/node_modules/delayed-stream/lib/delayed_stream.js new file mode 100644 index 0000000..b38fc85 --- /dev/null +++ b/tunestats/app/api/node_modules/delayed-stream/lib/delayed_stream.js @@ -0,0 +1,107 @@ +var Stream = require('stream').Stream; +var util = require('util'); + +module.exports = DelayedStream; +function DelayedStream() { + this.source = null; + this.dataSize = 0; + this.maxDataSize = 1024 * 1024; + this.pauseStream = true; + + this._maxDataSizeExceeded = false; + this._released = false; + this._bufferedEvents = []; +} +util.inherits(DelayedStream, Stream); + +DelayedStream.create = function(source, options) { + var delayedStream = new this(); + + options = options || {}; + for (var option in options) { + delayedStream[option] = options[option]; + } + + delayedStream.source = source; + + var realEmit = source.emit; + source.emit = function() { + delayedStream._handleEmit(arguments); + return realEmit.apply(source, arguments); + }; + + source.on('error', function() {}); + if (delayedStream.pauseStream) { + source.pause(); + } + + return delayedStream; +}; + +Object.defineProperty(DelayedStream.prototype, 'readable', { + configurable: true, + enumerable: true, + get: function() { + return this.source.readable; + } +}); + +DelayedStream.prototype.setEncoding = function() { + return this.source.setEncoding.apply(this.source, arguments); +}; + +DelayedStream.prototype.resume = function() { + if (!this._released) { + this.release(); + } + + this.source.resume(); +}; + +DelayedStream.prototype.pause = function() { + this.source.pause(); +}; + +DelayedStream.prototype.release = function() { + this._released = true; + + this._bufferedEvents.forEach(function(args) { + this.emit.apply(this, args); + }.bind(this)); + this._bufferedEvents = []; +}; + +DelayedStream.prototype.pipe = function() { + var r = Stream.prototype.pipe.apply(this, arguments); + this.resume(); + return r; +}; + +DelayedStream.prototype._handleEmit = function(args) { + if (this._released) { + this.emit.apply(this, args); + return; + } + + if (args[0] === 'data') { + this.dataSize += args[1].length; + this._checkIfMaxDataSizeExceeded(); + } + + this._bufferedEvents.push(args); +}; + +DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() { + if (this._maxDataSizeExceeded) { + return; + } + + if (this.dataSize <= this.maxDataSize) { + return; + } + + this._maxDataSizeExceeded = true; + var message = + 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.' + this.emit('error', new Error(message)); +}; diff --git a/tunestats/app/api/node_modules/delayed-stream/package.json b/tunestats/app/api/node_modules/delayed-stream/package.json new file mode 100644 index 0000000..eea3291 --- /dev/null +++ b/tunestats/app/api/node_modules/delayed-stream/package.json @@ -0,0 +1,27 @@ +{ + "author": "Felix Geisendörfer (http://debuggable.com/)", + "contributors": [ + "Mike Atkins " + ], + "name": "delayed-stream", + "description": "Buffers events from a stream until you are ready to handle them.", + "license": "MIT", + "version": "1.0.0", + "homepage": "https://github.com/felixge/node-delayed-stream", + "repository": { + "type": "git", + "url": "git://github.com/felixge/node-delayed-stream.git" + }, + "main": "./lib/delayed_stream", + "engines": { + "node": ">=0.4.0" + }, + "scripts": { + "test": "make test" + }, + "dependencies": {}, + "devDependencies": { + "fake": "0.2.0", + "far": "0.0.1" + } +} diff --git a/tunestats/app/api/node_modules/depd/History.md b/tunestats/app/api/node_modules/depd/History.md new file mode 100644 index 0000000..cd9ebaa --- /dev/null +++ b/tunestats/app/api/node_modules/depd/History.md @@ -0,0 +1,103 @@ +2.0.0 / 2018-10-26 +================== + + * Drop support for Node.js 0.6 + * Replace internal `eval` usage with `Function` constructor + * Use instance methods on `process` to check for listeners + +1.1.2 / 2018-01-11 +================== + + * perf: remove argument reassignment + * Support Node.js 0.6 to 9.x + +1.1.1 / 2017-07-27 +================== + + * Remove unnecessary `Buffer` loading + * Support Node.js 0.6 to 8.x + +1.1.0 / 2015-09-14 +================== + + * Enable strict mode in more places + * Support io.js 3.x + * Support io.js 2.x + * Support web browser loading + - Requires bundler like Browserify or webpack + +1.0.1 / 2015-04-07 +================== + + * Fix `TypeError`s when under `'use strict'` code + * Fix useless type name on auto-generated messages + * Support io.js 1.x + * Support Node.js 0.12 + +1.0.0 / 2014-09-17 +================== + + * No changes + +0.4.5 / 2014-09-09 +================== + + * Improve call speed to functions using the function wrapper + * Support Node.js 0.6 + +0.4.4 / 2014-07-27 +================== + + * Work-around v8 generating empty stack traces + +0.4.3 / 2014-07-26 +================== + + * Fix exception when global `Error.stackTraceLimit` is too low + +0.4.2 / 2014-07-19 +================== + + * Correct call site for wrapped functions and properties + +0.4.1 / 2014-07-19 +================== + + * Improve automatic message generation for function properties + +0.4.0 / 2014-07-19 +================== + + * Add `TRACE_DEPRECATION` environment variable + * Remove non-standard grey color from color output + * Support `--no-deprecation` argument + * Support `--trace-deprecation` argument + * Support `deprecate.property(fn, prop, message)` + +0.3.0 / 2014-06-16 +================== + + * Add `NO_DEPRECATION` environment variable + +0.2.0 / 2014-06-15 +================== + + * Add `deprecate.property(obj, prop, message)` + * Remove `supports-color` dependency for node.js 0.8 + +0.1.0 / 2014-06-15 +================== + + * Add `deprecate.function(fn, message)` + * Add `process.on('deprecation', fn)` emitter + * Automatically generate message when omitted from `deprecate()` + +0.0.1 / 2014-06-15 +================== + + * Fix warning for dynamic calls at singe call site + +0.0.0 / 2014-06-15 +================== + + * Initial implementation diff --git a/tunestats/app/api/node_modules/depd/LICENSE b/tunestats/app/api/node_modules/depd/LICENSE new file mode 100644 index 0000000..248de7a --- /dev/null +++ b/tunestats/app/api/node_modules/depd/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2018 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/depd/Readme.md b/tunestats/app/api/node_modules/depd/Readme.md new file mode 100644 index 0000000..043d1ca --- /dev/null +++ b/tunestats/app/api/node_modules/depd/Readme.md @@ -0,0 +1,280 @@ +# depd + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Deprecate all the things + +> With great modules comes great responsibility; mark things deprecated! + +## Install + +This module is installed directly using `npm`: + +```sh +$ npm install depd +``` + +This module can also be bundled with systems like +[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/), +though by default this module will alter it's API to no longer display or +track deprecations. + +## API + + + +```js +var deprecate = require('depd')('my-module') +``` + +This library allows you to display deprecation messages to your users. +This library goes above and beyond with deprecation warnings by +introspection of the call stack (but only the bits that it is interested +in). + +Instead of just warning on the first invocation of a deprecated +function and never again, this module will warn on the first invocation +of a deprecated function per unique call site, making it ideal to alert +users of all deprecated uses across the code base, rather than just +whatever happens to execute first. + +The deprecation warnings from this module also include the file and line +information for the call into the module that the deprecated function was +in. + +**NOTE** this library has a similar interface to the `debug` module, and +this module uses the calling file to get the boundary for the call stacks, +so you should always create a new `deprecate` object in each file and not +within some central file. + +### depd(namespace) + +Create a new deprecate function that uses the given namespace name in the +messages and will display the call site prior to the stack entering the +file this function was called from. It is highly suggested you use the +name of your module as the namespace. + +### deprecate(message) + +Call this function from deprecated code to display a deprecation message. +This message will appear once per unique caller site. Caller site is the +first call site in the stack in a different file from the caller of this +function. + +If the message is omitted, a message is generated for you based on the site +of the `deprecate()` call and will display the name of the function called, +similar to the name displayed in a stack trace. + +### deprecate.function(fn, message) + +Call this function to wrap a given function in a deprecation message on any +call to the function. An optional message can be supplied to provide a custom +message. + +### deprecate.property(obj, prop, message) + +Call this function to wrap a given property on object in a deprecation message +on any accessing or setting of the property. An optional message can be supplied +to provide a custom message. + +The method must be called on the object where the property belongs (not +inherited from the prototype). + +If the property is a data descriptor, it will be converted to an accessor +descriptor in order to display the deprecation message. + +### process.on('deprecation', fn) + +This module will allow easy capturing of deprecation errors by emitting the +errors as the type "deprecation" on the global `process`. If there are no +listeners for this type, the errors are written to STDERR as normal, but if +there are any listeners, nothing will be written to STDERR and instead only +emitted. From there, you can write the errors in a different format or to a +logging source. + +The error represents the deprecation and is emitted only once with the same +rules as writing to STDERR. The error has the following properties: + + - `message` - This is the message given by the library + - `name` - This is always `'DeprecationError'` + - `namespace` - This is the namespace the deprecation came from + - `stack` - This is the stack of the call to the deprecated thing + +Example `error.stack` output: + +``` +DeprecationError: my-cool-module deprecated oldfunction + at Object. ([eval]-wrapper:6:22) + at Module._compile (module.js:456:26) + at evalScript (node.js:532:25) + at startup (node.js:80:7) + at node.js:902:3 +``` + +### process.env.NO_DEPRECATION + +As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` +is provided as a quick solution to silencing deprecation warnings from being +output. The format of this is similar to that of `DEBUG`: + +```sh +$ NO_DEPRECATION=my-module,othermod node app.js +``` + +This will suppress deprecations from being output for "my-module" and "othermod". +The value is a list of comma-separated namespaces. To suppress every warning +across all namespaces, use the value `*` for a namespace. + +Providing the argument `--no-deprecation` to the `node` executable will suppress +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not suppress the deperecations given to any "deprecation" +event listeners, just the output to STDERR. + +### process.env.TRACE_DEPRECATION + +As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` +is provided as a solution to getting more detailed location information in deprecation +warnings by including the entire stack trace. The format of this is the same as +`NO_DEPRECATION`: + +```sh +$ TRACE_DEPRECATION=my-module,othermod node app.js +``` + +This will include stack traces for deprecations being output for "my-module" and +"othermod". The value is a list of comma-separated namespaces. To trace every +warning across all namespaces, use the value `*` for a namespace. + +Providing the argument `--trace-deprecation` to the `node` executable will trace +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. + +## Display + +![message](files/message.png) + +When a user calls a function in your library that you mark deprecated, they +will see the following written to STDERR (in the given colors, similar colors +and layout to the `debug` module): + +``` +bright cyan bright yellow +| | reset cyan +| | | | +▼ ▼ ▼ ▼ +my-cool-module deprecated oldfunction [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ +| | | | +namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +If the user redirects their STDERR to a file or somewhere that does not support +colors, they see (similar layout to the `debug` module): + +``` +Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ ▲ +| | | | | +timestamp of message namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +## Examples + +### Deprecating all calls to a function + +This will display a deprecated message about "oldfunction" being deprecated +from "my-module" on STDERR. + +```js +var deprecate = require('depd')('my-cool-module') + +// message automatically derived from function name +// Object.oldfunction +exports.oldfunction = deprecate.function(function oldfunction () { + // all calls to function are deprecated +}) + +// specific message +exports.oldfunction = deprecate.function(function () { + // all calls to function are deprecated +}, 'oldfunction') +``` + +### Conditionally deprecating a function call + +This will display a deprecated message about "weirdfunction" being deprecated +from "my-module" on STDERR when called with less than 2 arguments. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } +} +``` + +When calling `deprecate` as a function, the warning is counted per call site +within your own module, so you can display different deprecations depending +on different situations and the users will still get all the warnings: + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } else if (typeof arguments[0] !== 'string') { + // calls with non-string first argument are deprecated + deprecate('weirdfunction non-string first arg') + } +} +``` + +### Deprecating property access + +This will display a deprecated message about "oldprop" being deprecated +from "my-module" on STDERR when accessed. A deprecation will be displayed +when setting the value and when getting the value. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.oldprop = 'something' + +// message automatically derives from property name +deprecate.property(exports, 'oldprop') + +// explicit message +deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') +``` + +## License + +[MIT](LICENSE) + +[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/nodejs-depd/master?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd +[coveralls-image]: https://badgen.net/coveralls/c/github/dougwilson/nodejs-depd/master +[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master +[node-image]: https://badgen.net/npm/node/depd +[node-url]: https://nodejs.org/en/download/ +[npm-downloads-image]: https://badgen.net/npm/dm/depd +[npm-url]: https://npmjs.org/package/depd +[npm-version-image]: https://badgen.net/npm/v/depd +[travis-image]: https://badgen.net/travis/dougwilson/nodejs-depd/master?label=linux +[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd diff --git a/tunestats/app/api/node_modules/depd/index.js b/tunestats/app/api/node_modules/depd/index.js new file mode 100644 index 0000000..1bf2fcf --- /dev/null +++ b/tunestats/app/api/node_modules/depd/index.js @@ -0,0 +1,538 @@ +/*! + * depd + * Copyright(c) 2014-2018 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var relative = require('path').relative + +/** + * Module exports. + */ + +module.exports = depd + +/** + * Get the path to base files on. + */ + +var basePath = process.cwd() + +/** + * Determine if namespace is contained in the string. + */ + +function containsNamespace (str, namespace) { + var vals = str.split(/[ ,]+/) + var ns = String(namespace).toLowerCase() + + for (var i = 0; i < vals.length; i++) { + var val = vals[i] + + // namespace contained + if (val && (val === '*' || val.toLowerCase() === ns)) { + return true + } + } + + return false +} + +/** + * Convert a data descriptor to accessor descriptor. + */ + +function convertDataDescriptorToAccessor (obj, prop, message) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + var value = descriptor.value + + descriptor.get = function getter () { return value } + + if (descriptor.writable) { + descriptor.set = function setter (val) { return (value = val) } + } + + delete descriptor.value + delete descriptor.writable + + Object.defineProperty(obj, prop, descriptor) + + return descriptor +} + +/** + * Create arguments string to keep arity. + */ + +function createArgumentsString (arity) { + var str = '' + + for (var i = 0; i < arity; i++) { + str += ', arg' + i + } + + return str.substr(2) +} + +/** + * Create stack string from stack. + */ + +function createStackString (stack) { + var str = this.name + ': ' + this.namespace + + if (this.message) { + str += ' deprecated ' + this.message + } + + for (var i = 0; i < stack.length; i++) { + str += '\n at ' + stack[i].toString() + } + + return str +} + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + var stack = getStack() + var site = callSiteLocation(stack[1]) + var file = site[0] + + function deprecate (message) { + // call to self as log + log.call(deprecate, message) + } + + deprecate._file = file + deprecate._ignored = isignored(namespace) + deprecate._namespace = namespace + deprecate._traced = istraced(namespace) + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Determine if event emitter has listeners of a given type. + * + * The way to do this check is done three different ways in Node.js >= 0.8 + * so this consolidates them into a minimal set using instance methods. + * + * @param {EventEmitter} emitter + * @param {string} type + * @returns {boolean} + * @private + */ + +function eehaslisteners (emitter, type) { + var count = typeof emitter.listenerCount !== 'function' + ? emitter.listeners(type).length + : emitter.listenerCount(type) + + return count > 0 +} + +/** + * Determine if namespace is ignored. + */ + +function isignored (namespace) { + if (process.noDeprecation) { + // --no-deprecation support + return true + } + + var str = process.env.NO_DEPRECATION || '' + + // namespace ignored + return containsNamespace(str, namespace) +} + +/** + * Determine if namespace is traced. + */ + +function istraced (namespace) { + if (process.traceDeprecation) { + // --trace-deprecation support + return true + } + + var str = process.env.TRACE_DEPRECATION || '' + + // namespace traced + return containsNamespace(str, namespace) +} + +/** + * Display deprecation message. + */ + +function log (message, site) { + var haslisteners = eehaslisteners(process, 'deprecation') + + // abort early if no destination + if (!haslisteners && this._ignored) { + return + } + + var caller + var callFile + var callSite + var depSite + var i = 0 + var seen = false + var stack = getStack() + var file = this._file + + if (site) { + // provided site + depSite = site + callSite = callSiteLocation(stack[1]) + callSite.name = depSite.name + file = callSite[0] + } else { + // get call site + i = 2 + depSite = callSiteLocation(stack[i]) + callSite = depSite + } + + // get caller of deprecated thing in relation to file + for (; i < stack.length; i++) { + caller = callSiteLocation(stack[i]) + callFile = caller[0] + + if (callFile === file) { + seen = true + } else if (callFile === this._file) { + file = this._file + } else if (seen) { + break + } + } + + var key = caller + ? depSite.join(':') + '__' + caller.join(':') + : undefined + + if (key !== undefined && key in this._warned) { + // already warned + return + } + + this._warned[key] = true + + // generate automatic message from call site + var msg = message + if (!msg) { + msg = callSite === depSite || !callSite.name + ? defaultMessage(depSite) + : defaultMessage(callSite) + } + + // emit deprecation if listeners exist + if (haslisteners) { + var err = DeprecationError(this._namespace, msg, stack.slice(i)) + process.emit('deprecation', err) + return + } + + // format and write message + var format = process.stderr.isTTY + ? formatColor + : formatPlain + var output = format.call(this, msg, caller, stack.slice(i)) + process.stderr.write(output + '\n', 'utf8') +} + +/** + * Get call site location as array. + */ + +function callSiteLocation (callSite) { + var file = callSite.getFileName() || '' + var line = callSite.getLineNumber() + var colm = callSite.getColumnNumber() + + if (callSite.isEval()) { + file = callSite.getEvalOrigin() + ', ' + file + } + + var site = [file, line, colm] + + site.callSite = callSite + site.name = callSite.getFunctionName() + + return site +} + +/** + * Generate a default message from the site. + */ + +function defaultMessage (site) { + var callSite = site.callSite + var funcName = site.name + + // make useful anonymous name + if (!funcName) { + funcName = '' + } + + var context = callSite.getThis() + var typeName = context && callSite.getTypeName() + + // ignore useless type name + if (typeName === 'Object') { + typeName = undefined + } + + // make useful type name + if (typeName === 'Function') { + typeName = context.name || typeName + } + + return typeName && callSite.getMethodName() + ? typeName + '.' + funcName + : funcName +} + +/** + * Format deprecation message without color. + */ + +function formatPlain (msg, caller, stack) { + var timestamp = new Date().toUTCString() + + var formatted = timestamp + + ' ' + this._namespace + + ' deprecated ' + msg + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n at ' + stack[i].toString() + } + + return formatted + } + + if (caller) { + formatted += ' at ' + formatLocation(caller) + } + + return formatted +} + +/** + * Format deprecation message with color. + */ + +function formatColor (msg, caller, stack) { + var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan + ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow + ' \x1b[0m' + msg + '\x1b[39m' // reset + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n \x1b[36mat ' + stack[i].toString() + '\x1b[39m' // cyan + } + + return formatted + } + + if (caller) { + formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan + } + + return formatted +} + +/** + * Format call site location. + */ + +function formatLocation (callSite) { + return relative(basePath, callSite[0]) + + ':' + callSite[1] + + ':' + callSite[2] +} + +/** + * Get the stack as array of call sites. + */ + +function getStack () { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = Math.max(10, limit) + + // capture the stack + Error.captureStackTrace(obj) + + // slice this function off the top + var stack = obj.stack.slice(1) + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack +} + +/** + * Capture call site stack from v8. + */ + +function prepareObjectStackTrace (obj, stack) { + return stack +} + +/** + * Return a wrapped function in a deprecation message. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + var args = createArgumentsString(fn.length) + var stack = getStack() + var site = callSiteLocation(stack[1]) + + site.name = fn.name + + // eslint-disable-next-line no-new-func + var deprecatedfn = new Function('fn', 'log', 'deprecate', 'message', 'site', + '"use strict"\n' + + 'return function (' + args + ') {' + + 'log.call(deprecate, message, site)\n' + + 'return fn.apply(this, arguments)\n' + + '}')(fn, log, this, message, site) + + return deprecatedfn +} + +/** + * Wrap property in a deprecation message. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + // set site name + site.name = prop + + // convert data descriptor + if ('value' in descriptor) { + descriptor = convertDataDescriptorToAccessor(obj, prop, message) + } + + var get = descriptor.get + var set = descriptor.set + + // wrap getter + if (typeof get === 'function') { + descriptor.get = function getter () { + log.call(deprecate, message, site) + return get.apply(this, arguments) + } + } + + // wrap setter + if (typeof set === 'function') { + descriptor.set = function setter () { + log.call(deprecate, message, site) + return set.apply(this, arguments) + } + } + + Object.defineProperty(obj, prop, descriptor) +} + +/** + * Create DeprecationError for deprecation + */ + +function DeprecationError (namespace, message, stack) { + var error = new Error() + var stackString + + Object.defineProperty(error, 'constructor', { + value: DeprecationError + }) + + Object.defineProperty(error, 'message', { + configurable: true, + enumerable: false, + value: message, + writable: true + }) + + Object.defineProperty(error, 'name', { + enumerable: false, + configurable: true, + value: 'DeprecationError', + writable: true + }) + + Object.defineProperty(error, 'namespace', { + configurable: true, + enumerable: false, + value: namespace, + writable: true + }) + + Object.defineProperty(error, 'stack', { + configurable: true, + enumerable: false, + get: function () { + if (stackString !== undefined) { + return stackString + } + + // prepare stack trace + return (stackString = createStackString.call(this, stack)) + }, + set: function setter (val) { + stackString = val + } + }) + + return error +} diff --git a/tunestats/app/api/node_modules/depd/lib/browser/index.js b/tunestats/app/api/node_modules/depd/lib/browser/index.js new file mode 100644 index 0000000..6be45cc --- /dev/null +++ b/tunestats/app/api/node_modules/depd/lib/browser/index.js @@ -0,0 +1,77 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = depd + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + function deprecate (message) { + // no-op in browser + } + + deprecate._file = undefined + deprecate._ignored = true + deprecate._namespace = namespace + deprecate._traced = false + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Return a wrapped function in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + return fn +} + +/** + * Wrap property in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } +} diff --git a/tunestats/app/api/node_modules/depd/package.json b/tunestats/app/api/node_modules/depd/package.json new file mode 100644 index 0000000..3857e19 --- /dev/null +++ b/tunestats/app/api/node_modules/depd/package.json @@ -0,0 +1,45 @@ +{ + "name": "depd", + "description": "Deprecate all the things", + "version": "2.0.0", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "deprecate", + "deprecated" + ], + "repository": "dougwilson/nodejs-depd", + "browser": "lib/browser/index.js", + "devDependencies": { + "benchmark": "2.1.4", + "beautify-benchmark": "0.2.4", + "eslint": "5.7.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.14.0", + "eslint-plugin-markdown": "1.0.0-beta.7", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "5.2.0", + "safe-buffer": "5.1.2", + "uid-safe": "2.1.5" + }, + "files": [ + "lib/", + "History.md", + "LICENSE", + "index.js", + "Readme.md" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail test/", + "test-ci": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter spec test/ && istanbul report lcovonly text-summary", + "test-cov": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter dot test/ && istanbul report lcov text-summary" + } +} diff --git a/tunestats/app/api/node_modules/destroy/LICENSE b/tunestats/app/api/node_modules/destroy/LICENSE new file mode 100644 index 0000000..0e2c35f --- /dev/null +++ b/tunestats/app/api/node_modules/destroy/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2015-2022 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/tunestats/app/api/node_modules/destroy/README.md b/tunestats/app/api/node_modules/destroy/README.md new file mode 100644 index 0000000..e7701ae --- /dev/null +++ b/tunestats/app/api/node_modules/destroy/README.md @@ -0,0 +1,63 @@ +# destroy + +[![NPM version][npm-image]][npm-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +Destroy a stream. + +This module is meant to ensure a stream gets destroyed, handling different APIs +and Node.js bugs. + +## API + +```js +var destroy = require('destroy') +``` + +### destroy(stream [, suppress]) + +Destroy the given stream, and optionally suppress any future `error` events. + +In most cases, this is identical to a simple `stream.destroy()` call. The rules +are as follows for a given stream: + + 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()` + and add a listener to the `open` event to call `stream.close()` if it is + fired. This is for a Node.js bug that will leak a file descriptor if + `.destroy()` is called before `open`. + 2. If the `stream` is an instance of a zlib stream, then call `stream.destroy()` + and close the underlying zlib handle if open, otherwise call `stream.close()`. + This is for consistency across Node.js versions and a Node.js bug that will + leak a native zlib handle. + 3. If the `stream` is not an instance of `Stream`, then nothing happens. + 4. If the `stream` has a `.destroy()` method, then call it. + +The function returns the `stream` passed in as the argument. + +## Example + +```js +var destroy = require('destroy') + +var fs = require('fs') +var stream = fs.createReadStream('package.json') + +// ... and later +destroy(stream) +``` + +[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square +[npm-url]: https://npmjs.org/package/destroy +[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square +[github-url]: https://github.com/stream-utils/destroy/tags +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master +[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/destroy +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/stream-utils/destroy/ci/master?label=ci&style=flat-square +[github-actions-ci-url]: https://github.com/stream-utils/destroy/actions/workflows/ci.yml diff --git a/tunestats/app/api/node_modules/destroy/index.js b/tunestats/app/api/node_modules/destroy/index.js new file mode 100644 index 0000000..7fd5c09 --- /dev/null +++ b/tunestats/app/api/node_modules/destroy/index.js @@ -0,0 +1,209 @@ +/*! + * destroy + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015-2022 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var EventEmitter = require('events').EventEmitter +var ReadStream = require('fs').ReadStream +var Stream = require('stream') +var Zlib = require('zlib') + +/** + * Module exports. + * @public + */ + +module.exports = destroy + +/** + * Destroy the given stream, and optionally suppress any future `error` events. + * + * @param {object} stream + * @param {boolean} suppress + * @public + */ + +function destroy (stream, suppress) { + if (isFsReadStream(stream)) { + destroyReadStream(stream) + } else if (isZlibStream(stream)) { + destroyZlibStream(stream) + } else if (hasDestroy(stream)) { + stream.destroy() + } + + if (isEventEmitter(stream) && suppress) { + stream.removeAllListeners('error') + stream.addListener('error', noop) + } + + return stream +} + +/** + * Destroy a ReadStream. + * + * @param {object} stream + * @private + */ + +function destroyReadStream (stream) { + stream.destroy() + + if (typeof stream.close === 'function') { + // node.js core bug work-around + stream.on('open', onOpenClose) + } +} + +/** + * Close a Zlib stream. + * + * Zlib streams below Node.js 4.5.5 have a buggy implementation + * of .close() when zlib encountered an error. + * + * @param {object} stream + * @private + */ + +function closeZlibStream (stream) { + if (stream._hadError === true) { + var prop = stream._binding === null + ? '_binding' + : '_handle' + + stream[prop] = { + close: function () { this[prop] = null } + } + } + + stream.close() +} + +/** + * Destroy a Zlib stream. + * + * Zlib streams don't have a destroy function in Node.js 6. On top of that + * simply calling destroy on a zlib stream in Node.js 8+ will result in a + * memory leak. So until that is fixed, we need to call both close AND destroy. + * + * PR to fix memory leak: https://github.com/nodejs/node/pull/23734 + * + * In Node.js 6+8, it's important that destroy is called before close as the + * stream would otherwise emit the error 'zlib binding closed'. + * + * @param {object} stream + * @private + */ + +function destroyZlibStream (stream) { + if (typeof stream.destroy === 'function') { + // node.js core bug work-around + // istanbul ignore if: node.js 0.8 + if (stream._binding) { + // node.js < 0.10.0 + stream.destroy() + if (stream._processing) { + stream._needDrain = true + stream.once('drain', onDrainClearBinding) + } else { + stream._binding.clear() + } + } else if (stream._destroy && stream._destroy !== Stream.Transform.prototype._destroy) { + // node.js >= 12, ^11.1.0, ^10.15.1 + stream.destroy() + } else if (stream._destroy && typeof stream.close === 'function') { + // node.js 7, 8 + stream.destroyed = true + stream.close() + } else { + // fallback + // istanbul ignore next + stream.destroy() + } + } else if (typeof stream.close === 'function') { + // node.js < 8 fallback + closeZlibStream(stream) + } +} + +/** + * Determine if stream has destroy. + * @private + */ + +function hasDestroy (stream) { + return stream instanceof Stream && + typeof stream.destroy === 'function' +} + +/** + * Determine if val is EventEmitter. + * @private + */ + +function isEventEmitter (val) { + return val instanceof EventEmitter +} + +/** + * Determine if stream is fs.ReadStream stream. + * @private + */ + +function isFsReadStream (stream) { + return stream instanceof ReadStream +} + +/** + * Determine if stream is Zlib stream. + * @private + */ + +function isZlibStream (stream) { + return stream instanceof Zlib.Gzip || + stream instanceof Zlib.Gunzip || + stream instanceof Zlib.Deflate || + stream instanceof Zlib.DeflateRaw || + stream instanceof Zlib.Inflate || + stream instanceof Zlib.InflateRaw || + stream instanceof Zlib.Unzip +} + +/** + * No-op function. + * @private + */ + +function noop () {} + +/** + * On drain handler to clear binding. + * @private + */ + +// istanbul ignore next: node.js 0.8 +function onDrainClearBinding () { + this._binding.clear() +} + +/** + * On open handler to close stream. + * @private + */ + +function onOpenClose () { + if (typeof this.fd === 'number') { + // actually close down the fd + this.close() + } +} diff --git a/tunestats/app/api/node_modules/destroy/package.json b/tunestats/app/api/node_modules/destroy/package.json new file mode 100644 index 0000000..c85e438 --- /dev/null +++ b/tunestats/app/api/node_modules/destroy/package.json @@ -0,0 +1,48 @@ +{ + "name": "destroy", + "description": "destroy a stream if possible", + "version": "1.2.0", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com", + "twitter": "https://twitter.com/jongleberry" + }, + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "repository": "stream-utils/destroy", + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.2", + "nyc": "15.1.0" + }, + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "files": [ + "index.js", + "LICENSE" + ], + "keywords": [ + "stream", + "streams", + "destroy", + "cleanup", + "leak", + "fd" + ] +} diff --git a/tunestats/app/api/node_modules/dotenv/CHANGELOG.md b/tunestats/app/api/node_modules/dotenv/CHANGELOG.md new file mode 100644 index 0000000..e35152a --- /dev/null +++ b/tunestats/app/api/node_modules/dotenv/CHANGELOG.md @@ -0,0 +1,475 @@ +# Changelog + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +## [Unreleased](https://github.com/motdotla/dotenv/compare/v16.4.5...master) + +## [16.4.5](https://github.com/motdotla/dotenv/compare/v16.4.4...v16.4.5) (2024-02-19) + +### Changed + +- 🐞 fix recent regression when using `path` option. return to historical behavior: do not attempt to auto find `.env` if `path` set. (regression was introduced in `16.4.3`) [#814](https://github.com/motdotla/dotenv/pull/814) + +## [16.4.4](https://github.com/motdotla/dotenv/compare/v16.4.3...v16.4.4) (2024-02-13) + +### Changed + +- 🐞 Replaced chaining operator `?.` with old school `&&` (fixing node 12 failures) [#812](https://github.com/motdotla/dotenv/pull/812) + +## [16.4.3](https://github.com/motdotla/dotenv/compare/v16.4.2...v16.4.3) (2024-02-12) + +### Changed + +- Fixed processing of multiple files in `options.path` [#805](https://github.com/motdotla/dotenv/pull/805) + +## [16.4.2](https://github.com/motdotla/dotenv/compare/v16.4.1...v16.4.2) (2024-02-10) + +### Changed + +- Changed funding link in package.json to [`dotenvx.com`](https://dotenvx.com) + +## [16.4.1](https://github.com/motdotla/dotenv/compare/v16.4.0...v16.4.1) (2024-01-24) + +- Patch support for array as `path` option [#797](https://github.com/motdotla/dotenv/pull/797) + +## [16.4.0](https://github.com/motdotla/dotenv/compare/v16.3.2...v16.4.0) (2024-01-23) + +- Add `error.code` to error messages around `.env.vault` decryption handling [#795](https://github.com/motdotla/dotenv/pull/795) +- Add ability to find `.env.vault` file when filename(s) passed as an array [#784](https://github.com/motdotla/dotenv/pull/784) + +## [16.3.2](https://github.com/motdotla/dotenv/compare/v16.3.1...v16.3.2) (2024-01-18) + +### Added + +- Add debug message when no encoding set [#735](https://github.com/motdotla/dotenv/pull/735) + +### Changed + +- Fix output typing for `populate` [#792](https://github.com/motdotla/dotenv/pull/792) +- Use subarray instead of slice [#793](https://github.com/motdotla/dotenv/pull/793) + +## [16.3.1](https://github.com/motdotla/dotenv/compare/v16.3.0...v16.3.1) (2023-06-17) + +### Added + +- Add missing type definitions for `processEnv` and `DOTENV_KEY` options. [#756](https://github.com/motdotla/dotenv/pull/756) + +## [16.3.0](https://github.com/motdotla/dotenv/compare/v16.2.0...v16.3.0) (2023-06-16) + +### Added + +- Optionally pass `DOTENV_KEY` to options rather than relying on `process.env.DOTENV_KEY`. Defaults to `process.env.DOTENV_KEY` [#754](https://github.com/motdotla/dotenv/pull/754) + +## [16.2.0](https://github.com/motdotla/dotenv/compare/v16.1.4...v16.2.0) (2023-06-15) + +### Added + +- Optionally write to your own target object rather than `process.env`. Defaults to `process.env`. [#753](https://github.com/motdotla/dotenv/pull/753) +- Add import type URL to types file [#751](https://github.com/motdotla/dotenv/pull/751) + +## [16.1.4](https://github.com/motdotla/dotenv/compare/v16.1.3...v16.1.4) (2023-06-04) + +### Added + +- Added `.github/` to `.npmignore` [#747](https://github.com/motdotla/dotenv/pull/747) + +## [16.1.3](https://github.com/motdotla/dotenv/compare/v16.1.2...v16.1.3) (2023-05-31) + +### Removed + +- Removed `browser` keys for `path`, `os`, and `crypto` in package.json. These were set to false incorrectly as of 16.1. Instead, if using dotenv on the front-end make sure to include polyfills for `path`, `os`, and `crypto`. [node-polyfill-webpack-plugin](https://github.com/Richienb/node-polyfill-webpack-plugin) provides these. + +## [16.1.2](https://github.com/motdotla/dotenv/compare/v16.1.1...v16.1.2) (2023-05-31) + +### Changed + +- Exposed private function `_configDotenv` as `configDotenv`. [#744](https://github.com/motdotla/dotenv/pull/744) + +## [16.1.1](https://github.com/motdotla/dotenv/compare/v16.1.0...v16.1.1) (2023-05-30) + +### Added + +- Added type definition for `decrypt` function + +### Changed + +- Fixed `{crypto: false}` in `packageJson.browser` + +## [16.1.0](https://github.com/motdotla/dotenv/compare/v16.0.3...v16.1.0) (2023-05-30) + +### Added + +- Add `populate` convenience method [#733](https://github.com/motdotla/dotenv/pull/733) +- Accept URL as path option [#720](https://github.com/motdotla/dotenv/pull/720) +- Add dotenv to `npm fund` command +- Spanish language README [#698](https://github.com/motdotla/dotenv/pull/698) +- Add `.env.vault` support. 🎉 ([#730](https://github.com/motdotla/dotenv/pull/730)) + +ℹ️ `.env.vault` extends the `.env` file format standard with a localized encrypted vault file. Package it securely with your production code deploys. It's cloud agnostic so that you can deploy your secrets anywhere – without [risky third-party integrations](https://techcrunch.com/2023/01/05/circleci-breach/). [read more](https://github.com/motdotla/dotenv#-deploying) + +### Changed + +- Fixed "cannot resolve 'fs'" error on tools like Replit [#693](https://github.com/motdotla/dotenv/pull/693) + +## [16.0.3](https://github.com/motdotla/dotenv/compare/v16.0.2...v16.0.3) (2022-09-29) + +### Changed + +- Added library version to debug logs ([#682](https://github.com/motdotla/dotenv/pull/682)) + +## [16.0.2](https://github.com/motdotla/dotenv/compare/v16.0.1...v16.0.2) (2022-08-30) + +### Added + +- Export `env-options.js` and `cli-options.js` in package.json for use with downstream [dotenv-expand](https://github.com/motdotla/dotenv-expand) module + +## [16.0.1](https://github.com/motdotla/dotenv/compare/v16.0.0...v16.0.1) (2022-05-10) + +### Changed + +- Minor README clarifications +- Development ONLY: updated devDependencies as recommended for development only security risks ([#658](https://github.com/motdotla/dotenv/pull/658)) + +## [16.0.0](https://github.com/motdotla/dotenv/compare/v15.0.1...v16.0.0) (2022-02-02) + +### Added + +- _Breaking:_ Backtick support 🎉 ([#615](https://github.com/motdotla/dotenv/pull/615)) + +If you had values containing the backtick character, please quote those values with either single or double quotes. + +## [15.0.1](https://github.com/motdotla/dotenv/compare/v15.0.0...v15.0.1) (2022-02-02) + +### Changed + +- Properly parse empty single or double quoted values 🐞 ([#614](https://github.com/motdotla/dotenv/pull/614)) + +## [15.0.0](https://github.com/motdotla/dotenv/compare/v14.3.2...v15.0.0) (2022-01-31) + +`v15.0.0` is a major new release with some important breaking changes. + +### Added + +- _Breaking:_ Multiline parsing support (just works. no need for the flag.) + +### Changed + +- _Breaking:_ `#` marks the beginning of a comment (UNLESS the value is wrapped in quotes. Please update your `.env` files to wrap in quotes any values containing `#`. For example: `SECRET_HASH="something-with-a-#-hash"`). + +..Understandably, (as some teams have noted) this is tedious to do across the entire team. To make it less tedious, we recommend using [dotenv cli](https://github.com/dotenv-org/cli) going forward. It's an optional plugin that will keep your `.env` files in sync between machines, environments, or team members. + +### Removed + +- _Breaking:_ Remove multiline option (just works out of the box now. no need for the flag.) + +## [14.3.2](https://github.com/motdotla/dotenv/compare/v14.3.1...v14.3.2) (2022-01-25) + +### Changed + +- Preserve backwards compatibility on values containing `#` 🐞 ([#603](https://github.com/motdotla/dotenv/pull/603)) + +## [14.3.1](https://github.com/motdotla/dotenv/compare/v14.3.0...v14.3.1) (2022-01-25) + +### Changed + +- Preserve backwards compatibility on exports by re-introducing the prior in-place exports 🐞 ([#606](https://github.com/motdotla/dotenv/pull/606)) + +## [14.3.0](https://github.com/motdotla/dotenv/compare/v14.2.0...v14.3.0) (2022-01-24) + +### Added + +- Add `multiline` option 🎉 ([#486](https://github.com/motdotla/dotenv/pull/486)) + +## [14.2.0](https://github.com/motdotla/dotenv/compare/v14.1.1...v14.2.0) (2022-01-17) + +### Added + +- Add `dotenv_config_override` cli option +- Add `DOTENV_CONFIG_OVERRIDE` command line env option + +## [14.1.1](https://github.com/motdotla/dotenv/compare/v14.1.0...v14.1.1) (2022-01-17) + +### Added + +- Add React gotcha to FAQ on README + +## [14.1.0](https://github.com/motdotla/dotenv/compare/v14.0.1...v14.1.0) (2022-01-17) + +### Added + +- Add `override` option 🎉 ([#595](https://github.com/motdotla/dotenv/pull/595)) + +## [14.0.1](https://github.com/motdotla/dotenv/compare/v14.0.0...v14.0.1) (2022-01-16) + +### Added + +- Log error on failure to load `.env` file ([#594](https://github.com/motdotla/dotenv/pull/594)) + +## [14.0.0](https://github.com/motdotla/dotenv/compare/v13.0.1...v14.0.0) (2022-01-16) + +### Added + +- _Breaking:_ Support inline comments for the parser 🎉 ([#568](https://github.com/motdotla/dotenv/pull/568)) + +## [13.0.1](https://github.com/motdotla/dotenv/compare/v13.0.0...v13.0.1) (2022-01-16) + +### Changed + +* Hide comments and newlines from debug output ([#404](https://github.com/motdotla/dotenv/pull/404)) + +## [13.0.0](https://github.com/motdotla/dotenv/compare/v12.0.4...v13.0.0) (2022-01-16) + +### Added + +* _Breaking:_ Add type file for `config.js` ([#539](https://github.com/motdotla/dotenv/pull/539)) + +## [12.0.4](https://github.com/motdotla/dotenv/compare/v12.0.3...v12.0.4) (2022-01-16) + +### Changed + +* README updates +* Minor order adjustment to package json format + +## [12.0.3](https://github.com/motdotla/dotenv/compare/v12.0.2...v12.0.3) (2022-01-15) + +### Changed + +* Simplified jsdoc for consistency across editors + +## [12.0.2](https://github.com/motdotla/dotenv/compare/v12.0.1...v12.0.2) (2022-01-15) + +### Changed + +* Improve embedded jsdoc type documentation + +## [12.0.1](https://github.com/motdotla/dotenv/compare/v12.0.0...v12.0.1) (2022-01-15) + +### Changed + +* README updates and clarifications + +## [12.0.0](https://github.com/motdotla/dotenv/compare/v11.0.0...v12.0.0) (2022-01-15) + +### Removed + +- _Breaking:_ drop support for Flow static type checker ([#584](https://github.com/motdotla/dotenv/pull/584)) + +### Changed + +- Move types/index.d.ts to lib/main.d.ts ([#585](https://github.com/motdotla/dotenv/pull/585)) +- Typescript cleanup ([#587](https://github.com/motdotla/dotenv/pull/587)) +- Explicit typescript inclusion in package.json ([#566](https://github.com/motdotla/dotenv/pull/566)) + +## [11.0.0](https://github.com/motdotla/dotenv/compare/v10.0.0...v11.0.0) (2022-01-11) + +### Changed + +- _Breaking:_ drop support for Node v10 ([#558](https://github.com/motdotla/dotenv/pull/558)) +- Patch debug option ([#550](https://github.com/motdotla/dotenv/pull/550)) + +## [10.0.0](https://github.com/motdotla/dotenv/compare/v9.0.2...v10.0.0) (2021-05-20) + +### Added + +- Add generic support to parse function +- Allow for import "dotenv/config.js" +- Add support to resolve home directory in path via ~ + +## [9.0.2](https://github.com/motdotla/dotenv/compare/v9.0.1...v9.0.2) (2021-05-10) + +### Changed + +- Support windows newlines with debug mode + +## [9.0.1](https://github.com/motdotla/dotenv/compare/v9.0.0...v9.0.1) (2021-05-08) + +### Changed + +- Updates to README + +## [9.0.0](https://github.com/motdotla/dotenv/compare/v8.6.0...v9.0.0) (2021-05-05) + +### Changed + +- _Breaking:_ drop support for Node v8 + +## [8.6.0](https://github.com/motdotla/dotenv/compare/v8.5.1...v8.6.0) (2021-05-05) + +### Added + +- define package.json in exports + +## [8.5.1](https://github.com/motdotla/dotenv/compare/v8.5.0...v8.5.1) (2021-05-05) + +### Changed + +- updated dev dependencies via npm audit + +## [8.5.0](https://github.com/motdotla/dotenv/compare/v8.4.0...v8.5.0) (2021-05-05) + +### Added + +- allow for `import "dotenv/config"` + +## [8.4.0](https://github.com/motdotla/dotenv/compare/v8.3.0...v8.4.0) (2021-05-05) + +### Changed + +- point to exact types file to work with VS Code + +## [8.3.0](https://github.com/motdotla/dotenv/compare/v8.2.0...v8.3.0) (2021-05-05) + +### Changed + +- _Breaking:_ drop support for Node v8 (mistake to be released as minor bump. later bumped to 9.0.0. see above.) + +## [8.2.0](https://github.com/motdotla/dotenv/compare/v8.1.0...v8.2.0) (2019-10-16) + +### Added + +- TypeScript types + +## [8.1.0](https://github.com/motdotla/dotenv/compare/v8.0.0...v8.1.0) (2019-08-18) + +### Changed + +- _Breaking:_ drop support for Node v6 ([#392](https://github.com/motdotla/dotenv/issues/392)) + +# [8.0.0](https://github.com/motdotla/dotenv/compare/v7.0.0...v8.0.0) (2019-05-02) + +### Changed + +- _Breaking:_ drop support for Node v6 ([#302](https://github.com/motdotla/dotenv/issues/392)) + +## [7.0.0] - 2019-03-12 + +### Fixed + +- Fix removing unbalanced quotes ([#376](https://github.com/motdotla/dotenv/pull/376)) + +### Removed + +- Removed `load` alias for `config` for consistency throughout code and documentation. + +## [6.2.0] - 2018-12-03 + +### Added + +- Support preload configuration via environment variables ([#351](https://github.com/motdotla/dotenv/issues/351)) + +## [6.1.0] - 2018-10-08 + +### Added + +- `debug` option for `config` and `parse` methods will turn on logging + +## [6.0.0] - 2018-06-02 + +### Changed + +- _Breaking:_ drop support for Node v4 ([#304](https://github.com/motdotla/dotenv/pull/304)) + +## [5.0.0] - 2018-01-29 + +### Added + +- Testing against Node v8 and v9 +- Documentation on trim behavior of values +- Documentation on how to use with `import` + +### Changed + +- _Breaking_: default `path` is now `path.resolve(process.cwd(), '.env')` +- _Breaking_: does not write over keys already in `process.env` if the key has a falsy value +- using `const` and `let` instead of `var` + +### Removed + +- Testing against Node v7 + +## [4.0.0] - 2016-12-23 + +### Changed + +- Return Object with parsed content or error instead of false ([#165](https://github.com/motdotla/dotenv/pull/165)). + +### Removed + +- `verbose` option removed in favor of returning result. + +## [3.0.0] - 2016-12-20 + +### Added + +- `verbose` option will log any error messages. Off by default. +- parses email addresses correctly +- allow importing config method directly in ES6 + +### Changed + +- Suppress error messages by default ([#154](https://github.com/motdotla/dotenv/pull/154)) +- Ignoring more files for NPM to make package download smaller + +### Fixed + +- False positive test due to case-sensitive variable ([#124](https://github.com/motdotla/dotenv/pull/124)) + +### Removed + +- `silent` option removed in favor of `verbose` + +## [2.0.0] - 2016-01-20 + +### Added + +- CHANGELOG to ["make it easier for users and contributors to see precisely what notable changes have been made between each release"](http://keepachangelog.com/). Linked to from README +- LICENSE to be more explicit about what was defined in `package.json`. Linked to from README +- Testing nodejs v4 on travis-ci +- added examples of how to use dotenv in different ways +- return parsed object on success rather than boolean true + +### Changed + +- README has shorter description not referencing ruby gem since we don't have or want feature parity + +### Removed + +- Variable expansion and escaping so environment variables are encouraged to be fully orthogonal + +## [1.2.0] - 2015-06-20 + +### Added + +- Preload hook to require dotenv without including it in your code + +### Changed + +- clarified license to be "BSD-2-Clause" in `package.json` + +### Fixed + +- retain spaces in string vars + +## [1.1.0] - 2015-03-31 + +### Added + +- Silent option to silence `console.log` when `.env` missing + +## [1.0.0] - 2015-03-13 + +### Removed + +- support for multiple `.env` files. should always use one `.env` file for the current environment + +[7.0.0]: https://github.com/motdotla/dotenv/compare/v6.2.0...v7.0.0 +[6.2.0]: https://github.com/motdotla/dotenv/compare/v6.1.0...v6.2.0 +[6.1.0]: https://github.com/motdotla/dotenv/compare/v6.0.0...v6.1.0 +[6.0.0]: https://github.com/motdotla/dotenv/compare/v5.0.0...v6.0.0 +[5.0.0]: https://github.com/motdotla/dotenv/compare/v4.0.0...v5.0.0 +[4.0.0]: https://github.com/motdotla/dotenv/compare/v3.0.0...v4.0.0 +[3.0.0]: https://github.com/motdotla/dotenv/compare/v2.0.0...v3.0.0 +[2.0.0]: https://github.com/motdotla/dotenv/compare/v1.2.0...v2.0.0 +[1.2.0]: https://github.com/motdotla/dotenv/compare/v1.1.0...v1.2.0 +[1.1.0]: https://github.com/motdotla/dotenv/compare/v1.0.0...v1.1.0 +[1.0.0]: https://github.com/motdotla/dotenv/compare/v0.4.0...v1.0.0 diff --git a/tunestats/app/api/node_modules/dotenv/LICENSE b/tunestats/app/api/node_modules/dotenv/LICENSE new file mode 100644 index 0000000..c430ad8 --- /dev/null +++ b/tunestats/app/api/node_modules/dotenv/LICENSE @@ -0,0 +1,23 @@ +Copyright (c) 2015, Scott Motte +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this + list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/tunestats/app/api/node_modules/dotenv/README-es.md b/tunestats/app/api/node_modules/dotenv/README-es.md new file mode 100644 index 0000000..154c139 --- /dev/null +++ b/tunestats/app/api/node_modules/dotenv/README-es.md @@ -0,0 +1,448 @@ +
+🎉 announcing dotenvx. run anywhere, multi-environment, encrypted envs. +
+ +  + +
+ +

+ + Dotenv es apoyado por la comunidad. + +

+Gracias espaciales a: +
+
+ +
+ Warp +
+ Warp es una rápida e impresionante terminal basada en Rust, reinventado para funcionar como una aplicación moderna. +
+ Haga más en la CLI con edición de texto real, resultado básado en bloques, y busqueda de comandos de IA. +
+ +
+ +
+ Retool +
+ Retool ayuda a los desarrolladores a crear software interno personalizado, como aplicaciones CRUD y paneles de administración, realmente rápido. +
+ Construya Interfaces de Usuario de forma visual con componentes flexibles, conéctese a cualquier fuente de datos, y escriba lógica de negocio en JavaScript. +
+ +
+ +
+ WorkOS +
+ Su Apliación, Lista para la Empresa. +
+ Agrega Inicio de Sesión Único, Autenticación Multi-Factor, y mucho más, en minutos en lugar de meses. +
+ +
+
+
+
+
+ +
+ +# dotenv [![NPM version](https://img.shields.io/npm/v/dotenv.svg?style=flat-square)](https://www.npmjs.com/package/dotenv) + +dotenv + +Dotenv es un módulo de dependencia cero que carga las variables de entorno desde un archivo `.env` en [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env). El almacenamiento de la configuración del entorno separado del código está basado en la metodología [The Twelve-Factor App](http://12factor.net/config). + +[![js-standard-style](https://img.shields.io/badge/code%20style-standard-brightgreen.svg?style=flat-square)](https://github.com/feross/standard) +[![LICENSE](https://img.shields.io/github/license/motdotla/dotenv.svg)](LICENSE) + +## Instalación + +```bash +# instalación local (recomendado) +npm install dotenv --save +``` + +O installación con yarn? `yarn add dotenv` + +## Uso + +Cree un archivo `.env` en la raíz de su proyecto: + +```dosini +S3_BUCKET="YOURS3BUCKET" +SECRET_KEY="YOURSECRETKEYGOESHERE" +``` + +Tan prónto como sea posible en su aplicación, importe y configure dotenv: + +```javascript +require('dotenv').config() +console.log(process.env) // elimine esto después que haya confirmado que esta funcionando +``` + +.. o usa ES6? + +```javascript +import * as dotenv from 'dotenv' // vea en https://github.com/motdotla/dotenv#como-uso-dotenv-con-import +// REVISAR LINK DE REFERENCIA DE IMPORTACIÓN +dotenv.config() +import express from 'express' +``` + +Eso es todo. `process.env` ahora tiene las claves y los valores que definiste en tu archivo `.env`: + +```javascript +require('dotenv').config() + +... + +s3.getBucketCors({Bucket: process.env.S3_BUCKET}, function(err, data) {}) +``` + +### Valores multilínea + +Si necesita variables de varias líneas, por ejemplo, claves privadas, ahora se admiten en la versión (`>= v15.0.0`) con saltos de línea: + +```dosini +PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY----- +... +Kh9NV... +... +-----END RSA PRIVATE KEY-----" +``` + +Alternativamente, puede usar comillas dobles y usar el carácter `\n`: + +```dosini +PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----\nKh9NV...\n-----END RSA PRIVATE KEY-----\n" +``` + +### Comentarios + +Los comentarios pueden ser agregados en tu archivo o en la misma línea: + +```dosini +# This is a comment +SECRET_KEY=YOURSECRETKEYGOESHERE # comment +SECRET_HASH="something-with-a-#-hash" +``` + +Los comentarios comienzan donde existe un `#`, entonces, si su valor contiene un `#`, enciérrelo entre comillas. Este es un cambio importante desde la versión `>= v15.0.0` en adelante. + +### Análisis + +El motor que analiza el contenido de su archivo que contiene variables de entorno está disponible para su uso. Este Acepta una Cadena o un Búfer y devolverá un Objeto con las claves y los valores analizados. + +```javascript +const dotenv = require('dotenv') +const buf = Buffer.from('BASICO=basico') +const config = dotenv.parse(buf) // devolverá un objeto +console.log(typeof config, config) // objeto { BASICO : 'basico' } +``` + +### Precarga + +Puede usar el `--require` (`-r`) [opción de línea de comando](https://nodejs.org/api/cli.html#-r---require-module) para precargar dotenv. Al hacer esto, no necesita requerir ni cargar dotnev en el código de su aplicación. + +```bash +$ node -r dotenv/config tu_script.js +``` + +Las opciones de configuración a continuación se admiten como argumentos de línea de comandos en el formato `dotenv_config_